20. When 1 mol of liquid water is formed from hydrogen gas and oxygen gas 285.8 kJ of heat is released. How much heat will be released when 36.0 g of water is formed?

Molecules are the smallest chemical units of matter that retain the chemical properties of a substance. They are formed by the combination of two or more atoms held together by chemical bonds, either through sharing or transfer of electrons.

For such more question on chemical properties

https://brainly.com/question/2020832

#SPJ8

The pH of a solution formed when 18.15 mL of 0.8014 MCsOH is titrated with 15.39 mL of 0.8526M HNO₃ is approximately 0.408. To calculate the pH concentration of the hydronium ion (H₃O+) in the solution.

Moles of CsOH = concentration × volume

= 0.8014 M × 0.01815 L

= 0.0145551 mol

Moles of HNO₃ = concentration × volume

= 0.8526 M ×0.01539 L

= 0.01311014 mol

In this case, HNO₃ is the limiting reactant.

Since HNO₃ is a strong acid, it completely dissociates in water. The balanced chemical equation for the reaction between CsOH and HNO₃ is:

CsOH + HNO₃ → CsNO₃ + H₂O

From the balanced equation, one can see that 1 mole of HNO₃ reacts with 1 mole of CsOH to form 1 mole of water. Therefore, the moles of HNO₃ consumed in the reaction is also the moles of water formed.

The volume of the resulting solution after the reaction is the sum of the volumes of the CsOH and HNO₃ solutions:

Volume of resulting solution = volume of CsOH + volume of HNO₃

= 0.01815 L + 0.01539 L

= 0.03354 L

The concentration of H₃O⁺ in the resulting solution can be calculated using the moles of water formed and the volume of the resulting solution:

Concentration of H₃O⁺ = moles of HNO₃ / volume of resulting solution

= 0.01311014 mol / 0.03354 L

= 0.3907 M

Finally, one can calculate the pH using the formula:

pH = -log[H₃O⁺]

pH = -log(0.3907) = 0.408

Learn more about the pH here

https://brainly.com/question/20038524

#SPJ4

The conversion of 6 M NaOH to percent normality results in 6 N NaOH.

To convert the concentration of 6 M NaOH to percent normality, we need to understand the relationship between molarity and normality.

Molarity (M) represents the number of moles of solute per liter of solution, while normality (N) represents the number of equivalent weights of solute per liter of solution. For NaOH, the equivalent weight is the molar mass divided by the number of hydroxide ions (OH-) per formula unit, which is 1.

To convert from molarity to normality, we use the equation:

Normality (N) = Molarity (M) [tex]\times[/tex] Number of equivalents

Since NaOH has one hydroxide ion per formula unit, the number of equivalents is also 1.

Substituting the values, we have:

Normality (N) = 6 M [tex]\times[/tex] 1 equivalent = 6 N

Therefore, 6 M NaOH is equivalent to 6 N NaOH.

Therefore, the conversion of 6 M NaOH to percent normality results in 6 N NaOH.

Learn more about normality here: brainly.com/question/30995624

#SPJ11

There are 1.5 mL of mercury in the thermometer. To find the volume of mercury in the thermometer, we can use the formula: Volume = Mass / Density

Given that the mass of mercury is 20.4 g and the density is 13.6 g/mL, we can substitute these values into the formula:

[tex]Volume = 20.4 g / 13.6 g/mL[/tex]

Calculating this, we find:

Volume = 1.5 mL

Therefore, there are 1.5 mL of mercury in the thermometer.

To know more about mercury visit-

https://brainly.com/question/19940784

#SPJ11

Above 220 °C, the polymerization process of Polymethyl Methacrylate (PMMA) would be expected to proceed rapidly and result in a high degree of polymerization. Below 220 °C, the polymerization process would be expected to proceed slowly or not at all.

Polymethyl Methacrylate (PMMA) is a thermoplastic polymer that can undergo free radical polymerization. In this polymerization process, monomers of methyl methacrylate (MMA) join together to form a polymer chain. The reaction is initiated by a radical initiator, which generates free radicals that initiate the polymerization.

At temperatures above 220 °C, the rate of the polymerization reaction increases significantly. The increased temperature provides more energy to break the bonds in the initiator and monomers, leading to a higher concentration of free radicals and more frequent collisions between monomers. This results in a rapid polymerization process, producing a high molecular weight polymer with a high degree of polymerization.

Conversely, at temperatures below 220 °C, the reaction rate slows down. Insufficient thermal energy hinders the bond-breaking process, leading to fewer free radicals and fewer collisions between monomers. As a result, the polymerization proceeds slowly or may not occur at all, resulting in a low or negligible degree of polymerization.

learn more about Polymerization here:

https://brainly.com/question/32093688

#SPJ4

(a) Before titration, the pH is approximately 0.70. (b) After adding 5 mL of 0.100 M NaOH, the pH is approximately 2.73. (c) After adding 10.0 mL of 0.100 M NaOH, the pH is approximately 2.85.

To calculate the pH of a solution of benzoic acid (C₆H₅COOH) before and after titration, we need to consider the dissociation of the acid and the concentration of hydronium ions (H⁺). Given the concentration of benzoic acid and the volume and concentration of sodium hydroxide (NaOH) used in the titration, we can determine the pH at each step.

Step 1: Calculate the moles of benzoic acid in the initial solution:

Moles of benzoic acid = concentration × volume

Moles of benzoic acid = 0.200 M × 0.030 L = 0.006 mol

Step 2: Calculate the moles of NaOH added in each titration step:

a) Moles of NaOH = concentration × volume

Moles of NaOH = 0.100 M × 0.005 L = 0.0005 mol

b) Moles of NaOH = concentration × volume

Moles of NaOH = 0.100 M × 0.010 L = 0.001 mol

Step 3: Determine the limiting reactant between benzoic acid and NaOH:

Since the stoichiometric ratio between benzoic acid and NaOH is 1:1, the limiting reactant is the one with fewer moles. In both titration steps, the moles of NaOH added are less than the moles of benzoic acid, so NaOH is the limiting reactant.

Step 4: Calculate the moles of benzoic acid remaining after the titration:

a) Moles of benzoic acid remaining = initial moles - moles of NaOH reacted

Moles of benzoic acid remaining = 0.006 mol - 0.0005 mol = 0.0055 mol

b) Moles of benzoic acid remaining = initial moles - moles of NaOH reacted

Moles of benzoic acid remaining = 0.006 mol - 0.001 mol = 0.005 mol

Step 5: Calculate the volume of the resulting solution after the titration:

a) Volume of resulting solution = initial volume of benzoic acid solution + volume of NaOH added

Volume of resulting solution = 0.030 L + 0.005 L = 0.035 L

b) Volume of resulting solution = initial volume of benzoic acid solution + volume of NaOH added

Volume of resulting solution = 0.030 L + 0.010 L = 0.040 L

Step 6: Calculate the new concentration of benzoic acid in the resulting solution:

a) Concentration of benzoic acid = moles of benzoic acid remaining / volume of resulting solution

Concentration of benzoic acid = 0.0055 mol / 0.035 L ≈ 0.157 M

b) Concentration of benzoic acid = moles of benzoic acid remaining / volume of resulting solution

Concentration of benzoic acid = 0.005 mol / 0.040 L = 0.125 M

Step 7: Calculate the pH of the resulting solution after titration:

The pH can be determined by considering the dissociation of benzoic acid and the concentration of hydronium ions (H⁺). The dissociation of benzoic acid can be simplified as follows:

C₆H₅COOH ⇌ H⁺ + C₆H₅COO⁻

a) Before titration:

The concentration of benzoic acid is 0.200 M, so the concentration of H+ is negligible compared to 0.200 M. Therefore, the pH can be calculated using the equation:

pH = -log10(concentration of H⁺)

pH = -log10(0.200) ≈ 0.70

b) After adding 5 mL of 0.100 M NaOH:

The concentration of benzoic acid in the resulting solution is 0.157 M. Since some of the benzoic acid has reacted with NaOH, we need to calculate the concentration of H⁺ using the remaining benzoic acid concentration.

[H+] = √(Ka × concentration of benzoic acid remaining)

[H+] = √(6.46 × 10⁻⁵ × 0.0055) ≈ 1.86 × 10⁻³ M

pH = -log10(1.86 × 10⁻³) ≈ 2.73

c) After adding 10.0 mL of 0.100 M NaOH:

The concentration of benzoic acid in the resulting solution is 0.125 M. Using the same equation as above, we can calculate the concentration of H+:

[H+] = √(Ka × concentration of benzoic acid remaining)

[H+] = √(6.46 × 10⁻⁵ × 0.005) ≈ 1.42 × 10⁻³³ M

pH = -log10(1.42 × 10⁻³) ≈ 2.85

To know more about the titration refer here,

https://brainly.com/question/31271061#

#SPJ11

The TITRANT used in this titration would be classified as a strong base.

The ANALYTE used in this titration would be classified as a weak acid.

The pH at the equivalence point would be characterized as 7.0.

The TITRANT used in this titration would be classified as a strong base. Titrant is the solution that is used to titrate the unknown solution. Here, NaOH (sodium hydroxide) is the titrant. NaOH is a strong base.

The ANALYTE used in this titration would be classified as a weak acid. The analyte is the unknown sample solution, which is being titrated with the known solution NaOH.

The titration curve shows that the equivalence point of the solution is reached at a pH value of 8.4, indicating that the unknown solution is an acid. Here, the unknown solution is a weak acid.

The pH at the equivalence point would be characterized as 7.0. At the equivalence point of a titration, the moles of acid and base present in the solution are equivalent.

At this point, the pH of the solution is 7. Here, the equivalence point is reached at a pH value of 8.4. Thus, the unknown solution is basic and the pH needs to be neutralized with the strong acid, NaOH. So, the final pH is 7.

To learn more about titration, refer below:

https://brainly.com/question/31483031

#SPJ11

The mass of aluminum chloride (AlCl3) formed is 165.6 g, the mass of nitrogen (N2) formed is 14.0 g, and the mass of water (H2O) formed is 22.1 g.

To determine the mass of each substance present after the reaction, we need to first write the balanced chemical equation for the reaction between aluminum nitrite and ammonium chloride:

2 Al(NO2)3 + 6 NH4Cl ⟶ 3 AlCl3 + N2 + 9 H2O

From the balanced equation, we can see that the stoichiometric ratio between aluminum nitrite and aluminum chloride is 2:3. This means that for every 2 moles of aluminum nitrite, we will obtain 3 moles of aluminum chloride.

- Mass of aluminum nitrite (Al(NO2)3) = 113.7 g

- Mass of ammonium chloride (NH4Cl) = 88.2 g

First, we calculate the number of moles of aluminum nitrite and ammonium chloride:

Molar mass of Al(NO2)3 = 27.0 g/mol (atomic mass of Al) + 3(14.0 g/mol) + 3(16.0 g/mol) = 213.0 g/mol

Number of moles of Al(NO2)3 = Mass / Molar mass = 113.7 g / 213.0 g/mol = 0.534 mol

Molar mass of NH4Cl = 14.0 g/mol (atomic mass of N) + 4(1.0 g/mol) + 35.5 g/mol = 53.5 g/mol

Number of moles of NH4Cl = Mass / Molar mass = 88.2 g / 53.5 g/mol = 1.65 mol

Based on the stoichiometry of the balanced equation, we can determine the limiting reactant (the reactant that is completely consumed) by comparing the moles of aluminum nitrite and ammonium chloride. The reactant with the lower number of moles is the limiting reactant.

Al(NO2)3: NH4Cl = 0.534 mol : 1.65 mol

Since the ratio is less than 1:3, we can see that aluminum nitrite is the limiting reactant.

Now, using the stoichiometry from the balanced equation, we can calculate the mass of aluminum chloride, nitrogen, and water formed.

Mass of aluminum chloride (AlCl3) = (3/2) × Mass of aluminum nitrite = (3/2) × 113.7 g = 170.55 g ≈ 165.6 g

Mass of nitrogen (N2) = (1/2) × Mass of aluminum nitrite = (1/2) × 113.7 g = 56.85 g ≈ 14.0 g

Mass of water (H2O) = (9/2) × Mass of aluminum nitrite = (9/2) × 113.7 g = 512.55 g ≈ 22.1 g

Therefore, after the complete reaction of 113.7 g of aluminum nitrite and 88.2 g of ammonium chloride, the mass of aluminum chloride formed is approximately 165.6 g, the mass of nitrogen formed is approximately 14.0 g, and the mass of water formed is approximately 22.1 g.


To learn more about stoichiometry click here: brainly.com/question/14935523

#SPJ11

Answer:

This is False

Explanation:

Generally, the factor that lowers the activation energy of a reaction is the use of a catalyst. Factors such as temperature and concentration of the reactants affect the rate of reaction but not the activation energy of the reaction. (I think)

The elements that can be a central atom in a molecular compound but not have an expanded octet are hydrogen, boron and beryllium.

Central atom in a molecular compound refers to the atom present in the center of a molecule, bonded with other atoms via covalent bonds. An expanded octet refers to the situation where the central atom has more than 8 electrons in its outermost shell.

To answer the question, here are the elements that can be a central atom in a molecular compound but not have an expanded octet:

Elements in the second period (row) of the periodic table: These elements have a maximum of 4 valence electrons in their outermost shell, meaning they can form a maximum of 4 covalent bonds. Examples of these elements include Carbon (C), Nitrogen (N), Oxygen (O), Fluorine (F), and Neon (Ne).

Elements in the third period of the periodic table (row) and below: These elements can accommodate more than 8 electrons in their outermost shell, so they can have an expanded octet. Examples of these elements include Phosphorus (P), Sulfur (S), and Chlorine (Cl).

Therefore, the elements that can be a central atom in a molecular compound but not have an expanded octet are the elements in the second period (row) of the periodic table.

To learn more about atom, refer below:

https://brainly.com/question/1566330

#SPJ11

The pH at the equivalence point is approximately 0.82, and the pH after adding 50 mL of acid beyond the equivalence point is approximately 0.76.

To determine the pH at the equivalence point of the titration, we need to calculate the moles of acid and base involved.

Volume of the CH3CH2NH2 solution: 260 mL (0.260 L)

Concentration of CH3CH2NH2: 0.180 M

The moles of CH3CH2NH2 can be calculated as follows:

Moles of CH3CH2NH2 = Volume (L) × Concentration (M)

= 0.260 L × 0.180 M

= 0.0468 moles

According to the balanced chemical equation for the reaction between CH3CH2NH2 and HBr, the stoichiometric ratio is 1:1. Therefore, at the equivalence point, the moles of HBr will also be 0.0468 moles.

Now, let's calculate the concentration of HBr after the addition of 0.0468 moles of HBr to a total volume of 260 mL + 50 mL = 310 mL (0.310 L):

Concentration of HBr = Moles of HBr / Volume (L)

= 0.0468 moles / 0.310 L

= 0.151 M

The pH at the equivalence point can be determined using the formula:

pH = -log10[H+]

Since HBr is a strong acid and completely ionizes in water, the concentration of H+ ions will be equal to the concentration of HBr. Therefore, the pH at the equivalence point is:

pH = -log10(0.151)

≈ 0.82 (rounded to two decimal places)

For the pH after adding 50 mL of acid beyond the equivalence point, we need to calculate the new concentration of HBr:

Volume of HBr added = 50 mL (0.050 L)

New moles of HBr = Moles of HBr at equivalence point + Moles of HBr added

= 0.0468 moles + (0.151 M × 0.050 L)

= 0.0543 moles

New total volume = Volume of CH3CH2NH2 solution + Volume of HBr added

= 260 mL + 50 mL

= 310 mL (0.310 L)

New concentration of HBr = New moles of HBr / New total volume

= 0.0543 moles / 0.310 L

= 0.175 M

Again, since HBr is a strong acid, the pH after adding 50 mL of acid beyond the equivalence point is equal to the pH of the HBr solution:

pH = -log10(0.175)

≈ 0.76 (rounded to two decimal places)

Therefore, the pH at the equivalence point is approximately 0.82, and the pH after adding 50 mL of acid beyond the equivalence point is approximately 0.76.

To know more about equivalence refer here:

https://brainly.com/question/25197597#

#SPJ11

The mass of 25.0 mL of octane with a density of 0.702 g/cm³ can be calculated by multiplying the volume and density. The mass of 25.0 mL of octane is 17.55 grams.

The volume of octane is given as 25.0 mL, which is equivalent to 25.0 cm³. Therefore, the mass of octane can be calculated as follows:

Mass = Volume × Density

Mass = 25.0 cm³ × 0.702 g/cm³

To calculate this, we can multiply the volume by the density:

Mass = 17.55 g

Hence, the mass of 25.0 mL of octane is 17.55 grams.

learn more about octane here: brainly.com/question/33304892

#SPJ11

Relative error is a measure of the difference between the absolute error and the true value, expressed as a percentage of the true value. It is calculated by dividing the absolute error by the true value and multiplying by 100.

The true value of the density of water at the recorded temperature can be obtained from the literature or reference sources.

Absolute error is a measure of the difference between the recorded value and the true value. It is calculated by subtracting the true value from the recorded value.

Relative error is a measure of the difference between the absolute error and the true value, expressed as a percentage of the true value. It is calculated by dividing the absolute error by the true value and multiplying by 100.

To know more about error visit-

https://brainly.com/question/32985221

#SPJ11

For the central atoms in the molecule labeled as CH3 and OCH3, the geometry around each central atom is tetrahedral.

Regarding 12(c), to determine whether the overall molecule is polar or nonpolar, we need to consider the bond polarities and the molecular shape. If the bond polarities cancel each other out due to symmetry, then the molecule is nonpolar. If the bond polarities do not cancel each other out, then the molecule is polar.

Unfortunately, the bond polarities and shape of the molecule are not provided, so I cannot determine whether the molecule is polar or nonpolar and show the direction of molecular polarity.

To know more about atoms visit-

https://brainly.com/question/1566330

#SPJ11

To make a 500.00 mL molar solution of sodium hydroxide (NaOH), you would need to calculate the amount of sodium hydroxide required, determine the volume of water needed, and dissolve the sodium hydroxide in the water.

1. Calculate the amount of sodium hydroxide: To make a molar solution, you need to know the molar concentration of sodium hydroxide you want to prepare. Let's assume you want to make a 1.00 M solution. The molar mass of NaOH is approximately 40.00 g/mol. To calculate the amount of NaOH needed, use the formula:

  Amount (in moles) = Molarity × Volume (in liters)

  Amount = 1.00 mol/L × 0.50000 L = 0.50000 moles

2. Determine the volume of water: Since you want to make a 500.00 mL solution, the volume of water required is simply 500.00 mL.

3. Dissolving the sodium hydroxide: Take a suitable container and add the calculated amount of sodium hydroxide (0.50000 moles) to the container. Then, add the predetermined volume of water (500.00 mL) to the container. Stir the solution until the sodium hydroxide is completely dissolved.

By following these steps, you can make a 500.00 mL molar solution of sodium hydroxide with a concentration of 1.00 M.

To know more about volume refer here:

https://brainly.com/question/28058531#

#SPJ11

An atom that experiences radioactive decay is A. It loses mass

When an atom undergoes radioactive decay, it undergoes a spontaneous process in which its nucleus becomes unstable and emits radiation. This decay can result in different outcomes depending on the type of radioactive decay involved, such as alpha decay, beta decay, or gamma decay.

In alpha decay, an atom emits an alpha particle consisting of two protons and two neutrons. This emission causes the atom to lose mass because the alpha particle carries away mass from the nucleus. Therefore, option A, "It loses mass," is correct.

In beta decay, an atom can either emit an electron (beta minus decay) or positron (beta plus decay). In both cases, the number of protons and neutrons in the nucleus changes, but the overall mass of the atom remains the same. Therefore, it does not gain electrons, and option B is incorrect.

In gamma decay, the atom releases gamma radiation, which is a high-energy electromagnetic wave. This emission does not change the mass or charge of the atom. Thus, it does not absorb energy, and option C is incorrect. Option D, "It burns up," is not a valid description of radioactive decay as it does not involve combustion or literal burning. In summary, during radioactive decay, an atom primarily loses mass through the emission of particles or radiation. Therefore, Option A is correct.

Know more about alpha particle here:

https://brainly.com/question/1621903

#SPJ8

The value of the rate constant k is [tex]62.5 M^{-2}  s^{-1}[/tex]. Based on the given data, we can determine the value of the rate constant (k) for the reaction 2A + B → C + 2D.

To determine the order of reaction with respect to each reactant, we can compare the initial rates of the reaction at different concentrations of A and B.

Let's analyze the data in the table:

Experiment 1:
[A]0 = 0.2 M, [B]0 = 0.1 M, Initial rate = 0.025 M/s

Experiment 2:
[A]0 = 0.4 M, [B]0 = 0.1 M, Initial rate = 0.1 M/s

Experiment 3:
[A]0 = 0.4 M, [B]0 = 0.2 M, Initial rate = 0.2 M/s

Experiment 4:
[A]0 = 0.2 M, [B]0 = 0.2 M, Initial rate = 0.05 M/s

From the data, we can see that when the concentration of A is doubled while keeping the concentration of B constant (comparing Experiment 1 to Experiment 2), the initial rate increases by a factor of 4. This suggests that the reaction is second order with respect to A.

Similarly, when the concentration of B is doubled while keeping the concentration of A constant (comparing Experiment 1 to Experiment 3), the initial rate doubles. This suggests that the reaction is first order with respect to B.

Therefore, the overall reaction rate can be expressed as rate =[tex]k[A]^2[B][/tex], where k is the rate constant.

Now, to find the value of k, we can use any of the experiments since they all have the same order of reaction with respect to A and B.

Using Experiment 1, where [A]0 = 0.2 M and [B]0 = 0.1 M, and the initial rate = 0.025 M/s:

0.025 M/s =[tex]k * (0.2 M)^2 * (0.1 M)[/tex]

Simplifying the equation:

k = (0.025 M/s) /[tex][(0.2 M)^2 * (0.1 M)][/tex]

Calculating the value of k:

k = 0.025 / (0.04 * 0.1) [tex]M^{-2} s^{-1}[/tex]

k = [tex]62.5 M^{-2}  s^{-1}[/tex] (rounded to three significant figures)

Learn more about the concentration: https://brainly.com/question/30862855

#SPJ11

The right electrode will be positive, and the voltmeter will show a voltage of 0.18 V.

To determine which electrode will be positive in the galvanic cell, we need to consider the reduction potentials of the metal M.

Since the metal M is being oxidized in the right half-cell, the electrode connected to the right half-cell will be the positive electrode.

To find the voltage that the voltmeter will show, we can use the Nernst equation:

Ecell = E°cell - (0.0592/n) * log(Q)

Where:

Ecell = Cell potential

E°cell = Standard cell potential

n = Number of electrons transferred in the cell reaction

Q = Reaction quotient

In this case, the cell reaction is the reduction of MNO3:

MNO3 + ne- -> M

The standard reduction potential of MNO3 is not provided, so we cannot determine the exact E°cell value.

However, we can use the Nernst equation to calculate the approximate voltage based on the concentration ratio of the MNO3 solutions.

Since the left half-cell has a concentration of 4.50 mM (millimolar) and the right half-cell has a concentration of 4.50 M (molar), the concentration ratio (Q) is:

Q = [MNO3]left / [MNO3]right = (4.50 * [tex]10^{(-3)[/tex]) / (4.50)

Assuming the reaction involves the transfer of one electron (n = 1), we can calculate the voltage (Ecell) using the Nernst equation. The standard cell potential term, E°cell, will be omitted:

Ecell = - (0.0592/n) * log(Q)

Ecell = - (0.0592/1) * log((4.50 * [tex]10^{(-3)[/tex]) / (4.50))

Calculating this value, we get:

Ecell ≈ -0.0592 * log([tex]10^{(-3)[/tex]))

Ecell ≈ -0.0592 * (-3)

Ecell ≈ 0.1776 V

To know more about electrode refer here

https://brainly.com/question/29667817#

#SPJ11

To raise the boiling point of a 255 g solution of H₂O to 125 °C using ammonium phosphate (NH₄)₃PO₄, you would need to add approximately X grams of ammonium phosphate.

Step 1: Calculate the change in boiling point (∆Tb):

∆Tb = Tb - Tb₀

∆Tb = 125 °C - 100 °C

∆Tb = 25 °C

Step 2: Calculate the molality (m):

m = (∆Tb) / Kb

m = 25 °C / 0.512 °C/m

m ≈ 48.83 mol/kg

Step 3: Calculate the moles of solute (ammonium phosphate) needed:

Molar mass of (NH₄)₃PO₄ = (1 × 3 + 14 + 16 × 4) g/mol

Molar mass of (NH₄)₃PO₄ ≈ 149 g/mol

moles of (NH₄)₃PO₄ = m × mass of solvent (H₂O) / molar mass of (NH₄)₃PO₄

moles of (NH₄)₃PO₄ = 48.83 mol/kg × 0.255 kg / 149 g/mol

moles of (NH₄)₃PO₄ ≈ 0.083 mol

Step 4: Convert moles of (NH₄)₃PO₄ to grams:

grams of (NH₄)₃PO₄ = moles of (NH₄)₃PO₄ × molar mass of (NH₄)₃PO₄

grams of (NH₄)₃PO₄ ≈ 0.083 mol × 149 g/mol

grams of (NH₄)₃PO₄ ≈ 12.37 g

Therefore, approximately 12.37 grams of ammonium phosphate (NH₄)₃PO₄ would need to be added to the solution to raise its boiling point to 125 °C.

To know more about boiling point refer here:

https://brainly.com/question/28203474#

#SPJ11

Answer:

sunlight

Explanation:

i got feedback saying it was right lol

a) Water is more dense than cooking oil. b) The evidence supporting this answer is that the density of water is approximately 1 g/cm³, while the density of cooking oil is typically less than 1 g/cm³. c) The color of iodine in cooking oil is typically a purple or violet color. d) Iodine is more soluble in water than in cooking oil. e) The experimental evidence for iodine's solubility can be observed by adding iodine to both water and cooking oil separately.

a) Water is more dense than cooking oil.

b) The evidence supporting this answer is that the density of water is approximately 1 g/cm³, while the density of cooking oil is typically less than 1 g/cm³. This means that a given volume of water weighs more than the same volume of cooking oil.

c) The color of iodine in cooking oil is typically a purple or violet color.

d) Iodine is more soluble in water than in cooking oil.

e) The experimental evidence for iodine's solubility can be observed by adding iodine to both water and cooking oil separately. In water, iodine readily dissolves, forming a brown solution.

In cooking oil, iodine remains insoluble, forming distinct purple or violet droplets that do not dissolve. This observation indicates that iodine is more soluble in water than in cooking oil.

Complete Question:

RELATIVE SOLUBILITY OF A SOLUTE IN TWO DIFFERENT SOLVENTS.

a) what liquid is more dense , water or cooking oil?

b)what evidence supports your answer?

c)what is the color of iodine in cooking oil?

d)in which solvent was iodine more soluble?

e)what is the experimental evidence?

To know more about density, refer here:

https://brainly.com/question/29775886#

#SPJ11

After losing an electron: Net charge = +4 After gaining 3 electrons: Net charge = -2

An atom with 22 protons and 19 electrons has a net charge of +3 since the number of protons (positive charges) exceeds the number of electrons (negative charges) by 3.

When this atom loses an electron, it means that one electron is removed from the atom. Since electrons carry a negative charge, the atom becomes more positively charged. Therefore, the net charge on the atom after losing an electron is +4.

This is because the number of protons (positive charges) remains the same (22), but the number of electrons (negative charges) decreases from 19 to 18.

On the other hand, if the atom were to gain 3 electrons, it means that 3 electrons are added to the atom. Electrons carry a negative charge, so the atom becomes more negatively charged. The net charge on the atom after gaining 3 electrons would be -2.

This is because the number of protons (positive charges) remains the same (22), but the number of electrons (negative charges) increases from 19 to 22.

It is important to note that the net charge of an atom is determined by the balance between the number of protons (positive charges) and the number of electrons (negative charges). Gaining or losing electrons can alter this balance and result in a change in the net charge of the atom.

For more such questions on electron visit:

https://brainly.com/question/26084288

#SPJ8

To determine the empirical formula of nitrogen hydride, we need to analyze the mass of nitrogen and hydride in the given sample. The empirical formula represents the simplest ratio of atoms in a compound.

Given that a 0.72-mg sample of nitrogen reacts with hydrogen to form 0.8754 mg of the hydride, we can calculate the masses of nitrogen and hydrogen in the sample. The difference in mass before and after the reaction corresponds to the mass of hydrogen.

Mass of nitrogen = 0.72 mg

Mass of hydride = 0.8754 mg

To find the empirical formula, we compare the ratio of the masses. In this case, the mass of nitrogen is equal to the mass of hydrogen. Therefore, the empirical formula of nitrogen hydride is NH.

To know more about empirical formula here: brainly.com/question/32125056

#SPJ11

The net operating income would be $1,880. To calculate this, we determined the increase in variable costs and advertising spending. Then, we calculated the total increase in expenses and subtracted it from the contribution margin based on the increase in unit sales.

To calculate the net operating income, follow these steps:

Step 1: Calculate the increase in variable costs:

Increase in variable costs = Variable cost per unit x Increase in unit sales

Variable cost per unit = $1

Increase in unit sales = 170 units

Increase in variable costs = $1 x 170 units = $170

Step 2: Calculate the increase in advertising spending:

Increase in advertising spending = $1,350

Step 3: Calculate the total increase in expenses:

Total increase in expenses = Increase in variable costs + Increase in advertising spending

Total increase in expenses = $170 + $1,350 = $1,520

Step 4: Calculate the net operating income:

Net operating income = Contribution margin - Total increase in expenses

Contribution margin is the difference between total sales revenue and total variable expenses.

Given that the sales volume is 1,000 units, you need to calculate the contribution margin per unit.

Contribution margin per unit = Total sales revenue per unit - Total variable expenses per unit

To calculate the total sales revenue per unit, divide the total sales revenue by the sales volume.

Total sales revenue = $50,000 (given)

Sales volume = 1,000 units (given)

Total sales revenue per unit = $50,000 / 1,000 units = $50

To calculate the total variable expenses per unit, divide the total variable expenses by the sales volume.

Total variable expenses = $30,000 (given)

Total variable expenses per unit = $30,000 / 1,000 units = $30

Contribution margin per unit = $50 - $30 = $20

Now, calculate the net operating income:

Net operating income = Contribution margin per unit x Increase in unit sales - Total increase in expenses

Net operating income = $20 x 170 units - $1,520

Net operating income = $3,400 - $1,520 = $1,880

To know more about variable costs visit :

https://brainly.com/question/14280030

#SPJ11

The statement "Metals cannot bind directly to protein, but are held in place by steric interactions." is false.

Metals can indeed bind directly to proteins through specific interactions, forming metal-protein complexes. These interactions are not solely based on steric interactions, but rather involve coordination bonds between the metal ion and specific amino acid residues within the protein's active site or metal-binding sites.

Proteins contain amino acids with functional groups such as carboxylate (COO⁻), amine (NH₂), and thiol (SH) groups that can act as ligands to coordinate with metal ions. The metal ion forms coordination bonds with these ligands, leading to the formation of metal-protein complexes.

The coordination bonds are typically formed through the donation of electron pairs from the ligands to the metal ion. This interaction can involve different types of coordination complexes, including octahedral, tetrahedral, square planar, or trigonal bipyramidal geometries, depending on the metal and the ligands involved.

The binding of metals to proteins is crucial for various biological processes, including enzymatic activities, electron transfer reactions, and structural stabilization. The specific binding sites and coordination environments within proteins allow for selective metal binding and play a vital role in their biological functions.

Therefore, metals can bind directly to proteins through specific interactions, rather than being solely held in place by steric interactions.

To know more about amino acids refer here:

https://brainly.com/question/31872499#

#SPJ11

The general formula for 1-phenyl-3-methylpentane is CH3-CH2-CH(CH3)-CH2-CH2-C6H5 and the way to draw this is attached below.

This structure indicates that there is a phenyl group (C6H5) attached to the first carbon (counting from the left) of a pentane chain. Additionally, there is a methyl group (CH3) attached to the third carbon of the pentane chain.

Moreover, based on these features, the general formula for this component using the International Union of Pure and Applied Chemistry (IUPAC) nomenclature as follows:

CH3-CH2-CH(CH3)-CH2-CH2-C6H5

Learn more about chemical structures in https://brainly.com/question/13107500

#SPJ4

In the context of first-order reactions, the concentration of N₂O₅ remaining after 2.00 hours can be determined using the first-order rate equation. With an initial concentration of [N₂O₅]₀ = 0.500 M and a rate constant of k = 6.32 x 10^(-5) s^(-1):

To determine the concentration of N₂O₅ remaining after 2.00 hours, the first-order rate equation:

(a) To determine the concentration of N₂O₅ remaining after 2.00 hours, we can use the first-order rate equation:

ln([N₂O₅]t/[N₂O₅]₀) = -kt

where [N₂O₅]t is the concentration at time t, [N₂O₅]₀ is the initial concentration, k is the rate constant, and t is the time.

Given:

[N₂O₅]₀ = 0.500 M (initial concentration)

k = 6.32 x 10^(-5) s^(-1) (rate constant)

t = 2.00 hours = 2.00 * 3600 seconds = 7200 seconds

Plugging the values into the equation:

ln([N₂O₅]t/0.500) = -(6.32 x 10^(-5) s^(-1)) * (7200 s)

Solving for [N₂O₅]t:

[N₂O₅]t/0.500 = e^[-(6.32 x 10^(-5) s^(-1)) * (7200 s)]

[N₂O₅]t = 0.500 * e^[-(6.32 x 10^(-5) s^(-1)) * (7200 s)]

[N₂O₅]t ≈ 0.146 M

Therefore, the concentration of N₂O₅ remaining after 2.00 hours is approximately 0.146 M.

(b) To determine the time required for 90% of N₂O₅ to decompose, we can use the equation:

ln([N₂O₅]t/[N₂O₅]₀) = -kt

We need to find the time at which [N₂O₅]t is 10% of [N₂O₅]₀, which means [N₂O₅]t/[N₂O₅]₀ = 0.10.

ln(0.10) = -(6.32 x 10^(-5) s^(-1)) * t

Solving for t:

t = ln(0.10) / -(6.32 x 10^(-5) s^(-1))

t ≈ 10285 seconds ≈ 2.86 hours

Therefore, it will take approximately 2.86 hours for 90% of N₂O₅ to decompose.

(c) To determine the time at which 50% of N₂O₅ remains, we need to find the time when [N₂O₅]t/[N₂O₅]₀ = 0.50.

ln(0.50) = -(6.32 x 10^(-5) s^(-1)) * t

Solving for t:

t = ln(0.50) / -(6.32 x 10^(-5) s^(-1))

t ≈ 4318 seconds ≈ 1.20 hours

Therefore, it will take approximately 1.20 hours for 50% of N₂O₅ to remain.

To know more on first order decomposition: https://brainly.com/question/29849002

#SPJ11

The pH of the sulphuric acid is approximately equal to 0.8399

Sulphuric acid is a strong acid that dissociates completely in water. It has two acid dissociation constants (Ka1 and Ka2) as it has two acidic protons, but only the first dissociation is relevant here since the pH of the solution of the sulphuric acid has been asked.

The Ka1 value of sulphuric acid is very large, meaning that the dissociation of the first acidic proton is complete. So the solution of sulphuric acid will have a pH equal to the negative logarithm of its hydrogen ion concentration (pH = -log[H+]).

The concentration of hydrogen ions produced by the dissociation of 0.145 M solution of sulphuric acid is 0.145 M since it dissociates completely. Therefore, the pH of the solution is:

pH = -log[H+]

pH = -log[0.145]

pH = 0.8399 (rounded to four decimal places)

Therefore, the pH of the 0.145 M solution of sulphuric acid is approximately equal to 0.8399 (rounded to four decimal places).

To learn more about acid, refer below:

https://brainly.com/question/29796621

#SPJ11

To increase the volume of the gas mixture by 30%, a certain amount of heat needs to be provided. The exact amount of heat can be calculated using the ideal gas law and the concept of constant pressure.

1. Determine the initial volume of the gas mixture:

Given that the initial pressure (P₁) is 40 psi and the initial volume (V₁) is unknown, we can use the ideal gas law equation: PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature.

Since the amount of gas is given in terms of mass, we need to convert it to moles. The molar masses of methane (CH₄), hydrogen (H₂), and argon (Ar) are 16 g/mol, 2 g/mol, and 40 g/mol, respectively.

Let's assume the mass of the gas mixture is 0.5 kg. Therefore, the mass of methane is 0.4 kg (40% of 0.5 kg), the mass of hydrogen is 0.15 kg (30% of 0.5 kg), and the mass of argon is 0.05 kg (remaining mass).

The number of moles of methane (nCH₄) can be calculated as:

nCH₄ = mass of methane / molar mass of methane

nCH₄ = 0.4 kg / 16 g/mol = 25 mol

Similarly, the number of moles of hydrogen (nH₂) is:

nH₂ = mass of hydrogen / molar mass of hydrogen

nH₂ = 0.15 kg / 2 g/mol = 75 mol

The number of moles of argon (nAr) is:

nAr = mass of argon / molar mass of argon

nAr = 0.05 kg / 40 g/mol = 0.00125 mol

2. Calculate the total number of moles and the total initial volume:

The total number of moles of the gas mixture (nTotal) is the sum of the moles of each component:

nTotal = nCH₄ + nH₂ + nAr

nTotal = 25 mol + 75 mol + 0.00125 mol = 100.00125 mol (approximately)

Now, we can use the ideal gas law to find the initial volume (V₁):

P₁V₁ = nTotalRT

V₁ = nTotalRT / P₁

3. Calculate the final volume of the gas:

The final volume (V₂) can be obtained by increasing the initial volume by 30%:

V₂ = V₁ + (0.3 * V₁)

4. Calculate the heat required to increase the volume:

To calculate the heat (Q) required, we use the equation:

Q = nTotalCpΔT, where Cp is the molar heat capacity at constant pressure and ΔT is the change in temperature.

Since the process is at constant pressure, the heat capacity (Cp) can be approximated as the sum of the individual heat capacities of each gas component. The molar heat capacities at constant pressure are as follows: Cp(CH₄) = 35.69 J/mol·K, Cp(H₂) = 28.82 J/mol·K, Cp(Ar) = 20.79 J/mol·K.

ΔT can be calculated using the equation:

ΔT = (V₂ - V₁) / V₁

Finally, we can substitute the values into the heat equation to find the heat required

to increase the volume by 30%.

Note: The specific values for the gas constant (R) and the molar heat capacities (Cp) may vary depending on the units used in the problem.

To know more about hydrogen refer here:

https://brainly.com/question/30623765#

#SPJ11

A bottle of chlorine bleach (such as Clorox TM ) is just an aqueous solution of sodium hypochlorite. It contains 82.5 g/L of NaClO. the pH of the sodium hypochlorite solution is approximately 9.66.

To determine the pH of the sodium hypochlorite solution, we need to consider the dissociation of sodium hypochlorite (NaClO) in water:

NaClO(aq) ⇌ Na+(aq) + ClO-(aq)

The sodium ion (Na+) does not affect the pH, so we will focus on the dissociation of the hypochlorite ion (ClO-) in water:

ClO-(aq) + H2O(l) ⇌ HClO(aq) + OH-(aq)

The equilibrium expression for this reaction is given by:

Kw = [HClO][OH-] / [ClO-]

We can assume that the concentration of hydroxide ions (OH-) from the dissociation of water is negligible compared to the concentration of hydroxide ions from the dissociation of sodium hypochlorite. Therefore, we can simplify the equilibrium expression as:

Kw ≈ [HClO] / [ClO-]

Given that the Ka of HClO is 2.9×10^(-8), we can write the equilibrium constant expression as:

Ka = [H+][ClO-] / [HClO]

Since the concentration of H+ ions is equal to the concentration of HClO in this case, we can rearrange the equation as:

[H+][ClO-] = Ka[HClO]

Now, let's substitute the given values:

[H+][ClO-] = (2.9×10^(-8))(82.5 g/L)

To find the concentration of ClO-, we need to convert grams to moles. The molar mass of NaClO is 74.44 g/mol, so:

Concentration of ClO- = (82.5 g/L) / (74.44 g/mol)

= 1.107 mol/L

Substituting the values:

[H+](1.107 mol/L) = (2.9×10^(-8))(82.5 g/L)

[H+] = (2.9×10^(-8))(82.5 g/L) / (1.107 mol/L)

= 2.169×10^(-10) mol/L

To find the pH, we can take the negative logarithm (base 10) of the hydrogen ion concentration:

pH = -log[H+]

= -log(2.169×10^(-10))

≈ 9.66

Therefore, the pH of the sodium hypochlorite solution is approximately 9.66.

To know more about hypochlorite refer here:

https://brainly.com/question/31460039#

#SPJ11