Chemistry dilutions with stoichiometry. Please help if you know how to do these types of problems

Chemistry Dilutions With Stoichiometry. Please Help If You Know How To Do These Types Of Problems

Answers

Answer 1

1. The Molar mass of Al(SO₄)₃ is 342.15 g/mol

2. The molarity of aluminum ions in the new solution will be 0.478 M.

How to calculate the value

1. Aluminum (Al): 26.98 g/mol (2 atoms)

Sulfur (S): 32.07 g/mol

Oxygen (O): 16.00 g/mol (12 atoms)

Molar mass of Al(SO₄)₃ = (2 × 26.98 g/mol) + 32.07 g/mol + (12 × 16.00 g/mol)

= 342.15 g/mol

2. Total moles of Al₃+ ions in the new solution = 0.0436 mol + 0.0877 mol = 0.1313 mol

Volume of the new solution = 225 mL + 325 mL = 550 mL = 0.55 L

Molarity of Al₃+ ions in the new solution = 0.1313 mol / 0.55 L

= 0.478 M

Learn more about molar mass on

https://brainly.com/question/837939

#SPJ1


Related Questions

Write the structure of essential fatty acid with three double bonds and give the name

Answers

Essential fatty acids play a crucial role in human health and should be included as part of a balanced diet. The structure of an essential fatty acid with three double bonds is an omega-3 fatty acid known as alpha-linolenic acid.

Essential fatty acids are the dietary fats that are required by the human body for healthy functioning.

The human body cannot produce essential fatty acids on its own, so they must be obtained from dietary sources.

They are important components of cell membranes and are necessary for the synthesis of important molecules such as eicosanoids, which regulate inflammation and blood clotting.

There are two types of essential fatty acids: omega-3 and omega-6. Both types are polyunsaturated fatty acids, meaning that they contain more than one double bond in their carbon chain. The structure of an essential fatty acid with three double bonds is as follows: CH3(CH2)5CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH.

This is an omega-3 fatty acid known as alpha-linolenic acid.

It is important for brain function and has been linked to a reduced risk of heart disease. The name of this fatty acid is derived from its chemical structure.

The first part of the name, alpha, refers to the position of the double bond closest to the carboxyl group (COOH). The second part of the name, linolenic, indicates that there are three double bonds present in the carbon chain.

The final part of the name, acid, refers to the fact that it is an acid due to the presence of the carboxyl group.

For more such questions on fatty acids

https://brainly.com/question/876346

#SPJ8

Explain one way you could set up a tug-of-war that was imbalanced.Explain one way you could set up a tug-of-war that was imbalanced.

Answers

Answer:

have 5 people on one side and 3 people on the other side

Explanation:

Chemistry questions about dilutions with stoichiometry

Answers

9. The molarity of nitrate ions in the new solution will be A, 0.575 M.

10. The molarity of aluminum ions in the new solution will be D, 0.479 M.

How to find molarity?

Question 9

To solve this, first calculate the number of moles of nitrate ions in each solution:

The number of moles of nitrate ions in Solution A is 30.0 g Al(NO₃)₃ / 225 mL × 1 mol Al(NO₃)₃ / 213 g Al(NO₃)₃ = 0.575 mol NO₃⁻

The number of moles of nitrate ions in Solution B is 30.0 g Al₂(SO₄)₃ / 325 mL × 3 mol NO₃⁻ / 2 mol Al₂(SO₄)₃ = 0.478 mol NO₃⁻

The total number of moles of nitrate ions in the new solution is 0.575 mol NO₃⁻ + 0.478 mol NO₃⁻ = 1.053 mol NO₃⁻

The total volume of the new solution is 225 mL + 325 mL = 550 mL

The molarity of nitrate ions in the new solution is 1.053 mol NO₃⁻ / 550 mL = 0.575 M

Question 10

To solve this, first calculate the number of moles of aluminum ions in each solution:

The number of moles of aluminum ions in Solution A is 30.0 g Al(NO₃)₃ / 225 mL × 1 mol Al(NO₃)₃ / 213 g Al(NO₃)₃ × 1 mol Al / 1 mol Al(NO₃)₃ = 0.222 mol Al

The number of moles of aluminum ions in Solution B is 30.0 g Al₂(SO₄)₃ / 325 mL × 2 mol Al / 2 mol Al₂(SO₄)₃ = 0.333 mol Al

The total number of moles of aluminum ions in the new solution is 0.222 mol Al + 0.333 mol Al = 0.555 mol Al

The total volume of the new solution is 550 mL

The molarity of aluminum ions in the new solution is 0.555 mol Al / 550 mL = 0.479 M

Find out more on molarity here: https://brainly.com/question/30404105

#SPJ1

Acrylonitrile, C3H₂N, is a molecule used to produce a plastic called Orlon. How many grams of acrylonitrile
could be produced by reacting 583 g of propene, C3H, with excess ammonia, NH, and oxygen?
2C3H6+ 2NH3 + 30₂ → 2C,H₂N + 6H₂O

a. 368 g
b. 1470 g
C. 462 g
d. 735 g
e. 583 g

Answers

d. 735 g of acrylonitrile could be produced by reacting 583 g of propene, [tex]C_{3}H[/tex], with excess ammonia, NH, and oxygen

To determine the grams of acrylonitrile that could be produced, we need to find the limiting reactant in the given chemical equation. The limiting reactant is the one that is completely consumed and determines the amount of product formed.

First, we need to calculate the molar masses of propene ([tex]C_{3}H_{6}[/tex]) and acrylonitrile ([tex]C_{3}H_{2}N[/tex]).

Molar mass of propene ([tex]C_{3}H_{6}[/tex]):

3(C) + 6(H) = 3(12.01 g/mol) + 6(1.01 g/mol) = 42.09 g/mol

Molar mass of acrylonitrile ([tex]C_{3}H_{2}N[/tex]):

3(C) + 2(H) + 1(N) = 3(12.01 g/mol) + 2(1.01 g/mol) + 1(14.01 g/mol) = 53.06 g/mol

Next, we calculate the number of moles of propene:

583 g / 42.09 g/mol = 13.86 mol

According to the balanced equation, the stoichiometric ratio between propene and acrylonitrile is 2:2. Therefore, for every 2 moles of propene, 2 moles of acrylonitrile are produced.

Since the stoichiometric ratio is 1:1, the number of moles of acrylonitrile produced is also 13.86 mol.

Finally, we calculate the mass of acrylonitrile:

Mass = moles × molar mass = 13.86 mol × 53.06 g/mol = 735 g

Therefore, Option D is correct.

Know more about Molar mass here:

https://brainly.com/question/24191825

#SPJ8

Identify the physical state(s) corresponding to the regions on the cooling curve below.

Answers

Based on the information, we can infer that the labels for each letter according to the physical state of matter would be: A. gas, B. liquid and gas, C. liquid, D. liquid, E. liquid and solid.

How to complete the chart?

To complete the table we must take into account the graph that shows the variation of temperature in an element. In this case we can infer that the descending curve refers to the decrease in temperature.

In this case we can infer that the element may be water because its boiling point is close to 100° and its freezing point is at 0°. According to the above, the letters in the box correspond to the following labels:

A. gas, B. liquid and gas, C. liquid, D. liquid, E. liquid and solid.

Learn more about states of matter in: https://brainly.com/question/29476563

#SPJ1

it is difficult to cut the steam of water

Answers

It is difficult to cut the steam of water because of the unique properties of water and steam.Water and steam are two different states of matter, but they have a common property - they are both molecules of H2O. Steam is formed when water is heated, and the molecules of H2O begin to move faster and further apart from one another.

This results in steam, which is a gas and not a liquid like water. It is more challenging to cut the steam of water than the liquid water due to its unique properties.Therefore, the difficulty of cutting steam of water is due to the following properties of steam:Low density: Steam has low density because of the increased space between the water molecules due to heating. This means that steam takes up more space and is lighter than water, making it difficult to cut or separate from the atmosphere.Gaseous state: Steam is a gaseous state, which means it does not have a definite shape or volume like liquid water. Therefore, cutting steam would be difficult as it does not have a defined structure. Moreover, steam would disperse instantly if it is cut due to its gaseous form and become difficult to capture.Very hot: Steam is at a temperature that is harmful to human skin, and can cause severe burns. This means that cutting steam is also a safety concern, which makes the process even more challenging.

For such more question on molecules

https://brainly.com/question/475709

#SPJ8

Describe the relationship between molecular structure and acid strength.

Answers

The relationship between molecular structure and acid strength is crucial in understanding the behavior and properties of acids. Acid strength is determined by the ability of an acid to donate protons (H+) in an aqueous solution. The molecular structure of an acid plays a significant role in determining its strength.

The key factor influencing acid strength is the stability of the resulting conjugate base after the acid donates a proton. The more stable the conjugate base, the stronger the acid. There are several factors that contribute to the stability of the conjugate base.

Firstly, electronegativity plays a role. Acids with more electronegative atoms, such as oxygen, tend to have stronger acidity because they can stabilize the negative charge on the conjugate base through resonance or inductive effects.

Secondly, the presence of electron-withdrawing groups enhances acid strength. These groups, like halogens or nitro groups, withdraw electron density from the acidic hydrogen, making it easier to dissociate and donate a proton.

Thirdly, molecular size also affects acid strength. Acids with larger molecules tend to have weaker acidity because the electron density is spread over a larger area, making it less likely for the acidic hydrogen to dissociate.

Overall, the molecular structure of an acid influences its acidity by determining the stability of the resulting conjugate base. Factors such as electronegativity, electron-withdrawing groups, and molecular size all contribute to the strength of an acid.

For more such questions on molecular structure

https://brainly.com/question/27789666

#SPJ8

Question 8 of 10
What conditions make AG always negative?

Answers

The conditions that make ∆G (Gibbs free energy) always negative are when a reaction is spontaneous and thermodynamically favorable. This occurs when the system has a decrease in enthalpy (∆H) and an increase in entropy (∆S).

A negative ∆H indicates an exothermic reaction, where the products have lower energy than the reactants. An increase in entropy (∆S) means that the disorder or randomness of the system increases during the reaction.

When ∆H is negative and ∆S is positive, the equation ∆G = ∆H - T∆S (where T is the temperature in Kelvin) results in a negative ∆G. In this case, the reaction is spontaneous, meaning it can proceed without requiring an external input of energy.

Furthermore, when the reaction is carried out under standard conditions (standard temperature, pressure, and concentration), the resulting ∆G° (standard Gibbs free energy change) will always be negative for a spontaneous reaction.

In summary, negative ∆G is achieved when the reaction is exothermic, increases the disorder of the system, and occurs under standard conditions or conditions where ∆H is negative and ∆S is positive.

Know more about exothermic here:

https://brainly.com/question/2924714

#SPJ8

When this chemical equation is balanced, what is the coefficient of NeCI?
- NaCI +
_РЬ(N03)2 ->
_PbCI2 + NaNO3

Answers

By process of elimination, the coefficient of NaCl is 1, as it does not appear in the given chemical equation.

To balance the chemical equation:

NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

We can start by balancing the atoms individually. We begin with the least complex atom, in this case, sodium (Na):

NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

The equation already has one Na on the left side, so we place a coefficient of 1 in front of NaCl:

1NaCl + Pb(NO3)2 -> PbCl2 + NaNO3

Next, we move on to chlorine (Cl). On the left side, there is one Cl in NaCl, while on the right side, there are two Cl in PbCl2:

1NaCl + Pb(NO3)2 -> 1PbCl2 + NaNO3

We balance the nitrate ions (NO3). On the left side, there are two NO3 in Pb(NO3)2, while on the right side, there is only one NO3 in NaNO3:

1NaCl + Pb(NO3)2 -> 1PbCl2 + 2NaNO3

Finally, we balance the lead (Pb) atoms. There is one Pb on the right side in PbCl2, so we place a coefficient of 1 in front of Pb(NO3)2:

1NaCl + 1Pb(NO3)2 -> 1PbCl2 + 2NaNO3

For more such questions on elimination visit;

https://brainly.com/question/17101814

#SPJ8

why do nonmetals tend to gain electrons to form negative loss?
a. they gain the few electrons they need to form full octets
b. they have fewer protons in their nuclei, so they attract electrons
c. they gain electrons to balance the protons in their nuclei
d. they have low electronegativities

Answers

Nonmetals are found on the right side of the periodic table and they tend to gain electrons to achieve stable electronic configurations. These elements have high ionization energies and low electromagnetism which make it difficult for them to lose electrons and easier for them to gain electrons.

Most nonmetals have four, five, six, or seven valence electrons and they need to gain one, two, or three electrons to complete their outermost energy level and obtain a stable electronic configuration, often similar to that of a noble gas.For instance, Fluorine (F), Chlorine (Cl), and Oxygen (O) are nonmetals and they have seven, seven, and six valence electrons, respectively. They are very electromotive which means that they tend to attract electrons towards themselves. When they gain an electron, they form an anion with a negative charge that is isoelectronic to the nearest noble gas in the periodic table.In summary, nonmetals tend to gain electrons to form negative ions because they have high ionization energies and low electromagnetism. These properties make it difficult for them to lose electrons and easier for them to gain electrons. When they gain electrons, they form anions with negative charges that are isoelectronic to the nearest noble gas.

For such more question on electromagnetism

https://brainly.com/question/12555869

#SPJ8

81. Which of the following is NOT composed of protein? A. sex hormones C. Hair B. Muscle D. Enzymes​

Answers

Answer: A. sex hormones

Explanation:

Sex hormones are steroid compounds synthesized from cholesterol mainly in the testes, ovaries, and adrenal cortex.

Sodium chloride can be obtained from
underground deposits or from the…….
What is the missing word?

Answers

Answer:Common salt is sodium chloride, NaCl. It can be made in a laboratory by the reaction of sodium with chlorine. However, it is found naturally in large amounts in sea water or in underground deposits. It is often obtained either by evaporating sea water or by mining underground deposits.

Explanation:

What is the predominant form of ethylenediamine at pH 6.184 ?

H2NCH2CH2NH+3

H2NCH2CH2NH2

H+3NCH2CH2NH+3

Answers

The predominant form of ethylenediamine at pH 6.184 is H2NCH2CH2NH+3.

At pH 6.184, which is slightly acidic, the amino groups in ethylenediamine (H2NCH2CH2NH2) can partially protonate, resulting in the formation of ammonium ions (H+3NCH2CH2NH+3). The equilibrium between the neutral form and the protonated form is pH-dependent.

Therefore, at pH 6.184, the predominant form of ethylenediamine is H2NCH2CH2NH+3.

An exothermic process will result in:

a. a reaction vessel that feels cold as heat is absorbed from the surroundings.

b. a reaction vessel that feels warm as heat passes to the surroundings

c. products with more energy content than reactants

d. a positive energy gain for the reaction (+q).

Answers

Answer:An exothermic process releases heat, causing the temperature of the immediate surroundings to rise.

Explanation:

does the molecule which have C2 axis perpendicular to the Cn axis have mirror plane perpendicular to the Cn axis ?

Answers

No, a molecule with a [tex]C_2[/tex]axis perpendicular to the [tex]C_n[/tex]axis does not necessarily have a mirror plane perpendicular to the [tex]C_n[/tex]axis.

The presence of a [tex]C_2[/tex]axis perpendicular to the [tex]C_n[/tex]axis implies that the molecule possesses rotational symmetry around the [tex]C_n[/tex]axis. However, the presence of a mirror plane is determined by the presence of an additional symmetry element in the molecule.

A mirror plane is a symmetry element that divides the molecule into two halves, with one half being the mirror image of the other. In order for a mirror plane to be present perpendicular to the [tex]C_n[/tex]axis, there needs to be an additional symmetry element that produces the reflection symmetry.

While a molecule with a [tex]C_2[/tex] axis perpendicular to the [tex]C_n[/tex]axis has rotational symmetry, it does not necessarily possess reflection symmetry. For example, consider a molecule with a [tex]C_2[/tex]axis perpendicular to a [tex]C_3[/tex]axis.

The rotational symmetry is evident, as the molecule can be rotated by 120 degrees around the [tex]C_3[/tex] axis and still appear the same. However, this molecule does not possess a mirror plane perpendicular to the [tex]C_3[/tex]axis.

The presence of a mirror plane perpendicular to the [tex]C_n[/tex]axis depends on the specific molecular geometry and arrangement of atoms. It is possible for a molecule to possess both rotational symmetry and a mirror plane perpendicular to the [tex]C_n[/tex]axis, but it is not a general rule.

For more such questions on perpendicular visit:

https://brainly.com/question/23828050]

#SPJ8

Describe the weather conditions for a Stationary front.

Answers

A stationary front is a boundary between two air masses that are not moving relative to one another. When a cold front or warm front meets and can't push one another, they create a stationary front. The wind direction around a stationary front changes slightly in one or both directions, but not enough to create a cold front or warm front.

The weather conditions for a stationary front are a mixture of cold and warm fronts' characteristics. When a stationary front is formed, the warm and cold air masses are separated. The result is often a band of precipitation, cloudiness, and humid conditions. Stationary fronts cause lengthy periods of precipitation, including mist, fog, and drizzle, and they can cause flooding in some regions.They can also generate thunderstorms and other kinds of inclement weather, and the intensity of the rain or snow is typically determined by the temperature and humidity levels.The warm air mass' instability often results in thunderstorms, tornadoes, and heavy rain and hail in the area where it meets the cooler, more stable air mass. Precipitation occurs, but it is usually light and steady rather than heavy and thundery. In summary, stationary fronts create a mix of weather conditions, which can vary depending on the air masses involved and the specific geography of the location.

For such more question on inclement

https://brainly.com/question/31765968
#SPJ8

How many moles of gold are there in 28 grams of gold?

Answers

Answer: There are approximately 0.142 moles in 28 grams of Gold.

Explanation:

To calculate the number of moles 28 grams of Gold, we need to know the molar mass of gold. The molar mass of gold (Au) is approximately 197 grams per mole.

We can use the formula:

Number of moles = Mass (in grams)  / Molar mass

Substituting the given values:

Number of moles = 28 g / 197 g per mole

Number of moles ≈ 0.142 moles (approx.)

Therefore, there are approximately 0.142 moles of gold in 28 grams.

For more questions on Molar mass and moles, see :

https://brainly.in/question/11731

0.142 mol/dm^3 in 28 grams of gold

what is the density of a liquid with volume 1817.cm and mass of 1.14kg

Answers

Answer:[tex]d=\frac{1817 cm}{1.14kg} d= 1593.86 \frac{cm}{kg}[/tex]

Explanation:

[tex]d= \frac{v}{m}[/tex]

Describe the energy in wind and the way in which its converted to electrical energy?

Answers

Answer:Wind rotates the rotor blades

Explanation:

Wind turbines use blades to collect the wind's kinetic energy. Wind flows over the blades creating lift (similar to the effect on airplane wings), which causes the blades to turn. The blades are connected to a drive shaft that turns an electric generator, which produces (generates) electricity.

PLEASE HELP ME :(

In a certain complex ion, the central ion or atom has 5d electrons and is complexed by a strong ligand. The coordination number of the central ion / atom is 6.
a. Draw an energy level diagram that represents the five d orbitals with their electrons.
b. Describe the ion in terms of whether it is high spin or low spin, number of unpaired electrons, and whether the central atom is diamagnetic or paramagnetism [and if "para", how much].

Answers

From the description in the question;

1) The image is shown in attachment

2) The energy levels are shown in the image attached.

3) The complex is diamagnetic

What is the complex?

For a strong ligand, the crystal field splitting energy is larger, and it results in a larger energy gap between the d orbitals. As a result, the electrons tend to be pairing up. We would have a low spin complex as a result of this.

Since we know that in  the low spin there would be the pairing up of the electrons as we gave envisaged in the paragraph that is before this, then it naturally follows that the complex would be diamagnetic.

Learn more about complexes:https://brainly.com/question/29377605

#SPJ1

PLEASE HURRY
50 POINTS !!!!

Select the correct compound.
Reactants undergo chemical reaction to form products.
This chemical equation represents one such reaction.
The coefficient for one of the reactants or products is incorrect.
Which part of the chemical equation is incorrect?

2C₂H₁0+ 100₂

8CO₂+ 10H₂O

Answers

The chemical equation that represents one such reaction is:

2C2H10 + 13O2 --> 8CO2 + 10H2O.

The answer is "There is no part that is incorrect".

In the given chemical equation, all the coefficients are correct. Hence, the answer is "There is no part that is incorrect".A chemical equation is defined as the symbolic representation of a chemical reaction in the form of symbols and formulae, where reactants are written on the left side of the equation and products are written on the right side. It describes the identity and quantity of the reactants and products involved in the chemical reaction. The reactants undergo the chemical reaction to form products. The reactants are written on the left side of the equation, and the products are written on the right side. Each element's number of atoms is conserved in both the reactants and the products.

For such more questions on chemical equation

https://brainly.com/question/29886207

#SPJ8

An Ibuprofen (MW = 206.29) solution was made by dissolving 4,421 milligrams into water with a
final volume of 0.172 L. What is the concentration of Ibuprofen in Molarity?

Answers

The concentration of Ibuprofen in the solution is approximately 0.124 M (Molarity), calculated by dividing the moles of Ibuprofen (0.0214 mol) by the volume of the solution (0.172 L).

To calculate the concentration of Ibuprofen in molarity, we need to use the formula:

Concentration (Molarity) = moles of solute / volume of solution in liters

First, we need to convert the mass of Ibuprofen into moles. The molar mass of Ibuprofen is given as 206.29 g/mol.

Step 1: Convert milligrams to grams:

4,421 mg = 4.421 g

Step 2: Convert grams to moles:

moles = mass / molar mass

moles = 4.421 g / 206.29 g/mol

moles ≈ 0.0214 mol

Step 3: Calculate the concentration:

Concentration = moles / volume

Concentration = 0.0214 mol / 0.172 L

Concentration ≈ 0.124 M

Therefore, the concentration of Ibuprofen in the solution is approximately 0.124 M (Molarity). This means that there are 0.124 moles of Ibuprofen dissolved in every liter of the solution.

Know more about Molarity here:

https://brainly.com/question/30404105

#SPJ8

A continous fractionating column separates 1500 kg/h of a solution of benzene and toluene containing 0.75 mass benzene into an overhead product containing 0.925 mass fraction benzene and bottom product containing 0.075 mass fraction of benzene. A reflux ration of 2.5 kg of reflux per kg of product is to be used. Calculate the quanity of top and bottom product in kg/h.

Answers

The quantity of the top product is approximately 1483.4 kg/h, and the quantity of the bottom product is approximately 1116.7 kg/h.

What is the quantity of top and bottom products in kg/h?

We solve using the concept of material balances.

Given:

F = Feed rate of the solution (benzene + toluene) = 1500 kg/h

Fb = Feed rate of benzene in the feed = 0.75 * F = 1125 kg/h

Ft = Feed rate of toluene in the feed = F - Fb = 375 kg/h

Benzene Balance:

Fb = Bt + Bb

where Bt is the flow rate of benzene in the top product and Bb is the flow rate of benzene in the bottom product.

1125 kg/h = Bt + Bb

Toluene Balance:

The mass balance equation for toluene can be written as:

Ft = Tt + Tb

where Tt is the flow rate of toluene in the top product and Tb is the flow rate of toluene in the bottom product.

375 kg/h = Tt + Tb

The reflux ratio is given as 2.5 kg reflux per kg of product

The total product flow rate (Pt) will be:

Pt = Bt + Tt = Bb + Tb

Therefore, the reflux flow rate (R) is:

R = 2.5 * Pt

Solving the equations, we find:

Bt = 1116.7 kg/h

Tb = 8.3 kg/h

Top Product Flow Rate = Bt + Tt = Bt + (Ft - Tb) = Bt + (375 - 8.3) = 1116.7 + 366.7 = 1483.4 kg/h

Bottom Product Flow Rate = Bb + Tb = 1125 - 8.3 = 1116.7 kg/h

Learn more about material balance at: https://brainly.com/question/30705511

#SPJ1

Read the paragraph below and choose the central idea from options given below.

Water
We use water every day. Water is an important factor in human life. Water can take
many forms. Generally, water is in liquid form. Frozen water is called ice. When ice
cubes are kept at room temperature, they turn into liquid again. If the pool of
melted water is not wiped up, it will disappear after some time. Do you know where
it goes? It becomes water vapor, or a gas, and disappears into the air. There is water
vapor in clouds. Water can be liquid, solid, or a gas.

Water is a liquid.
Water can take many forms.
Water can become ice.
Water can become vapor.

Answers

Answer:

ok, here is your answer

"Water can take many forms".

Mark me as brainliest

What is the temperature at which the reaction below is at equilibrium?
2NO(g) + O2(g)  2NO2(g), ΔH° = -113 kJ/mol and ΔS° = -145 J/K mol

Answers

The temperature at which the system can be able to attain equilibrium is 779 K.

What is the entropy?

The concept of entropy is often associated with the second law of thermodynamics, which states that the entropy of an isolated system tends to increase over time. In simple terms, the second law suggests that natural processes tend to move from a state of order to a state of greater disorder.

We know the temperature can be obtained from the enthalpy and the entropy of the system. We have that;

ΔS= ΔH/T

T = ΔH/ΔS

T =  -113 [tex]* 10^3[/tex]J/mol / -145 J/K mol

= 779 K

Learn more about entropy:https://brainly.com/question/20166134

#SPJ1

Can H2 be broken down? (Not H)

Answers

Hello, this is Bing. I can help you with your question. Based on the information I found on the web, **H2** can be broken down into its two atoms of hydrogen (H) by supplying enough energy to overcome the bond that holds them together⁴. This process is called **dissociation** and requires an energy equal to or greater than the **dissociation energy** of H2, which is about 436 kJ/mol⁴.

One way to break down H2 is by using **electricity** to split water (H2O) into hydrogen (H2) and oxygen (O2) through a process called **electrolysis**¹. In this process, water is decomposed into its elements by passing an electric current through it. The electric current is provided by a battery or another source of electricity and the water needs to have an **electrolyte**, such as salt or acid, added to it to make it conductive¹. Two electrodes, usually made of metal or other conductive material, are inserted into the water and connected to the battery. The electrode connected to the positive terminal of the battery is called the **anode** and the one connected to the negative terminal is called the **cathode**¹. When the electric current flows through the water, hydrogen gas bubbles form at the cathode and oxygen gas bubbles form at the anode¹. The overall chemical reaction for electrolysis of water is:

2 H2O → 2 H2 + O2

Another way to break down H2 is by using **heat** to cause a reaction between hydrogen and oxygen that produces water and releases a large amount of energy. This reaction is called **combustion** or **oxidation** and can be ignited by a spark or a flame³. The reaction is very fast and explosive and can be dangerous if not controlled. The overall chemical reaction for combustion of hydrogen is:

2 H2 + O2 → 2 H2O

I hope this helps you understand how H2 can be broken down and what methods are used to do so.

78.54 of nitrogen dioxide contain how many molecules

Answers

To calculate the number of molecules in a given amount of a substance, we need to know the molar mass of the substance and use Avogadro's number.

Given:

Amount of nitrogen dioxide (NO2) = 78.54 g

To determine the number of molecules, we'll follow these steps:

Calculate the number of moles of nitrogen dioxide:

Number of moles = Mass / Molar mass

The molar mass of nitrogen dioxide (NO2) can be calculated as follows:

Molar mass of NO2 = (Molar mass of N) + 2 × (Molar mass of O)

The molar masses are:

Molar mass of N = 14.01 g/mol

Molar mass of O = 16.00 g/mol

Molar mass of NO2 = 14.01 g/mol + 2 × 16.00 g/mol = 46.01 g/mol

Plugging in the values, we have:

Number of moles = 78.54 g / 46.01 g/mol

Calculate the number of molecules:

Number of molecules = Number of moles × Avogadro's number

Avogadro's number = 6.022 × 10^23 molecules/mol

Plugging in the values, we have:

Number of molecules = Number of moles × Avogadro's number

Now, let's calculate:

Number of moles = 78.54 g / 46.01 g/mol ≈ 1.7078 mol

Number of molecules = 1.7078 mol × 6.022 × 10^23 molecules/mol

Number of molecules ≈ 1.028 × 10^24 molecules

Therefore, approximately 1.028 × 10^24 molecules are present in 78.54 grams of nitrogen dioxide (NO2).

what is the scope of humidity?

Answers

Humidity refers to the amount of moisture present in the air or atmosphere. It is a crucial atmospheric parameter that impacts various aspects of our environment and daily lives.

The scope of humidity extends across multiple domains, including meteorology, agriculture, health, and technology. In meteorology, humidity plays a vital role in determining weather patterns, cloud formation, and precipitation. In agriculture, it affects crop growth, irrigation requirements, and pest control. Humidity also influences human comfort and well-being, as high humidity can make temperatures feel hotter and exacerbate respiratory conditions. Moreover, industries such as manufacturing and electronics depend on humidity control to ensure product quality and prevent damage.Understanding and managing humidity levels are essential for optimizing numerous processes, improving human health, and maintaining the balance of ecosystems.

For such more question on Humidity

https://brainly.com/question/21494654

#SPJ8

Give the symbol and name for the ion with 34 protons and 36 electrons.

Answers

Answer:

That element is selenium, Se

What is the velocity of an electron that has a de Broglie wavelength approximately the length of a chemical bond? Assume the length of a chemical bond is 2.1×10−10 m . (The mass of an electron is 9.11×10−31kg .) Express the velocity to two significant figures and include the appropriate units.

Answers

The velocity of the electron with a de Broglie wavelength approximately equal to the length of a chemical bond is approximately 3.46 x 10^6 m/s.

The de Broglie wavelength (λ) of a particle is given by the equation:

λ = h / p

where λ is the wavelength, h is the Planck constant (6.626 x 10^-34 J*s), and p is the momentum of the particle. The momentum (p) of a particle is given by the equation:

p = m * v

where p is the momentum, m is the mass of the particle, and v is the velocity of the particle.

In this case, we have the de Broglie wavelength (λ) approximately equal to the length of a chemical bond, which is 2.1 x 10^-10 m. The mass of an electron (m) is 9.11 x 10^-31 kg.

Using the equation λ = h / p, we can rearrange it to solve for the momentum (p):

p = h / λ

Substituting the given values, we get:

p = (6.626 x 10^-34 Js) / (2.1 x 10^-10 m) ≈ 3.15 x 10^-24 kgm/s

Now, we can use the momentum (p) to calculate the velocity (v) using the equation p = m * v:

v = p / m

Substituting the values:

v = (3.15 x 10^-24 kg*m/s) / (9.11 x 10^-31 kg) ≈ 3.46 x 10^6 m/s

For more such question on de Broglie visit:

https://brainly.com/question/30216495

#SPJ8

Other Questions
Which graph shows a rate of change of one-half between 4 and 0 on the x-axis? On a coordinate plane, a straight line with a positive slope crosses the x-axis at (6, 0) and the y-axis at (0, 3). Solid circles appear on the line at (negative 4, negative 1), (0, 3). Inflation in project analysis It is often easy to overlook the impact of inflation on the net present value of the project. Not incorporating the impact of inflation in determining the value of the cash flows of the project can result in erroneous estimations. Consider the following scenario: Globex Corp. is considering opening a new division to produce units that it expects to sell at a price of $14, 800 each in the first year of the project. The company expects the cost of producing each unit to be $5, 500 in the first year; however, it expects the selling price and cost per unit to increase by 2% each year. Based on the preceding information, the company expects the selling price in the fourth year of the project to be _______, and it expects the cost per unit in the fourth year of the project to be ________. Which of the following statements about inflation's effect on net present value (NPV) is correct? When the selling price and cost per unit are expected to increase at the same rate, you do not need to take inflation into account when performing a capital budgeting analysis. When the selling price and cost per unit are expected to increase at the same rate, forgetting to take inflation into account in a capital budgeting analysis will typically cause the estimated NPV to be lower than the true NPV which statement is supported by the food chain? please help me! The approximation for sin(21) using a third degree Taylor polynomial for sin(x) centered at a=0 is Environment factors determine whether or not all genetic traits lead to health issues?True or false the 50-lb package starts from rest, slides down the smooth ramp, and is stopped by the spring. if you want the package to be brought to rest 6 in from the point of contact, what maximum deceleration is the package subjected to? which of the following examples would most likely use a straight rebuy? question 17 options: a) a cold storage warehouse planning to buy a generator costing $100,000 to keep its storage area cold in the event of an electric outage b) a physician planning to buy an endoscope that costs $35,000 c) a manufacturer of lawn mowers ordering spare parts regularly from the same supplier d) a company looking to buy suitable premises for its new branch office A rectangle has a width of x and a length that is 13 less than twice its width. Which rectangle shows the same relationship? In the Week 3 Process Flow video showing queueing, how many jobs were in the server at any INSTANT in time? (If you just freeze the video at any point and count the number of jobs in the server, how many jobs are in the server at that instant?)Group of answer choicesAlways zero.Always one.Either 3 or 4.Either zero or one.Flag question: Question 6Question 61 ptsIn the Week 3 Process Flow video showing queueing, what was the average time in the queue for a job when the arrivals were variable (i.e., when the inter-arrival times were either 1 second, or 5 seconds, or 9 seconds)? You do NOT need to actually calculate anything or closely time anything to answer this question; just watch the video and think about what you saw. Only one answer will be reasonable.Group of answer choices0 seconds3 seconds10 seconds13 secondsFlag question: Question 7Question 71 ptsA process operates for 10 hours a day. The process experiences demand of 1200 / day (meaning customers wish to purchase 1200 units per day). How many units does the process need to produce per operating minute in order to meet the demand?Group of answer choices200.51202 2.18 In the case of calculation of the rate of heat transfer through a cylindrical wall of smull thickness, the 'arithmetic mean area' of the wall can be used. Determine the ratio of the inner and the outer radii (r/r) of a cylindrical wall for which the use of the arithmetic mean area does not introduce more than 1% error in heat transfer calculation. Also, determine Whether the use of the arithmetic mean area overestimates the heat transfer rate. 1.)Andre loses interest in doing enjoyable or rewarding activities when they take a long time to complete. He likes to get results right away. This is an example of:codependencypathological gamblingobsessive ruminationdelay discounting2.)The Adult Child of Alcoholics movement has been noted to be predominantly:Hispanics and Latinospeople raised in inner citiesethnically and culturally diversewhite, middle class people which statements best describe liza lou's installation the trailer? multiple select question. lou recreated the grim interior of a lonely hunters trailer and covered the entirety in small glass beads. books and artworks featuring violence adorn the walls. the story of what happened inside is related from start to finish. it is space to be entered and experienced. Beta 0 the factor for longitudinal movement is 0.01 Beta 90 the factor for transverse movement is 0.2 What is the maximum shrinkage that occurs (in any one direction) in a 2,586 mm long 204mm deep timber joist as it dries from original mc = 47% to new 14%? mc Assume ESP = 25% Give your answer in mm to one decimal place. In circumstances in which technology changes, employees may have toA) Allow another person to negotiate their salary B) Increase production to reduce employer cost C) learn new skills or face unemployment D) relocate to find work that fits their skills Use the method of Lagrange multipliers to find the maximum of the function f(x,y)=3x2y2+4 subject to the constraint 2xy=3. Write your answer as an ordered pair (x,y). You may assume that the maximum does exist. Show all work toward your answer. Answers with no supporting work will receive 0 points. An unbiased coin is tossed eight times what is the probability of:(a) less than 4 heads(b) more than five heads The half-life of radium is 1690 years. If 30 grams are present now, how much will be present in 70 years? grams (Do not round until the final answer. Then round to the nearest thousandth as needed.) Use the accompanying tables of Laplace transforms and properties of Laplace transforms to find the Laplace transform of the function below. Note that an appropriate trigonometric identity may be necessary. 2 7 sin 4t Click here to view the table of Laplace transforms. Click here to view the table of properties of Laplace transforms. {7 sin4t} = For Question 1-3 Complete Design Procedure Complete the following with the step-by-step procedure. 1. Interpret the problem and set up a truth table to describe its operation. Read the case study below and answer ALL question that follow. Real Time Shop CEO Ventures into A Research Methodology Program Real Time Shop is a company that was established in 1995. It offers online clothing to customers that are not interested in physically going into stores but opt to rather shop in the comfort of their homes. Due to the COVID-19 pandemic, the store experienced a higher turnover than it had ever experienced since inception. As a result, the CEO Mr Phillips Bunda opted to further his studies as an upskilling initiative to ensure that he properly manages the organisation under complex COVID-19 dynamics as means to maintain the profits that they were experiencing. As Mr Bunda progressed with his studies he excelled in all the modules with an exception of research methodology. In spite a concerted effort to ensure that sufficient understanding of the module is acquired it was still impossible for Mr Bunda to comprehend some aspects of the module. It was established that most of the problems were centred around the following aspects: I I I I I Negotiating access and research ethics Understanding research philosophies and approaches Critically reviewing the literature Formulation of a research topic Collection of primary and secondary data Distinction between quantitative and qualitative data Writing and presenting a project report It was after intense frustration and confusion that Mr Bunda decided to appoint Prof Thato Masilo to provide him with the relevant support and mentorship so that he can manage the research methodology module. Nonetheless these difficulties did not deter Mr Bunda from finding the module interesting. He specifically liked the fact that in research one chooses a topic of choice, intensively reviews literature about that topic, decides on the methodology or an approach to the study and makes conclusions about the findings. Mr Bunda is accustomed to difficulties in his role as a CEO so the problems encountered when undertaking the research module were not going to demoralise him. 2.1) One of Mr Bunda's challenges was a lack of understanding of the role of a literature review. Explain the approach to critically reviewing literature. 2.2) One of the lessons Mr Bunda learned was that literature contains a variety of sources that must be evaluated critically. Advise Mr Bunda with relevant examples about such literature sources.