The number of patients that waited for more than 20 minutes is 74
The median waiting time is 17
How to determine the number of patientsFrom the question, we have the following parameters that can be used in our computation:
The graph
Where
x = Waiting time
y = Cumulative frequency
This means that
y = Number of patients that waited x or more time
From the graph, we have
(x, y = (20, 74)
So, the number of patients is 74
The median waiting timeFrom the question, we have the following parameters that can be used in our computation:
Maximum CF = 100
Divide by 2 to calculate the median
Median = 100/2
Evaluate
Median = 50
From the graph, we have
(x, y = (50, 17)
So, the median is 17
Read more about median and cumulative frequency at
https://brainly.com/question/13053979
#SPJ1
Each of these graphs of residuals is from the same set of data using different lines to fit the data. Which graph is most likely to represent the residuals from the best fit line?EXPLAIN YOUR REASONING.
The graph which is most likely to represent the residuals from the best fit line is Option C.
What is Graph?Graph is a mathematical representation of a network and it describes the relationship between lines and points.
Given that from the graphs of residuals is the same set of data using different lines to fit the data.
The best fit line is the line that minimizes the sum of the squared residuals.
In other words, it is the line that has the smallest sum of the squared differences between the actual data points and the predicted values from the line.
The residuals represent the differences between the actual data points and the predicted values, and any systematic pattern in the residuals would suggest that the line is not a good fit for the data.
Hence, Option C is correct, the graph which is most likely to represent the residuals from the best fit line.
To learn more on Graph click:
https://brainly.com/question/17267403
#SPJ1
3. PLEASE THIS IS URGENT
B. Bill's Bikes sells new and used bikes. Bill buys used bikes, fixes them, and marks them up by 80%. The sales-
person selling the bike receives a 25% commission on the markup.
a. Find the missing values in the table. Show your work below
Strategies include:
Using proportions
Percent bar models
Multiplying with the decimal (or fractional) equivalent
Reasoning about with benchmark percent values
Costs and Revenue for Roberto's Sales
Buying
Markup
Selling
Commission
Profit (money the
(25% of markup) shop makes on the sale)
Price (80% of buying price) Price
$100
$180
$20
$60
$10
$55
$125
PLEASE AND I NEED THE WORK SHOWN FOR BOTH CHARTS
The values that van be put in the table based on the information will be:
Buying price (dollars) 100.
Mark-up 80.
Selling price 180
Commission 20
Profit 60
Buying price (dollars) 10
Mark-up 8
Selling price 18
Commission 2
Profit 6
Buying price (dollars) 55
Mark-up 44
Selling price 99
Commission 11
Profit 33
Buying price (dollars) 125
Mark-up 100
Selling price 225
Commission 25
Profit 75
How to explain the valueIt should be noted that the markup is 80% of the buying price. For example, when the buying price is $10, the markup will be:
= 80% × $10
= $8
The selling price is that addition of buying price and markup. This will be:
= $10 + $8
= $18
The commission is 25% of markup. This will be:
= 25% × 8
= $2
Learn more about percentages on:
brainly.com/question/24877689
#SPJ1
jack's favorite number is 836. jill subtracts a secret number from 836 and her answer is the smallest possible combination of all the digits from jack's favorite number. what is the secret number?
The secret number is 564 as we solve it by given question.
jack's favorite number is 836 so here we have number 836 and
jill subtracts a secret number from 836 and her answer is the smallest possible combination of all the digits from jack's favorite number
so here we have a number 836
let we subtract x from 836 to get a number which is smallest number by using 836
the number which we can make by using these 3 degits are
368, 386, 638, 683, 836, 863 anf from all these numbers the smallest number which can be using 836 is 368
as given in question we have 836 and we will subtract x and get 368 so
836 - x = 368
x = 836 - 368
x = 564
the secrets number is 564.
know more about smallest numbers click here;
https://brainly.com/question/24023290
#SPJ4
Question 12
Identify Structure Choose two different inequalities that each has a solution of x ≤ 4. One inequality should involve multiplication with a
negative coefficient and the other should involve division with a negative coefficient.
□A) 2-2
□ B) 421
943-1
D)-3x ≥ 12
□6)-2x ≤-8
OF)-5x2-20
↓
The equation that would give the solution of x ≤ 4 is -2x ≤-8
What is inequality in mathematics?In mathematics, "inequality" refers to a relationship between two expressions or values that is not equal to each other. Therefore, inequality emerges from a lack of balance.
the equation is given as -2x ≤-8. We are to solve the inequality so as to get the value of x
we are to divide through -2x ≤-8 by -2
-2x / -2 ≤ -8 / -2
x ≤ 4
the other parts of the question are not clearly stated
Read more on inequality here:https://brainly.com/question/25275758
#SPJ1
which of the following are true statements? select all that apply: 1. a 95% confidence interval is a random interval that contains the true parameter 95% of the time 2. the true parameter is a random value that has 95% chance of falling in the 95% confidence interval 3. i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5. 4. the true parameter (unknown to me) is 0.5. if i sample data and construct a 95% confidence interval, the interval will contain 0.5 95% of the time. answer :
Among the following statements, The true statements are:
Option (1) a 95% confidence interval is a random interval that contains the true parameter 95% of the time, (2)the true parameter is a random value that has 95% chance of falling in the 95% confidence interval, (3) i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5, (4) the true parameter (unknown to me) is 0.
A 95% confidence interval is a random interval that contains the true parameter 95% of the time.
The true parameter is NOT a random value, and it is not correct to say that it has a 95% chance of falling in the 95% confidence interval.
If you perform a linear regression and get a 95% confidence interval from 0.4 to 0.5,
it means that if you repeated the same experiment many times, 95% of the resulting confidence intervals would contain the true parameter.
It is not correct to say that there is a 95% probability that the true parameter is between 0.4 and 0.5 because the true parameter is either in the interval or not.
If the true parameter is 0.5 and you sample data and construct a 95% confidence interval, the interval may or may not contain 0.5.
The 95% confidence interval is a statement about the probability of the interval containing the true parameter, not about the probability of the true parameter being any specific value.
For more such questions on parameter
https://brainly.com/question/29344078
#SPJ4
2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs
There are 8.75 pounds of meat for 7 dogs
How to find the value of x?
Ratio is used to compare two or more quantities. It is used to indicate how big or small a quantity is when compared to another.
Since 2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs. We can write:
2.5/2 = x/7
2*x = 2.5*7
2x = 17.5
x = 17.5/2
x = 8.75
Learn more about ratio on:
brainly.com/question/2328454
#SPJ1
Which expressions are equivalent to 4 � 4b4, b ? Choose all answers that apply: Choose all answers that apply: (Choice A) A � + 2 ( � + 2 � ) b+2(b+2b)b, plus, 2, left parenthesis, b, plus, 2, b, right parenthesis (Choice B) B 3 � + � 3b+b3, b, plus, b (Choice C) C 2 ( 2 � ) 2(2b)
B=3b-b
C= 2b expressions are equivalent to 4 � 4b4, b .
b+2(b+2b)=b+2(3b)=b+6b=7b
3b+b=4b
2(2b)=4b Option B and C produce the outcome 4b. They are the expressions that are comparable to 4b as a result. We can also get an equivalent equation by multiplying or dividing both sides of an equation by the same nonzero value. If x4=2x+7, we can add 4 to both sides to get the following equation, which is equivalent: x4+4=2x+7+4. Of course, both sides of the equation can be made simpler. Constants x=2x+7+4 on the left side cancel each other out. If two systems of equations have the same solution, they are equivalent (s). In algebra, two equations are said to be equivalent if their roots or solutions are the same. The same number, symbol, or expression must be added to or subtracted from both sides of an equation to produce an equivalent equation.
Learn more about equivalent from
brainly.com/question/2972832
#SPJ4
2. 20 m 24 m 24 26 m
Note that the body starts "with an initial velocity and moves with uniform acceleration."(Option C)
What is Acceleration?In mechanics, acceleration is defined as the rate of change of an object's velocity with respect to time. Vector quantities are accelerations. The orientation of an object's acceleration is determined by the orientation of its net force.
The distance covered by the particle in nth second
Sₙ = u + a/2(2n-1)
S₈ = 20m
S₈ = u + a/2(2x(8-1)
20 = u + 7.5a ...................()
S₉ = 22 = u + a/2(2*9-1)
22 = u + 8.5a ..................(2)
By solving equations 1 and 2 we have :
u=5m/s , a=2m/s²
Thus,
S₁₀ = u+ a/2(2*10-1)
S₁₀ = 5 + 1/2 * 2 (2 * 10-1)
S₁₀ = 5 + 19
S₁₀ = 24m
Thus, it is correct to state that the body starts with the initial velocity and moves with uniform acceleration, and the correct option is C.
Learn more about Acceleration:
https://brainly.com/question/12550364
#SPJ1
Full Question:
A body covers 20 m, 22 m, 24 m, in 8th, 9th, and 10th seconds respectively. The body starts:
from rest and moves with uniform velocity.
from rest and moves with uniform acceleration.
with an initial velocity and moves with uniform acceleration.
with an initial velocity and moves with uniform velocity.
take your time in 2-6
how many three-digit numbers can be formed from the digits 0, 1, 2, 3, 4, 5, and 6 if each digit can be used only once? how many of these are odd numbers? how many are greater than 330?
By using the concept of combinations, we have determined that there are 210 three-digit numbers that can be formed using the digits 0-6 without repeating any of them. Among them, there are 90 odd numbers and 120 numbers greater than 330.
Combinations are a fundamental concept in mathematics, particularly in the field of combinatorics, which deals with counting and arranging objects.
To solve this problem, we can use the concept of combinations, which is a way of counting the number of ways we can choose k items from a set of n items. In this case, we want to find the number of three-digit numbers we can form from the set {0, 1, 2, 3, 4, 5, 6}, without repeating any of the digits.
First, we can determine the number of ways we can choose the first digit. Since there are seven digits to choose from, we have 7 options for the first digit.
Next, we can determine the number of ways we can choose the second digit. Since we have already used one of the digits, we only have 6 options left for the second digit.
Finally, we can determine the number of ways we can choose the third digit. Since we have used two of the digits, we only have 5 options left for the third digit.
Therefore, the total number of three-digit numbers we can form is given by the product of the number of choices for each digit:
7 x 6 x 5 = 210
So there are 210 different three-digit numbers that can be formed using the digits 0, 1, 2, 3, 4, 5, and 6, without repeating any of the digits.
To find the number of odd numbers, we need to consider that the last digit must be either 1, 3, or 5, since these are the only odd digits in the set. We can choose the first two digits in the same way as before, and then choose one of the three odd digits for the last digit. Therefore, the number of odd three-digit numbers is:
6 x 5 x 3 = 90
To find the number of three-digit numbers greater than 330, we need to consider that the first digit must be either 3, 4, 5, or 6. We can choose the first digit in 4 ways, and then choose the remaining two digits as before. Therefore, the number of three-digit numbers greater than 330 is:
4 x 6 x 5 = 120
To know more about combination here.
https://brainly.com/question/28998705
#SPJ4
I NEED HELP PLEASEEEEEEEEE!!!!!!
Step-by-step explanation:
so, it starts (year 0 after 2000) with 350 foxes.
after 1 year the number had increased by 5%.
that means : 350×1.05
because 5% is represented by 0.05.
5% of 350 is 350×0.05 (= 17.5)
and to add 5% means that this is added to the original 100% (= 1).
100% + 5% = 105%
means
1 + 0.05 = 1.05
so, again, after the first year we have
350×1.05
foxes.
after the second year we have to multiply that by 1.05 again :
350×1.05×1.05
and so on.
so, what we are doing is multiplying the original number of foxes by powers of 1.05 (with the exponent being the number of years after 2000).
f(x) = 350 × (1.05)^x
In what time will the simple interest on Rs7560 be Rs1102. 50 at 25/4% per annum
The simple interest on Rs 7560 will be Rs 1102.50 at a rate of 25/4% per annum after approximately 1 month (0.09 years).
Simple interest is a type of interest that is calculated only on the principal amount of a loan or investment, and not on any accumulated interest. It is usually calculated as a percentage of the principal amount, multiplied by the time period for which the interest is being calculated.
We can use the formula for simple interest to solve this problem:
Simple Interest (SI) = Principal (P) x Rate (R) x Time (T)
We know that the principal is Rs 7560, the rate is 25/4% per annum, and the interest is Rs 1102.50. Substituting these values into the formula, we get:
1102.50 = 7560 x (25/4) x T
Simplifying:
1102.50 = 47250T/4
Multiplying both sides by 4 to eliminate the fraction:
1102.50 x 4 = 47250T
4410 = 47250T
Dividing both sides by 47250:
T = 4410/47250
T = 0.093 or approximately 0.09 years.
To convert this to months or days, we can multiply by 12 or 365, respectively.
To learn more about simple interest click on,
https://brainly.com/question/27976154
#SPJ4
Simplify.
(5x-2+3x²)+(4x+3)
O 3x² +9x-1
O 12x4 +1
O 3x²+x+5
O 3x² +9x+1
Answer:
3x² + 9x + 1
Step-by-step explanation:
5x - 2 + 3x² + 4x + 3
= 9x - 2 + 3x² + 3
= 9x + 1 + 3x²
= 3x² + 9x + 1
Simplify: √-363
○ -11√/3
11i
33i
○ 11i√√3
Answer:
11i√√3
Step-by-step explanation:
A sea horse weighs 42oz. Together, 3 sea monkeys and a sea horse weighs the same as 8 sea monkeys plus 9oz. How much does a sea monkey weigh?
Answer:
a sea monkey weighs 6.6oz
Step-by-step explanation:
Sketch and graph please
We have drawn the graph for the given inequality.
What is inequality?
Inequality is a mathematical statement that compares two values or expressions and shows their relative size. It is represented by the symbols >, <, ≥, or ≤, which respectively mean "greater than", "less than", "greater than or equal to", and "less than or equal to". Inequalities can also include variables and can be used to describe a range of possible values for that variable.
For the given inequality y ≤ 3/5x-5
we can draw the graph as shown below:
Hence, we have drawn the graph for the given inequality.
To learn more about the inequalities, visit:
https://brainly.com/question/25275758
#SPJ1
What information is in the text but not in the graph?
Answer:
B. More money was given than expected in 1994
Step-by-step explanation:
Nowhere is it mentioned what amount was expected as donations. Only actual amounts received are shown on the graph
Hence this is an assumption and not necessarily fact
1 13. In the first few days of its life, the length of an earthworm I is thought to be proportional to the square root of the number of hours n which have elapsed since its birth. If a worm is 2 cm long after 1 hour, how long will it be after 4 hours? How long will it take to grow to a length of 14 cm?
The length of earthworm will be 4 cm after 4 hours. And the length is 14 cm after 49 hours.
What is meant by Proportion?Proportions are defined when two or more ratios are made to be equal to each other.
Two quantities are said to be directly proportional if a positive change in one quantity also lead to a positive change in the other quantity.
If a is proportional to b, we denote it as a ∝ b.
Given,
Length of an earthworm, l ∝ square root of the number of hours, n, which have elapsed since it's birth.
l ∝ √n
l = k √n, for some constant k.
If a worm is 2 cm long after 1 hour, we can write it as,
2 = k × √1
⇒ k = 2
So the proportionality constant is 2.
After 4 hours,
l = k √4
l = 2 × 2 = 4 cm
If the length is 14 cm,
14 = 2 √n
√n = 14 / 2
√n = 7
n = 7² = 49 hours
Hence the length of worm is 4 cm after 4 hours. It will take 49 hours to grow to a length of 14 cm.
Learn more about Proportional Relationships here :
https://brainly.com/question/15785739
#SPJ9
QUESTION FOR FOR LIH04
you are testing h0: μ=10 against ha: μ≠10 based on an srs of 15 observations from a normal population. what values of the t statistic are statistically significant at the α=0.005 level?
The values of the t statistic that are statistically significant at the α=0.005 level are t < -2.977 or t > 2.977.
To determine the values of the t statistic that are statistically significant at the α=0.005 level, we need to find the critical values of the t-distribution with 14 degrees of freedom (df = n - 1 = 15 - 1 = 14).
Using a t-table or a calculator, we can find that the critical values for a two-tailed test with α=0.005 are -2.977 and 2.977. This means that any t statistic less than -2.977 or greater than 2.977 would be considered statistically significant at the α=0.005 level.
In other words, if the calculated t statistic falls within the range of -2.977 to 2.977, we would fail to reject the null hypothesis (H0: μ=10) and conclude that there is not enough evidence to suggest that the population mean is different from 10. However, if the calculated t statistic falls outside of this range, we would reject the null hypothesis and conclude that there is evidence to suggest that the population mean is different from 10.
So, the values of the t statistic that are statistically significant at the α=0.005 level are t < -2.977 or t > 2.977.
To learn more about the values of the t statistic that are statistically significant, click here: https://brainly.com/question/16244531
#SPJ11
A small publishing company is releasing a new book. The production costs will include a one-time fixed cost for editing and an additional cost for each book
printed. The total production cost C (in dollars) is given by the function C=15. 95N+750, where N is the number of books.
The total revenue earned (in dollars) from selling the books is given by the function R-32. 80N.
Let P be the profit made (in dollars). Write an equation relating P to N. Simplify your answer as much as possible.
0
?
If The total revenue earned (in dollars) from selling the books is given by the function R-32. 80N.The equation relating the profit P (in dollars) to the number of books N is P = 16.85N - 750.
The profit made by the company is the difference between the total revenue earned and the total production cost, so we can write:
P = R - C
Substituting the expressions for R and C, we get:
P = 32.80N - (15.95N + 750)
Simplifying the right-hand side, we get:
P = 16.85N - 750
This equation shows that the profit made by the company is a linear function of the number of books printed. The slope of the line is the revenue per book (32.80 dollars), minus the cost per book (15.95 dollars), which is 16.85 dollars.
The intercept of the line is the fixed cost for editing (750 dollars). The equation can be used to estimate the profit for any given number of books printed, and to determine the break-even point, which is the number of books that need to be sold to cover the total production cost.
To learn more about equation click on,
https://brainly.com/question/29608834
#SPJ4
Which question can be answered using the expression 3 ÷ 1
?
4 8
Responses
A
How many 1 -pound pieces of fudge are in 3
-pound fudge?
8 4How many 1 -pound pieces of fudge are in 3 -pound fudge? 8 4
B
How many 3 -pound pieces of fudge are in 1 -pound fudge?
4 8How many 3 -pound pieces of fudge are in 1 -pound fudge? 4 8
C
Rob ate 1 of 3 pound of fudge. How much fudge did Rob eat?
8 4Rob ate 1 of 3 pound of fudge. How much fudge did Rob eat? 8 4
D
Rob ate 3 of 1 pound of fudge. How much fudge did Rob eat?
4 8
The question that can be answered using the expression 3 ÷ 1 is "How many 1-pound pieces of fudge are in a 3-pound fudge?". The correct option is B.
The expression "3 ÷ 1" is a mathematical expression that represents a division operation. In this case, the operation is "3 divided by 1".
To understand what this expression means, we can think of it in terms of a real-world scenario. For example, we can think of it as dividing 3 pounds of fudge into 1-pound pieces.
If we divide 3 pounds of fudge into 1-pound pieces, we can ask the question "How many 1-pound pieces of fudge are in 3 pounds of fudge?" This is the question that can be answered using the expression "3 ÷ 1".
To solve this division problem, we simply divide 3 by 1. The result is 3. This means that there are 3 one-pound pieces of fudge in 3 pounds of fudge.
So, to summarize, the expression "3 ÷ 1" means "3 divided by 1" and can be interpreted as dividing 3 pounds of fudge into 1-pound pieces. The answer to the question "How many 1-pound pieces of fudge are in 3 pounds of fudge?" is 3.
To learn more about expressions click on,
https://brainly.com/question/6203017
#SPJ4
A cable company charges an installation fee to install cable at a residence. There is also a monthly fee for the cable service. The total cost for months 2, 4, 6 and 8 are $145, $255, $365, and $475, respectively. How much is the installation fee? Assume that the relationship between the two quantities is linear
$13,000 and $15,000.
mark brainlyest
Fatima has a total of $8 to spend to make fruit smoothies. She will use two types of fruit. The table to the right shows the cost of each type of fruit per cup.
For the mango and pineapple mixture, find a linear equation in standard form that models how much mango and pineapple she can buy, where x is cups of mango and y is cups of pineapple.
Mango=0.50
Pineapple=0.75
Strawberry=1.00
Answer:
0.75y + 0.5x = 8.00
Step-by-step explanation:
rcentage of people who completed or more years of college listed by state are the percentages of the population who have completed or more years of a college education. construct a frequency distribution with classes.
The frequency distribution table of the data is illustrated below.
The data we have been given represents the percentage of people who have completed 4 or more years of college education in different states. To create a frequency distribution, we need to first decide on the number of classes we want to use. In this case, we will use 7 classes.
Next, we need to determine the range of values for each class. To do this, we first find the minimum and maximum values in the data set, which are 18.9 and 37.9, respectively.
The range of values for each class will be (max value - min value) / number of classes, which in this case is (37.9 - 18.9) / 7 = 2.86.
We will start with the first class, which will include all values from 18.9 to 21.76 (the lower limit of the first class plus the range of values for each class). The next class will include values from 21.76 to 24.62, and so on, until we reach the final class which will include all values from 33.18 to 36.04 (the upper limit of the final class plus the range of values for each class).
To create the frequency distribution, we count the number of values in the data set that fall into each class. For example, the first class includes values between 18.9 and 21.76, and there are 2 values in the data set that fall into this range (21.4 and 20.0). We continue this process for each class until we have a table that shows the frequency of values in each class.
To know more about percentage here.
https://brainly.com/question/13729841
#SPJ4
Complete Question:
Percentage of People Who Completed 4 or More Years of College Listed by state are the percentages of the population who have completed 4 or more years of a college education. Construct a frequency distribution with 7 classes.
21.4,26.0,25.3,19.3,29.5,35.0,34.7,26.1,25.8,23.4,27.1,29.2,24.5,29.5,22.1,24,3,28.8,20,0,20.4,26.7,35.2,37.9,24.7,31.0,18.9,24.5,27.0
I need help on this problem pleaseeeeeeeeeee
F.E.O.L. Perpendicular to a Given Line
Write the slope-intercept form of the equation of the line described.
1) through: (-2,-3), perp. to y=-x
5
3) through: (2,-2), perp. to y=-
2) through: (5,-2), perp. to y = 5x +4
4) through: (-4,-3), perp. to y=-x+2
The equation of the line are;
a. y = 5/2x + 2
b. y = -1/5x - 1
c. y = -5/2x - 3
d. y = -x - 7
What is the slope intercept form of the linea.
The line passes through point (-2, -3) and it is perpendicular to y = -2/5x
The equation of the line is y = 5/2x + 2
b.
The line passes through the point (5, -2) and it is perpendicular to y = 5x + 4
The equation of the line is y = -1/5x - 1
c.
The line passes through (-2, 2) and it is perpendicular to y = 2/5x - 4
Th equation of the line is y = -5/2x - 3
d.
The line passes through (-4, -3) and it is perpendicular to y = -x + 2
The equation of line is y = -x - 7
Learn more on equation of perpendicular line here;
https://brainly.com/question/6910525
#SPJ1
(15, 2); perpendicular to 5x - y = 2
(a) Write the equation of the line in slope-intercept form.
(b) Write the equation of the line in standard form.
Answer:
see explanation
Step-by-step explanation:
the equation of a line in slope- intercept form is
y = mx + c ( m is the slope and c the y- intercept )
given
5x - y = 2 ( subtract 5x from both sides )
- y = - 5x + 2 ( multiply through by - 1 )
y = 5x - 2 ← in slope- intercept form
with slope m = 5
(a)
given a line with slope m then the slope of a line perpendicular to it is
[tex]m_{perpendicular}[/tex] = - [tex]\frac{1}{m}[/tex] = - [tex]\frac{1}{5}[/tex] , then
y = - [tex]\frac{1}{5}[/tex] x + c ← is the partial equation
to find c substitute (15, 2 ) into the partial equation
2 = - [tex]\frac{1}{5}[/tex] (15) + c = - 3 + c ( add 3 to both sides )
5 = c
y = - [tex]\frac{1}{5}[/tex] x + 5 ← in slope- intercept form
(b)
the equation of a line in standard form is
Ax + By = C ( A is a positive integer and B, C are integers )
y = - [tex]\frac{1}{5}[/tex] x + 5 ( multiply through by 5 to clear the fraction )
5y = - x + 25 ( add x to both sides )
x + 5y = 25 ← in standard form
. Solve for n.
scale: 1 1/2 inches: 250 miles
scale measure: 3/4 inches
actual measure: n miles
A. 100 miles
B. 125 miles
C. 187 1/2 miles
D. 281 1/4 miles
Answer:
C) 187 1/2 miles
Step-by-step explanation:
We can start by using the formula for converting between scale measure and actual measure:
actual measure = scale measure * (actual distance / scale distance)
Here, the scale measure is 3/4 inch and the scale distance is 1 1/2 inches, so:
actual measure = (3/4) * (n / 250)
Rearranging the equation, we can isolate n:
n = (actual measure * 250) / (3/4)
Substituting in the actual measure of 3/4 inch, we find:
n = (3/4 * 250) / (3/4) = 250 miles
So the answer is C) 187 1/2 miles.
Step 3: Apply the slope formula: m =
2-3
-1-6
m=
(1/5)
(-1/7)
(1/7)
32-).
X2 X1
The slope formula is m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are two points on the line and m is the slope of the line. To use the formula, you need to know the coordinates of two points on the line. If you have the coordinates of two points, you can substitute them into the formula to find the slope.