1)Grignard reagent when reacted with methanol will yield A) ethanol (B) secondary alcohols (C) tertiary alcohols (D ropanol (E) primary alcohol

Answers

Answer 1

When the reaction of  Grignard reagent reacted with methanol will yield a tertiary alcohol. Therefore, Option C tertiary alcohol is correct.

Contains a carbon-metal link, Grignard reagents are chemicals used in catalysis. They generally result from the anhydrous reaction of magnesium metal with an alkyl or aryl halide. Because of their high reactivity, Grignard reagents frequently act as nucleophiles in organic reactions.

An alkyl group from a Grignard reagent binds to the oxygen atom of methanol (CH3OH) when it interacts with the methanol, breaking the carbon-metal connection. A precursor alkoxide is created as a result. The equivalent alcohol is then produced by protonating the intermediate alkoxide.

The reaction of a Grignard reagent with methanol leads to the formation of a tertiary alcohol.

Learn more about reagents here:

https://brainly.com/question/29729676


Related Questions

On another planet, the isotopes of titanium have the given natural abundances.

Isotope Abundance Mass (u)
46Ti 73.700% 45.95263
48Ti 15.000% 47.94795
50Ti 11.300% 49.94479
What is the average atomic mass of titanium on that planet?

average atomic mass =

Answers

The average atomic mass of titanium on the planet, given the various isotopic abundance of the element, is 46.70 u

How do i determine the atomic mass of the titanium?

First, we shall list out the given parameters from the question. This is shown below:

Abundance of ⁴⁶Ti (1st%) = 73.700%Mass of ⁴⁶Ti = 45.95263 u Abundance of ⁴⁸Ti (2nd%) = 15.000%Mass of ⁴⁸Ti = 47.94795 u Abundance of ⁵⁰Ti (3rd%) = 11.300%Mass of ⁵⁰Ti = 49.94479Average atomic mass =?

The average atomic mass of the titanium can be obtain as follow:

Average atomic mass = [(Mass of 1st × 1st%) / 100] + [(Mass of 2nd × 2nd%) / 100] + [(Mass of 3rd × 3rd%) / 100] + [(Mass of 4th × 4th%) / 100]

= [(45.95263 × 73.7) / 100] + [(47.94795 × 15) / 100] + [(49.94479 × 11.3) / 100]

= 46.70 u

Thus, the average atomic mass of the titanium in the planet is 46.70 u

Learn more about average atomic mass:

https://brainly.com/question/24185848

#SPJ1

what is the scope of humidity?

Answers

Humidity refers to the amount of moisture present in the air or atmosphere. It is a crucial atmospheric parameter that impacts various aspects of our environment and daily lives.

The scope of humidity extends across multiple domains, including meteorology, agriculture, health, and technology. In meteorology, humidity plays a vital role in determining weather patterns, cloud formation, and precipitation. In agriculture, it affects crop growth, irrigation requirements, and pest control. Humidity also influences human comfort and well-being, as high humidity can make temperatures feel hotter and exacerbate respiratory conditions. Moreover, industries such as manufacturing and electronics depend on humidity control to ensure product quality and prevent damage.Understanding and managing humidity levels are essential for optimizing numerous processes, improving human health, and maintaining the balance of ecosystems.

For such more question on Humidity

https://brainly.com/question/21494654

#SPJ8

What is the [H3O*] in a solution with [OH-] = 5 x 10-12 M?
O 5 x 10-12 M
0 7x 102 M
O 3 x 10-7 M
O 5 x 10-8 M
O 2x 10-3 M

Answers

The concentration of the ion that has been shown here is[tex]2 x 10^-3[/tex]M. OptionD

What is the oxinium ion concentration?

We must bear in mind that in the case that we have we have to deal with the process that we have to use to obtain the oxonium ion concentration when we do have that hydroxide ion concentration and this an important part of the pH calculation process.

We have that;

[H3O^+]  = 1 * 10^-14/ 5 x 10^-12 [tex][H3O^+] = 1 * 10^-14/ 5 x 10^-12[/tex]

Thus we have that the concentration of the ion can now be ween to be

[tex]2 * 10^-3[/tex] M as shown

Learn more about concentration:https://brainly.com/question/13872928

#SPJ1

What is the temperature at which the reaction below is at equilibrium?
2NO(g) + O2(g)  2NO2(g), ΔH° = -113 kJ/mol and ΔS° = -145 J/K mol

Answers

The temperature at which the system can be able to attain equilibrium is 779 K.

What is the entropy?

The concept of entropy is often associated with the second law of thermodynamics, which states that the entropy of an isolated system tends to increase over time. In simple terms, the second law suggests that natural processes tend to move from a state of order to a state of greater disorder.

We know the temperature can be obtained from the enthalpy and the entropy of the system. We have that;

ΔS= ΔH/T

T = ΔH/ΔS

T =  -113 [tex]* 10^3[/tex]J/mol / -145 J/K mol

= 779 K

Learn more about entropy:https://brainly.com/question/20166134

#SPJ1

why do nonmetals tend to gain electrons to form negative loss?
a. they gain the few electrons they need to form full octets
b. they have fewer protons in their nuclei, so they attract electrons
c. they gain electrons to balance the protons in their nuclei
d. they have low electronegativities

Answers

Nonmetals are found on the right side of the periodic table and they tend to gain electrons to achieve stable electronic configurations. These elements have high ionization energies and low electromagnetism which make it difficult for them to lose electrons and easier for them to gain electrons.

Most nonmetals have four, five, six, or seven valence electrons and they need to gain one, two, or three electrons to complete their outermost energy level and obtain a stable electronic configuration, often similar to that of a noble gas.For instance, Fluorine (F), Chlorine (Cl), and Oxygen (O) are nonmetals and they have seven, seven, and six valence electrons, respectively. They are very electromotive which means that they tend to attract electrons towards themselves. When they gain an electron, they form an anion with a negative charge that is isoelectronic to the nearest noble gas in the periodic table.In summary, nonmetals tend to gain electrons to form negative ions because they have high ionization energies and low electromagnetism. These properties make it difficult for them to lose electrons and easier for them to gain electrons. When they gain electrons, they form anions with negative charges that are isoelectronic to the nearest noble gas.

For such more question on electromagnetism

https://brainly.com/question/12555869

#SPJ8

it is difficult to cut the steam of water

Answers

It is difficult to cut the steam of water because of the unique properties of water and steam.Water and steam are two different states of matter, but they have a common property - they are both molecules of H2O. Steam is formed when water is heated, and the molecules of H2O begin to move faster and further apart from one another.

This results in steam, which is a gas and not a liquid like water. It is more challenging to cut the steam of water than the liquid water due to its unique properties.Therefore, the difficulty of cutting steam of water is due to the following properties of steam:Low density: Steam has low density because of the increased space between the water molecules due to heating. This means that steam takes up more space and is lighter than water, making it difficult to cut or separate from the atmosphere.Gaseous state: Steam is a gaseous state, which means it does not have a definite shape or volume like liquid water. Therefore, cutting steam would be difficult as it does not have a defined structure. Moreover, steam would disperse instantly if it is cut due to its gaseous form and become difficult to capture.Very hot: Steam is at a temperature that is harmful to human skin, and can cause severe burns. This means that cutting steam is also a safety concern, which makes the process even more challenging.

For such more question on molecules

https://brainly.com/question/475709

#SPJ8

What is the velocity of an electron that has a de Broglie wavelength approximately the length of a chemical bond? Assume the length of a chemical bond is 2.1×10−10 m . (The mass of an electron is 9.11×10−31kg .) Express the velocity to two significant figures and include the appropriate units.

Answers

The velocity of the electron with a de Broglie wavelength approximately equal to the length of a chemical bond is approximately 3.46 x 10^6 m/s.

The de Broglie wavelength (λ) of a particle is given by the equation:

λ = h / p

where λ is the wavelength, h is the Planck constant (6.626 x 10^-34 J*s), and p is the momentum of the particle. The momentum (p) of a particle is given by the equation:

p = m * v

where p is the momentum, m is the mass of the particle, and v is the velocity of the particle.

In this case, we have the de Broglie wavelength (λ) approximately equal to the length of a chemical bond, which is 2.1 x 10^-10 m. The mass of an electron (m) is 9.11 x 10^-31 kg.

Using the equation λ = h / p, we can rearrange it to solve for the momentum (p):

p = h / λ

Substituting the given values, we get:

p = (6.626 x 10^-34 Js) / (2.1 x 10^-10 m) ≈ 3.15 x 10^-24 kgm/s

Now, we can use the momentum (p) to calculate the velocity (v) using the equation p = m * v:

v = p / m

Substituting the values:

v = (3.15 x 10^-24 kg*m/s) / (9.11 x 10^-31 kg) ≈ 3.46 x 10^6 m/s

For more such question on de Broglie visit:

https://brainly.com/question/30216495

#SPJ8

How many moles of gold are there in 28 grams of gold?

Answers

Answer: There are approximately 0.142 moles in 28 grams of Gold.

Explanation:

To calculate the number of moles 28 grams of Gold, we need to know the molar mass of gold. The molar mass of gold (Au) is approximately 197 grams per mole.

We can use the formula:

Number of moles = Mass (in grams)  / Molar mass

Substituting the given values:

Number of moles = 28 g / 197 g per mole

Number of moles ≈ 0.142 moles (approx.)

Therefore, there are approximately 0.142 moles of gold in 28 grams.

For more questions on Molar mass and moles, see :

https://brainly.in/question/11731

0.142 mol/dm^3 in 28 grams of gold

Describe the energy in wind and the way in which its converted to electrical energy?

Answers

Answer:Wind rotates the rotor blades

Explanation:

Wind turbines use blades to collect the wind's kinetic energy. Wind flows over the blades creating lift (similar to the effect on airplane wings), which causes the blades to turn. The blades are connected to a drive shaft that turns an electric generator, which produces (generates) electricity.

An exothermic process will result in:

a. a reaction vessel that feels cold as heat is absorbed from the surroundings.

b. a reaction vessel that feels warm as heat passes to the surroundings

c. products with more energy content than reactants

d. a positive energy gain for the reaction (+q).

Answers

Answer:An exothermic process releases heat, causing the temperature of the immediate surroundings to rise.

Explanation:

What is a renewable resource?

Answers

Answer:

A renewable resource is a natural resource that can be replenished or regenerated within a reasonable timeframe, typically within a human lifespan or less. These resources are essentially inexhaustible as they can be naturally replenished or artificially renewed through human interventions. Renewable resources include sunlight, wind, water (hydroelectric power), biomass, geothermal energy, and certain types of biofuels. These resources are generally considered environmentally friendly and sustainable, as their use does not deplete or harm the Earth's natural systems.

Describe the relationship between molecular structure and acid strength.

Answers

The relationship between molecular structure and acid strength is crucial in understanding the behavior and properties of acids. Acid strength is determined by the ability of an acid to donate protons (H+) in an aqueous solution. The molecular structure of an acid plays a significant role in determining its strength.

The key factor influencing acid strength is the stability of the resulting conjugate base after the acid donates a proton. The more stable the conjugate base, the stronger the acid. There are several factors that contribute to the stability of the conjugate base.

Firstly, electronegativity plays a role. Acids with more electronegative atoms, such as oxygen, tend to have stronger acidity because they can stabilize the negative charge on the conjugate base through resonance or inductive effects.

Secondly, the presence of electron-withdrawing groups enhances acid strength. These groups, like halogens or nitro groups, withdraw electron density from the acidic hydrogen, making it easier to dissociate and donate a proton.

Thirdly, molecular size also affects acid strength. Acids with larger molecules tend to have weaker acidity because the electron density is spread over a larger area, making it less likely for the acidic hydrogen to dissociate.

Overall, the molecular structure of an acid influences its acidity by determining the stability of the resulting conjugate base. Factors such as electronegativity, electron-withdrawing groups, and molecular size all contribute to the strength of an acid.

For more such questions on molecular structure

https://brainly.com/question/27789666

#SPJ8

Acrylonitrile, C3H₂N, is a molecule used to produce a plastic called Orlon. How many grams of acrylonitrile
could be produced by reacting 583 g of propene, C3H, with excess ammonia, NH, and oxygen?
2C3H6+ 2NH3 + 30₂ → 2C,H₂N + 6H₂O

a. 368 g
b. 1470 g
C. 462 g
d. 735 g
e. 583 g

Answers

d. 735 g of acrylonitrile could be produced by reacting 583 g of propene, [tex]C_{3}H[/tex], with excess ammonia, NH, and oxygen

To determine the grams of acrylonitrile that could be produced, we need to find the limiting reactant in the given chemical equation. The limiting reactant is the one that is completely consumed and determines the amount of product formed.

First, we need to calculate the molar masses of propene ([tex]C_{3}H_{6}[/tex]) and acrylonitrile ([tex]C_{3}H_{2}N[/tex]).

Molar mass of propene ([tex]C_{3}H_{6}[/tex]):

3(C) + 6(H) = 3(12.01 g/mol) + 6(1.01 g/mol) = 42.09 g/mol

Molar mass of acrylonitrile ([tex]C_{3}H_{2}N[/tex]):

3(C) + 2(H) + 1(N) = 3(12.01 g/mol) + 2(1.01 g/mol) + 1(14.01 g/mol) = 53.06 g/mol

Next, we calculate the number of moles of propene:

583 g / 42.09 g/mol = 13.86 mol

According to the balanced equation, the stoichiometric ratio between propene and acrylonitrile is 2:2. Therefore, for every 2 moles of propene, 2 moles of acrylonitrile are produced.

Since the stoichiometric ratio is 1:1, the number of moles of acrylonitrile produced is also 13.86 mol.

Finally, we calculate the mass of acrylonitrile:

Mass = moles × molar mass = 13.86 mol × 53.06 g/mol = 735 g

Therefore, Option D is correct.

Know more about Molar mass here:

https://brainly.com/question/24191825

#SPJ8

Describe the weather conditions for a Stationary front.

Answers

A stationary front is a boundary between two air masses that are not moving relative to one another. When a cold front or warm front meets and can't push one another, they create a stationary front. The wind direction around a stationary front changes slightly in one or both directions, but not enough to create a cold front or warm front.

The weather conditions for a stationary front are a mixture of cold and warm fronts' characteristics. When a stationary front is formed, the warm and cold air masses are separated. The result is often a band of precipitation, cloudiness, and humid conditions. Stationary fronts cause lengthy periods of precipitation, including mist, fog, and drizzle, and they can cause flooding in some regions.They can also generate thunderstorms and other kinds of inclement weather, and the intensity of the rain or snow is typically determined by the temperature and humidity levels.The warm air mass' instability often results in thunderstorms, tornadoes, and heavy rain and hail in the area where it meets the cooler, more stable air mass. Precipitation occurs, but it is usually light and steady rather than heavy and thundery. In summary, stationary fronts create a mix of weather conditions, which can vary depending on the air masses involved and the specific geography of the location.

For such more question on inclement

https://brainly.com/question/31765968
#SPJ8

Identify the physical state(s) corresponding to the regions on the cooling curve below.

Answers

Based on the information, we can infer that the labels for each letter according to the physical state of matter would be: A. gas, B. liquid and gas, C. liquid, D. liquid, E. liquid and solid.

How to complete the chart?

To complete the table we must take into account the graph that shows the variation of temperature in an element. In this case we can infer that the descending curve refers to the decrease in temperature.

In this case we can infer that the element may be water because its boiling point is close to 100° and its freezing point is at 0°. According to the above, the letters in the box correspond to the following labels:

A. gas, B. liquid and gas, C. liquid, D. liquid, E. liquid and solid.

Learn more about states of matter in: https://brainly.com/question/29476563

#SPJ1

81. Which of the following is NOT composed of protein? A. sex hormones C. Hair B. Muscle D. Enzymes​

Answers

Answer: A. sex hormones

Explanation:

Sex hormones are steroid compounds synthesized from cholesterol mainly in the testes, ovaries, and adrenal cortex.

A continous fractionating column separates 1500 kg/h of a solution of benzene and toluene containing 0.75 mass benzene into an overhead product containing 0.925 mass fraction benzene and bottom product containing 0.075 mass fraction of benzene. A reflux ration of 2.5 kg of reflux per kg of product is to be used. Calculate the quanity of top and bottom product in kg/h.

Answers

The quantity of the top product is approximately 1483.4 kg/h, and the quantity of the bottom product is approximately 1116.7 kg/h.

What is the quantity of top and bottom products in kg/h?

We solve using the concept of material balances.

Given:

F = Feed rate of the solution (benzene + toluene) = 1500 kg/h

Fb = Feed rate of benzene in the feed = 0.75 * F = 1125 kg/h

Ft = Feed rate of toluene in the feed = F - Fb = 375 kg/h

Benzene Balance:

Fb = Bt + Bb

where Bt is the flow rate of benzene in the top product and Bb is the flow rate of benzene in the bottom product.

1125 kg/h = Bt + Bb

Toluene Balance:

The mass balance equation for toluene can be written as:

Ft = Tt + Tb

where Tt is the flow rate of toluene in the top product and Tb is the flow rate of toluene in the bottom product.

375 kg/h = Tt + Tb

The reflux ratio is given as 2.5 kg reflux per kg of product

The total product flow rate (Pt) will be:

Pt = Bt + Tt = Bb + Tb

Therefore, the reflux flow rate (R) is:

R = 2.5 * Pt

Solving the equations, we find:

Bt = 1116.7 kg/h

Tb = 8.3 kg/h

Top Product Flow Rate = Bt + Tt = Bt + (Ft - Tb) = Bt + (375 - 8.3) = 1116.7 + 366.7 = 1483.4 kg/h

Bottom Product Flow Rate = Bb + Tb = 1125 - 8.3 = 1116.7 kg/h

Learn more about material balance at: https://brainly.com/question/30705511

#SPJ1

When this chemical equation is balanced, what is the coefficient of NeCI?
- NaCI +
_РЬ(N03)2 ->
_PbCI2 + NaNO3

Answers

By process of elimination, the coefficient of NaCl is 1, as it does not appear in the given chemical equation.

To balance the chemical equation:

NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

We can start by balancing the atoms individually. We begin with the least complex atom, in this case, sodium (Na):

NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

The equation already has one Na on the left side, so we place a coefficient of 1 in front of NaCl:

1NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

Next, we move on to chlorine (Cl). On the left side, there is one Cl in NaCl, while on the right side, there are two Cl in PbCl2:

1NaCl + Pb(NO3)2 -> 1PbCl2 + NaNO3

We balance the nitrate ions (NO3). On the left side, there are two NO3 in Pb(NO3)2, while on the right side, there is only one NO3 in NaNO3:

1NaCl + Pb(NO3)2 -> 1PbCl2 + 2NaNO3

Finally, we balance the lead (Pb) atoms. There is one Pb on the right side in PbCl2, so we place a coefficient of 1 in front of Pb(NO3)2:

1NaCl + 1Pb(NO3)2 -> 1PbCl2 + 2NaNO3

For more such questions on elimination visit;

https://brainly.com/question/17101814

#SPJ8

An Ibuprofen (MW = 206.29) solution was made by dissolving 4,421 milligrams into water with a
final volume of 0.172 L. What is the concentration of Ibuprofen in Molarity?

Answers

The concentration of Ibuprofen in the solution is approximately 0.124 M (Molarity), calculated by dividing the moles of Ibuprofen (0.0214 mol) by the volume of the solution (0.172 L).

To calculate the concentration of Ibuprofen in molarity, we need to use the formula:

Concentration (Molarity) = moles of solute / volume of solution in liters

First, we need to convert the mass of Ibuprofen into moles. The molar mass of Ibuprofen is given as 206.29 g/mol.

Step 1: Convert milligrams to grams:

4,421 mg = 4.421 g

Step 2: Convert grams to moles:

moles = mass / molar mass

moles = 4.421 g / 206.29 g/mol

moles ≈ 0.0214 mol

Step 3: Calculate the concentration:

Concentration = moles / volume

Concentration = 0.0214 mol / 0.172 L

Concentration ≈ 0.124 M

Therefore, the concentration of Ibuprofen in the solution is approximately 0.124 M (Molarity). This means that there are 0.124 moles of Ibuprofen dissolved in every liter of the solution.

Know more about Molarity here:

https://brainly.com/question/30404105

#SPJ8

Explain one way you could set up a tug-of-war that was imbalanced.Explain one way you could set up a tug-of-war that was imbalanced.

Answers

Answer:

have 5 people on one side and 3 people on the other side

Explanation:

Question 8 of 10
What conditions make AG always negative?

Answers

The conditions that make ∆G (Gibbs free energy) always negative are when a reaction is spontaneous and thermodynamically favorable. This occurs when the system has a decrease in enthalpy (∆H) and an increase in entropy (∆S).

A negative ∆H indicates an exothermic reaction, where the products have lower energy than the reactants. An increase in entropy (∆S) means that the disorder or randomness of the system increases during the reaction.

When ∆H is negative and ∆S is positive, the equation ∆G = ∆H - T∆S (where T is the temperature in Kelvin) results in a negative ∆G. In this case, the reaction is spontaneous, meaning it can proceed without requiring an external input of energy.

Furthermore, when the reaction is carried out under standard conditions (standard temperature, pressure, and concentration), the resulting ∆G° (standard Gibbs free energy change) will always be negative for a spontaneous reaction.

In summary, negative ∆G is achieved when the reaction is exothermic, increases the disorder of the system, and occurs under standard conditions or conditions where ∆H is negative and ∆S is positive.

Know more about exothermic here:

https://brainly.com/question/2924714

#SPJ8

Write the structure of essential fatty acid with three double bonds and give the name

Answers

Essential fatty acids play a crucial role in human health and should be included as part of a balanced diet. The structure of an essential fatty acid with three double bonds is an omega-3 fatty acid known as alpha-linolenic acid.

Essential fatty acids are the dietary fats that are required by the human body for healthy functioning.

The human body cannot produce essential fatty acids on its own, so they must be obtained from dietary sources.

They are important components of cell membranes and are necessary for the synthesis of important molecules such as eicosanoids, which regulate inflammation and blood clotting.

There are two types of essential fatty acids: omega-3 and omega-6. Both types are polyunsaturated fatty acids, meaning that they contain more than one double bond in their carbon chain. The structure of an essential fatty acid with three double bonds is as follows: CH3(CH2)5CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH.

This is an omega-3 fatty acid known as alpha-linolenic acid.

It is important for brain function and has been linked to a reduced risk of heart disease. The name of this fatty acid is derived from its chemical structure.

The first part of the name, alpha, refers to the position of the double bond closest to the carboxyl group (COOH). The second part of the name, linolenic, indicates that there are three double bonds present in the carbon chain.

The final part of the name, acid, refers to the fact that it is an acid due to the presence of the carboxyl group.

For more such questions on fatty acids

https://brainly.com/question/876346

#SPJ8

What is the predominant form of ethylenediamine at pH 6.184 ?

H2NCH2CH2NH+3

H2NCH2CH2NH2

H+3NCH2CH2NH+3

Answers

The predominant form of ethylenediamine at pH 6.184 is H2NCH2CH2NH+3.

At pH 6.184, which is slightly acidic, the amino groups in ethylenediamine (H2NCH2CH2NH2) can partially protonate, resulting in the formation of ammonium ions (H+3NCH2CH2NH+3). The equilibrium between the neutral form and the protonated form is pH-dependent.

Therefore, at pH 6.184, the predominant form of ethylenediamine is H2NCH2CH2NH+3.

Read the paragraph below and choose the central idea from options given below.

Water
We use water every day. Water is an important factor in human life. Water can take
many forms. Generally, water is in liquid form. Frozen water is called ice. When ice
cubes are kept at room temperature, they turn into liquid again. If the pool of
melted water is not wiped up, it will disappear after some time. Do you know where
it goes? It becomes water vapor, or a gas, and disappears into the air. There is water
vapor in clouds. Water can be liquid, solid, or a gas.

Water is a liquid.
Water can take many forms.
Water can become ice.
Water can become vapor.

Answers

Answer:

ok, here is your answer

"Water can take many forms".

Mark me as brainliest

does the molecule which have C2 axis perpendicular to the Cn axis have mirror plane perpendicular to the Cn axis ?

Answers

No, a molecule with a [tex]C_2[/tex]axis perpendicular to the [tex]C_n[/tex]axis does not necessarily have a mirror plane perpendicular to the [tex]C_n[/tex]axis.

The presence of a [tex]C_2[/tex]axis perpendicular to the [tex]C_n[/tex]axis implies that the molecule possesses rotational symmetry around the [tex]C_n[/tex]axis. However, the presence of a mirror plane is determined by the presence of an additional symmetry element in the molecule.

A mirror plane is a symmetry element that divides the molecule into two halves, with one half being the mirror image of the other. In order for a mirror plane to be present perpendicular to the [tex]C_n[/tex]axis, there needs to be an additional symmetry element that produces the reflection symmetry.

While a molecule with a [tex]C_2[/tex] axis perpendicular to the [tex]C_n[/tex]axis has rotational symmetry, it does not necessarily possess reflection symmetry. For example, consider a molecule with a [tex]C_2[/tex]axis perpendicular to a [tex]C_3[/tex]axis.

The rotational symmetry is evident, as the molecule can be rotated by 120 degrees around the [tex]C_3[/tex] axis and still appear the same. However, this molecule does not possess a mirror plane perpendicular to the [tex]C_3[/tex]axis.

The presence of a mirror plane perpendicular to the [tex]C_n[/tex]axis depends on the specific molecular geometry and arrangement of atoms. It is possible for a molecule to possess both rotational symmetry and a mirror plane perpendicular to the [tex]C_n[/tex]axis, but it is not a general rule.

For more such questions on perpendicular visit:

https://brainly.com/question/23828050]

#SPJ8

Give the symbol and name for the ion with 34 protons and 36 electrons.

Answers

Answer:

That element is selenium, Se

Chemistry questions about dilutions with stoichiometry

Answers

9. The molarity of nitrate ions in the new solution will be A, 0.575 M.

10. The molarity of aluminum ions in the new solution will be D, 0.479 M.

How to find molarity?

Question 9

To solve this, first calculate the number of moles of nitrate ions in each solution:

The number of moles of nitrate ions in Solution A is 30.0 g Al(NO₃)₃ / 225 mL × 1 mol Al(NO₃)₃ / 213 g Al(NO₃)₃ = 0.575 mol NO₃⁻

The number of moles of nitrate ions in Solution B is 30.0 g Al₂(SO₄)₃ / 325 mL × 3 mol NO₃⁻ / 2 mol Al₂(SO₄)₃ = 0.478 mol NO₃⁻

The total number of moles of nitrate ions in the new solution is 0.575 mol NO₃⁻ + 0.478 mol NO₃⁻ = 1.053 mol NO₃⁻

The total volume of the new solution is 225 mL + 325 mL = 550 mL

The molarity of nitrate ions in the new solution is 1.053 mol NO₃⁻ / 550 mL = 0.575 M

Question 10

To solve this, first calculate the number of moles of aluminum ions in each solution:

The number of moles of aluminum ions in Solution A is 30.0 g Al(NO₃)₃ / 225 mL × 1 mol Al(NO₃)₃ / 213 g Al(NO₃)₃ × 1 mol Al / 1 mol Al(NO₃)₃ = 0.222 mol Al

The number of moles of aluminum ions in Solution B is 30.0 g Al₂(SO₄)₃ / 325 mL × 2 mol Al / 2 mol Al₂(SO₄)₃ = 0.333 mol Al

The total number of moles of aluminum ions in the new solution is 0.222 mol Al + 0.333 mol Al = 0.555 mol Al

The total volume of the new solution is 550 mL

The molarity of aluminum ions in the new solution is 0.555 mol Al / 550 mL = 0.479 M

Find out more on molarity here: https://brainly.com/question/30404105

#SPJ1

Sodium chloride can be obtained from
underground deposits or from the…….
What is the missing word?

Answers

Answer:Common salt is sodium chloride, NaCl. It can be made in a laboratory by the reaction of sodium with chlorine. However, it is found naturally in large amounts in sea water or in underground deposits. It is often obtained either by evaporating sea water or by mining underground deposits.

Explanation:

acidified heptaoxodichromate(vi) with chlorine ion​

Answers

The balanced chemical equation for this reaction can be written as follows: Cr2O7 2- + 14H+ + 6Cl- → 2Cr3+ + 3Cl2 + 7H2O

When heptaoxodichromate(VI) ion (Cr2O7 2-) is acidified with chlorine ion (Cl-), a redox reaction occurs. The heptaoxodichromate(VI) ion acts as an oxidizing agent, while the chlorine ion acts as a reducing agent. The balanced chemical equation for this reaction can be written as follows:

Cr2O7 2- + 14H+ + 6Cl- → 2Cr3+ + 3Cl2 + 7H2O

In this reaction, the heptaoxodichromate(VI) ion is reduced to chromium(III) ion (Cr3+), while the chlorine ion is oxidized to chlorine gas (Cl2). The acidified environment provides protons (H+) necessary for the reaction.

The reduction half-reaction can be represented as follows:

Cr2O7 2- + 14H+ + 6e- → 2Cr3+ + 7H2O

And the oxidation half-reaction can be represented as follows:

6Cl- → 3Cl2 + 6e-

Overall, the reaction involves the transfer of electrons from the chlorine ion to the heptaoxodichromate(VI) ion. The chlorine ion loses electrons and is oxidized, while the heptaoxodichromate(VI) ion gains electrons and is reduced.

This reaction is commonly used in laboratory settings to generate chlorine gas or to detect the presence of chloride ions in a solution. The redox reaction between acidified heptaoxodichromate(VI) and chlorine ion allows for the conversion of one species into another while the electrons are transferred between them.

For more such questions on  balanced chemical equation visit:

https://brainly.com/question/11904811

#SPJ8

Ethylenediamine has pb values of 4.072 ( pb1 ) and 7.152 ( pb2 ).
predominant form of ethylenediamine at pH 6.184 - H+3NCH2CH2NH+3
Calculate the percentage of ethylenediamine in the predominant form at each pH.
pH 6.184

Answers

The percentage of ethylenediamine in the predominant form (H+3NCH2CH2NH+3) is 127.36%.

To determine the percentage of ethylenediamine in the predominant form at pH 6.184, we need to compare the pH with the pKa values of ethylenediamine (pb1 and pb2). The pKa values indicate the acidity or basicity of a molecule.

In this case, the predominant form of ethylenediamine at pH 6.184 is the protonated form (H+3NCH2CH2NH+3). To calculate the percentage, we can use the Henderson-Hasselbalch equation:

pH = pKa + log([A-]/[HA])

Since the predominant form is the protonated form, the concentration of the deprotonated form ([A-]) is negligible. Therefore, we can ignore it in the equation. The concentration of the protonated form ([HA]) is the percentage we are trying to calculate.

Let's calculate the percentage of ethylenediamine in the protonated form at pH 6.184 using the pKa value pb1 (4.072):

6.184 = 4.072 + log([A-]/[HA])

2.112 = log([A-]/[HA])

Now, we can convert this equation into the exponential form:

[tex]10^{2.112[/tex] = [A-]/[HA]

Approximately,

127.36 = [A-]/[HA]

Since [A-] is negligible, we can assume it to be zero. Therefore, the concentration of [HA] is approximately 127.36.

To calculate the percentage, we need to divide the concentration of [HA] by the total concentration of ethylenediamine:

Percentage = ([HA] / Total concentration) * 100

Assuming the total concentration of ethylenediamine is 1 M,

Percentage = (127.36 / 1) * 100 = 127.36%

Therefore, at pH 6.184, the percentage of ethylenediamine in the predominant form (H+3NCH2CH2NH+3) is approximately 127.36%.

know more about ethylenediamine here:

https://brainly.com/question/31143463

#SPJ8

Other Questions
What three factors are used to determine if someone is an employee or an independent contractor? 12. Regarding accident and health insurance plans, taxpayers are allowed to exclude 13. When can meals and lodging be excluded from taxable income? 14. Define fringe benefits. 15. Define flexible spending accounts. Are these funds excluded from an employee's income? 16. How did COVID changes the provisions of FSAs? 17. What other types of flexible spending accounts may employers offer? Explain each type. 18. How much group term life insurance can an employer pay before the fringe benefit is no longer tax-free to employees? 19. How much education/tuition assistance can an employer pay before the fringe benefit is no longer tax-free and employees must include the amount in their income? 20. Can employee discounts be excluded from gross income? What are the provisions for the discount to be excluded from gross income? 21. List 5 types of fringe benefits and include their summary of treatment. 22. True or False. A 20 percent discount on investment real estate granted to the employee of a real estate developer would be taxable to the employee receiving the benefit. 23. Are prizes and awards taxable income to recipients? Provide at least 2 examples of a prize or award. 24. How is awarded property recorded within an individual's income? 25. What provisions allow a taxpayer to exclude an award from income? 26. Define annuities. Who sells annuities? 27. What is the difference between qualified and nonqualified annuities? 28. What two reasons attract buyers to annuities? 29. How are the taxable and nontaxable portions of annuity payments calculated? Explain the two methods. 30. What form is used to report annuities? 31. Mary retired on May 30,2021 and receives a monthly employee annuity benefit of $1,400 payable for life, beginning June 1,2021 . During her years Assume that Khosrowshahi has a high level of prosocial motivation. Based on this individual difference, which of the following prosocial behaviors could decrease at Uber? Multiple Choice knowledge sharing O organizational citizenship behaviors proactivity compassion knowledge sharing organizational citizenship behaviors proactivity compassion counter productive work behaviors D must be provided in writing by the contractor, and acknowledged in writing by the owner................answer must be 1-2 words only In the month of June, a department had 20000 units in beginning work in process inventory that were 60% complete. During June, 80000 units were transferred into production from another department. At the end of June there were 11000 units in ending work in process inventory that were 30% complete as on conversion. Materials are added at the beginning of the process, while conversion costs are incurred uniformly throughout the process. The equivalent units of production for materials for June were 80000 equivalent units. 103300 equivalent units. 100000 equivalent units. 89000 equivalent units. eTextbook and Media Which of the following compounds would most likely contain a covalent bond?Cl4CaCl2LiBrKINaCl Predict the three possible structures of [Os6(CO)18H2] using the Wade- Mingos rules and comment on the relative stability of the conformers. Thomson's Plum Pudding Model Rutherford's Nucleus Model Atomic models have changed over the decades. Two early atomic models can be seen above in the pictures. Find the difference between the two models. what value does Euler phi function (1) = ?has. Why did many workers lose their lives setting gunpowder into the cliffs? A. The wind sometimes blew the workers too close to the lighted fuse. B. The workers had only a short time between lighting the fuse and getting to the cliff top. C. The men up above did not always see the hand signals of the workers bel solve the rational inequality and graph the solution set on the real number line.Express the solution set in interval notation (x-1)/(x-2) 0 During the month of July, isotherms (lines of points with equal temperature that span the whole planet) generally bend over land To the north in both hemispheres To the south in both hemispheres To the south in the northern hemisphere and to the north in the southern hemisphere To the north in the northern hemisphere and to the south in the southern hemisphere A company reported that 76% of 1721 randomly selected college freshmen returned to college the next year. The study was stratified by type of college_-public or private. The retention rates were 74.5% among 550 students enrolled in public colleges and 76.7% among 1171 students enrolled in private colleges. The company found 95% confidence intervals for retention rates. Suppose that the company wants to update its information on the percentage of freshmen that retum for a second year of college. Complete parts a and below. a) It wants to cut the stated margin of error in half. How many college freshmen must be surveyed? Evaluate the determinant 347112213 While observing the year-end inventory of Ethical Manufacturing Company, the plant manager offers Herb Standard a fishing rod, which Ethical manufactures, in appreciation for a job well done. 4. Herb Standard's acquaintance, Joe Lender, is chief loan officer at Local Bank, an audit client of Cash \& Green. Herb approaches Joe for an unsecured loan from Local Bank and Joe approves the loan. 5. Herb Standard is a member of a local investment club composed of college fraternity brothers. The club invests in listed stocks and is fairly active in trading. Last week the club purchased the stock of Leverage Corp., a client of another Cash \& Green office. Herb has no contact with the members of this office. equired or each situation, (a) identify the ethical issues that are involved and (b) discuss whether there has or as not been any violation of ethical conduct. Support your answers by reference to the rules of the ICPA Code of Professional Conduct, available at the AICPA website (www.aicpa.org). Class, access the balance sheet of a publicly traded company, and list what items of assets are reported in the property, plant, and equipment section on the asset side. Select any one item from the property, plant, and equipment section, and discuss how you determine the cost of that item to be reported on the balance sheetPls give me plagiarism free answer Rafael owns a restaurant and requires all employees to wash their hands thoroughlyafter using the bathroom. Why is this important?(1 point)O Failing to wash hands brings pathogens into the kitchen.If washing hands is a rule, most employees will rinse their hands at a minimum.Most customers do not wash their hands, so the staff needs to.The water in most bathrooms is warm enough to kill germs. The G=(V,E) is a network graphic, and V is the vertex set, and E is the edge set. V=(u,v,w,x,y,z), and E=((u,v),(u,w),(u,x),(v,w),(v,x),(w,x),(w,y), (w,z),(x,y),(y,z)). Let c(x,y) denotes the cost of edge (x,y). c(u,v)=2, c(u,w)=5, c(u,x)=1, c(v,w)=3, c(v,x)=2, c(w,x)=3, c(w,y)=1, c(w,z)=5, c(x,y)=1,c(y,z)=2; What is the lowest cost path from u to z? (for example the path u->x->w is uxw) 1. King's Ranch in Texas is approximately 825,000 acres. How many square miles is this? Use the following conversion factors: 1 acre = 43,560 ft2 and 1 mi = 5280 ft. 2. Ibuprophen suspensions for infants contains 80. mg/4.0 mL of suspension. The recommended dosage is 10. mg/kg of body weight. How many mL of suspension is needed for a 19 lb infant. Use the conversion factor 1 lb = 454 g. 1- According to the Market Power Spectrum, and its explanation, which of the following is the best option with which for consumers to do business?Group of answer choicesMonopoliesPerfect CompetitorsOligopoliesMonopolistic Competitors2-Which of these is NOT a Fixed cost to a business?Group of answer choicesWages to employeesOffice or Building RentLiability InsuranceLease payments on Copier and The delivery truck3-Which of these ARE characteristics of Perfect (or Pure) competitors?Select all that apply!Group of answer choicesProducing a Homogeneous OutputVery Large Numbers of Firmssubject to free entry and exitSignificant Market SharesFacing a Flat Demand Curve This is a lab report following the guide that is posted in the course materials. Make sure you start with the objective and then follow through with the rest of the format.Make sure that the data in sentence form and ALL other requirements are in the conclusion in their proper order.Finally, AFTER the conclusion make sure to show worked-out answers for the following questions from the lab manual. I have provided the correct formula Ca3(PO4)2 and Fe2(SO4)3 (You are only doing A and B)Questions:1. Calculate the percent by mass of each element in the following compounds:a. Calcium phosphateChemical Formula= Ca3(PO4)2Formula Mass=%Ca=%P=%O=b. Iron(III) sulfateChemical Formula= Fe2(SO4)3Formula Mass=%Fe=