Based on the Tonicity in Elodea Cells lab, a hypotonic environment causes a cell to swell or burst because
-the water in the solution moves into the plant cell.
-the solutes in the solution have a lower concentration than the solute concentration inside the plant cell.
-the water is moving down its concentration gradient from high to low.
-The water moved across the selectively permeable membrane down its concentration gradient from an area of high water concentration to an area of low water concentration. There were fewer solutes in the solution and more solutes in the cell, which is why the water moved into the cell.

Answers

Answer 1

A hypotonic environment causes a cell to swell or burst because the water is moving down its concentration gradient from high to low.

What is hypotonic environment?

A hypotonic environment is an environment where the concentration of solutes outside a cell is lower than the concentration of solutes inside the cell. This can cause water to move into the cell by osmosis, causing the cell to swell and possibly even burst. Hypotonic environments are most commonly found in aquatic environments, but can also be seen in a variety of other settings, such as in a cell culture dish or in a protein crystallization experiment. In the case of aquatic environments, hypotonic solutions are those that have a lower salt concentration than the solution inside the cell, causing the cell to absorb more water than it would in a hypertonic solution.

To learn more about cell

https://brainly.com/question/26122239

#SPJ4


Related Questions

Dunes can be up to 300
meters tall! What is a
dune?
A. what is left behind when the
wind blows all of the sand away
B. a mound of sand piled up by
the wind
C. a very large cave
D. a very common occurrence in
wet and rainy areas

Answers

Answer:

B. a mound of sand piled up by the wind.

Explanation:

It is option B because a dune is a natural feature formed by the wind blowing sand particles and piling them up in a specific area. The wind can shape the dune and cause it to grow taller, sometimes reaching heights of 300 meters or more. Dunes are not caused by the wind blowing sand away, as stated in option A, nor are they found in wet and rainy areas, as stated in option D, they are typically found in desert regions or along coastlines. It is not a cave as stated in option C.

You mix 260. mL of 1.20 M lead(II) nitrate with 300. mL of 1.90 M potassium iodide. The lead (II) iodide is insoluble. Which of the following is false? a) The final concentration of Pb2+ ions is 0.0482 M. b) You form 131 g of lead(II) iodide. c) The final concentration of K+ is 1.02 M. d>The final concentration of NO, is 1.02 M. e) All are true.

Answers

All are true. The resulting solution will have a NO3- ion concentration of 672 mmoles/580 mL, or 1.159 M.

Pb(NO3)2 volume = 260 mL = 0.26 L

Pb(NO3)2 has  molarity of 1.2 M.

KI volume = 300 mL = 0.3 L

KI has a molarity of 1.9 M.

Pb(NO3)2 + 2KI reaction rightarrow PbI2 + 2KNO3

First potassium iodide.

Potassium iodide we must determine the moles of reactants present: Pb(NO3)2 moles = Pb molarity (NO3)  1.2 × 0.26 = 0.312 moles = 2 times Volume in L 1.9 x 0.3 = 0.57 moles of KI = Molarity of KI x Volume in L

We know from stoichiometry that For the reaction to proceed, 1 mole of KI requires 1/2 mole of Pb(NO3)

2. As a result, 0.57 mole of KI necessitates (1/2 * 0.57) mole of Pb(NO3)2 for the reaction to continue.

0.285 moles of Pb(NO3)2 required

We have 0.312 moles, which indicates that Pb(NO3)2 is present in excess.

You mix 260. mL of 1.20 M lead(II) nitrate with 300. mL of 1.90 M potassium iodide.The lead (II) iodide is insoluble  all are true.  

learn more about potassium iodide  here:

https://brainly.com/question/28099104

#SPJ4

What is the empirical formula for this crystalline material

Answers

The empirical formula for the given crystalline material is Cu₁₆O₂₀YBa₂

What is the empirical formula of a compound?

The empirical formula of a compound is the simplest formula of a compound that shows the simplest ratio in which the elements are present in a compound.

The simplest whole-number ratio of atoms in a chemical molecule is its empirical formula. Sulfur monoxide's empirical formula, SO, and disulfur dioxide's empirical formula, S₂O₂, are two straightforward examples of this idea. Both have the same empirical formula of SO.

Learn more about empirical formulas at: https://brainly.com/question/13058832

#SPJ1

in the combustion of octane co2 and water are produced. starting with 22.4 g of cotane and excess o2 will produce how many grams of co2

Answers

69 grams of CO2 will produce in the combustion of octane where CO2 and Water is produced.

Combustion is defined as the chemical reaction between substances  including oxygen. The reaction is accompanied by the generation of heat and light in the form of flame. The products CO2 and H2O forms when octane is burned. The process of combustion cannot take place in an atmosphere devoid of oxygen. The main ingredient of combustion is oxygen. The balanced chemical equation for combustion of octane is,

    2C8H18 + 25O2 ----> 16CO2 + 18H2O

The molar mass of C8H18 = 114 g/mole

The molar mass of CO2 = 44 g/mole

The mass ratio of C8H18/CO2 is 2* 114 / (16 * 44)

22.4 g of octane generates, 69 gram of CO2.

To learn more about Combustion please visit:

https://brainly.com/question/29671504

#SPJ4

to make a 1% solution of glucose, you would dissolve gram(s) of glucose into enough water to make a 100ml solution.

Answers

To make a 1% solution of glucose, 1 gram of glucose would be needed to be dissolved into enough water to make a 100ml solution.

Weight/Volume percentage of a solution is defined as the percentage of mass of the solute in grams per 1 ml of volume of the solution. It is denoted by W/V%

W/V% = [tex]\frac{W}{V}[/tex] × [tex]100[/tex]    .....[tex]eq[/tex]

Here, V = Volume of the solution in milliliters (ml)

          W = Weight of the solute in solution in grams (g)

Volume of solution given in the question = 100 ml

W/V% of solution given in the question = 1 %

Thus putting the values in the  [tex]eq[/tex] , we get

Mass or Weight of glucose needed to be dissolved in the solution (W):

= [(W/V%) × [tex]V[/tex]] / [tex]100[/tex]

= ([tex]1[/tex] × [tex]100[/tex]) / [tex]100[/tex]

= 1 gram

Hence, one gram of glucose is needed to be dissolved in a 100 ml solution to make it a 1 % solution of glucose.

Learn more about solution of glucose here:

https://brainly.com/question/14937397

#SPJ4

The next few problems deal with calculating the pH of solutions of weak acids/bases (buffers). Here, we need to use the Henderson-Hasselbalch equation,
which relates pH, pKa (-log10Ka), and the ratio of the concentration of congugate acid (HA) and conjugate base (A-) as follows:
pH = pKa + log10([A-]/[HA])
You wish to prepare 150. milliliters of 0.0900 M sodium acetate, pH 4.80, from glacial acetic acid [a liquid; concentration = 17.5 M, pKa = 4.76] and sodium hydroxide [a solid; purity 99.9%; MW = 40.0].
1. What volume (in milliliters) of glacial acetic acid would you need to make the buffer?
2. What mass (in grams) of NaOH would you need to prepare 25.0 mL of 1.00 M NaOH?
3. What volume (in milliliters) of the 1.00 M NaOH would be needed to adjust the pH to 4.80?

Answers

To prepare 150 mL of 0.0900 M sodium acetate, pH 4.80, we need 74.72 mL of glacial acetic acid, 25 g of NaOH, and 12.6 mL of 1.00 M NaOH.

1. To prepare 150 mL of 0.0900 M sodium acetate, we need to use the Henderson-Hasselbalch equation, which relates pH, pKa (-log10Ka), and the ratio of the concentration of conjugate acid (HA) and conjugate base (A-).

pH = pKa + log₁₀([A-]/[HA])

[A-] = 0.0900 M, [HA] = 17.5 M, pKa = 4.76

To calculate the volume of glacial acetic acid needed, we can use the following equation:

pH = pKa + log₁₀([A-]/[HA])

We know that pH = 4.80, [A-] = 0.0900 M, pKa = 4.76

Therefore, log10([A-]/[HA]) = pH - pKa = 4.80 - 4.76 = 0.04

[A-]/[HA] = 10⁰·⁰⁴ = 1.82

[HA] = [A-]/1.82 = 0.0900 M/1.82 = 0.0495 M

Then, we can calculate the volume of glacial acetic acid needed by using the following equation:

V = n / C = (n / V) x V = (0.0495 M x 150 mL) / 0.0900 M = 74.72 mL

2. To prepare 25.0 mL of 1.00 M NaOH, we can use the following equation:

m = n / V = (n / C) x V = (1.00 M x 25.0 mL) / 1 = 25.0 g

3. To adjust the pH to 4.80, we need to use the Henderson-Hasselbalch equation again, and we can calculate the volume of 1.00 M NaOH needed.

pH = pKa + log₁₀([A-]/[HA])

We know that pH = 4.80, [A-] = 0.0900 M, pKa = 4.76

Therefore, log₁₀([A-]/[HA]) = pH - pKa = 4.80 - 4.76 = 0.04

[A-]/[HA] =10⁰·⁰⁴ = 1.82

[HA] = [A-]/1.82 = 0.0900 M/1.82 = 0.0495 M

The initial [HA] = 17.5 M, thus we need to add 1.82 x 0.0495 M = 0.088 M of NaOH to increase the [A-] and decrease the [HA] to reach the desired pH.

V = n / C = (n / V) x V = (0.088 M x 150 mL) / 0.0900 M = 12.6 mL

Learn more about the Henderson-Hasselbalch equation at

https://brainly.com/question/13423434

#SPJ4

Using the following reaction
A + 2B = 3C + D + heat
If D is removed, what happens to A?

Concentration
of A increases

Concentration
of A decreases

Answers

A's concentration falls if D is removed. In this scenario, the equilibrium position will change, causing A's concentration to once again drop as a result of its reaction with B to produce more C and D.

What is the Le Chatelier creed?

The following is the Le Chatelier principle: A shift in the equilibrium's location cancels out the impact of a change in one of the variables that define an equilibrium in a system.

The KP equation is what?

The broad statement: Kp = Kc(RT) (RT) Where n = moles of gaseous products - moles of gaseous reactants, one can derive n. Pure solids and pure liquids are not given concentration words.

To know more about equilibrium visit:-

https://brainly.com/question/29359391

#SPJ1

Multiply these in scientific notation
(4.1 × 10°) x (3 x 10-6)
Oa
7.1 x103
Ob
1.23 x 102
O c
7.1 x103
O
d
3.21 x 102

Answers

The result of the multiplication of given number in scientific notation is 1.23 × 10⁻⁵. The power of 10 is added in the muiltipication.

What is scientific notation ?

Scientific notation is a standard and scientific way of representing numbers. In scientific notation, the numbers are converted with powers of ten. For example a number 5 can be written as 5 × 10°. Similarly 500 can be written as  5 × 10².

The first term in the scientific notation  4.1 × 10° = 4.1 . since 10° = 1.

second terms, 3 × 10 ⁻⁶. Multiply it with 4.1

= 4.1 × 3 × 10 ⁻⁶ = 12.3 × 10 ⁻⁶ =   1.23 × 10⁻⁵.

Therefore, the final answer in scientific notation is written as: 1.23 × 10⁻⁵.The power ten is increased when we move the decimal point to the left.

Find more on scientific notation:

https://brainly.com/question/16936662

#SPJ1

Figure 16.2 summarizes the classic method for separating a mixture of common cations by selective precipitation. Explain the chemistry involved with each of the four steps in the diagram.

Answers

With the aid of a reagent that precipitates one or more ions while leaving others in solution, ions in an aqueous solution can be separated using the selective precipitation technique.

What does "selective precipitation" entail?With the aid of a reagent that precipitates one or more ions while leaving others in solution, ions in an aqueous solution can be separated using the selective precipitation technique. For metallic elements, conduct a qualitative analysis.Proteins can be selectively precipitated in a variety of ways, including as a bulk technique to recover the majority of the proteins from a crude lysate, a selective technique to fractionate a subset of proteins from a protein solution, or a very specific technique to recover a single protein from a purification step.          

To learn more about precipitation technique refer to:

https://brainly.com/question/866725

#SPJ4

A certain substance has a fixed composition of S and Cl atoms regardless of its source. Which of the following statements about the substance is true?A.) The substance is a homogenous mixtureB.) The substance contains atoms of silicon and chlorineC.) The substance is a heterogenous mixtureD.) The substance is a compound that contains two elementsE.) The substance must contain equal numbers of S and Cl atoms

Answers

The answer was the substance is a compound that contains two elements.

What is meant by elements ?

A fundamental object that is difficult to divide into smaller bits is known as an element.An element is a substance that cannot be broken down by non-nuclear reactions in chemistry and physics.A discrete component of a larger system or collection is referred to as an element in computers and mathematics.The names nihonium, moscovium, tennessine, and oganesson are the official names for elements 113, 115, 117, and 118, respectively.A pure element is one that is made up of atoms of the same kind. Since sodium exclusively contains sodium atoms, it is a pure element. While various atom types make up cement and glass, respectively.

To learn more about elements refer to

https://brainly.com/question/20096027

#SPJ4

polar molecules have attractive dipole-dipole interactions when the dipoles are arranged in which of the following geometries?

Answers

When the dipoles are organized in head-to-tail; antiparallel and side-to-side geometries, polar molecules exhibit attractive dipole-dipole interactions. molecules that are polar.

Because PCl₃ is polar, dipole-dipole attractions will occur. Nonpolar F₂, ionic FeCl₂, and nonpolar CO₂. Dipoles develop in amplitude as covalent bonds get more polar, and hence dipole-dipole attractions expand in size. Dipole-dipole interactions occur when partial charges produced inside one molecule are attracted to an opposing partial charge in a neighboring molecule. Polar molecules align so that the positive end of one molecule interacts with the negative end of another.

learn more about Dipole-dipole interactions here:

brainly.com/question/30510859

#SPJ4

The actual question is:

Polar molecules have attractive dipole-dipole interactions when the dipoles are arranged in which of the following geometries?(Select all that apply)

head-to-tail; side-to-side; antiparallel; diagonal; round and round

which of the statements best describes the carbon-carbon length and strength for the following compounds

Answers

The correct option is (2) i.e. Benzene and p-disubstituted benzene do not have alternating single and double Carbon-Carbon bonds. The C-C bond lengths in these compounds are all similar.

Benzene is a six-carbon aromatic hydrocarbon with a hexagonal ring structure and is characterized by its distinctive aroma. The carbon-carbon (C-C) bonds in benzene are intermediate in length between a single bond and a double bond, and are referred to as "aromatic" or "delocalized" bonds. This means that the electrons in the bonds are spread out over the entire ring, rather than being localized between two adjacent carbon atoms. p-Disubstituted benzene is a type of substituted benzene in which one or more of the hydrogens in the benzene ring have been replaced with a different group. Substitution of the benzene ring often leads to changes in the physical and chemical properties of the molecule. However, the C-C bond lengths in p-disubstituted benzene still have an average value that is between the values for the average C-C single bond length and the average C-C double bond length.

To know more about carbon please refer: https://brainly.com/question/22530423

#SPJ4

Question - Which one of the following statements best describes the C-C bond lengths in benzene and p-disubstituted benzene?

1) Benzene and p-disubstituted benzene have alternating single and double C-C bonds. These bond lengths are not similar to values for the average C-C single bond length and the average C-C double bond length, respectively.

2) Benzene and p-disubstituted benzene do not have alternating single and double C-C bonds. The C-C bond lengths in these compounds are all similar, and have an average value that is between the values for the average C-C single bond length and the average C-C double bond length.

3) Benzene and p-disubstituted benzene have alternating single and double C-C bonds. These bond lengths are similar to values for the average C-C single bond length and the average C-C double bond length, respectively.

Which of the following is an example of water in a liquid state?

Question 6 options:

Steam


Snow


Rain


Ice

Answers

The correct option is Rain because rain is considered a liquid. The other choices are not correct because they are in solid and gas states.

reaction 1: reaction 2: reaction 3: the chemical equations and equilibrium expressions for two reactions at the same temperature are given above. based on the information, which of the following expressions can be used to calculate the value of for reaction 3 at the same temperature? (a) (b) (c) (d)

Answers

The expression for K3 = 1K1×1K2 when the chemical equations and equilibrium expressions for two reactions at the same temperature are given.

A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. For a reaction like aA -> A, the rate law frequently takes the form rate = k[A]n, where k is the proportionality constant known as the rate constant and n is the order of the reaction.

Given the reactions as:

CO(g)+3H2(g)⇄CH4(g)+H2O(g)

the rate law for the above equation is (K1) = [CH4][H2O]/[CO][H2]^3

Then [H2]^3 = [CH4][H2O]/K1[CO]

CO2(g)+H2(g)⇄CO(g)+H2O(g)

the rate law for the above equation is (K2) = [CO][H2O]/[CO2][H2]

[CO2] = [CO][H2O]/K2[H2]

CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)

Similarly the rate law for the above equation is (K3) = [CO2][H2]^4/[CH4][H2O]^2

Then K3 = [CO][H2][CH4][H2O][H2O]/K2[H2]K1[CO]

Then K3 = 1K1×1K2

To learn more about equilibrium click here https://brainly.com/question/29359391

#SPJ4

complete question: Reaction 1:CO(g)+3H2(g)⇄CH4(g)+H2O(g),  K1=[CH4][H2O][CO][H2]3 . Reaction 2:CO2(g)+H2(g)⇄CO(g)+H2O(g), K2=[CO][H2O][CO2][H2]. Reaction 3:CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)then K3=?

The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3 for reaction 3 at the same temperature?

Perform each of the following operations and report your final answer with the correct number of significant figures and in scientific notation. Explain(65.0×1.07)/14=170-3.33+24.9 =99.670+24.52-0.3=

Answers

The correct number of significant figures for (65.0×1.07)/14 is 2, for 170-3.33+24.9 is 3 and 99.670+24.52-0.3 is 4.

The critical figures of a number are the crucial or significant digits that accurately convey the meaning of that number. 6.658, for instance, has four significant digits. These huge amounts give the numbers accuracy. Additionally, they are known as significant digits. The 2, 4, 5, and last 0 of the number 0.2540 are significant. Additionally significant are the zeros before and after numerals and the decimal point. Exponential digits are not significant in scientific notation; the three significant digits in 1.12106 are 1, 1, and 2.

Given the various operations to be carried out as:

(a) (65.0×1.07)/14 = 4.9678 = 5.0

The number of significant figures = 2

(b) 170-3.33+24.9 = 191.57 = 192

The number of significant figures = 3

(c) 99.670+24.52-0.3 = 123.89 = 123.9

The number of significant figures = 4

To learn more about significant figures click here https://brainly.com/question/17396594

#SPJ4

P4 + 5O2 → 2P2O5

How many grams of P2O5 would be produced with 2 moles of P4 used?

________ g P2O5

Answers

The answer is 567.76 grams.

We used the balanced equation for the reaction of P4 + 5O2 → 2P2O5. This equation tells us that for every 1 mole of P4 that reacts, 2 moles of P2O5 are produced.

Therefore, if we start with 2 moles of P4, we would end up with 4 moles of P2O5. To find the mass of 4 moles of P2O5, we can use the molar mass of P2O5 which is 141.94 g/mol.

To find the mass, we multiply the number of moles by the molar mass, so 4 moles * 141.94 g/mol = 567.76 grams.

Learn more about stoichiometry at,

https://brainly.com/question/14935523

if the empirical formula of an organic compound is CH2O then the molecular mass of the compound could be what

Answers

The empirical formula of an organic compound gives the simplest whole number ratio of the different elements in the compound. In this case, the empirical formula of the compound is CH2O, which means that the compound is made up of one Carbon atom, two Hydrogen atoms, and one Oxygen atom.

The molecular mass of a compound can be determined by adding up the atomic masses of all the atoms in its empirical formula. The atomic mass of Carbon is 12.0107 g/mol, the atomic mass of Hydrogen is 1.008 g/mol, and the atomic mass of Oxygen is 15.9994 g/mol.

So, the molecular mass of the compound with an empirical formula of CH2O is (12.0107 + 2 x 1.008 + 15.9994) g/mol = 30.03 g/mol

Therefore, the molecular mass of the compound is 30.03 g/mol.

For the following acid-base reaction, predict the position of the equilibrium and identify the most acidic compound.O favor the right side with compound I being the most acidic compound O favor the right side with compound III being the most acidic compound O favor the left side with compound I being the most acidic compound O favor the left side with compound III being the most acidic compound O the reaction is at equilibrium so all the compounds are in equal concentration

Answers

Favour the right side with compound I being the most acidic compound.Option (b) is correct

Because carbonyl is electron withdrawing group.out of halogen fluorine is most electronegative so it's show it's negative inductive effect and inductive effect is maximum upto 3 atom.in option( b) it is near to  carbonyl . Electron withdrawing group increase acidic strength and halogen are electron withdrawing group,out of all halogen Fluorine is most electron withdrawing atom .The substance is acidic if there are more positively charged hydroniums than negatively charged hydroxyls. If there are more positively charged hydroniums than negatively charged hydroxyls, the compound becomes basic.. The term "potential (or power) of hydrogen" actually denotes pH.

Learn more about acidic compound

brainly.com/question/30255884

#SPJ4

Place the steps required to determine whether or not a precipitate forms when two solutions are mixed in the correct order. Start with the first step at the top of the list. ++ Place these in the proper order. Note the ions present in the reactants. Use the solubility rules to determine whether or not either of the combinations gives an insoluble salt. Consider possible cation-anion combinations. Do you know the answer? No Idea Unsure Think so I know it Read -

Answers

1. Take note of the ions present in the reactants to determine the right order. 2. Consider various cation-anion pairings. 3. To ascertain if one of the combinations results in an insoluble salt, use the solubility criteria.

Positively charged ions are known as cations. Negatively charged ions are referred to as anions. A charged atom or molecule is an ion. A balanced atom will change into a positively charged cation if one or more of its electrons are lost. A balanced atom will change into a negatively charged anion if it gains one or more electrons. Ions include both anions and cations. They are drawn to one another because their electrical charges are in opposition. While an anion repels an additional anion, a cation repels other cations. An ion that has acquired one or more electrons and now has a net negative charge is called an anion.

learn more about Ions here:

https://brainly.com/question/1488567

#SPJ4

If a channel of a particular cell preferentially transmits smaller ionic species across the membrane, given the following biologically relevant, isoelectronic ions, the channel is LEAST likely to transmit:
A.S2−
B.Cl−
C.K+
D.Ca2+

Answers

The channel is least likely to transmit smaller ionic species is D. Ca2+.

What are ions?

Ions are atoms or molecules that have an unequal number of protons and electrons, giving them a net electric charge. The charge can be positive (called cations) or negative (called anions). Ions are formed when atoms gain or lose electrons through chemical reactions or physical processes.

Ca2+ ions are larger than S2-, Cl- and K+, and therefore, it would be harder for a channel that preferentially transmits smaller ionic species to transmit Ca2+ ions across the membrane. The other ions mentioned (S2-, Cl- and K+) are all smaller than Ca2+ and therefore would be more likely to be able to pass through the channel.

It's important to note that this is a hypothetical scenario and the actual ion selectivity of a particular ion channel can depend on many factors like the size and charge of the ion, the structure of the channel pore and the presence of other molecules. It's also important to note that not all ion channels are selective and some allow multiple ions to pass through.

Therefore, the Ca2+ channel is least likely to transfer smaller ionic species.

To learn more about ions from the given link:

https://brainly.com/question/14389993

#SPJ4

What is the charge of the monatomic cation usually formed by each of the following metals? Remember to include the sign with each charge, and enter the number along with the correct sign of the charge in each case. (Do NOT re-enter the element symbols.)Zn Ag Cd

Answers

The charge of the monatomic cation usually formed by each of the following metals is: Zn: +2, Ag: +1, Cd: +2.

It's important to note that the charge of a cation is determined by the number of electrons that the atom loses to form the cation. The charge of a cation can be determined by looking at the element's position in the periodic table and its electron configuration, and also by knowing the common oxidation states of the elements. Some elements tend to lose electrons more readily than others, and that's why they form cations with different charges. A monoatomic cation is a cation (an ion with a positive charge) that is composed of only one atom. It is formed when an atom loses one or more electrons, leaving it with a net positive charge. Monoatomic cations are commonly formed by metals, which tend to lose electrons to form cations with a positive charge. The charge of a monoatomic cation is determined by the number of electrons that the atom loses to form the cation.

To know more about cation please refer: https://brainly.com/question/28710898

#SPJ4

F and G react together. When the concentration of F is tripled and the concentration of G remains constant, there is a nine-fold increase in the rate of the reaction. What is the order of the reaction with respect to F?

Answers

There is a nine-fold rise in the pace of the reaction when the concentration of F is tripled but the concentration of G stays the same. The response is in the second order relative to F.

What happens to rate of reaction if concentration is tripled?

If you increase one reactant's concentration in a third order reaction involving two reactants by three times, the rate rises by a factor of three. If a reactant is first order, its concentration will cause a doubling in the reaction's rate; a tripling in the reaction's rate, etc. If a reactant is third order, its rate of reaction will increase by a factor of 8 when its concentration is doubled (23 = 8), etc.

The concentration of a reactant does not impact the rate. The rate remains unchanged even if the concentration is doubled. The given rate law needs to be written first. The concentrations of A and B will be increased by three times each after that.

To learn more about order refer to :

https://brainly.com/question/28179168

#SPJ4

A chemist adds 265.0 mL of a 0.122 M barium chlorate (Ba(CIO3)2) solution to a reaction flask. Calculate the mass in grams of barium chlorate the chemist has added to the flask.

Answers

The chemist added 0.1424 g of barium chlorate to the flask.

To calculate the mass of barium chlorate added to the reaction flask, we need to use the formula: mass = molarity x volume x molar mass.

First, we need to find the molar mass of barium chlorate. The molar mass is calculated by adding the molar masses of all the atoms in the compound.

The formula for barium chlorate is Ba(CIO₃)₂, which means it is made up of one barium atom (Ba), two chlorine atoms (Cl), six oxygen atoms (O), and two iodine atoms (I).

The molar mass of barium is 137.327 g/mol, chlorine is 35.453 g/mol, oxygen is 15.999 g/mol, and iodine is 126.904 g/mol.

So the molar mass of barium chlorate is (137.327 + 235.453 + 615.999 + 2×126.904) g/mol = 479.205 g/mol.

Next, we need to use the formula mass = molarity x volume x molar mass. We know that the molarity is 0.122 M, the volume is 265.0 mL and the molar mass is 479.205 g/mol. So we can plug these values into the formula: mass = 0.122 x 0.265 x 479.205.

After converting the volume to L and using the formula, we get 0.1220.265479.205 = 0.1424 g.

So the chemist added 0.1424 g of barium chlorate to the flask.

Learn more about barium chlorate at

https://brainly.com/question/30010074

#SPJ4

What is the molar mass of Carbon atoms in 1 mole of trolamine (C6H15NO3)?
Be sure to include the mass of all elements in the formula.

14.01g

48.00g

15.15g

72.06g

Answers

The molar mass of carbon atoms in 1 mole of trolamine is 72.06 g where the molar mass of compound is 149 g.

What is molar mass?

Molar mass of a compound or a molecule is defined as the mass of the elements which are present in it.The molar mass is considered to be a bulk quantity not a molecular quantity. It is often an average of the of the masses at many instances.

Molar masses of an element are given as relative atomic masses while that of compounds is the sum of relative atomic masses which are present in the compound.

Molar mass of carbon atoms in 1 mole of trolamine is given as, 12.011×6=72.06 g

Thus, the molar mass of carbon atoms in 1 mole of trolamine is 72.06 g where the molar mass of compound is 149 g.

Learn more about molar mass,here:

https://brainly.com/question/22997914

#SPJ1

with reference to their rf values, rank the four amino acids in terms of their solubility in the solvent used

Answers

The four amino acids that are ranked in terms of their solubility in the solvent used, according to the Rf values, are Leucine, Arginine, Alanine, and Glycine.

What is Rf value?The retention factor (Rf value) is important in chromatography because it can be used to predict where a specific substance will be located on the chromatogram. This is due to the fact that the Rf value measures how far a specific substance has traveled relative to the solvent front.The presence of a high retention factor indicates a strong interaction between the compound of interest and the surface. This also implies that the compound of interest is highly soluble in the mobile phase.Moving molecules with a small Rf are less soluble in the hydrophobic (non-polar) solvent they are larger and also have a greater affinity towards the hydrophilic paper than molecules with a larger Rf.

To learn more about Rf value refer to :

https://brainly.com/question/17796724

#SPJ4

assignment is to list three different areas of science that changed significantly in the Scientific Revolution After you have come up with three areas of the sciences you will write three to four sentences on how these sciences contributed to the Scientific Revolution. Make sure you are going below the surface: who contributed and how they created change, what ideas were challenged, what questions did they want answered?

Answers

Three different areas of science changed significantly in the Scientific Revolution, abstract reasoning, quantitative thought, and an understanding of how nature works.

What is a scientific revolution?

Focusing on quantitative analysis, understanding how nature functions, seeing nature as a machine, and developing an experimental scientific method were all hallmarks of the Scientific Revolution.

The world's understanding of the principles of motion and gravity improved thanks to the Scientific Revolution, which also laid the groundwork for several other discoveries and inventions.

Therefore, the Scientific Revolution brought about important changes in three different branches of science: abstract reasoning, quantitative thinking, and an understanding of how nature functions.

To learn more about the scientific revolution, refer to the link:

https://brainly.com/question/14328830

#SPJ1

What is the temperature (in K) of 16.45
moles of methane gas in a 70.7 L
container at 3,557 torr?

Answers

At 3,557 torr, 16.45 moles of methane gas are at a temperature of T=17.15 K in a 70.7 L container.

According to the ideal gas law: PV=nRT, where R=0.082 and T is temperature in Kelvin (K). P is pressure, V is volume, n is the amount in moles.

(4.68)*(4.95)=(16.45)*(0.0821)*

T=17.15, therefore calculate it.

What's called gas?

An object that is in the gaseous, or vaporous, condition of matter, is referred to as a gas. When referring to material with characteristics of a gaseous substance, the word "gas" can also refer to the condition itself. Along with liquid, solid, and plasma, gases are one of the four natural states of matter. The shape or volume of a gas can change.

To know more about Gas visit:

https://brainly.com/question/10725862

#SPJ1

Answer:

245

Explanation:

everyone needs to chill don't answer if you can't get it right it wastes you time and others as well not trying be a hater but its true

From 23g of ethanol are obtained,36g ethylethanoate by esterification with ethanoic acid in the presence of concentrated

Answers

In the presence of concentrated sulphuric acid as a catalyst, ethanol interacts with ethanol to form the ester, ethyl ethanoate. The response is gradual and reversible.

How does the mechanism work?

In the presence of concentrated sulphuric acid as a catalyst, ethanol interacts with ethanol to form the ester, ethyl ethanoate. The response is delayed and can be reversed. To reduce the possibility of a reverse reaction, the ester is distilled out as soon as it is generated.

Because it makes the process less unclear, all of the stages in the mechanism below are depicted as one-way reactions. The reverse reaction is performed so differently that it influences how the mechanism is stated. If you’re interested, there’s a link to ester hydrolysis farther down the page.

To learn more about  Ethanoic acid to refer:

https://brainly.com/question/28166727

#SPJ1

Ethene (C2H4) reacts with halogens (X2) by the following reaction:
C2H4(g) + X2 == C2H4X2(g)
The following figures represent the concentrations at equilibrium at the same temperature when X2 is Cl2 (green), Br2 (brown), and I2 (purple). List the equilibria from smallest to largest equilibrium constant. [Section 15.3]

Answers

The correct order for equilibrium constant = K₁ > K₂ >K₃

What is meant by equilibrium?

Alkene ethene and elemental halogen X2 are both used. Halogenation reaction is the name given to the reaction between an alkene and a halogen.The electrophilic addition mechanism is used in this reaction. Elctrophile, X+, is produced in this reaction by elemental halogen (X2).The double bond in the alkene draws this electrophile and binds it to it.Electrophile addition causes the production of a carbocation intermediate.Nucleophile attacks this positive carbon, leading to the production of a 1,2-di halide alkane as a consequence.Ethene (C2H4) and halogen (X2) combine to form 1,2 - dihalide ethane (C2H4X2). The graphic depicts the reaction of halogen (X2) with chlorine (Cl2).

On applying this concept in figures :

Given : Green = Cl₂ Brown = Br₂ Purple = I₂ Grey = Ethene

Grey + Green = 1,2- dihalide ethane

a) Number of Cl₂(green ) = 2

number of ethane ( grey ) = 2

Number of 1,2-dichloride alkane( grey + green ) = 8

Plugging these number in equilibrium constant expression :

[tex]k_{1} = 8/ 2*2=8/4=2[/tex]

Hence K₁ for ethene + chlorine = 2

b) Number of Br₂(brown ) = 4

number of ethane ( grey ) = 4

Number of 1,2-dibromide alkane( grey + brown ) = 6

On plugging these values in K expression as :

[tex]K_{2} = 6/4*4=6/16=0.0612[/tex]

Hence K₂ for ethen + Bromine = 0.375

c) Number of I₂(purple ) = 7

number of ethane ( grey ) = 7

Number of 1,2-diiodide alkane( grey + purple ) = 3

On plugging values in K expression as:

[tex]K_{3} = 3/7*7=3/49=0.0612[/tex]

Hence K₃ for ethene + Iodine = 0.0612

So , the order of equilibrium constant (K) from largest to smallest :

K₃ = 0.0612 K₂ = 0.375 K₁= 2

K₁ > K₂ >K₃

To learn more about equilibrium refer to

https://brainly.com/question/26075805

#SPJ4

: identify the structures of each amino acid and classify each amino acid. the structures of each amino acid are shown.

Answers

Aliphatic, aromatic, acidic, basic, acid amide, sulfur and cyclic amino acids. Based on characteristic of functional group amino acids are classified as: polar and non-polar amino acids.

What is meant by functional?

Functional refers to an object's operation or usefulness. It also denotes that it relates to how it performs or operates.A mathematical machine known as a function accepts one or more numbers as inputs and outputs another number.One or more functions may be inputs to a functional, which outputs a number. A Functional is a function of Functions, then.All biological activities, including digestion, elimination, respiration, and others, can be performed by a cell. The functional unit of life is referred to be such for this reason. Each and every living thing is made up of cells, which are the smallest unit of life.

To learn more about  functional refer to

https://brainly.com/question/22340031

#SPJ4

Other Questions
true/false. different aspects of the u.s. constitution as well as the debate between federalist no. 10 and brutus no. 1 reflect the tension between the broad participatory model and the more filtered participation of the pluralist and elite models. which of the following assumptions do the market structures of monopolistic competition and perfect competition share? O a. many buyers and sellers O b. homogeneous products c. difficult entry into the market O d. difficult exit from the market here to search what is the angle between the given vector and the positive direction of the x-axis? (round your answer to the nearest degree. i + sqrt (15) j WILL GIVE 15 POINTS(don't have a lot) BUT PLEASE HELP4. Why does the stream take so long to start flowing heavily after it has been raining? HELP PLIS IS FOR MY QUIZGovernment and Politics Unit 2: The Three BrancheGovernment and Foreign PolicyWhy did the framers of the Constitution create three separate branches of government?A. to help people with different opinions cooperateB. to increase the power of the central governmentC. to keep any one group from gaining too much powerD. to provide enough officials to handle the volume of workWhich of these is the defining characteristic of a federal system of government?A. Elected representatives make decisions for the nation.B. Power is divided between central and regional bodies.C. Separate branches have different areas of responsibility.D. Legislative actions are limited by a set of written guidelines.Over time, constitutional amendments have extended which right to the groups listed below?- African Americans- Women- Residents of the District of Columbia18-year-oldsA right to an educationB. right to serve on a juryC. right to vote in electionsD. right to federal employmentThe Supremacy Clause of the Constitution indicates how to resolve conflicts betweenA. state and federal laws.B. both chambers of Congress.C. strict and loose constructionists.D. majority rule and minority rights.Which of these is the best example of constitutional checks and balances?A. Treaties require Senate approval.B. The Constitution may be amended.C. The president is paid for his services.D. Courts decide conflicts between states.The process of amending the Constitution involves bothA. the Congress and the states.B. the president and the Congress.C. the states and the Supreme Court.D. the Supreme Court and the president. Bruna i comparing the pay for advertied job. Which 2 way could Bruna find the bet paying job? ( choo 2 anwr) A 2kg ball accelerate downward at 9. 8m/^2. How long doe it take to reach a peed of 29. 4m/? (a) Calculate a confidence interval at confidence level approximately 95% for the difference between population mean height for the younger women and that for the older women. (Use 2039 60 and older.)Interpret the interval. O We cannot draw a conclusion from the given information. O We are 95% confident that the true average height of younger women is greater than that of older women by an amount outside the confidence interval. O We are 95% confident that the true average height of younger women is less than that of older women by an amount within the confidence interval. O We are 95% confident that the true average height of younger women is greater than that of older women by an amount within the confidence interval. True orFFalse: Strategic objectives are the means of achieving the mission and vision, and should provide focus on decisions regarding which projects to select and how to prioritize them. swarthmore offers optional interviews. please note that applicants who do not interview are not at a disadvantage. left turns are made from the furthest most _____lane and should be done so only when traffic indicates it is safe and prudent. What type of monarchy has laws that limited the ruler's power?. Alyson deposits $500 in the bank for 12 years. The bank offers her a 4% interest rate compounded annually. How much money will be in her account at theend of the 12 years? (Remember to round your answer to the nearest cent.) How does Gilgamesh relate to the hero's journey?. What percent of the 8th graders estimated they spend less than an hour a day on social media? Round your answer to the nearest whole number percent. someone help solve this pls Culture is defined as:The opinions or general feelingsabout somethingThe behaviors, values, and beliefs shared by agroup of people, such as an ethnic, racial,geographical, religious, gender, class or agegroupThe ability to relate effectively to individualsfrom various groups and backgroundsPreconceived judgment or opinion; an adverseopinion or leaning formed without just groundsor before sufficient knowledge What are the characteristics of the poetry of Wordsworth?. Fraud risk ______.(Select all that apply)must be considered on each audit engagementis the risk of material error by management when issuing financial statementsis not specifically mentioned in the audit risk model the city of is the capital city of (country) - located where the white nile and blue nile converge.