Answer:
35
Step-by-step explanation:
The pattern is adding powers of 2.
4+1=5 (exception)
5+2=7
7+4=11
11+8=19
19+16=35
Answer:
35
Step-by-step explanation:
4 + 1 = 5
5 + (1 × 2) = 5 +2 =7
7 + (2×2) = 7 + 4 = 11
11 +(4×2) = 11 + 8 = 19
19 + (8×2) = 19 + 16 = 35
Assume a researcher wants to compare the mean Alanine Aminotransferase (ALT) levels in two populations, individuals who drink alcohol and individuals who do not drink alcohol. The mean ALT levels for the individuals who do not drink alcohol is 32 with a standard deviation of 14, and 37 individuals were in the sample. The mean ALT levels for individuals who drink alcohol is 69 with a standard deviation of 19, and 38 individuals were in the sample. Construct and interpret a 95% confidence interval demonstrating the difference in means for those individuals who drink alcohol when compared to those who do not drink alcohol.
a. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.22 and 39.78.
b. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.33 and 39.67
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
d. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.41 and 39.59.
Answer:
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
Step-by-step explanation:
Given :
Groups:
x1 = 69 ; s1 = 19 ; n1 = 38
x2 = 32 ; s2 = 14 ; n2 = 37
1 - α = 1 - 0.95 = 0.05
Using a confidence interval calculator to save computation time, kindly plug the values into the calculator :
The confidence interval obtained is :
(24.32 ; 39.68) ; This means that we are 95% confident that the true mean difference in ALT values between the two population lies between
(24.32 ; 39.68) .
The diameter of a regulation soccer ball is about 8 and three-fifths inches. This number was graphed on a number line.
A number line going from negative 9 to positive 9. Point A is between negative 9 and negative 8, point B is between negative 7 and negative 6, point C is between 6 and 7, point D is between 8 and 9.
Which point could be the point representing the graph of the diameter of the ball?
A
B
C
D
Answer:
D
Step-by-step explanation:
8 and 3/5 = 8.2 and 8.2 is between 8 and 9 so the answer is D.
Find the x- and y-intercept of the line
X+4y=36
You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.
Answer:
[tex]35.36,44.64[/tex]
Step-by-step explanation:
Sample size [tex]n=40[/tex]
Mean weight [tex]\=x =67[/tex]
Standard deviation [tex]\sigma=11.4[/tex]
Confidence Interval [tex]CI=0.99[/tex]
\alpha==0.01
Therefore
[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]
From table
[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]
Generally, the equation for Margin of error is mathematically given by
[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]
[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]
[tex]M.E=4.64[/tex]
Therefore Estimated mean is
[tex]\=x-M.E<\mu <\=x +E[/tex]
[tex]40-4.64<\mu< 40+4.64[/tex]
[tex]35.36<\mu < 44.64[/tex]
[tex]35.36,44.64[/tex]
A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.
Answer:
C
Step-by-step explanation:
3/5x - 1/2x= 1, please help me to solve this
Answer:
x = - 10
Step-by-step explanation:
(6x -5x) / 10 = - 1
x = - 10
Please send only answer
Want to bring a metal rod to assemble a toy frame. All long metal rods must be used at least. How much to assemble the frame as shown in the picture
Answer:
how many times should u use the metal rod ??
HELP!!!!!!!!!!!!!!!!!!!
Calculate the future value of $2,500.00, earning interest at a rate of 2 1/2% that is compounded quarterly for 4 years.
A) $3,711.26
B) $2,563.09
C) $2,762.07
D) $5,910,086.00
Answer:
C) $2,762.07
you can use a compound interest calculator to find the answer
Larissa is ordering nachos at a restaurant, and the server tells her that she can have up to four toppings: ground beef, black beans, refried beans, and sour cream. Since she cannot decide how many of the toppings she wants, she tells the server to surprise her. If the server randomly chooses which toppings to add, what is the probability that Larissa gets just refried beans and sour cream
Answer:
0.0625
Step-by-step explanation:
Given that :
Number of toppings = 4 (ground beef, black beans, refried beans, and sour cream)
The probability of choosing any particular topping at random from the four is :
Probability = required / total possible outcomes
Hence, P = 1 / 4 = 0.25
Hence, the probability of choosing : getting refried bean and sour cream :
P(refried bean) = 1/4
P(sour cream) = 1/4
P(refried bean and sour cream) = 1/4 * 1/4 = 1/16 =
0.0625
sin(180+0).cos(180+0)/cos(180+0).sin(180-0)
rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible
= 2025
When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)
For this, you divide the given lengths using the numbers that divides all through.
I have added an image to this answer. Go through it for more explanation
.
.
.
.
.
.
.
.
.
.
.
“””” HELP PLEASE “”””
.
.
.
.
.
.
.
.
.
.
.
9514 1404 393
Answer:
x = 14 cm
Step-by-step explanation:
We can only solve for x if the triangles are similar. The arrows on the left and right legs say those are parallel. Since alternate interior angles at each of the transversals are congruent, the triangles are AA similar.
ΔABC ~ ΔDEC, so we have ...
EC/ED = BC/BA
x/(18 cm) = (35 cm)/(45 cm)
x = (18 cm)(7/9) = 14 cm
0.5 kilograms (kg) is equal to how many ounces? Round your answer to the
Answer:
17.637 ounces
Step-by-step explanation:
35.274 ounces is 1 kilogram so divide 35.274 by 2
Can someone please help me with part b ? It would be so appreciated you have no idea ;)
Answer:
absolutely yes, because pythagorean theorem is used in a right triangle
and when we match a line from the tee to the hole, we have a right triangle
Step-by-step explanation:
Please help, I'll give brainliest to the correct answer <3
A company recently purchased a new set of laser printers.
The value of the laser printers P, in dollars, t years after the purchase can be represented by the function P(t)=1,900(0.82)t.
Interpret the meaning of the function in the context of this situation.(1 point)
The initial value of the laser printers was $1,900, and the value increases by 82% each year.
The initial value of the laser printers was $1,558, and the value decreases by 82% each year.
The initial value of the laser printers was $1,558, and the value decreases by 18% each year.
The initial value of the laser printers was $1,900, and the value decreases by 18% each year.
Answer:
The initial value of the laser printers was $1,900, and the value decreases by 18% each year.
Step-by-step explanation:
Here ya go bestie <3
Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)
Answer:
The zeroes of the function are: 3 and 4
Step-by-step explanation:
The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem
dN/dt = N(1 − 0.0008N), N(0) = 1.
Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?
Answer:
1250 supermarkets
Step-by-step explanation:
Given
[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]
[tex]N(0) = 1[/tex]
Required
Number of supermarkets over a long period of time
To do this, we simply set
[tex]\frac{dN}{dt} = 0[/tex]
So, we have:
[tex]N(1 - 0.0008N) = 0[/tex]
Split
[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]
Solve: [tex]1 - 0.0008N = 0[/tex]
Collect like terms
[tex]0.0008N = 1[/tex]
Make N the subject
[tex]N = \frac{1}{0.0008}[/tex]
[tex]N = 1250[/tex]
So:
[tex]\lim_{t \to \infty} N(t) = 1250[/tex]
What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?
Answer:
17 units
Step-by-step explanation:
Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]
Plug in the points and simplify:
[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]
[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]
[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]
[tex]d = \sqrt{225 + 64[/tex]
[tex]d = \sqrt{289[/tex]
[tex]d = 17[/tex]
So, the distance between the points is 17 units
ou invested 7000 between two accounts paying 4% and 9% annual interest, respectively. If the total interest earned for the year was $430 how much was invested at each rate? $ nothing was invested at and $ nothing was invested at
9514 1404 393
Answer:
$3000 at 9%$4000 at 4%Step-by-step explanation:
Let x represent the amount invested at 9%. Then 7000-x was invested at 4% and the interest earned was ...
9%·x +4%(7000-x) = 430
5%·x +280 = 430 . . . . . . . . . simplify
0.05x = 150 . . . . . . . . . . . subtract 280
x = 3000 . . . . . . . . . . divide by 0.05
$3000 was invested at 9%; $4000 was invested at 4%.
PLEASE HELP ASAP!!!!!
Step-by-step explanation:
Area ABC=1/2ab×sin C
=1/2 ×20×10 ×Sin C
Sin C =100
What is the value of x in the equation 5(3x + 4) = 23?
Answer:
x = 1/5
Step-by-step explanation:
5(3x + 4) = 23
Distribute
15x+20 = 23
Subtract 20 from each side
15x+20-20 = 23-20
15x = 3
Divide by 15
15x/15 = 3/15
x = 1/5
Answer:
[tex]x = 0.2[/tex]
Step-by-step explanation:
Step 1: Distribute
[tex]5(3x + 4) = 23[/tex]
[tex](5 * 3x) + (5 * 4) = 23[/tex]
[tex](15x) + 20 = 23[/tex]
Step 2: Subtract 20 from both sides
[tex](15x) + 20 - 20 = 23 - 20[/tex]
[tex]15x = 3[/tex]
Step 3: Divide both sides by 15
[tex]\frac{15x}{15} = \frac{3}{15}[/tex]
[tex]x = \frac{1}{5}[/tex]
[tex]x = 0.2[/tex]
Answer: [tex]x = 0.2[/tex]
Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later
Answer:
The rate at which the distance between the two cars is increasing is 30 mi/h
Step-by-step explanation:
Given;
speed of the first car, v₁ = 24 mi/h
speed of the second car, v₂ = 18 mi/h
Two hours later, the position of the cars is calculated as;
position of the first car, d₁ = 24 mi/h x 2 h = 48 mi
position of the second car, d₂ = 18 mi/h x 2 h = 36 mi
The displacement of the two car is calculated as;
displacement, d² = 48² + 36²
d² = 3600
d = √3600
d = 60 mi
The rate at which this displacement is changing = (60 mi) / (2h)
= 30 mi/h
Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.
the camdens drove 116 miles on 5 gallons of gas. at this rate, how many miles can they drive on 7 gallons of gas
Answer:
162.4 miles
Step-by-step explanation:
We can write a ratio to solve
116 miles x miles
----------------- = ------------
5 gallons 7 gallons
Using cross products
116*7 = 5x
Divide by 5
812 /5 = 5x/5
162.4 =x
162.4 miles
Help me! Thanks!!!!!!
Answer:
there are infinite solutions
Step-by-step explanation:
if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system
Question 6 plz show ALL STEPS
Step-by-step explanation:
6a. Both the x and y coordinates are negative so this means isn't must be in the Third Quadrant.
6b. The measure of this using the unt circle is
[tex] \cos(x) - \frac{1}{2} [/tex]
[tex] \sin(x) = - \frac{ \sqrt{3} }{2} [/tex]
In the unit circle, this occurs about
an angle of 240 degrees. We can find coterminal angles within the interval of 2 pi to -2 pi. Just subtract 260 from theta.( which is 240)
[tex]240 - 360 = - 120[/tex]
So the angles in the interval is
240, -120.
6c. pi/2 is the same as 90 degrees so this means that
[tex](240 + 90) = 330[/tex]
In the unit circle, we know that at 330 degrees,
[tex] \cos(330) = \frac{ \sqrt{3} }{2} [/tex]
[tex] \sin(330) = \frac{1}{2} [/tex]
So the coordinates are
(sqr root of 3/2, 1/2).
6d. pi is the same as 180 degrees so this means that
[tex](240 - 180) = 60[/tex]
In the unit circle, we know that 60 degrees,
[tex] \cos(60) = \frac{1}{2} [/tex]
[tex] \sin(60) = \frac{ \sqrt{3} }{2} [/tex]
So the coordinates are
(1/2, sqr root of 3/2)
Help please ….. help
Answer:
Step-by-step explanation:
a) categorical
b) add all of the numbers and divide by how many numbers there were.
c) outliers means any that were far away from the rest of the data
d) not entirely, you can make an estimate based on it, but nat an exact answer.
How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse
Answer:
isosceles acute
Step-by-step explanation:
We have two sides that are equal so the triangle is isosceles
None of the angles are larger than 90 degrees so non of the angles are obtuse, and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)
GIVING 25 POINTS AND BRAINIER IF ANSWERED!
What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.
Answer:
B. The question may not be directly stated.
18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?
•
acute
•
obtuse
•
equiangular
•
right
Answer:
obtuse
aniuhafjhnfajfnha
