The mole fraction of acetyl bromide in the solution is 0.586, rounded to 3 significant digits.
What is the mole fraction of acetyl bromide?To calculate the mole fraction of acetyl bromide in the solution, we need to first determine the total number of moles of the two components:
Moles of acetyl bromide = 127 g / (99.94 g/mol) = 1.271 mol
Moles of heptane = 90 g / (100.21 g/mol) = 0.899 mol
The total moles of the solution = 1.271 + 0.899 = 2.170 mol
The mole fraction of acetyl bromide can be calculated using the formula:
Mole fraction of acetyl bromide = moles of acetyl bromide / total moles of the solution
Mole fraction of acetyl bromide = 1.271 mol / 2.170 mol = 0.586
Therefore, the mole fraction of acetyl bromide in the solution is 0.586, rounded to 3 significant digits.
Learn more about acetyl bromide
brainly.com/question/31805639
#SPJ11
which of the following features of dna molecules contain the actual code for building proteins?
Answer:
The DNA code for building proteins is contained in the sequence of nucleotides in the DNA molecule. The four nucleotides in DNA are adenine (A), cytosine (C), guanine (G), and thymine (T). The sequence of these nucleotides is what determines the sequence of amino acids in a protein.
The DNA code is read in groups of three nucleotides, called codons. Each codon codes for a specific amino acid. There are 64 possible codons, but only 20 amino acids. This means that some amino acids are coded for by more than one codon.
The process of reading the DNA code and using it to build proteins is called protein synthesis. Protein synthesis takes place in two steps: transcription and translation.
Transcription is the process of copying the DNA code into a molecule of messenger RNA (mRNA). The mRNA then carries the DNA code out of the nucleus of the cell to the cytoplasm.
Translation is the process of using the mRNA code to build a protein. The mRNA code is read by a ribosome, which assembles the amino acids into a protein chain.
The DNA code is essential for life. It is the blueprint for all of the proteins that our cells need to function. Without the DNA code, we would not be able to grow, develop, or reproduce.
Explanation:
If you mix one liter of water at 60° C with one liter at 30° C, what will the temperature of the water be when it reaches thermal equilibrium?
If you mix one liter of water at 60° C with one liter at 30° C. Then, the temperature of the water will be 45°C when it reaches thermal equilibrium.
To find the final temperature of the water, we use the principle of the conservation of energy;
The heat lost by hot water = the heat gained by cold water
Q_hot = Q_cold
where Q = m × c × ΔT, m is the mass of the water, c is the specific heat capacity of water, and ΔT is the change in temperature.
Assuming that the two liters of water have the same mass (which is approximately true for water), we can write:
m × c × (T_final - 60) = m × c × (30 - T_final)
where T_final will be the final temperature of the water.
Simplifying this equation, we get;
T_final = (60 + 30) / 2 = 45°C
Therefore, the temperature of the water will be 45°C.
To know more about thermal equilibrium here
https://brainly.com/question/30358043
#SPJ4
In the space station, liquid ammonia is used to transfer heat.
If 100 g of liquid ammonia evaporates, then how much heat was removed?
(AH, = 5.65 kJ/mol)
If 100 g of liquid ammonia evaporates, then 33.23 kJ heat was removed.
Given in the question that ΔH = 5.65 kJ/mol
No. of moles = Mass / Molar mass
No. of moles = 100 / 17 = 5.88
1 mole of ammonia evolves 5.65 kJ
So, 5.88 moles of ammonia evolves 33.23 kJ.
Heat is the transfer of kinetic energy from one medium or object to another, or from an energy source to a medium or object. Such energy transfer can occur in three ways: radiation, conduction, and convection.
The Sun is the biggest source of heat energy in our solar system. It radiates heat, which reaches Earth in the form of radiation.
Measurement of heat is done in calories. One calorie is the amount of energy required to raise one gram of water one degree Celsius. To measure heat, you divide the change in temperature of a sample of water by the mass of the water.
Learn more about Heat, here:
https://brainly.com/question/30603212
#SPJ1
Which of the following correctly lists the gases in order of increasing rate of effusion? Which of the following correctly lists the gases in order of increasing rate of effusion?
A. CH4 < He < Cl2 < Ar
B. He < CH4 < Ar < Cl2
C. He < Ar < Cl2 < CH4
D. Cl2 < Ar < CH4 < He
B. He < CH4 < Ar < Cl2 of the following correctly lists the gases in order of increasing rate of effusion.
The rate of effusion of gases is governed by Graham's Law, which states that the rate of effusion of a gas is inversely proportional to the square root of its molar mass. In other words, lighter gases effuse faster than heavier gases. Based on the molar masses of the given gases:
- Helium (He) has a molar mass of approximately 4 g/mol.
- Methane (CH4) has a molar mass of approximately 16 g/mol.
- Argon (Ar) has a molar mass of approximately 40 g/mol.
- Chlorine (Cl2) has a molar mass of approximately 71 g/mol.
According to Graham's Law, the gas with the lowest molar mass will have the highest rate of effusion. In this case, the gases in order of increasing rate of effusion are Helium, Methane, Argon, and Chlorine, which corresponds to option B.
To know more about rate of effusion visit:
https://brainly.com/question/29808345
#SPJ11
what will be the boiling point of a 3 molal solution of nacl? kb for water = 0.512 °c/m.
The boiling point of the 3 molal solution of NaCl will be 100 °C + 1.536 °C = 101.536 °C.
To find the boiling point of a 3 molal solution of NaCl, we need to use the boiling point elevation formula, which states that the change in boiling point is equal to the molality of the solution times the boiling point elevation constant of the solvent. In this case, the solvent is water and its boiling point elevation constant is 0.512 °C/m.
Since the molality of the solution is 3 molal, we can calculate the change in boiling point as follows:
ΔTb = (3 molal) x (0.512 °C/m)
ΔTb = 1.536 °C
Therefore, the boiling point of the 3 molal solution of NaCl will be 100 °C + 1.536 °C = 101.536 °C.
To know about boiling visit:
https://brainly.com/question/1416592
#SPJ11
a solid with a random arrangement of particles is . question 22 options: a crystalline solid an amorphous solid a metallic solid a covalent network solid
An amorphous solid; A solid with a random arrangement of particles is known as an amorphous solid.
Unlike crystalline solids, amorphous solids lack a definite and ordered arrangement of particles, which leads to their unique physical properties. They often exhibit a glassy or rubbery appearance and can be formed by cooling a liquid rapidly or by applying pressure. Some common examples of amorphous solids include glass, rubber, and plastic.
In contrast, crystalline solids have a highly ordered and repetitive arrangement of particles, resulting in characteristic properties such as cleavage planes, anisotropy, and distinct melting points. Metallic solids consist of metal atoms packed closely together in a regular arrangement, while covalent network solids consist of a network of covalent bonds throughout the solid, resulting in strong and hard materials such as diamond.
Learn more about amorphous solid here:
https://brainly.com/question/28274778
#SPJ11
what does zn(hg) hcl do
Zinc amalgam (Zn(Hg)) with hydrochloric acid (HCl) produces hydrogen gas (H2) and a solution of zinc chloride (ZnCl2) in water (H2O).
When zinc amalgam (Zn(Hg)) is added to hydrochloric acid (HCl), a redox reaction takes place. The HCl donates hydrogen ions (H+) to the Zn(Hg) and forms zinc chloride (ZnCl2) and hydrogen gas (H2) as products. The balanced chemical equation for this reaction is:
Zn(Hg) + 2HCl(aq) → ZnCl2(aq) + H2(g)
The zinc amalgam acts as a reducing agent and reduces the hydrogen ions (H+) in the hydrochloric acid (HCl) to form hydrogen gas (H2). The hydrogen gas is produced as bubbles, which can be observed during the reaction.
The solution formed is a clear, colorless solution of zinc chloride (ZnCl2) dissolved in water (H2O). This reaction is a common demonstration of the reactivity of metals with acids and the production of hydrogen gas.
Visit here to learn more about Zinc:
brainly.com/question/15678491
#SPJ11
Calculate the concentration of a solution of CO2 in water , which contains 20.25g of CO2 per 675mL of solution.
a two-year chart of carbon dioxide measurements made from the top of mauna loa, hawaii, shows a saw tooth pattern. why?
The sawtooth pattern observed in the two-year chart of carbon dioxide measurements from Mauna Loa, Hawaii, is a result of seasonal variations and human activities.
Carbon dioxide levels increase during the winter months when plants are dormant and decrease during the summer months when they are actively photosynthesizing. Additionally, human activities such as burning fossil fuels and deforestation contribute to the overall increase in carbon dioxide levels. The sawtooth pattern provides valuable data for scientists studying the impacts of climate change and global warming. It also serves as a reminder of the urgent need to reduce carbon emissions and adopt sustainable practices to mitigate the effects of climate change.
The sawtooth pattern observed in the two-year chart of carbon dioxide (CO2) measurements from Mauna Loa, Hawaii, is primarily due to seasonal fluctuations in plant growth and decay. During spring and summer, increased photosynthesis in the Northern Hemisphere absorbs CO2 from the atmosphere, causing a decrease in CO2 levels. Conversely, during fall and winter, reduced photosynthesis and increased plant decay release CO2 back into the atmosphere, resulting in a rise in CO2 levels. This cyclical pattern creates the sawtooth appearance on the chart, while the overall trend still shows a continuous increase in atmospheric CO2 levels due to human activities.
To know about sawtooth:
https://brainly.com/question/31595132
#SPJ11
after exactly 8 hours, the activity level of a sample of a particular radioactive isotope, which decays into a stable isotope, has fallen to 30.0% of its initial value. calculate the half-life of this isotope.
The half-life of the isotope is approximately 14.5 hours.
The half-life of a radioactive isotope is the time it takes for the activity level to reduce by half. We can use the given information to calculate the half-life of the isotope as follows:
Let A0 be the initial activity level and A be the activity level after 8 hours. We know that A = 0.3*A0.
Using the formula for radioactive decay, we have:
A = A0 * (1/2)^(t/T)
where t is the time elapsed, T is the half-life of the isotope, and (1/2)^(t/T) is the fraction of the original activity remaining after time t.
Substituting t = 8 hours and A = 0.3*A0, we get:
0.3*A0 = A0 * (1/2)^(8/T)
Taking the natural logarithm of both sides, we get:
ln(0.3) = -8/T * ln(2)
Solving for T, we get:
T = -8 / (ln(0.3) / ln(2)) ≈ 14.5 hours
In conclusion, using the given information about the activity level of the radioactive isotope after 8 hours, we have calculated its half-life as 14.5 hours using the formula for radioactive decay.
for more questions on half-life
https://brainly.com/question/29803994
Sulfur is a nonmetal that has six electrons in its outermost level. Using the models of a magnesium (Mg) atom and a sulfur (S) atom below, draw arrows to show the transfer of electrons.
Explanation:
(The answer is the attached image)
Magnesium is a metal and has two valence electrons, while sulfur is a nonmetal that has six valence electrons. Thus, to achieve a full octet, magnesium wants to lose its two valence electrons and sulfur wants to gain two valence electrons. The two valence electrons of magnesium are transferred to the sulfur atoms, causing both the Mg2+ ion and the S2- ion to have full octets.
If the pressure of a gas increases, but temperature and volume stay
constant, then the number of gas particles must
increase
decrease
has no change
unable to tell
g what is the least reactive carboxylic acid derivative? a. amide b. ester c. acid chloride d. anhydride
The answer is (A) amide, which is the least reactive carboxylic acid derivative. The reactivity of carboxylic acid derivatives depends on their ability to undergo nucleophilic acyl substitution reactions. In general, the order of reactivity is acid chloride > anhydride > ester > amide.
Acid chlorides are the most reactive carboxylic acid derivatives because they have a highly polarized C-Cl bond that is easily broken, and the resulting carbonyl group is highly electrophilic. Anhydrides are less reactive than acid chlorides because the carbonyl groups in anhydrides are less electrophilic due to the presence of two electron-withdrawing groups. Ester carbonyl groups are less electrophilic than anhydride carbonyl groups because the alkyl groups in esters are less electron-withdrawing than the acyl groups in anhydrides. Finally, amide carbonyl groups are the least reactive due to the presence of two electron-donating groups (the nitrogen and the carbonyl oxygen).
Therefore, the answer is (A) amide, which is the least reactive carboxylic acid derivative.
Learn more about polarized here:
https://brainly.com/question/29217577
#SPJ11
which of the following would you buy if you wanted the highest polyunsaturated fatty acid content? Liquid, squeezable margarine, made from safflower oil
If you are looking for the highest polyunsaturated fatty acid content, the best option would be liquid safflower oil. Liquid safflower oil is typically higher in polyunsaturated fatty acids compared to margarine made from safflower oil.
Squeezable margarine may contain added ingredients and may not have the same concentration of polyunsaturated fatty acids as pure safflower oil. Therefore, if your goal is to maximize polyunsaturated fatty acid intake, choosing liquid safflower oil would be the preferred option.
To know more about fatty acid refer here
brainly.com/question/5710423#
#SPJ11
the reaction between nh3 and cl2 produces n2cl4 and hcl. what number of molecules of hcl can be produced if 6 molecules of nh3 are mixed with 10 molecules of cl2?
Therefore, 0.6 molecules of HCl can be produced when 6 molecules of NH3 are mixed with 10 molecules of Cl2.
To answer this question, we need to first balance the equation for the reaction between NH3 and Cl2:
NH3 + Cl2 → N2Cl4 + HCl
Now, we can use stoichiometry to determine the number of molecules of HCl produced. From the balanced equation, we can see that for every 1 molecule of NH3 and 1 molecule of Cl2, 1 molecule of HCl is produced. Therefore, we can set up a proportion:
6 molecules NH3 / 1 x 10 molecules Cl2 / 1 x 1 molecule HCl / 1 = x molecules HCl / 1
Solving for x, we get:
x = (6 x 1 x 1) / 10 = 0.6
Note that it is not possible to have a fraction of a molecule, so we would round down to say that 0 molecules of HCl are produced in this scenario.
Overall, the number of molecules of HCl that can be produced depends on the limiting reactant, which in this case is Cl2. If there are not enough Cl2 molecules to react with all the NH3, then there will be leftover NH3 that does not react and does not produce HCl.
To know more about molecules visit:
https://brainly.com/question/30465503
#SPJ11
Read the excerpt from Richard Connell's short story "The Most Dangerous Game." Then, respond to the question that follows.
Rainsford, reclining in a steamer chair, indolently puffed on his favorite brier. The sensuous drowsiness of the night was on him." It's so dark," he thought, "that I could sleep without closing my eyes; the night would be my eyelids—"
An abrupt sound startled him. Off to the right he heard it, and his ears, expert in such matters, could not be mistaken. Again he heard the sound, and again. Somewhere, off in the blackness, someone had fired a gun three times.
Rainsford sprang up and moved quickly to the rail, mystified. He strained his eyes in the direction from which the reports had come, but it was like trying to see through a blanket. He leaped upon the rail and balanced himself there, to get greater elevation; his pipe, striking a rope, was knocked from his mouth. He lunged for it; a short, hoarse cry came from his lips as he realized he had reached too far and had lost his balance. The cry was pinched off short as the blood-warm waters of the Caribbean Sea dosed over his head.
He struggled up to the surface and tried to cry out, but the wash from the speeding yacht slapped him in the face and the salt water in his open mouth made him gag and strangle. Desperately he struck out with strong strokes after the receding lights of the yacht, but he stopped before he had swum fifty feet. A certain coolheadedness had come to him; it was not the first time he had been in a tight place. There was a chance that his cries could be heard by someone aboard the yacht, but that chance was slender and grew more slender as the yacht raced on. He wrestled himself out of his clothes and shouted with all his power. The lights of the yacht became faint and ever-vanishing fireflies; then they were blotted out entirely by the night.
Rainsford remembered the shots. They had come from the right, and doggedly he swam in that direction, swimming with slow, deliberate strokes, conserving his strength. For a seemingly endless time he fought the sea. He began to count his strokes; he could do possibly a hundred more and then—
Rainsford heard a sound. It came out of the darkness, a high screaming sound, the sound of an animal in an extremity of anguish and terror.
He did not recognize the animal that made the sound; he did not try to; with fresh vitality he swam toward the sound. He heard it again; then it was cut short by another noise, crisp, staccato.
In a well-written paragraph of at least 5-7 sentences:
-identify three figurative language devices used in the bolded lines
-identify the overall mood of the passage
-explain how the figurative language creates the mood of the passage
Explanation:
There are no bolded lines in the given excerpt. However, I can analyze the entire passage.
In this passage from Richard Connell's short story "The Most Dangerous Game," the author uses vivid imagery, sensory details, and figurative language to create a sense of suspense and danger. The passage begins with Rainsford, the protagonist, reclining comfortably on a steamer chair, enjoying the night. However, the sudden sound of gunshots startles him, and he rushes to the railing to investigate. The description of the night as a "blanket" and the Caribbean Sea as "blood-warm waters" creates an ominous and eerie mood. The use of figurative language in the description of the sea and its violent waves, as well as the scream of an animal in distress, adds to the sense of danger and foreboding. The overall mood of the passage is one of suspense and danger, with a sense of impending peril lurking just beneath the surface.
Answer:
The phrase “he fought the sea” is an idiom as he did not fight the sea but he was just trying his best to stay alive while in the sea. The phrase “it was like trying to see through a blanket” is a simile as he his comparing the darkness to trying to see through a blanket which both mean you can barely see anything. The phrase "the wash from the speeding yacht slapped him in the face" is a personification since they are referencing how fast the water was going to the point where he felt pain in his face from it to being slapped. The overall mood of the passage are terrified and troubled. I suggested these two because the protagonist is terrified of losing his life and is troubled as he does not know how he will survive. The figurative language creates the mood of the passage because it helps a reader understand the situation better by comparing or referencing certain things to things that have happened or that the reader can compare with.
select the single best answer. compound a exhibits two singlets in its 1h nmr spectrum at 2.64 and 3.69 ppm and the ratio of the absorbing signals is 2:3. compound b exhibits two singlets in its 1h nmr spectrum at 2.09 and 4.27 ppm and the ratio of the absorbing signals is 3:2. which compound corresponds to dimethyl succinate and which compound corresponds to ethylene diacetate?
Compound A corresponds to ethylene diacetate and Compound B corresponds to dimethyl succinate.
The reason for this is that in the 1H NMR spectrum of Compound A, the two singlets are at 2.64 and 3.69 ppm, with a ratio of 2:3. This pattern corresponds to the two methyl groups of the ethylene diacetate molecule. On the other hand, in the 1H NMR spectrum of Compound B, the two singlets are at 2.09 and 4.27 ppm, with a ratio of 3:2. This pattern corresponds to the two methyl groups and the two methoxy groups of the dimethyl succinate molecule. Therefore, by analyzing the chemical shifts and the ratio of the absorbing signals, we can identify which compound corresponds to which molecule.
Compound A corresponds to dimethyl succinate, and Compound B corresponds to ethylene diacetate. In Compound A, the 1H NMR spectrum displays singlets at 2.64 ppm (2 protons) and 3.69 ppm (3 protons), which match the chemical shifts expected for the protons in the methylene and methyl groups of dimethyl succinate. In Compound B, the singlets at 2.09 ppm (3 protons) and 4.27 ppm (2 protons) align with the chemical shifts anticipated for the protons in the methyl and methylene groups of ethylene diacetate, respectively. The different ratios of absorbing signals (2:3 and 3:2) further support the identification of these compounds.
To learn more about ethylene here
https://brainly.com/question/14797464
#SPJ11
Toner particles are composed mostly of _______________, which allows them to be melted to the page.
Select one:
a. carbon
b. power
c. plastic
d. Teflon
Toner particles are composed mostly of plastic, which allows them to be melted to the page. The option c is coorect.
The plastic used in toner particles is typically made from a type of polyester called styrene-acrylic. This plastic has a low melting point, which allows it to be melted by the heat of the printer and fused to the paper.
In addition to plastic, toner particles may also contain carbon black, which is used to give the toner its black color.
Other colors of toner may contain different pigments to produce the desired color. Overall, the plastic composition of toner particles plays a crucial role in the printing process, allowing the toner to adhere to the page and produce high-quality prints.
Visit here to learn more about polyester:
brainly.com/question/29186121
#SPJ11
the molecular weight of glucose is 180.156 g/mol. if you wish to administer 315.00 grams of glucose from a 0.278 m glucose solution, what volume of solution will need to be dispensed?
The 315.00 grams of the glucose from the 0.278 M of the glucose solution, the volume of the solution needed is 6.25 L.
The mass of the glucose = 315 g
The molar mass of the glucose = 180.156 g/mol
The moles of the solution = mass / molar mass
The moles of the solution = 315 / 180.156
The moles of the solution = 1.74 mol
The molarity of the solution = 0.278 M
The molarity of the solution = moles / volume
The volume of the solution = moles / molarity
The volume of the solution = 1.74 / 0.278
The volume of the solution = 6.25 L.
To learn more about molarity here
https://brainly.com/question/31545539
#SPJ4
What are the top four ions in seawater, in their order of abundance?
A. Chloride, Sodium, sulfate, potassium
B. Chloride, sodium, sulfate, magnesium
C. Sodium, Chloride, magnesium, sulfate
D. Sulfate, Calcium, Chloride, sodium
Therefore, B. The top four ions in seawater, in their order of abundance, are chloride, sodium, sulfate, and magnesium.
Chloride and sodium are the most abundant ions in seawater, making up around 85% of all ions present. Sulfate is the third most abundant ion, followed by magnesium. These ions play important roles in many biological and chemical processes in the ocean, including regulating pH, maintaining the proper balance of ions in cells, and providing essential nutrients for marine life. Magnesium sulfate, also known as Epsom salt, is often used as a supplement in marine aquariums to provide these important ions in the correct ratios.
To know more about magnesium visit:
https://brainly.com/question/8351050
#SPJ11
name: 1. name three factors that influence the rate at which a solute dissolves in a solvent 2. define the following words a. solubility b. saturated c. unsaturated d. supersaturated
1. The three factors that influence the rate at which a solute dissolves in a solvent are: a. Temperature - as temperature increases, the rate of dissolution also increases
b. Surface area - the greater the surface area of the solute, the faster it dissolves
c. Agitation - stirring or shaking the mixture can increase the rate of dissolution by exposing more solute to the solvent.
2.
a. Solubility is the maximum amount of solute that can be dissolved in a given amount of solvent at a particular temperature and pressure.
b. Saturated refers to a solution where the maximum amount of solute has been dissolved in a given amount of solvent at a particular temperature and pressure.
c. Unsaturated refers to a solution where less than the maximum amount of solute has been dissolved in a given amount of solvent at a particular temperature and pressure.
d. Supersaturated refers to a solution where more than the maximum amount of solute has been dissolved in a given amount of solvent at a particular temperature and pressure, often achieved by heating the solution and then allowing it to cool slowly.
Visit here to learn more about dissolution brainly.com/question/17438203
#SPJ11
t/f Gases behave most ideally at STP
The given statement "Gases behave most ideally at STP is true. Gases behave most ideally at STP (standard temperature and pressure).
STP is defined as a temperature of 0°C (273.15 K) and a pressure of 1 atm (101.325 kPa). At this specific combination of temperature and pressure, gases behave most ideally, meaning they follow the ideal gas law more accurately. This is because at STP, the intermolecular forces between gas molecules are minimal, and the volume of the gas particles themselves is negligible compared to the volume of the container they are in.
This allows for more predictable behavior, making it easier to use the ideal gas law to calculate properties such as pressure, volume, temperature, and number of moles.
More on STP: https://brainly.com/question/30550516
#SPJ11
List two modern farming methods that contribute to soil erosion?
Answer:
Deforestation and overgrazing
Answer:
The primary causes of soil erosion due to poor farm management are excessive fertilization or irrigation, conventional tillage, monocropping, overgrazing, and more.
Hope this helps :)
Pls brainliest...
which species in each pair is predicted to have a higher ionization energy: na or mg+; na+ or mg+?
Mg+ is predicted to have a higher ionization energy than Na. Na+ is predicted to have a higher ionization energy than Mg+.Ionization energy is the energy required to remove an electron from an atom or ion in the gas phase. As we move from left to right across a period in the periodic table, the ionization energy generally increases due to the increasing effective nuclear charge. This means that the positive charge of the nucleus increases, which makes it more difficult to remove an electron. Therefore, Mg+ is predicted to have a higher ionization energy than Na because Mg+ has a greater nuclear charge due to the loss of an electron.
When comparing Na+ and Mg+, we need to consider their respective electron configurations. Na+ has a noble gas electron configuration (neon) and Mg+ has a configuration of 1s22s22p6. The electron removed from Na+ is in a stable configuration, while the electron removed from Mg+ would result in a configuration of 1s22s22p5, which is not as stable. Therefore, Na+ is predicted to have a higher ionization energy than Mg+.
To learn more about electron click here: brainly.com/question/12001116
#SPJ11
3. How many liters of water need to be added to
0.84 moles of KI to make a 0.20 M solution of KI?
Answer: 4.2 Liters
Explanation:
Molarity can be calculated by dividing the moles of a substance number of liters of solution
Equation:
.2M = .84 mol / x liters
Convert to mL:
200/1000 = 840/ x
Solve for x:
200x = 840000
x = 4200 ml
Convert back to liters:
4200 ml = 4.2 L
CH3CH2CHCHCHCH2CH3, with two CH2CH3 groups and an SH group attached
The chemical formula you provided is a representation of the molecule hexanethiol (C6H14S), which contains a chain of six carbon atoms with an SH group attached to the fifth carbon atom and two CH2CH3 groups attached to the second and sixth carbon atoms.
Hexanethiol is a colorless liquid with a strong, unpleasant odor and is commonly used as a reagent in organic chemistry.
It seems like you're describing a molecule with a specific structure. Based on the information provided, the molecule can be represented as follows:
CH3CH2C(CH2CH3)C(SH)CH(CH2CH3)CH2CH3
This molecule has a main carbon chain of 7 carbons (heptane) with two CH2CH3 (ethyl) groups and an SH (thiol) group attached to different carbon atoms along the chain.
Visit here to learn more about chemical formula : https://brainly.com/question/32018188
#SPJ11
A 7.94-g piece of solid CO2 (dry ice) is allowed to sublime in a balloon. The final volume of the balloon is 1.00 L at 301 K. What is the pressure of the gas?
A)
4.46 atm
B)
atm
C)
3.11 atm
D)
0.224 atm
E)
none of these
The pressure of the gas in the balloon is 4.46 atm, which is option A. To solve this problem, we need to use the ideal gas law, PV=nRT, where P is pressure, V is volume, n is the number of moles of gas, R is the gas constant, and T is temperature.
Since dry ice sublimes directly from a solid to a gas, we can assume that the number of moles of gas produced is equal to the number of moles of solid CO2 initially present.
First, we need to calculate the number of moles of CO2:
n = m/M
where m is the mass of CO2 and M is the molar mass of CO2.
m = 7.94 g
M = 44.01 g/mol
n = 7.94 g / 44.01 g/mol = 0.1806 mol
Next, we can use the ideal gas law to solve for pressure:
P = nRT/V
R = 0.08206 L atm/mol K (gas constant)
T = 301 K
V = 1.00 L
P = (0.1806 mol) (0.08206 L atm/mol K) (301 K) / (1.00 L) = 4.46 atm
Therefore, the pressure of the gas in the balloon is 4.46 atm, so the answer is A).
To know about volume:
https://brainly.com/question/28058531
#SPJ11
A 25.0 g sample of metal is
warmed by 6.1 °C using 259 ] of
energy.
What is the specific heat of the
metal?
Spec. Heat (J/g °C)
PH
A 25.0 g sample of metal is warmed at 6.1 °C using 259 of energy. The specific heat of the metal is 1.07 J/g°C.
Given:
m = 25.0 g
ΔT = 6.1 °C
q = 259 J
The specific heat of the metal is given by the formula:
q = mcΔT
where q is the amount of heat energy absorbed by the metal, m is the mass of the metal, c is the specific heat of the metal, and ΔT is the change in temperature.
Rearranging the formula:
c = q / (m ΔT)
Substituting the given values:
c = 259 J / (25.0 g × 6.1 °C)
c = 1.07 J/g°C
To learn more about the specific heat, follow the link:
https://brainly.com/question/11297584
#SPJ1
Answer:
The correct answer is 1.69
Acellus
Explanation:
the procedure and data table for an experiment are shown here. step 1: add approximately 25 ml of water to a 50-ml graduated cylinder. step 2: measure and record the initial volume of the water to the nearest 0.1 ml. step 3: carefully slide the object into the graduated cylinder. measure and record the final volume of the water to the nearest 0.1 ml. step 4: determine the volume of the object by subtracting the measurements in steps 2 and 3. what pattern in these data could be used to predict the final volume if the initial volume is known?
The procedure for the experiment involves measuring the volume of an object using water displacement. To begin the experiment, 25 ml of water is added to a 50-ml graduated cylinder.
The initial volume of the water is measured and recorded to the nearest 0.1 ml. Next, the object is carefully slid into the graduated cylinder, and the final volume of the water is measured and recorded to the nearest 0.1 ml. The volume of the object can be determined by subtracting the measurements taken in steps 2 and 3. To predict the final volume of an object if the initial volume is known, one could observe the pattern in the data collected from the experiment.
This would involve comparing the initial volume measurements to the corresponding final volume measurements. If there is a consistent increase or decrease in the final volume based on the initial volume, then this pattern could be used to make predictions about the final volume for future experiments. For example, if the data shows that for every 5 ml increase in initial volume, the final volume increases by 3 ml, then this pattern could be used to predict the final volume for any initial volume measurement within the range of the data collected.
To know more about cylinder visit:-
https://brainly.com/question/6755244
#SPJ11
draw a structure, with a formula of c4h9br, which has an integration of 3h, 2h, 2h, and 2h.
The formula C4H9Br can represent multiple structures, but based on the given integration values, one possible structure is 1-bromobutane.
To answer your question, the given formula of c4h9br can represent a variety of different structures. However, based on the integration values provided, we can narrow down the possibilities. The integration values indicate that there are 3 hydrogen atoms present in one group, and 2 hydrogen atoms each in two other groups. This suggests the presence of a primary (3H) and two secondary (2H) carbon atoms.
One possible structure that fits this description is 1-bromobutane, which has the formula C4H9Br. In this structure, the bromine atom is attached to a primary carbon atom, while the other three carbon atoms are each attached to a single hydrogen atom (two secondary and one primary). This structure would give rise to the observed integration values of 3H, 2H, 2H, and 2H.
To know more about hydrogen atom visit:
brainly.com/question/30886690
#SPJ11
