aluminum bromide and potassium sulfate produce potassium bromide and aluminum sulfatebalanced word equation
How would you balance: AlBr3 + K2SO4 --> KBr + Al2(SO4)3?

The mass of given no. of molecules of methanol will be 508 grams.

First , we have to calculate the no. of moles. So, No of moles = No. of molecules / avagadros no. Therefore :

⇒9.56 x [tex]10^{23}[/tex]  / 6.02 x [tex]10^{23}[/tex]

⇒15.875 moles

Now, We know that the molecular mass of methanol is 32 grams. So, we can calculate the mass by simply multiplying the molecular mass with moles.

Therefore,

⇒15.875 x 32

⇒508.00 grams

Learn more about mole concept here,

https://brainly.com/question/22540912

The complete question should be ,

What is the mass, in grams, of 9.56 x [tex]10^{23}[/tex]  molecules of methanol (CH, OH) ?

This equation implies that there are two protons on the left side and two protons on the right side.

NaHSO3 + H2O → Na+ + HSO3- + OH-

H2SO3 + 2 H2O → H3O+ + HSO3- + OH-

1.4 x 10-2 H3O+ + 6.5 x 10-8 HSO3- → 1.4 x 10-2 OH- + 6.5 x 10-8 H3O+

NaHSO3  ->  Na+ + HSO3- (Ka1 = 1.4 x 10-2)

HSO3-  ->  H+ + SO32- (Ka2 = 6.5 x 10-8)

The complete proton balance for the system is:

NaHSO3 + H2O <=> Na+ + H3O+ + HSO3-

HSO3- + H2O <=> H+ + SO32- + H2O

NaHSO3 + H2O <=> Na+ + H3O+ + H+ + SO32-

So the proton balance is:

NaHSO3 + H2O <=> Na+ + 2 H3O+ + SO32-

NaHSO3 + H2O <=> Na+ + 2 H3O+ + SO32-

To learn more about The proton balance for the system refer to:

https://brainly.com/question/12449324

#SPJ1

According to  the problem,Consider the following pair of nucleophiles in CH3OH. H2O is the better nucleophile.

What is the nucleophile ?

Nucleophiles are atoms or molecules that carry a negative charge and have the ability to form an electron-pair bond with a positive or partially positive atom. Common nucleophiles include hydroxide ions (OH–), amines (H2N–), and carboxylates (RCOO–). Nucleophiles are important in many organic reactions, such as substitution, elimination, and addition reactions. They are also important in biochemistry, where they facilitate enzyme-catalyzed reactions such as hydrolysis, oxidation, and reduction. In biochemistry, nucleophiles can attack the carbonaly carbon of an organic molecule, resulting in a covalent bond known as an ester or amide bond.

To learn more about nucleophile

https://brainly.com/question/14052597

#SPJ4

The volume of the potassium dichromate solution is 15.58 liters.

The molar mass of potassium dichromate, also known as potassium bichromate, is 294.19 g/mol. Molar mass is the mass of one mole of a substance, which is defined as Avogadro's number of atoms or molecules. The molar mass of a substance can be calculated by adding up the atomic masses of all the atoms in its chemical formula. In the case of potassium dichromate, its chemical formula is K2Cr2O7. The molar mass is calculated by adding up the atomic masses of 2 atoms of potassium (K), 2 atoms of Chromium (Cr) and 7 atoms of Oxygen (O) (2* 39.0983 + 252.00 + 716.00 = 294.19 g/mol).

To know more about Molar Mass visit: https://brainly.com/question/22997914

#SPJ1

The expression for K3 = 1K1×1K2 when the chemical equations and equilibrium expressions for two reactions at the same temperature are given.

A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. For a reaction like aA -> A, the rate law frequently takes the form rate = k[A]n, where k is the proportionality constant known as the rate constant and n is the order of the reaction.

Given the reactions as:

CO(g)+3H2(g)⇄CH4(g)+H2O(g)

the rate law for the above equation is (K1) = [CH4][H2O]/[CO][H2]^3

Then [H2]^3 = [CH4][H2O]/K1[CO]

CO2(g)+H2(g)⇄CO(g)+H2O(g)

the rate law for the above equation is (K2) = [CO][H2O]/[CO2][H2]

[CO2] = [CO][H2O]/K2[H2]

CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)

Similarly the rate law for the above equation is (K3) = [CO2][H2]^4/[CH4][H2O]^2

Then K3 = [CO][H2][CH4][H2O][H2O]/K2[H2]K1[CO]

Then K3 = 1K1×1K2

To learn more about equilibrium click here https://brainly.com/question/29359391

#SPJ4

complete question: Reaction 1:CO(g)+3H2(g)⇄CH4(g)+H2O(g),  K1=[CH4][H2O][CO][H2]3 . Reaction 2:CO2(g)+H2(g)⇄CO(g)+H2O(g), K2=[CO][H2O][CO2][H2]. Reaction 3:CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)then K3=?

The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3 for reaction 3 at the same temperature?

If the equilibrium constant for this reaction is 23, set (3) (n-butane] 0.04 M [iso-butane] = 0.27 M, of concentrations represents an equilibrium of these two compounds.

The equilibrium constant for a reaction is the ratio of the product concentrations to the reactant concentrations at equilibrium, raised to their stoichiometric coefficients. In this case, the reaction is:

n-butane (g) <==> iso-butane (g)

The equilibrium constant for this reaction, Kc, is defined as:

Kc = [iso-butane]/[n-butane]

Therefore, if the equilibrium constant is given as 23, then at equilibrium:

[iso-butane]/[n-butane] = 23

Out of the given sets of concentrations, only set 3) represents an equilibrium of these two compounds:

[n-butane] = 0.04 M

[iso-butane] = 0.27 M

Because:

[iso-butane]/[n-butane] = 0.27/0.04 = 6.75 which is close to the equilibrium constant of 23. The other sets of concentrations represent different ratios of [iso-butane]/[n-butane] which is not equal to 23 and thus not in equilibrium.

To know more about equilibrium please refer: https://brainly.com/question/15118952

#SPJ4

ewhat grade is this

Explanation:

The balanced chemical equation for the dissolution of strontium fluoride in water is: SrF2 (s) + H2O (l) --> Sr(NO3)2 (aq) + 2F- (aq) and The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 is approximately 3.8 x 10^-7 mol/L.

How to calculate molar solubility of SrF2?

The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be determined using the solubility product constant (Ksp) of SrF2. The Ksp of SrF2 is 2.9 x 10^-11.

The solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be calculated by using the expression:

Ksp = [Sr2+] [F-]^2

where [Sr2+] is the molarity of the Sr2+ ions and [F-] is the molarity of the F- ions.

The solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be calculated by using the expression:

[Sr2+] = Ksp / [F-]^2

The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 is approximately 3.8 x 10^-7 mol/L

To learn more about molar solubility, visit: https://brainly.com/question/30265969

#SPJ1

Tetrahedral H2O has an electrical geometry, Water is classified as tetrahedral in terms of electron-group geometry since it has four electron groups.

To learn more about Water refer to:

https://brainly.com/question/1313076

#SPJ4

False. Osmosis may be defined as the movement of a solvent through a semipermeable membrane from a region of lower solute concentration to one of higher concentration.

Osmosis can be defined as the movement of solvent particles or water from lower solute concentration to higher solute concentration through the semipermeable membrane. This process does not require any energy. This requires only a concentration gradient. Semipermeable membranes are very thin layers of material which allows some things to pass through them. The movement of a solvent through a semipermeable membrane from a region of higher solute concentration to one of lower solute concentration is called diffusion.

To learn more about Osmosis please visit:

https://brainly.com/question/2811191

#SPJ4

Acidic solutions include those with HBr, H3PO4, and CH3CH2COOH.Any liquid that has more hydrogen ions per volume than water is considered acidic.

To learn more about Acidic solutions refer to:

https://brainly.com/question/24255408

#SPJ4

Option (b) is correct. The NADH generated during glycolysis and the citric acid cycle feeds its high energy electron to the electron transport chain.

During Glycolysis and the citric acid cycle, the NADH and FADH2 molecules formed carry their electrons to the electron transport chain. This electron transport chain creates a proton gradient that leads to the production of a large amount of ATP. NADH are the high energy electron carrier used to transport electrons generated in Glycolysis and citric acid  Cycle to the Electron Transport Chain. Glycolysis is said to be a process in which glucose is break down to produce energy. Glucose produces two molecules of pyruvate, ATP, NADH and water. Glycolysis process takes place in the cytoplasm of a cell.

To learn more about Glycolysis please visit:

https://brainly.com/question/1966268

#SPJ4

The given question is incorrect. The correct question is,

The NADH generated during glycolysis and the citric acid cycle feeds its high-energy electrons to which of the following?

(a) citric acid cycle

(b) the electron transport chain

(c) ADP

(d) H20

(e) FAD

3 moles, 2 moles, 4 moles. soluble ionic compound with the number of moles of ions formed when 1 mole of each compound is dissolved into water. cacl2 cacl2 drop zone empty.

nabr nabr drop zone empty. fe(no3)3 fe(no3)3 drop zone empty. 3 moles of ions 4 moles of ions 2 moles of ions need help review these concept resources.Moles (nevi) are a form of skin growth that is rather frequent. Clusters of pigment-forming cells lead them to look as tiny, dark brown dots (melanocytes). The majority of people have 10 to 40 moles that form during childhood and adolescence and may alter or vanish over time. A non-cancerous condition of pigment-producing skin cells that is generally known as birth markings or moles.This form of mole is frequently big and is caused by a disease involving melanocytes, or pigment-producing cells (melanin). Melanocytic nevi can be rough, flat, or elevated in appearance. They might be present at birth or appear later in life. Melanocytic nevi can develop malignant in rare cases.

learn more about moles  here:

https://brainly.com/question/26416088

#SPJ4

three, two, and four moles An ideal gas combination is made up of 4 moles of hydrogen, 2 moles of helium, and 1 mole of water vapour. What is the mixture's molar specific heat at a constant

Why are you asking this I wonder. Are you uncertain as to whether the term "hydrogen" refers to hydrogen molecules or hydrogen atoms (H)? (H2)

The query contains a hint: molar mass

We are dealing with the macro world which is the one in which we reside, and in this world, "hydrogen exists as H2 molecules. There has a 2 g/mol molar mass.

If a question reads "You are dealing with atoms while dealing with hydrogen atoms

You are working with molecules if an inquiry asks about "hydrogen molecules

Since hydrogen occurs as molecules in the larger universe, you are dealing with molecules if an inquiry asks, "hydrogen

Learn more about moles of hydrogen here:

https://brainly.in/question/25363072

#SPJ4

The gas chromatograph, in combination with the mass Spectrometer, can separate the components of a drug mixture and then unequivocally identify each substance present in the mixture.

A mass spectrometer can only determine a molecule's mass after it has changed into a gas-phase ion. To do this, it charges molecules electrically and converts the resulting flow of electrically charged ions into a proportionate electrical current that a data device can then read. The components of a drug mixture are separated by the gas chromatograph and mass spectrometer, which then positively identify each component. By electrically charging molecules, which results in a flow of electrically charged ions, it does this.

learn more about chromatograph  here:

brainly.com/question/29442779

#SPJ4

The mass of a single atom of carbon is 1.9 x 10-²³ g/atom (option A).

An atom is the smallest possible amount of matter which still retains its identity as a chemical element, now known to consist of a nucleus surrounded by electrons.

According to this question, the mass of a mole of carbon atoms is 12.011 grams.

1 mole of carbon atom = 12g

1 mole of a carbon atoms = 6.022 × 10²³ atoms

Hence, mass of 6.022 × 10²³ atoms of carbon = 12g

Mass of 1 atom of carbon = 12 ÷ 6.022 ×10²³ = 1.9 × 10-²³ g/atom.

Therefore, 1.9 × 10-²³ g/atom is the mass of a single atom of carbon.

Learn more about atom at: https://brainly.com/question/29695801

#SPJ1

Density and specific gravity are related but not the same, Specific gravity is defined as the ratio of the density of a substance to the density of a reference substance. In this case, the reference substance is water, and it is commonly assumed to be water at 4°C (39.2°F) and is generally given as 1.000 g/cm3 (or 1.000 g/ml).

So, the specific gravity of grain alcohol = Density of grain alcohol / Density of water at 4°C = 0.789 g/mL / 1.00 g/mL = 0.789.

This value is dimensionless and it is used to compare the density of different substances with water.

To solve this problem, we need to convert the time in years to seconds, and then multiply it by the speed of light to find the distance traveled.

First, we'll convert the time in years to days: 4.00 years * 365.25 days/year = 1461 days

Now we'll convert days to seconds: 1461 days * 24 hours/day * 60 minutes/hour * 60 seconds/minute = 31,557,600 sec

Now we can multiply the time in seconds by the speed of light to find the distance traveled: 31,557,600 sec * (1 meter / (1/299,772,458)) = 9.461*10^16 meters

To express the distance in kilometers we need to divide the distance in meters by 1000

9.46110^16 meters / 1000 = 9.46110^13 kilometers.

So, light travels 9.461*10^13 kilometers in 4.00 years.

To know more about Light

https://brainly.com/question/10728818

The mass of the sodium sulfate sample is 0.00126grams.

The mass of a substance can be calculated by multiplying the number of moles in the substance by its molar mass as follows:

mass = no of moles × molar mass

According to this question, a sample of sodium sulfate (MM = 142.04 amu/molecule) was found to contain 5.4 x 10¹⁸ oxygen atoms. The number of moles can be calculated as follows:

no of moles = 5.4 × 10¹⁸ ÷ 6.02 × 10²³ = 0.89 × 10-⁵ moles = 0.0000089moles

mass = 0.0000089moles × 142.04 amu/molecule

mass = 0.00126grams.

Learn more about mass at: https://brainly.com/question/16386473

#SPJ1

The 1,3-dipolar addition, a chemical reaction between a 1,3-dipole and a dipolarophile, results in a five-membered ring. The first 1,3-dipolar cycloadditions weren't discovered until the latter part of 19th century.

The early 20th century, following the discovery of 1, 3-dipoles. From the food our bodies digest to the way the sunlight we receive is created, chemical reaction occur all around us. Understanding physical and chemical changes is essential before beginning chemical processes. A molecule is defined as a collection of two or more atoms held together by the attractive forces known as chemical bonds; depending on the context, the term may or may not include ions that fit this criteria.

Learn more about chemical reaction here

https://brainly.com/question/29039149

#SPJ4

If his original scan time was 1.25 seconds, 3 seconds will be his scan time be with the new source.

The discrete packet (or quantum) containing electromagnetic (as well as light) energy known as a photon is referred to as a photon. In a vacuum, which is a region that is entirely empty, photons are always moving at the same speed as light to everyone observers.

Number of photons detected = (Power output of source) x (Scan time)

Power output of new source = 0.42 x Power output of original source

Number of photons detected = (Power output of new source) x (New scan time)

Number of photons detected = (0.42 x Power output of original source) x (New scan time)

Number of photons detected = (Power output of original source) x (1.25 seconds)

dividing both side by Power output of original source to get:

(New scan time) = (Number of photons detected) / (0.42 x Power output of original source)

(New scan time) = (1.25 seconds) / (0.42)

(New scan time) = 3 seconds

Therefore, 3 seconds will be his scan time be with the new source, if his original scan time was 1.25 seconds.

To know more about photon, here:

https://brainly.com/question/12015967

#SPJ1

The type of chemical bond that most commonly forms between each combination of elements is Metallic bond → metallic, Covalent bond → covalent, Ionic bond → ionic.

A metallic bond is a type of chemical bond that forms between two or more metal atoms. The metallic bond is characterized by the sharing of electrons between the atoms, creating a metallic lattice structure. This type of bonding results in a strong bond that gives metals their characteristic properties such as high melting points, ductility, and conductivity.

A covalent bond is a chemical bond in which atoms share electrons. Covalent bonds typically form between nonmetal atoms and are characterized by the sharing of electrons between atoms. Covalent bonds are typically strong and result in stable compounds. They are commonly found in compounds such as water, methane and carbon dioxide.

An ionic bond is a chemical bond in which one atom loses an electron to another atom. Ionic bonds typically form between metal atoms and nonmetal atoms. Ionic bonds are characterized by the transfer of electrons, resulting in the formation of ions. Ionic bonds are typically strong and result in stable compounds, They are commonly found in compounds such as sodium chloride (NaCl) and calcium chloride (CaCl2).

To know more about covalent bond

https://brainly.com/question/10777799

#SPJ4

The third term of the sequence is 19. The term to term rule when we reverse the order of the sequence is subtract 13 then divide by 6.

The sequence has three terms. Its term to term rule is as follows:

multiply by 6 and then add 13.

The first term of the sequence is -2.

By using the rule the third term can be found as follows:

Second term:

-2 × 6 + 13 = - 12 + 13 = 1

Third term

1 × 6 + 13 = 6 + 13 = 19

Therefore, the first three terms are as follows:

-2, 1, 19

Now, let's reverse the three terms of the sequence,

19, 1, -2

Therefore, the term to term rule of the sequence is as follows:

subtract 13 then divide by 6

Learn more on sequence here:

brainly.com/question/26151197

#SPJ1

Oxidation of pyruvate to CO2, oxidation of NAD+ to NADH,  reduction of NAD+ to NADH correctly represents an oxidation or reduction reaction. Thus, option A, B, D is the answer.

An oxidation reaction is a chemical reaction in which a molecule loses one or more electrons. A reduction reaction is a chemical reaction in which a molecule gains one or more electrons.

Oxidation of pyruvate to CO2 represents an oxidation reaction because pyruvate loses electrons and becomes CO2 in this reaction.

Oxidation of NAD+ to NADH represents an oxidation reaction because NAD+ loses electrons and becomes NADH in this reaction.

Reduction of pyruvate to CO2 is not a correct statement because pyruvate is a molecule that loses electrons in the process of oxidation, not reduction.

Reduction of NAD+ to NADH represents a reduction reaction because NAD+ gains electrons and becomes NADH in this reaction.

Learn more about oxidation:

https://brainly.com/question/25798412

#SPJ4

"Combustion analysis can evaluate the molecular formula of unidentified compounds containing primarily C and H," is an incorrect statement.

Combustion analysis is a technique used to determine the amounts of carbon and hydrogen present in a compound by burning a sample and measuring the volume of gases produced. It can be used to determine the empirical formula of a compound containing C, H, and O only (which gives the ratio of atoms in a compound and not the actual number of atoms) but not the molecular formula (which gives the actual number of atoms in a compound). The molecular formula of a compound can be determined by other techniques like Mass Spectroscopy, IR spectroscopy, NMR spectroscopy etc.

To learn more about empirical formula  here:

https://brainly.com/question/14044066

#SPJ4

Examples of elements that conduct electricity between that of metals and nonmetals are carbon, silicon, and germanium.

Electricity is a form of energy that is created when electrons move from one atom to another. It is a form of energy that can be used to power a variety of appliances, from lights to computers to refrigerators. Electricity is created when electrical charges move through a conductor, such as a wire. It can also be stored in batteries for later use. Electricity can be very dangerous and should always be handled with care.

These elements belong to a class called semi-conductors. Semi-conductors are materials that can be manipulated to allow them to either conduct or insulate electricity depending on their application. They are an integral part of many electronic circuits, whether it be for computers, phones, or other electronic devices. Semi-conductors are also used in photovoltaic cells, which are used to convert solar energy into electricity.

To know more about electricity click-
https://brainly.com/question/24154868
#SPJ4