23 inches of wire cost 92 cents at the same rate, how much (in cents) will 34 inches of wire cost?

Answers

Answer 1

Answer:

Step-by-step explanation:

Let's use the formula rate = cost/length to find the cost of one inch of wire. We know that 23 inches of wire cost 92 cents, so the rate of one inch of wire can be found by dividing 92 cents by 23 inches:

rate = cost/length = 92 cents/23 inches = 4 cents/inch

Now that we have found the rate of one inch of wire, we can use it to find the cost of 34 inches of wire. We simply multiply the rate by the length:

cost = rate * length = 4 cents/inch * 34 inches = 136 cents

So, 34 inches of wire will cost 136 cents.

Answer 2

Step-by-step explanation:

the trick is to find the "norm" rate, which is the rate for one unit.

from there we can get the rate for any number of units just by multiplying.

so,

23 in for 92 cents.

that means the rate is

23/92 = 23/(23×4) = 1/4

so, by dividing numerator and denominator by 23 (in this case it has an integer result also for the denominator) we get the price for 1 inch of wire : 4 cents.

so, 34 inches then have the length/price ratio (we multiply numerator and denominator by 34)

1/4 × 34/34 = 34/136

that means 34 inches cost 136 cents (= $1.36).


Related Questions

Write an equation in slope-intercept form for the line with slope -3/4 and y- intercept of 1.

Answers

The equation of the line will be y = -3/4x + 1.

What is an equation of the line?

An equation of the line is defined as a linear equation having a degree of one. The equation of the line contains two variables x and y. And the third parameter is the slope of the line which represents the elevation of the line.

The general form of the equation of the line:-

y = mx + c

m = slope

c = y-intercept

Slope = ( y₂ - y₁ ) / ( x₂ - x₁ )

The slope of the line is -3/4 and the y-intercept is 1. The equation of the line can be written as:-

y = mx + c

y = -3/4x + 1

Therefore, the line will have the equation y = -3/4x + 1.

To know more about an equation of the line follow

https://brainly.com/question/18831322

#SPJ9

The last customer of the day calls telling you they purchased 80 meters of fencing to fence in
a circular area around their flagpole. They want to know how much area of concrete they'd
need to buy to cover the entire circular pad around the flagpole. Using their fence as the
circumference, calculate how much area they will need to cover with the concrete for their
circular pad.

Answers

The area of circle that is needed to be filled with concrete is 509 m².

What is the definition of a circle?

A circle is a kind of ellipse with zero eccentricity and two coinciding foci. The locus of points drawn at equal distances from the centre is also known as a circle. A circle's radius is the distance between its centre and its outer line. A circle's diameter is the line that divides it into two equal halves and is equal to twice its radius.

A circle in the plane has the following equation:

(x-h)^²+ (y-k)² = r²

When the coordinate points are aligned (x, y)

(h, k) is the centre of a circle's coordinate.

r denotes the radius of a circle.

where 2πr is the circumference of the circle

πr²=circle's area

Now,

Given that circumference of the area=80 m

2πr=180

2*22/7*r=80

r=80*7/44

r=140/11 m

then area of the circular pad=πr²

=22/7*140/11*140/11

=2*20*140/11

=5600/11

=509 m²

hence,

              The area of circle that is needed to be filled with concrete is 509 m².        

To know more about circle visit the link

https://brainly.com/question/11833983?referrer=searchResults

#SPJ1

What is the average rate of change? Problem in the picture

Answers

The average rate of change over the interval (-1, 2) of the function is 3.

What is a parabola?

A parabola is a curve drawn in a plane. Where any point is at an equal distance from a fixed point (the focus) and a fixed straight line (the directrix).

A graph of the parabola is given.

The vertex is (-1, -4).

And the y-intercept is -3.

So, the equation of the parabola is,

y = (x + 1)² - 4.

The average rate of change over the interval (-1, 2):

= f(-1) - f(2)/(-1 - 2)

= (-4 - 5)/-3

= 3

Hence, 3 is the average rate of change.

To learn more about parabolas;

https://brainly.com/question/21685473

#SPJ1

For what value of x does 34x27x-³?

Answers

The value of x in the given equation using laws of exponents is; x = -9

How to use laws of exponents?

We want to solve the problem correctly expressed as;

3^(4x) = 27^(x - 3)

Now, some of the laws of exponents are;

1) Product of powers rule.

2) Quotient of powers rule.

3) Power of a power rule.

4) Power of a product rule.

5) Power of a quotient rule.

6) Zero power rule.

7) Negative exponent rule.

Now, 27^(x - 3) can also be expressed as;

3^(3(x - 3))

Now, according to power of power rule, if a base raised to a power is being raised to another power, the exponents are multiplied and the base remains the same. Thus;

3^(3(x - 3)) = 3^(3x - 9)

Thus, we now have;

3^(4x) = 3^(3x - 9)

4x = 3x - 9

3x - 4x = 9

-x = 9

x = -9

Read more about Laws of Exponents at; https://brainly.com/question/11761858

#SPJ1



1. Which of the fractions are closer to 1 than to 0?
2. Which of the fractions are closer to 0 than to 1?
3. Write two fractions with a denominator of 8 that are closer to 0
than to 1.
4. Use the benchmark and the fractions and to write three
comparison statements.

Answers

Answer:

where’s the options??

Step-by-step explanation:

Scientists are studying the temperature on a distant planet. Let y represent the temperature (in degrees Celsius). Let .x
represent the height above the surface (in kilometers). Suppose that x and y are related by the equation y = 47-5x.

Answers

The temperature on the surface of the planet, based on the equation for the temperature, is 47 degrees Celsius.

How to find the temperature ?

The equation given of y = 47 - 5x, is such that every one kilometer that we go from the surface of the planet, the temperature reduces by 5 degrees Celsius.

What this means is that at the surface of the planet the temperature is 47 degrees Celsius because this is the temperature when we have not gone a single kilometer above the surface.

Find out more on temperature at https://brainly.com/question/24746268

#SPJ1

The rest of the question is:

Note that a change can be an increase or a decrease.

For an increase, use a positive number. For a decrease, use a negative number.

What is the temperature on the surface of the planet?

How can the statement be rewritten as a conditional statement in if-then form? the sum of the digits of a two-digit number is less than the value of the original two-digit number.

Answers

The statement "the sum of a two-digit number is less than the value of the original two-digit number" can be rewritten as conditional statement. If the sum of two digits of a two-digit number is less than the value of the original two-digit number, the number is valid.

A conditional statement, "if p, then q," with p representing the hypothesis and q representing the conclusion. We can identify the hypothesis and conclusion by rewriting the statement "the sum of the digits of a two-digit number is less than the value of the original two-digit number" as an if-then conditional statement.

The hypothesis is the condition that must be satisfied in order to valid the conclusion. In this case, the hypothesis is "the sum of the digits of a two-digit number is less than the value of the original two-digit number".

By combining these, we can rewrite the statement as follows:

If the sum of a two-digit number's digits is less than the value of the original two-digit number, the number is valid.

The hypothesis (the sum of the digits of a two-digit number is less than the value of the original two-digit number) is a sufficient condition for the conclusion, according to this conditional statement (the number is valid). In other words, if the hypothesis is correct, we can be certain that the conclusion is correct as well.

To learn more about hypothesis.

https://brainly.com/question/29519577

#SPJ4

What is the y-
coordinate for the solution to the system of equations?
{−x + 3y = 9
{y=2/3x
Enter your answer as the correct value, like this: 42

Answers

The y-coordinate for the solution to the system of equations is 6.

What is LCM?

In mathematics, the value that is equally divided by the two supplied numbers is known as the LCM of any two. Least Common Multiple is its full name. Another name for it is the Least Common Divisor (LCD).

When the fractions' denominators differ, LCM can also be used to add or subtract any two fractions. LCM is used to make the denominators common when doing any arithmetic operations using fractions, such as addition and subtraction. The simplifying process is facilitated by this procedure.

The system of equation is given as:

−x + 3y = 9

y = 2/3x

The second equation can be written as:

x = 3/2y

Substituting the value of x in equation 1:

-3/2y + 3y = 9

Take the LCM:

-3y + 6y / 2 = 9

-3y + 6y = 18

3y = 18

y = 6

Hence, the y-coordinate for the solution to the system of equations is 6.

Learn more about system of equations here:

https://brainly.com/question/90105

#SPJ1


A chef bought 3 bags of beans. Each bag contains kilograms of beans. How
many kilograms of beans did she buy?

Answers

The chef bought a total of 4 1/5 kilograms of beans.

How many kilograms of beans did she buy?

Number of bags of beans the chef bought= 3

Quantity of beans in each bag = 1 2/5 kilograms

Total kilograms of beans bought by the chef= Number of bags of beans the chef bought × Quantity of beans in each bag

= 3 × 1 2/5

= 3 × 7/5

= 21/5

= 4 1/5 kilograms of beans

Ultimately, the chef bought 4 1/5 kilograms of beans.

Complete question:

a chef bought 3 bags of beans. Each bag contains 1 2/5 kilogram of beans. How many kilograms of beans did she buy?

Read more on kilograms:

https://brainly.com/question/15201918

#SPJ1

someone help me please

Answers

Step-by-step explanation:

This symbol is signma, which is the sub of all the X's after plugging them into the equation.

Just to show the pattern, the first 3 numbers on your table are 15, 13, and 13... doing those 3 with Sigma, and simplifying

[tex]( {1 5 - 2)}^{2} + ({13 - 2)}^{2} + {(13 - 2)}^{2} [/tex]

[tex]169 + 121 + 121[/tex]

You would pretty much do that all the way down the list.

After doing so, we wind up with

15, 13, 13, 4, 19, 12, 6, 5, 14

[tex]169 + 121 + 121 + 4 + 289 + 100 + 16 + 9 + 144[/tex]

Adding these together gets your answer of:

[tex]973[/tex]

1. For
what value of x is the
3(x + 2)-2x = 12 true?
A. 6
B. 10
C. 12
D. 14
E. 18
1.4.1 Set
the equation

Answers

Answer: A. 6

Step-by-step explanation:

Answer: I think D.

Step-by-step explanation: why not pick D…..

Hope this helps^^

17.1
What is the solution to the equation --+?
X=-5
X=-4
X-5
Save and Exit

Answers

the  solution of the given equation will be x =1

What is a System of Equations?

A system of equations in algebra is made up of two or more equations that are solved together. "A group of equations satisfied by the same set of variables are called a system of linear equations. Finding the values of the variables employed in the system of equations is the first step towards solving it. While maintaining the balance of the equations on both sides, we compute the values of the unknown variables. Finding a variable whose value makes the condition of all the given equations true is the primary goal of solving an equation system.

The given equation x -5 = -4

add +5 in both side we get

x = -4+5

x=1.

Hence the solution of the given equation will be x =1

Learn more about System of Equations, by the following link.

https://brainly.com/question/12526075

#SPJ1

A one of a kind necklace is worth $3200. The value of the necklace increases by 9% each year. Which explicit and recursive formulas can be used to model the situation.

Answers

The fomulas of the sequence are a(n) = 3200(1.09)^n-1 and a(n) = a(n - 1) * 1.09

How to determine the fomulas of the sequence

from the question, we have the following parameters that can be used in our computation:

First term, a = 3200

Increment, r = 9%

To find the explicit formula, we can use the formula for compound interest:

a(n) = a * (1 + r)^n-1

So, we have

a(n) = 3200(1.09)^n-1

For the recursive formula, we have

a(n) = a(n - 1) * 1.09

This is because the product of the current term and the incremnt rate gives the next term

Read more about sequence at

https://brainly.com/question/29431864

#SPJ1

Find the x- and y-components of the vector d⃗ = (3. 0 km , 30 ∘ left of +y-axis). Express your answer using two significant figures. Enter the x and y components of the vector separated by a comma

Answers

For the information provided the x- and y-components of the vector are 1.5 km and 2.6 km, respectively.

To find the x- and y-components of the vector, we can use trigonometry.

The x-component of vector is given by:

d_x = d × cos(θ)

where d is the magnitude of the vector and θ is the angle between the vector and the x-axis.

In this case, d = 3.0 km and θ = 60 degrees (since the vector is 30 degrees to the left of the y-axis).

So, d_x = 3.0 km × cos(60°) = 1.5 km.

The y-component of vector is given by:

d_y = d × sin(θ)

In this case, d_y = 3.0 km × sin(60°) = 2.6 km.

Expressing the answer using two significant figures gives:

d_x = 1.5 km, d_y = 2.6 km.

Learn more about vectors here: brainly.com/question/15519257

#SPJ4

Which equation represents a nonlinear function?

Answers

Answer:

A nonlinear function is a function in which the rate of change of the output (y) is not proportional to the rate of change of the input (x). In other words, a nonlinear function is a function where the graph of the function is not a straight line.

Here are a few examples of equations that represent nonlinear functions:

y = x^2: This is the equation for a parabolic function, which is a classic example of a nonlinear function.

y = sin(x): This is the equation for the sine function, which is periodic and nonlinear.

y = |x|: This is the equation for the absolute value function, which is nonlinear and has a "kink" at x = 0.

y = log(x): This is the equation for the natural logarithmic function, which is also nonlinear.

These are just a few examples of nonlinear functions. There are many other types of nonlinear functions, including polynomial, exponential, and trigonometric functions.

Sophia ate 18 candies in 4.5 minutes. How many candies did she eat per minute
what is it

Answers

Sophia ate an average of 4 candies per minute. This can be calculated by dividing the total number of candies (18) by the time it took her to eat them (4.5 minutes).
The answer is 4 because 18 divided by 4.5 is 4

How much money should you invest now to have $5000 in 12 years if you invest at a rate of 9.6% compounded semiannually?

Answers

To calculate the amount of money you need to invest now to have $5000 in 12 years at a rate of 9.6% compounded semiannually, you can use the compound interest formula. The formula is A = P(1 + r/n)^nt, where A is the future value, P is the present value, r is the interest rate, n is the number of times the interest is compounded per year, and t is the number of years. In this case, A = 5000, P = ?, r = 0.096, n = 2, and t = 12. Plugging these values in, we get P = 5000 / (1 + 0.096/2)^(2 * 12), which equals $2751.08. Therefore, you need to invest $2751.08 now to have $5000 in 12 years at a rate of 9.6% compounded semiannually.

Which of the following are roots of the polynomial function?
Check all that apply.
F(x)=3-2-5x-3
A. 3-√√2
B. 1-√√3
□ C. -1
D. 3
DE 1+√3
F. 3+√√2

Answers

Answer:B

Step-by-step explanation:

johns orchard yielded a harvest of 460 apples and 340 oranges .He managed to sell 20%of the apples and 30%of the oranges. Which fruit notched up a better sale?

Answers

Answer:

oranges

Step-by-step explanation:

20% of 460 = 92

30% of 340 = 102

Find the value of x
(to
the nearest ten th).
31°
x
9

Answers

The value of x from the given triangle is 17.5 units.

What are trigonometric ratios?

The sides and angles of a right-angled triangle are dealt with in Trigonometry. The ratios of acute angles are called trigonometric ratios of angles. The six trigonometric ratios are sine (sin), cosine (cos), tangent (tan), cotangent (cot), cosecant (cosec), and secant (sec).

We know that, sinθ= Opposite/Hypotenuse

Here, sin31°=9/x

0.515=9/x

x=9/0.515

x=17.5

Therefore, the value of x is 17.5 units.

Learn more about the trigonometric ratios here:

brainly.com/question/25122825.

#SPJ9

Question
What is the relative minimum of the function?



Enter your answer in the box.

A coordinate plane with x axis increments of one increasing from negative 5 to 5 and y axis increments of one increasing from negative 5 to 5. The coordinate plane contains a parabola opening up with a vertex at begin ordered pair one comma negative five end ordered pair. The parabola crosses the y axis at begin ordered pair 0 comma negative 3 end ordered pair.

Answers

The relative minimum's coordinates are (1, -5).

How can you determine a function's relative minimum?

The first derivative test can be used to determine if a continuous function's critical point is a relative minimum or maximum. Simply put, the first derivative is a relative minimum if it is negative to the left of the critical point and positive to the right of it.

The parabola's equation takes the following form because its vertex is at (1, -5).

y = a(x - 1)² - 5

where "a" is a constant that determines the shape of the parabola. Since the parabola crosses the y-axis at (0, -3), we can substitute these coordinates into the equation and solve for "a" as follows:

-3 = a(0 - 1)² - 5

-3 = a - 5

a = 2

Thus, the equation of the parabola is:

y = 2(x - 1)² - 5

The x-coordinate of the vertex is given by x = 1

find the corresponding y-coordinate by substituting x = 1 into the equation:

y = 2(1 - 1)²- 5 = -5

To know more about relative minimum visit:-

https://brainly.com/question/29088643

#SPJ1

35% off of a 85 dollar item

Answers

The amount after 35% off on a 85 dollar item will be $55.25

What is the percentage?

Percentage is a way to express a number as a fraction of hundred. It is often used to represent proportions  and  ratios in a more convenient and understandable form, especially in financial  statistical and financial  contexts. For example, 50% means 50 per 100, or half of a given quantity. It is denoted using the symbol "%".

To find the sale price of an item that has a discount, you can use the following formula:

Sale price = Original price - (Discount percent × Original price)

In this case, the discount is 35% off of an $85 item. So we have:

Discount percent = 35%

Original price = $85

Substituting these values into the formula, we get:

Sale price = $85 - (35% × $85)

Sale price = $85 - $29.75

Sale price = $55.25

Therefore, the sale price of the item after a 35% discount is $55.25.

To know more about Percentage check:

https://brainly.com/question/29306119

#SPJ1

there are 877 students taking College Algebra or Calculus. There are 478 students taking College​ Algebra, 428 students taking​ Calculus, and 29 students taking both College Algebra and Calculus. How many students are taking College​ Algebra, but not​ Calculus?

Answers

College Algebra only = (College Algebra students) - (students taking both)
College Algebra only = 478 - 29
College Algebra only = 449

Please work these out, If possible can someone just work out 1 providing solutions. Thanks ​

Answers

Answer:

See below for solution steps for parts (a) and (c)

Step-by-step explanation:

The trick here is to get all the roots to have the same radical. Each of the lowest radical is the square root pf a prime so cannot be reduced further

For example, in a, the lowest is [tex]\sqrt{3}[/tex]

So get all the others to this level a[tex]\sqrt{3}[/tex]  and then you can just add up the non-radicals and use the radical as the common expression

I will solve a couple and that will give you a general idea of solving the rest

Let's do a.
[tex]5\sqrt{3} , \sqrt{3}[/tex] are already at the lowest radical level of [tex]\sqrt{3}[/tex] so let's reduce 108 to have [tex]\sqrt{108}[/tex] to have [tex]\sqrt{3}[/tex] as one of its components

We can factor 108 as follows;

108/3 = 36

So 108 = 36 x 3

√108 = √36 × √3 = 6√3

Therefore the original expression becomes

[tex]5\sqrt{3} - 6\sqrt{3} + \sqrt{3} = (5 - 6 + 1)\sqrt{3} = 0 \sqrt{3} = 0[/tex]

[tex]-------------------------------[/tex]

c.
[tex]2\sqrt{20} - 7\sqrt{5} + \sqrt{45}[/tex]

Lowest radical is [tex]\sqrt{5}[/tex] whose coefficient is 7

Factor 20 = 4 x 5

[tex]2\sqrt{20} = 2\sqrt{4 \times 5} = 2\sqrt{4} \times \sqrt{5} = 2\times 2 \times \sqrt{5}\\= \bold{4\sqrt{5}}[/tex]

Factor 45:
45 = 9 x 5

[tex]\sqrt{45} = \sqrt{9} \times \sqrt{5} = \bold{3\sqrt{5}}[/tex]

Original expression becomes:
[tex]4\sqrt{5} - 7\sqrt{5} + 3\sqrt{5}\\\\=(4 - 7 + 3)\sqrt{5}\\\\= 0 \sqrt{5}\\\\= 0\\----------------------------[/tex]

I am sure you can do the rest. If not post them as another question. Maybe someone else will answer a few of the ones I did not.

All the best

Label each figure correctly. Area is understood to be square feet and perimeter is understood to be feet.

Answers

1. Area of the figure = 702 square feet.

Perimeter = 114 feet

2. Area of the figure = 20 square inches.

Perimeter = 24 inches.

How to Find the Area and Perimeter?

Area of a rectangle = length * width

Perimeter of a shape = length of all the surrounding of a figure.

1. Area = area of rectangle 1 + area of rectangle 2 = 27 * 24 + 9 * 6

= 702 square feet.

Perimeter = 30 + 27 + 24 + 18 + 6 + 9 = 114 feet

2. Area = area of rectangle 1 + area of rectangle 2 = 7 * 2 + 3 * 2

= 20 square inches.

Perimeter = 7 + 2 + 3 + 3 + 2 + 3 + 2 + 2

= 24 inches.

Learn more about the area and perimeter of a figure on:

https://brainly.com/question/443376

#SPJ1

Note: Enter your answer and show all the steps that you use to solve this problem in the space provided.

A rectangle is shown with length x plus 10 and width 2 x plus 5. The inside of the rectangle is shaded other than an unshaded square with length x plus 1 and width x plus 1.

Write an expression for the area of the shaded region in its simplest form. Show all of your steps.

Answers

Answer:

x² + 23x + 49

Step-by-step explanation:

area of rectangle = length × width

Area of outer rectangle:

(x + 10) × (2x + 5) = 2x² + 5x + 20x + 50 = 2x² + 25x + 50

Area of unshaded square:

(x + 1)² = x² + 2x + 1

shaded area = area of outer rectangle - area of square

shaded area = 2x² + 25x + 50 - (x² + 2x + 1) =

= 2x² + 25x + 50 - x² - 2x - 1

= x² + 23x + 49

five times the sum of a number and two is nineteen less than six times the number.​

Answers

Answer:

The number is 29.

Step-by-step explanation:

"five times the sum of a number and two" can be represented as 5(x + 2), where x is the number. "nineteen less than six times the number" is the same as 6x - 19. The word "is" determines that these two parts are equal. So, 5(x + 2) = 6x - 19.

Solve:

5x + 10 = 6x - 19

10 = x - 19

x = 29

Check:

5 * (29 + 2) = 5 * 31 = 155

(6 * 29) - 19 = 155

155 = 155

Factor: 8x 4x 2x 5-23 +12

Answers

Answer:

this is the answer ................................

g(a)= -3a² + a
h(a) = 3a +4
Find (3g - 2h)(0)
A) 12
C) -8
B) -50
D) -38

Answers

Answer:yo no se come ablar ingles

Step-by-step explanation:

Regular pentagons ABCDE and PQRST are congruent to each other. What is the perimeter of pentagon PQRST?

Answers

The perimeter of the pentagon PQRST will be equal to the perimeter of the pentagon ABCDE.

What is the perimeter of the regular polygon?

The regular polygon's edges are all identical to one another. The relationship between the number of sides to the mean distance determines the regular polygon's perimeter when it has n sides.

Then the perimeter of the pentagon ABCDE is given as,

P = AB + BC + CD + DE + EA

And the perimeter of the pentagon PQRST is given as,

P = PQ + QR + RS + ST + TP

Regular pentagons ABCDE and PQRST are congruent with each other.  Then the perimeter of the pentagons will be identical to each other.

More about the perimeter of the regular polygon link is given below.

https://brainly.com/question/10885363

#SPJ9

Other Questions
compared to 20-year-olds, 35-year-olds are less likely to: a. require a warm-up period before exercise. b. perform any job requiring manual labor. c. engage in energy-demanding sports. d. bounce back quickly after a physiologically stressful activity. A large tank hold 1. 9 time 10 to the 7th power gallons of oil. How much oil can be stored in 9 tanks. Scientific notation something is wrong with your executive assistant. they have been late to work 12 times in the last month. they have been forgetting to spell check outgoing documents. additionally, they seem depressed. you need to find out what is bothering them before their poor work performance puts their job in jeopardy. you should use . what is the system that consists of the skin and its accessory organs PLS HELP FAST ONLY TEN MIN LIFT WILL GIVE BRIANLIEST IF RIGHTLOTS OF POINTS why are changes in inventories included as part of investment spending? Who is the president signed the emancipation proclamation? 2. A young kid is playing catch with himself by throwing a ball straight up. How fast does he throw it ifthe ball comes back to his hands a second later? What was the maximum height of the ball? Ignore airresistance. on a certain sight-seeing tour, the ratio of the number of women to the number of children was 5 to 2. what was the number of men on the sight-seeing tour? The greater the blank of a moving object, the blank it has two examples of characters 1. There are 3 main types of chemical formulas: empirical, molecular and structural.Structural formulas identify the location of chemical bonds between the atoms of amolecule. Consider the following molecular structure below:(a) Redraw the structure in the form of expanded and condensed structures.(b) Classify the carbons labelled a and b as primary, secondary or tertiary.[4 marks] Which example is most clearly a form of media?(a) A diagram of the first rocket launched into space(b) An argument about commercial space travel(c) A gesture to draw the audience's attention to an image (d) A reference to scientists who improved space travel if something costs 9.95 how much you give them and how much is your change? why did banks believe that mortgage-backed securities protected them from defaults Ismail tried to prove that sin()=cos(90)sin()=cos(90)sine, left parenthesis, theta, right parenthesis, equals, cosine, left parenthesis, 90, degree, minus, theta, right parenthesis using the following diagram. His proof is not correct. Solve the equation.7x2 + 5 - x = 6x2 + 10 Which choice best describes EBradiusdiameterLine FPoint based on the information from the periodic table, which mistake did darrell make on his diagram? a nitrogen should have six electrons instead of seven. b nitrogen should have eight protons instead of six. c nitrogen should have seven protons instead of six. d nitrogen should have eight electrons instead of seven. Choose the correct form of IR to complete the following sentence:al comedor para desayunar.YovamosO vanO voyva