1
What is the perimeter of a rectangle with a length of 8 feet and a width of 6:
6² feet?
6
14. feet
9
○ 16²/2
16 feet
O 29 feet
29-
6
O 3
48- feet
18

Answers

Answer 1

The perimeter of a rectangle with given length and width is 28 feet.

What is the perimeter of a rectangle?

The perimeter of a rectangle is the total distance of its outer boundary. It is twice the sum of its length and width and it is calculated with the help of the formula: Perimeter = 2(length + width).

Given that, length of a rectangle = 8 feet and the width of a rectangle = 6 feet.

Here, perimeter= 2(8+6)

= 2×14

= 28 feet

Therefore, the perimeter of a rectangle is 28 feet.

To learn more about the perimeter of a rectangle visit:

https://brainly.com/question/15287805.

#SPJ9


Related Questions

Sketch and graph please

Answers

We have drawn the graph for the given inequality.

What is inequality?

Inequality is a mathematical statement that compares two values or expressions and shows their relative size. It is represented by the symbols >, <, ≥, or ≤, which respectively mean "greater than", "less than", "greater than or equal to", and "less than or equal to". Inequalities can also include variables and can be used to describe a range of possible values for that variable.

For the given inequality y ≤ 3/5x-5

we can draw the graph as shown below:

Hence, we have drawn the graph for the given inequality.

To learn more about the inequalities, visit:

https://brainly.com/question/25275758

#SPJ1

Fatima has a total of​ $8 to spend to make fruit smoothies. She will use two types of fruit. The table to the right shows the cost of each type of fruit per cup.

For the mango and pineapple​ mixture, find a linear equation in standard form that models how much mango and pineapple she can​ buy, where x is cups of mango and y is cups of pineapple.


Mango=0.50
Pineapple=0.75
Strawberry=1.00

Answers

Answer:

0.75y + 0.5x = 8.00

Step-by-step explanation:

In what time will the simple interest on Rs7560 be Rs1102. 50 at 25/4% per annum

Answers

The simple interest on Rs 7560 will be Rs 1102.50 at a rate of 25/4% per annum after approximately 1 month (0.09 years).

Simple interest is a type of interest that is calculated only on the principal amount of a loan or investment, and not on any accumulated interest. It is usually calculated as a percentage of the principal amount, multiplied by the time period for which the interest is being calculated.

We can use the formula for simple interest to solve this problem:

Simple Interest (SI) = Principal (P) x Rate (R) x Time (T)

We know that the principal is Rs 7560, the rate is 25/4% per annum, and the interest is Rs 1102.50. Substituting these values into the formula, we get:

1102.50 = 7560 x (25/4) x T

Simplifying:

1102.50 = 47250T/4

Multiplying both sides by 4 to eliminate the fraction:

1102.50 x 4 = 47250T

4410 = 47250T

Dividing both sides by 47250:

T = 4410/47250

T = 0.093 or approximately 0.09 years.

To convert this to months or days, we can multiply by 12 or 365, respectively.

To learn more about simple interest click on,

https://brainly.com/question/27976154

#SPJ4

Simplify: √-363
○ -11√/3
11i
33i
○ 11i√√3

Answers

Answer:
11i√√3

Step-by-step explanation:

F.E.O.L. Perpendicular to a Given Line
Write the slope-intercept form of the equation of the line described.
1) through: (-2,-3), perp. to y=-x
5
3) through: (2,-2), perp. to y=-
2) through: (5,-2), perp. to y = 5x +4
4) through: (-4,-3), perp. to y=-x+2

Answers

The equation of the line are;

a. y = 5/2x + 2

b. y = -1/5x - 1

c. y = -5/2x - 3

d. y = -x - 7

What is the slope intercept form of the line

a.

The line passes through point (-2, -3) and it is perpendicular to y = -2/5x

The equation of the line is y = 5/2x + 2

b.

The line passes through the point (5, -2) and it is perpendicular to y = 5x + 4

The equation of the line is y = -1/5x - 1

c.

The line passes through (-2, 2) and it is perpendicular to y = 2/5x - 4

Th equation of the line is y = -5/2x - 3

d.

The line passes through (-4, -3) and it is perpendicular to y = -x + 2

The equation of line is y = -x - 7

Learn more on equation of perpendicular line here;

https://brainly.com/question/6910525

#SPJ1

A sea horse weighs 42oz. Together, 3 sea monkeys and a sea horse weighs the same as 8 sea monkeys plus 9oz. How much does a sea monkey weigh?​

Answers

Answer:

a sea monkey weighs 6.6oz

Step-by-step explanation:

Simplify.
(5x-2+3x²)+(4x+3)
O 3x² +9x-1
O 12x4 +1
O 3x²+x+5
O 3x² +9x+1

Answers

The simplified version is: 3x^2 + 9x +1

Answer:

3x² + 9x + 1

Step-by-step explanation:

5x - 2 + 3x² + 4x + 3

= 9x - 2 + 3x² + 3

= 9x + 1 + 3x²

= 3x² + 9x + 1

take your time in 2-6

Answers

For #5 55 would come next and for #6 37 would come next. Hope that was helpful!

QUESTION FOR FOR LIH04

Answers

D. Stop motion. Stop motion is a form of animation where objects are moved in small increments between individual frames, creating the illusion of movement when the frames are played in sequence. This is the technique that Mario is using to animate his spoon.

2. 20 m 24 m 24 26 m​

Answers

Note that the body starts "with an initial velocity and moves with uniform acceleration."(Option C)

What is Acceleration?

In mechanics, acceleration is defined as the rate of change of an object's velocity with respect to time. Vector quantities are accelerations. The orientation of an object's acceleration is determined by the orientation of its net force.

The distance covered by the particle in nth second

Sₙ = u + a/2(2n-1)

S₈ = 20m

S₈ = u + a/2(2x(8-1)

20 = u + 7.5a ...................()

S₉ = 22 = u + a/2(2*9-1)

22 = u + 8.5a ..................(2)

By solving equations 1 and 2 we have :

u=5m/s , a=2m/s²

Thus,

S₁₀ = u+ a/2(2*10-1)

S₁₀ = 5 + 1/2 * 2 (2 * 10-1)

S₁₀ = 5 + 19

S₁₀ = 24m

Thus, it is correct to state that the body starts with the initial velocity and moves with uniform acceleration, and the correct option is C.

Learn more about Acceleration:
https://brainly.com/question/12550364
#SPJ1

Full Question:

A body covers 20 m, 22 m, 24 m, in 8th, 9th, and 10th seconds respectively. The body starts:

from rest and moves with uniform velocity.

from rest and moves with uniform acceleration.

with an initial velocity and moves with uniform acceleration.

with an initial velocity and moves with uniform velocity.

. Solve for n.

scale: 1 1/2 inches: 250 miles
scale measure: 3/4 inches
actual measure: n miles

A. 100 miles
B. 125 miles
C. 187 1/2 miles
D. 281 1/4 miles

Answers

Answer:

C) 187 1/2 miles

Step-by-step explanation:

We can start by using the formula for converting between scale measure and actual measure:

actual measure = scale measure * (actual distance / scale distance)

Here, the scale measure is 3/4 inch and the scale distance is 1 1/2 inches, so:

actual measure = (3/4) * (n / 250)

Rearranging the equation, we can isolate n:

n = (actual measure * 250) / (3/4)

Substituting in the actual measure of 3/4 inch, we find:

n = (3/4 * 250) / (3/4) = 250 miles

So the answer is C) 187 1/2 miles.

Step 3: Apply the slope formula: m =
2-3
-1-6
m=
(1/5)
(-1/7)
(1/7)
32-).
X2 X1

Answers

The slope formula is m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are two points on the line and m is the slope of the line. To use the formula, you need to know the coordinates of two points on the line. If you have the coordinates of two points, you can substitute them into the formula to find the slope.

how many three-digit numbers can be formed from the digits 0, 1, 2, 3, 4, 5, and 6 if each digit can be used only once? how many of these are odd numbers? how many are greater than 330?

Answers

By using the concept of combinations, we have determined that there are 210 three-digit numbers that can be formed using the digits 0-6 without repeating any of them. Among them, there are 90 odd numbers and 120 numbers greater than 330.

Combinations are a fundamental concept in mathematics, particularly in the field of combinatorics, which deals with counting and arranging objects.

To solve this problem, we can use the concept of combinations, which is a way of counting the number of ways we can choose k items from a set of n items. In this case, we want to find the number of three-digit numbers we can form from the set {0, 1, 2, 3, 4, 5, 6}, without repeating any of the digits.

First, we can determine the number of ways we can choose the first digit. Since there are seven digits to choose from, we have 7 options for the first digit.

Next, we can determine the number of ways we can choose the second digit. Since we have already used one of the digits, we only have 6 options left for the second digit.

Finally, we can determine the number of ways we can choose the third digit. Since we have used two of the digits, we only have 5 options left for the third digit.

Therefore, the total number of three-digit numbers we can form is given by the product of the number of choices for each digit:

7 x 6 x 5 = 210

So there are 210 different three-digit numbers that can be formed using the digits 0, 1, 2, 3, 4, 5, and 6, without repeating any of the digits.

To find the number of odd numbers, we need to consider that the last digit must be either 1, 3, or 5, since these are the only odd digits in the set. We can choose the first two digits in the same way as before, and then choose one of the three odd digits for the last digit. Therefore, the number of odd three-digit numbers is:

6 x 5 x 3 = 90

To find the number of three-digit numbers greater than 330, we need to consider that the first digit must be either 3, 4, 5, or 6. We can choose the first digit in 4 ways, and then choose the remaining two digits as before. Therefore, the number of three-digit numbers greater than 330 is:

4 x 6 x 5 = 120

To know more about combination here.

https://brainly.com/question/28998705

#SPJ4

A cable company charges an installation fee to install cable at a residence. There is also a monthly fee for the cable service. The total cost for months 2, 4, 6 and 8 are $145, $255, $365, and $475, respectively. How much is the installation fee? Assume that the relationship between the two quantities is linear

Answers

$13,000 and $15,000.

mark brainlyest

the probability that it will rain tomorrow is 0.3. if it rains tomorrow, the probability that it will rain on the following day is 0.9. if it does not rain tomorrow, the probability that it will rain on the following day is 0.08. round your answers to three decimal places.

Answers

the probability that it will rain on the following day, given that it rained tomorrow, is 0.75. Rounded to three decimal places, the answer is 0.750.

Given the probabilities, you can use Bayes' theorem to calculate the probability that it will rain on the following day, given that it rained tomorrow. Bayes' theorem states that: P(A|B) = P(B|A) * P(A) / P(B)

Where: P(A|B) is the likelihood that event A will occur assuming event B has already happened. P(B|A) is the probability of event B given that event A has occurred. The prior probability of event A is P(A). The prior probability of event B is P(B).

In this case, let A be the event that it rains on the following day and B be the event that it rains tomorrow.

So, P(A|B) = P(B|A) * P(A) / P(B) = 0.9 * 0.3 / P(B)

To calculate P(B), you can use the total probability theorem:

P(B) = P(B|A) * P(A) + P(B|~A) * P(~A) = 0.9 * 0.3 + 0.08 * 0.7 = 0.327

Now, you can substitute the values into the formula for P(A|B) to get:

P(A|B) = 0.9 * 0.3 / 0.327 = 0.75

So, the probability that it will rain on the following day, given that it rained tomorrow, is 0.75. Rounded to three decimal places, the answer is 0.750.

To learn more about Bayes' theorem click here

brainly.com/question/17010130

#SPJ4

1 13. In the first few days of its life, the length of an earthworm I is thought to be proportional to the square root of the number of hours n which have elapsed since its birth. If a worm is 2 cm long after 1 hour, how long will it be after 4 hours? How long will it take to grow to a length of 14 cm?​

Answers

The length of earthworm will be 4 cm after 4 hours. And the length is 14 cm after 49 hours.

What is meant by Proportion?

Proportions are defined when two or more ratios are made to be equal to each other.

Two quantities are said to be directly proportional if a positive change in one quantity also lead to a positive change in the other quantity.

If a is proportional to b, we denote it as a ∝ b.

Given,

Length of an earthworm, l ∝ square root of the number of hours, n, which have elapsed since it's birth.

l ∝ √n

l = k √n, for some constant k.

If a worm is 2 cm long after 1 hour, we can write it as,

2 = k × √1

⇒ k = 2

So the proportionality constant is 2.

After 4 hours,

l = k √4

l = 2 × 2 = 4 cm

If the length is 14 cm,

14 = 2 √n

√n = 14 / 2

√n = 7

n = 7² = 49 hours

Hence the length of worm is 4 cm after 4 hours. It will take 49 hours to grow to a length of 14 cm.

Learn more about Proportional Relationships here :

https://brainly.com/question/15785739

#SPJ9

jack's favorite number is 836. jill subtracts a secret number from 836 and her answer is the smallest possible combination of all the digits from jack's favorite number. what is the secret number?

Answers

The secret number is 564 as we solve it by given question.

jack's favorite number is 836 so here we have number 836 and

jill subtracts a secret number from 836 and her answer is the smallest possible combination of all the digits from jack's favorite number

so here we have a number 836

let we subtract x from 836 to get a number which is smallest number by using 836

the number which we can make by using these 3 degits are

368, 386, 638, 683, 836, 863 anf from all these numbers the smallest number which can be using 836 is 368

as given in question we have 836 and we will subtract x and get 368 so

836 - x = 368

x = 836 - 368

x = 564

the secrets number is 564.

know more about smallest numbers click here;

https://brainly.com/question/24023290

#SPJ4

I need help on this problem pleaseeeeeeeeeee

Answers

Y=mx+b

A. Y=7.65x+50

B . 149.45-50= 99.45. 99.45/7.65=13 13 Hours

C. Y=7.65x48= $376.20 For 2 Days



Please give me Brainlyiest

which of the following are true statements? select all that apply: 1. a 95% confidence interval is a random interval that contains the true parameter 95% of the time 2. the true parameter is a random value that has 95% chance of falling in the 95% confidence interval 3. i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5. 4. the true parameter (unknown to me) is 0.5. if i sample data and construct a 95% confidence interval, the interval will contain 0.5 95% of the time. answer :

Answers

Among the following statements, The true statements are:

Option (1) a 95% confidence interval is a random interval that contains the true parameter 95% of the time, (2)the true parameter is a random value that has 95% chance of falling in the 95% confidence interval, (3) i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5, (4) the true parameter (unknown to me) is 0.

A 95% confidence interval is a random interval that contains the true parameter 95% of the time.

The true parameter is NOT a random value, and it is not correct to say that it has a 95% chance of falling in the 95% confidence interval.

If you perform a linear regression and get a 95% confidence interval from 0.4 to 0.5,

it means that if you repeated the same experiment many times, 95% of the resulting confidence intervals would contain the true parameter.

It is not correct to say that there is a 95% probability that the true parameter is between 0.4 and 0.5 because the true parameter is either in the interval or not.

If the true parameter is 0.5 and you sample data and construct a 95% confidence interval, the interval may or may not contain 0.5.

The 95% confidence interval is a statement about the probability of the interval containing the true parameter, not about the probability of the true parameter being any specific value.

For more such questions on parameter

https://brainly.com/question/29344078

#SPJ4

What information is in the text but not in the graph?

Answers

Answer:

B. More money was given than expected in 1994

Step-by-step explanation:

Nowhere is it mentioned what amount was expected as donations. Only actual amounts received are shown on the graph

Hence this is an assumption and not necessarily fact

A small publishing company is releasing a new book. The production costs will include a one-time fixed cost for editing and an additional cost for each book

printed. The total production cost C (in dollars) is given by the function C=15. 95N+750, where N is the number of books.

The total revenue earned (in dollars) from selling the books is given by the function R-32. 80N.

Let P be the profit made (in dollars). Write an equation relating P to N. Simplify your answer as much as possible.

0

?

Answers

If The total revenue earned (in dollars) from selling the books is given by the function R-32. 80N.The equation relating the profit P (in dollars) to the number of books N is P = 16.85N - 750.

The profit made by the company is the difference between the total revenue earned and the total production cost, so we can write:

P = R - C

Substituting the expressions for R and C, we get:

P = 32.80N - (15.95N + 750)

Simplifying the right-hand side, we get:

P = 16.85N - 750

This equation shows that the profit made by the company is a linear function of the number of books printed. The slope of the line is the revenue per book (32.80 dollars), minus the cost per book (15.95 dollars), which is 16.85 dollars.

The intercept of the line is the fixed cost for editing (750 dollars). The equation can be used to estimate the profit for any given number of books printed, and to determine the break-even point, which is the number of books that need to be sold to cover the total production cost.

To learn more about equation click on,

https://brainly.com/question/29608834

#SPJ4

Which expressions are equivalent to 4 � 4b4, b ? Choose all answers that apply: Choose all answers that apply: (Choice A) A � + 2 ( � + 2 � ) b+2(b+2b)b, plus, 2, left parenthesis, b, plus, 2, b, right parenthesis (Choice B) B 3 � + � 3b+b3, b, plus, b (Choice C) C 2 ( 2 � ) 2(2b)

Answers

B=3b-b

C= 2b expressions are equivalent to 4 � 4b4, b .

b+2(b+2b)=b+2(3b)=b+6b=7b

3b+b=4b

2(2b)=4b Option B and C produce the outcome 4b. They are the expressions that are comparable to 4b as a result. We can also get an equivalent equation by multiplying or dividing both sides of an equation by the same nonzero value. If x4=2x+7, we can add 4 to both sides to get the following equation, which is equivalent: x4+4=2x+7+4. Of course, both sides of the equation can be made simpler. Constants x=2x+7+4 on the left side cancel each other out. If two systems of equations have the same solution, they are equivalent (s). In algebra, two equations are said to be equivalent if their roots or solutions are the same. The same number, symbol, or expression must be added to or subtracted from both sides of an equation to produce an equivalent equation.

Learn more about equivalent from

brainly.com/question/2972832

#SPJ4

I NEED HELP PLEASEEEEEEEEE!!!!!!

Answers

Step-by-step explanation:

so, it starts (year 0 after 2000) with 350 foxes.

after 1 year the number had increased by 5%.

that means : 350×1.05

because 5% is represented by 0.05.

5% of 350 is 350×0.05 (= 17.5)

and to add 5% means that this is added to the original 100% (= 1).

100% + 5% = 105%

means

1 + 0.05 = 1.05

so, again, after the first year we have

350×1.05

foxes.

after the second year we have to multiply that by 1.05 again :

350×1.05×1.05

and so on.

so, what we are doing is multiplying the original number of foxes by powers of 1.05 (with the exponent being the number of years after 2000).

f(x) = 350 × (1.05)^x

(15, 2); perpendicular to 5x - y = 2
(a) Write the equation of the line in slope-intercept form.
(b) Write the equation of the line in standard form.

Answers

Answer:

see explanation

Step-by-step explanation:

the equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

given

5x - y = 2 ( subtract 5x from both sides )

- y = - 5x + 2 ( multiply through by - 1 )

y = 5x - 2 ← in slope- intercept form

with slope m = 5

(a)

given a line with slope m then the slope of a line perpendicular to it is

[tex]m_{perpendicular}[/tex] = - [tex]\frac{1}{m}[/tex] = - [tex]\frac{1}{5}[/tex] , then

y = - [tex]\frac{1}{5}[/tex] x + c ← is the partial equation

to find c substitute (15, 2 ) into the partial equation

2 = - [tex]\frac{1}{5}[/tex] (15) + c = - 3 + c ( add 3 to both sides )

5 = c

y = - [tex]\frac{1}{5}[/tex] x + 5 ← in slope- intercept form

(b)

the equation of a line in standard form is

Ax + By = C ( A is a positive integer and B, C are integers )

y = - [tex]\frac{1}{5}[/tex] x + 5 ( multiply through by 5 to clear the fraction )

5y = - x + 25 ( add x to both sides )

x + 5y = 25 ← in standard form

Each of these graphs of residuals is from the same set of data using different lines to fit the data. Which graph is most likely to represent the residuals from the best fit line?EXPLAIN YOUR REASONING.

Answers

The graph which is most likely to represent the residuals from the best fit line is Option C.

What is Graph?

Graph is a mathematical representation of a network and it describes the relationship between lines and points.

Given that from the graphs of residuals is  the same set of data using different lines to fit the data.

The best fit line is the line that minimizes the sum of the squared residuals.

In other words, it is the line that has the smallest sum of the squared differences between the actual data points and the predicted values from the line.

The residuals represent the differences between the actual data points and the predicted values, and any systematic pattern in the residuals would suggest that the line is not a good fit for the data.

Hence, Option C is correct, the graph which is most likely to represent the residuals from the best fit line.

To learn more on Graph click:

https://brainly.com/question/17267403

#SPJ1

you are testing h0: μ=10 against ha: μ≠10 based on an srs of 15 observations from a normal population. what values of the t statistic are statistically significant at the α=0.005 level?

Answers

The values of the t statistic that are statistically significant at the α=0.005 level are t < -2.977 or t > 2.977.

To determine the values of the t statistic that are statistically significant at the α=0.005 level, we need to find the critical values of the t-distribution with 14 degrees of freedom (df = n - 1 = 15 - 1 = 14).

Using a t-table or a calculator, we can find that the critical values for a two-tailed test with α=0.005 are -2.977 and 2.977. This means that any t statistic less than -2.977 or greater than 2.977 would be considered statistically significant at the α=0.005 level.

In other words, if the calculated t statistic falls within the range of -2.977 to 2.977, we would fail to reject the null hypothesis (H0: μ=10) and conclude that there is not enough evidence to suggest that the population mean is different from 10. However, if the calculated t statistic falls outside of this range, we would reject the null hypothesis and conclude that there is evidence to suggest that the population mean is different from 10.

So, the values of the t statistic that are statistically significant at the α=0.005 level are t < -2.977 or t > 2.977.

To learn more about the values of the t statistic that are statistically significant, click here: https://brainly.com/question/16244531

#SPJ11

3. PLEASE THIS IS URGENT

B. Bill's Bikes sells new and used bikes. Bill buys used bikes, fixes them, and marks them up by 80%. The sales-
person selling the bike receives a 25% commission on the markup.
a. Find the missing values in the table. Show your work below
Strategies include:
Using proportions
Percent bar models
Multiplying with the decimal (or fractional) equivalent
Reasoning about with benchmark percent values
Costs and Revenue for Roberto's Sales
Buying
Markup
Selling
Commission
Profit (money the
(25% of markup) shop makes on the sale)
Price (80% of buying price) Price
$100
$180
$20
$60
$10
$55
$125
PLEASE AND I NEED THE WORK SHOWN FOR BOTH CHARTS

Answers

The values that van be put in the table based on the information will be:

Buying price (dollars) 100.

Mark-up 80.

Selling price 180

Commission 20

Profit 60

Buying price (dollars) 10

Mark-up 8

Selling price 18

Commission 2

Profit 6

Buying price (dollars) 55

Mark-up 44

Selling price 99

Commission 11

Profit 33

Buying price (dollars) 125

Mark-up 100

Selling price 225

Commission 25

Profit 75

How to explain the value

It should be noted that the markup is 80% of the buying price. For example, when the buying price is $10, the markup will be:

= 80% × $10

= $8

The selling price is that addition of buying price and markup. This will be:

= $10 + $8

= $18

The commission is 25% of markup. This will be:

= 25% × 8

= $2

Learn more about percentages on:

brainly.com/question/24877689

#SPJ1

rcentage of people who completed or more years of college listed by state are the percentages of the population who have completed or more years of a college education. construct a frequency distribution with classes.

Answers

The frequency distribution table of the data is illustrated below.

The data we have been given represents the percentage of people who have completed 4 or more years of college education in different states. To create a frequency distribution, we need to first decide on the number of classes we want to use. In this case, we will use 7 classes.

Next, we need to determine the range of values for each class. To do this, we first find the minimum and maximum values in the data set, which are 18.9 and 37.9, respectively.

The range of values for each class will be (max value - min value) / number of classes, which in this case is (37.9 - 18.9) / 7 = 2.86.

We will start with the first class, which will include all values from 18.9 to 21.76 (the lower limit of the first class plus the range of values for each class). The next class will include values from 21.76 to 24.62, and so on, until we reach the final class which will include all values from 33.18 to 36.04 (the upper limit of the final class plus the range of values for each class).

To create the frequency distribution, we count the number of values in the data set that fall into each class. For example, the first class includes values between 18.9 and 21.76, and there are 2 values in the data set that fall into this range (21.4 and 20.0). We continue this process for each class until we have a table that shows the frequency of values in each class.

To know more about percentage here.

https://brainly.com/question/13729841

#SPJ4

Complete Question:

Percentage of People Who Completed 4 or More Years of College Listed by state are the percentages of the population who have completed 4 or more years of a college education. Construct a frequency distribution with 7 classes.

21.4,26.0,25.3,19.3,29.5,35.0,34.7,26.1,25.8,23.4,27.1,29.2,24.5,29.5,22.1,24,3,28.8,20,0,20.4,26.7,35.2,37.9,24.7,31.0,18.9,24.5,27.0

Which question can be answered using the expression 3 ÷ 1
?
4 8
Responses
A
How many 1 -pound pieces of fudge are in 3
-pound fudge?
8 4How many 1 -pound pieces of fudge are in 3 -pound fudge? 8 4
B
How many 3 -pound pieces of fudge are in 1 -pound fudge?
4 8How many 3 -pound pieces of fudge are in 1 -pound fudge? 4 8
C
Rob ate 1 of 3 pound of fudge. How much fudge did Rob eat?
8 4Rob ate 1 of 3 pound of fudge. How much fudge did Rob eat? 8 4
D
Rob ate 3 of 1 pound of fudge. How much fudge did Rob eat?
4 8

Answers

The question that can be answered using the expression 3 ÷ 1 is "How many 1-pound pieces of fudge are in a 3-pound fudge?". The correct option is B.

The expression "3 ÷ 1" is a mathematical expression that represents a division operation. In this case, the operation is "3 divided by 1".

To understand what this expression means, we can think of it in terms of a real-world scenario. For example, we can think of it as dividing 3 pounds of fudge into 1-pound pieces.

If we divide 3 pounds of fudge into 1-pound pieces, we can ask the question "How many 1-pound pieces of fudge are in 3 pounds of fudge?" This is the question that can be answered using the expression "3 ÷ 1".

To solve this division problem, we simply divide 3 by 1. The result is 3. This means that there are 3 one-pound pieces of fudge in 3 pounds of fudge.

So, to summarize, the expression "3 ÷ 1" means "3 divided by 1" and can be interpreted as dividing 3 pounds of fudge into 1-pound pieces. The answer to the question "How many 1-pound pieces of fudge are in 3 pounds of fudge?" is 3.

To learn more about expressions click on,

https://brainly.com/question/6203017

#SPJ4

2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs

Answers

There are 8.75 pounds of meat for 7 dogs

How to find the value of x?

Ratio is used to compare two or more quantities. It is used to indicate how big or small a quantity is when compared to another.

Since 2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs. We can write:

2.5/2 = x/7

2*x = 2.5*7

2x = 17.5

x = 17.5/2

x = 8.75

Learn more about ratio on:

brainly.com/question/2328454

#SPJ1

Other Questions
what is not true about your digital footprint? question 3 options: potential employers can use your history to detemine future employment you can erase your digital footprint online predators look at your personal information college admissions offices are allowed to view your online posts a. what is the url of the document requested by the browser? b. what version of http is the browser running? Which North African ethnic group continues to maintain many of its nomadic and semi-nomadic cultural traditions?A. EgyptiansB. LibyansC. MoroccansD. Berbers President Roosevelt's first concern as president was the A. Public panic caused by the bank failures B. Collapse of agriculture C. Problem of widespread unemployment. D. Deflationary spiral that had crippled business. you just won a lottery that promises to pay you $1 million exactly 10 years from today. because the $1 million payment is guaranteed by the state in which you live, opportunities exist to sell the claim today for an immediate lump-sum cash payment. what is the least you will sell your claim for if you could earn 5.05 % on similar-risk investments during the 10-year period? the savings equation tells us that to reduce a current account deficit, a country must increase its private savings, reduce domestic investment, or cut its government budget deficit. some people recommend restrictions on imports from china to reduce us current account deficit. how would higher us barriers to imports affect its private savings, domestic investment and government deficit? do you agree that import restrictions would necessarily reduce a us current account deficit? Nile Valley Contributions to Civilization summary Indigenous peoples in the region grew the "three sisters" crops- corn,squash, and beans. Two unrelated passengers on a small plane sued the pilot of the plane for injuries suffered during a rough landing after a sightseeing trip. They filed a negligence action in federal district court with the younger passenger, who had only minor injuries, claiming $5,000 in damages and the older passenger, whose injuries were life-threatening, claiming $95,000. The two passengers are citizens of the same state. The pilot is a citizen of another state. The pilot moved to dismiss the younger passenger's claim for lack of subject-matter jurisdiction.Should the court dismiss the younger passenger's claim?Joinder of Parties when you look at the sky on a dark night and see stars of different colors, which are the hottest? Can someone answer please How long does it take for a patient to file a claim after the day of service? You need to be of average or better intelligence in order to use a language correctly. TRUE OR FALSE. What is the value of x?What is the value of y?What is the value of z? Examples of how ethical standards differ among countries and cultures includeMultiple choice question.A. Emerging economies with weak government regulations that allow foreign companies to control labor lawsB International companies that have been able to negotiate a global wage agreement so that all their employees are paid the same no matter what country they are working inCU.S. executives who complain that their businesses are at a competitive disadvantage when bidding against non-U.S. companies, since foreign companies don't abide by bribery laws Complete the sentence below.20.8 is ten times bigger than How does the subject shift in paragraph 4 contribute to the development of the central ideas of thetext? Cite evidence from the text in your answer. Question: What type of intermolecular forces are present in each compound? Van der Waals forces.Van der Waals forces and dipole-dipole interactions.Van der Waals forces and dipole-dipole interactions.Van der Waals forces and dipole-dipole interactions.Van der Waals forces, dipole-dipole interactions, and hydrogen bonding.Van der Waals forces. what underlies cognitive construction piaget For this assignment, you will watch a short video about food waste in the United States titled Food waste the world's biggest problem Using what you've learned, you will write at least 200 words responding to the prompt. Be sure to include evidence to support your ideas.The link they want u to watch u don't need to but it might be helpfullDescribe the problem of food waste in the United States, including how individual citizens have taken action to solve the problem.