Conversion of pressure of 1379 torr to atm= 1.814474
What are unit Conversion ?Unit conversion is a multi-step procedure that involves adding, subtracting, multiplying, or dividing by a conversion factor.
Additionally, choosing the right number of significant digits and rounding may be necessary during the process.
The multi-step process of unit conversion involves multiplying or dividing by a numerical factor.
Weight, distance, and temperature can all be measured in a variety of ways.
Temperature is expressed in degrees Celsius, weight is expressed in kilos, and distance is measured in kilometers.
Imagine you are on vacation in India and are informed that the two cities are 100 kilometers apart.
Hence, Conversion of pressure of 1379 torr to atm= 1.814474
learn more about Conversion click here:
https://brainly.com/question/13016491
#SPJ4
Ice-Cream Palace has received an order for 3 1⁄2 gallons of ice-cream. The shop packages its ice-cream in 1-quart containers. How many containers will the shop need for this order?
Answer:
There are 4 quarts in a gallon, so 3 1/2 gallons is equal to 3.5 x 4 = 14 quarts.
Since the shop packages its ice-cream in 1-quart containers, the shop will need 14 containers to fulfill the order.
Step-by-step explanation:
A rental car company charge $72. 37 per day to rent a car and $0. 06 for every mile driven. Colton want to rent a car, knowing that:
He plan to drive 275 mile. He ha at mot $450 to pend. Which inequality can be ued to determine dd, the maximum number of day Colton can afford to rent for while taying within hi budget?
Colton can rent the car for a total of 6 days while still staying within his means.
We are aware that hiring a car costs $72.37 per day, and that each mile travelled costs $0.06. We also know that Colton has a $450 spending limit and intends to go 275 miles.
We may set up the following inequality to determine how long Colton can afford to hire the car for:
72.37d + 0.06(275) <= 450
This inequality indicates that the entire cost must be less than or equal to Colton's $450 budget. It represents the cost of renting the car as well as the cost of the miles driven.
We must isolate d on one side of the inequality in order to solve for it. To calculate the cost of the miles driven, first multiply 0.06 by 275:
72.37d + 16.5 <= 450
After that, we will take 16.5 away from either side of the inequality:
72.37d <= 433.5
A final division of 72.37 will be applied to both sides of the inequality:
d <= 6
Therefore, Colton can rent the car for a total of 6 days while still staying within his means.
To know more about inequality visit :
brainly.com/question/30228778
#SPJ4
Suppose linda's mom invests $10,000, part at 3% and the rest at 2.5%, in interest bearing accounts. the total yearly income (interest) is $283. how much did lindsay's mom invest at each rate?
She reportedly invested $6600 at 3% and $3400 at 2.5%, according to the statement.
Why do individuals invest?Investing is a smart way to put your money to work and could make you richer. If you make smart investing choices, your money may increase in value as outpace inflation. The major factors contributing to investment's increased growth potential are the possibility of compounding and the trade-off amongst risk and return.
Simple interest is calculated as follows: deposit amount multiplied by time and interest rate.
Let "a" represent the money placed in the account earning 3% interest.
Let's use the symbol to represent the amount deposited into the account earning 2.5% interest (10,000 - a)
a * 0.03 plus (10,000 - a) * 0.025 = 283
0.03a + 250 - 0,025a = 283
Collect like terms
0.03a - 0.025a = 283 - 250
0.005a = 33
a = $ 6600
What was put into the 2.5% account = 1000 - 6600 = $ 3400
To know more about Invests visit:
https://brainly.com/question/30057798
#SPJ4
Consider the following sample of observations on coating thickness for low-viscosity paint:
.83 .88 .88 1.04 1.09 1.12 1.29 1.31 1.48 1.49 1.59 1.62 1.65 1.71 1.76 1.83
Assume that the distribution of coating thickness is normal (a normal probability plot strongly supports this assumption).
a. Calculate a point estimate of the mean value of coating thickness, and state which estimator you used.
b. Calculate a point estimate of the median of the coating thickness distribution, and state which estimator you used. c. Calculate a point estimate of the value that separates the largest 10% of all values in the thickness distribution from the remaining 90%, and state which estimator you used. [Hint: Express what you are trying to estimate in terms of m and s.]
d. Estimate P(X < 1.5), i.e., the proportion of all thickness values less than 1.5. [Hint: If you knew the values of m and s, you could calculate this probability. These values are not available, but they can be estimated.]
e. What is the estimated standard error of the estimator that you used in part (b)?
The coating thickness distribution is normal and has a mean value of 1.245.
What is mean?In statistics, in addition to the mode and median, the mean is one of the measures of central tendency. Simply put, the mean is the average of the values in the given set. It indicates that values in a particular data set are distributed equally. The three most frequently employed measures of central tendency are the mean, median, and mode.
To calculate the data's coating thickness, sample mean is employed.
The following formula is used to determine the mean value's point estimate:
[tex]\bar x = \frac{1}{n} \sum x_i[/tex]
The typical probability plot shown there has a rather straight pattern. Assume right now that the coating thickness distribution is normal and has a mean value:
[tex]\bar x = \frac{19.92}{16}\\\\\bar x = 1.245[/tex]
Learn more about mean here:
https://brainly.com/question/28670966
#SPJ4
Can someone help me do 1 2 and 4 I am so lost I don’t understand
Algebra 2
1) The definition of function F(x) is: B. F(x) = -(x + 2)²(x - 2).
2) The standard definition of the cubic function is: A. F(x) = ax³ + bx² + cx + d.
4) The approximate solution to the system of equations is given as follows: A. (-3.43, 6.30).
What is the Factor Theorem?The Factor Theorem states that a polynomial function with roots(also called zeros) [tex]x_1, x_2, \codts, x_n[/tex], is represented by the product of it's linear factors [tex]x - x_1, x - x_2, \cdots x - x_n[/tex], according to the rule the rule presented as follows:
[tex]f(x) = a(x - x_1)(x - x_2) \cdots (x - x_n)[/tex]
In which a is the leading coefficient.
From the graph, the roots of the function are given as follows:
x = -2, with a multiplicity of 2, as the function just touches the x-axis, not crossing.x = 2, with a multiplicity of 1.Meaning that the cubic function is defined as follows:
F(x) = a(x + 2)²(x - 2).
The y-intercept of the function, numerically, is given as follows:
F(0) = a(2² x (-2))
F(0) = -8a.
The y-intercept is positive, meaning that the leading coefficient is negative, and thus the option B is the correct option.
The general format of a cubic function, with leading coefficient a and constant d positive, is given as follows:
y = ax³ + bx² + cx + d.
Meaning that the correct option for item 2 is given by option A.
How to solve the system of equations?The solution to the system of equations is found through graphing, and is the point of intersection of the two functions.
From the graph given by the image presented at the end of the answer, using rounding, the approximate solution for item 4 is given by option A.
More can be learned about the Factor Theorem at https://brainly.com/question/30249951
#SPJ1
if you flip two coins 52 times, what is the best prediction possible for the number of times both coins will land on heads?
Answer:
13 times
Step-by-step explanation:
lol, I actually did this right now. I got 13 times for both coins being heads, 9 times for each coin being tales, and exactly 30 times both were uneven. I hope this helps :)
The table shows the rate at which water is being pumped into a swimming pool
The unit rate of the relationship between the amount of water pumped and time is the amount of water pumped in one minute for 14 hours.
How is the unit price calculated?To calculate unit price, you need to divide the first term (quantity) by the second term (unit). The resulting value is the unit price.
For example, if you want to calculate the unit price for a bag of 4 $3 apples, divide the total cost ($3) by the number of apples (4).
$3 / 4 apples = $0.75 / apple
In this example, the unit price is $0.75 per apple. So the price per apple is $0.75.
Given by the equation:
The unit rate of water pumped versus time is the amount of water pumped in one minute, so:
28/2=14
That means 14 gallons of water is being pumped every minute.
Now you can calculate the water pumped in 3/2 minutes like this
14*3/2=21
So in total, water pumped in 12 minutes plus 3/2 minutes gives water pumped in 15/2 minutes.
14*15/2=105
To learn more about unit rate visit:
brainly.com/question/29099525
#SPJ1
I WILL MARK BRAINLIEST
u(x) = 5x + 3
w(x) = -5x -4
Find the value of u(w(-5)).
Answer:
148
Step-by-step explanation:
first plug in w(x) into u(x):
u(w(x)) = 5(-5(x)+4)+3
then plug in -5 for x:
u(w(-5)) = 5(-5(-5)+4)+3
solve:
= 148
This is a composite function:
Composite functions are are functions that are written within each other like f(g(x).
To solve this problem, first solve the function within u(x), which would be w(x)
w(-5) = -5(-5) -4
= 25 - 4
= 21
Now, plug in that value into u(x) to get your final answer:
u(21) = 5(21) +3
= 105 +3
= 108
Answer: u(w(-5) = 108
What is 1/6 (12x - 30) + 4x simplified
Answer: 6x - 5
Step-by-step explanation:
Given:
1/6 (12x - 30) + 4x
Distribute:
2x - 5 + 4x
Combine like terms with addition:
6x - 5
Answer:
6x - 5
Step-by-step explanation:
Given expression,
→ (1/6)(12x - 30) + 4x
Let's simplify the expression,
→ (1/6)(12x - 30) + 4x
→ ((12x - 30)/6) + 4x
→ 2x - 5 + 4x
→ (2x + 4x) - 5
→ 6x - 5
Hence, the answer is 6x - 5.
PLS HELP I NEED THE WORK SHOWN TOO!! FOR EACH PROBLEM
The cost of pair of gloves is $8.5 and cost of hat is $6.5. The solution has been obtained by using linear equation.
What is a linear equation?
The equation with the biggest degree of one is one that is linear. The lack of variables in a linear equation with an exponent larger than one is demonstrated by this. A straight line is produced by such an equation on the graph.
Let the cost of pair of gloves be 'x' and cost of hat be 'y'.
We are given that Cody bought two pairs of gloves and four hats for $43.00.
This can be represented as 2x + 4y = $43.00
Tori bought two pairs of gloves and two hats for $30.00.
This can be represented as 2x + 2y = $30.00
On subtracting both the equations, we get
⇒ 2y = 13
⇒ y = 6.5
Substituting this value in the equation, we get
⇒2x + 2(6.5) = $30.00
⇒x + 6.5 = 15
⇒x = 8.5
Hence, the cost of pair of gloves is $8.5 and cost of hat is $6.5.
Learn more about linear equation from the given link
https://brainly.com/question/30092358
#SPJ1
Since, there are multiple questions, so the question answered above is attached below.
Denise has incorrectly expanded the expression 5(4x − 3).
a) Write a sentence explaining how you think she reached her answer.
b) Write down the correct answer. Show all of your working.
5 (4x - 3) = 20x - 3 X
Answer: a. in the step by step explanation. b. 20x - 15
Step-by-step explanation:
I think that Denise thought that the 5 only appplied to 4x since they were closer and since she multiplied them both, she thought there would be no use of it.
Example - 2 (3x+2)
2 x 3x = 6x
6x + 2
Of course this is wrong since the real answer should be 6x + 12 but someoneone like Denise may see it that way, only multiplying the ones closest and not opening it fully.
Write down the equations corresponding to the augmented matrix in Exercise 12 and verify your answer to Exercise 12 is correct by substituting the solutions you obtained back into the original equations.
Both equations are satisfied, so the solutions to the equations are correct.
What is matrix?Matrix is a system of data or numbers arranged in rows and columns that is used to solve mathematical problems. It is a mathematical representation of a real-world situation. The rows represent the elements or items in the situation, while the columns represent the attributes or characteristics of the elements. Matrix can be used to solve various types of problems, such as linear equations, calculus, and statistics. It can also be used to represent data in graphs, tables, and other visual formats.
The augmented matrix in Exercise 12 is:
\begin{bmatrix}
1 & 4 & 5 & -10 \\
2 & 8 & 6 & -20
\end{bmatrix}
The corresponding equations are:
1x + 4y = -10
2x + 8y = -20
To verify that the solutions obtained in Exercise 12 are correct, we can substitute x=5 and y=-2 back into the equations:
1(5) + 4(-2) = -10
2(5) + 8(-2) = -20
Both equations are satisfied, so the solutions to the equations are correct.
To know more about matrix click-
https://brainly.com/question/2456804
#SPJ4
Both equations are satisfied, so the solutions to the equations are correct. This can be solved using the concept of matrix.
What is matrix?Matrix is a system of data or numbers arranged in rows and columns that is used to solve mathematical problems. It is a mathematical representation of a real-world situation. The rows represent the elements or items in the situation, while the columns represent the attributes or characteristics of the elements. Matrix can be used to solve various types of problems, such as linear equations, calculus, and statistics. It can also be used to represent data in graphs, tables, and other visual formats.
The augmented matrix in Exercise 12 is:
[tex]\left[\begin{array}{cccc}1&4&5&-10\\2&8&6&-20\end{array}\right][/tex]
The corresponding equations are:
1x + 4y = -10
2x + 8y = -20
To verify that the solutions obtained in Exercise 12 are correct, we can substitute x=5 and y=-2 back into the equations:
1(5) + 4(-2) = -10
2(5) + 8(-2) = -20
Both equations are satisfied, so the solutions to the equations are correct.
To know more about matrix refer to-
brainly.com/question/2456804
#SPJ4
What is angle x? It needs to use the rules of angles in parallel lines
Answer:
53
Step-by-step explanation:
Find the exact value of cos using cos( - ): Hint: To calculate π/12, select two fractions that when subtracted from each other will result in π/12.
The exact value of cos is cos([tex]\frac{\pi }{12}[/tex]) = ([tex]\sqrt{2}[/tex] + [tex]\sqrt{6}[/tex]) /4
given that
Trigonometry is a field of mathematics that examines correlations between triangle side lengths and angles (from the Ancient Greek words "trigonon" and "metron"). The field was created in the Hellenistic era in the third century BC as a result of the use of geometry in astronomical research. While Indian mathematicians produced the earliest tables of values for trigonometric ratios (also known as trigonometric functions), such as sine, the Greeks concentrated on chord calculation.
Trigonometry has been used historically in fields like geodesy, surveying, celestial mechanics, and navigation.
Trigonometry has a wide variety of identities. In order to simplify an expression, identify a more practical version of an expression, or solve an equation, trigonometric identities are frequently employed to rewrite trigonometrical expressions.
now , we need to find the value of cos
[tex]\pi[/tex]/12 can be written as [tex]\pi[/tex]/3 and [tex]\pi[/tex]/4
using cos(-) we need to find
cos(A - B) = cos(A)cos(B)+sin(A)sin(B)
cos([tex]\frac{\pi }{3}[/tex] - [tex]\frac{\pi }{4}[/tex]) = cos([tex]\frac{\pi }{3}[/tex])cos([tex]\frac{\pi }{4}[/tex]) + sin([tex]\frac{\pi }{3}[/tex])sin([tex]\frac{\pi }{4}[/tex])
cos([tex]\frac{\pi }{12}[/tex]) = (1/2)(1/[tex]\sqrt{2}[/tex]) +([tex]\sqrt{3}[/tex]/2)(1/[tex]\sqrt{2}[/tex])
= (1/2)([tex]\sqrt{2}[/tex]/2) + ([tex]\sqrt{3}[/tex]/2)([tex]\sqrt{2}[/tex]/2)
= ([tex]\sqrt{2}[/tex]/4) + ([tex]\sqrt{6}[/tex]/4)
cos([tex]\frac{\pi }{12}[/tex]) = ([tex]\sqrt{2}[/tex] + [tex]\sqrt{6}[/tex]) /4
To learn more about cos:
https://brainly.com/question/2193114
#SPJ4
What is the radius and diameter of the following circle
Answer:
The radius of the circle is 5.1, and the diameter of the circle is 10.2
Step-by-step explanation:
In the shown circle, the point from the center to the edge is 5.1, so that is the radius. Then, the diameter of a circle is twice its radius, so we have:
5.1 * 2 = 10.2
So the diameter of the circle is 10.2.
The radius of the circle is 5.1, and the diameter of the circle is 10.2.
Hope this helped!
a right triangle has sides that measure 24 and 32, but the length of the hypotenuse is unknown. what is the perimeter measurement of this triangle? round your answer to the nearest hundredth
The perimeter of the triangle is 96, rounded to the nearest hundredth.
To calculate the perimeter of the triangle, we need to first calculate the length of the hypotenuse.
The hypotenuse of a right triangle is calculated using the Pythagorean theorem, which states that the square of the hypotenuse is equal to the sum of the squares of the two sides.
Therefore, for this triangle, we have:
(Hypotenuse)² = (24)² + (32)²
Therefore, the Hypotenuse = √(24² + 32²)
Hypotenuse = √(576 + 1024)
Hypotenuse = √1600
Hypotenuse = 40
To calculate the perimeter, we need to add up all three sides of the triangle.
the perimeter = 24 + 32 + 40
the perimeter = 96
Therefore, the perimeter of the triangle is 96, rounded to the nearest hundredth.
Learn more about right triangle here:
https://brainly.com/question/29285631
#SPJ4
Solve for X, Leave in simplest radical form
The value of x in the simplest radical form is 3.
What are trigonometric relations?The trigonometric functions in mathematics are real functions that connect the right-angled triangle's angle to the ratios of its two side lengths. They are extensively employed in all fields of geometry-related study, including geodesy, solid mechanics, celestial mechanics, and many others.
Here, we have
Given: Let the triangle be ΔABC
The triangle ABC is a right-angled triangle and the angles inside the triangles are 45°, 45° and 90°
tan θ = x / 3
Now , θ = 45°
So, tan 45° = x / 3
The value of x is 3.
Hence, the value of x is 3.
To learn more about trigonometric relations visit:
brainly.com/question/1143565
#SPJ1
What is the measure of angle x?
Answer:
159
Step-by-step explanation:
The angle below is a co-interior angle
This means that both angle should add up to 180
180 - 21 = 159Have a lovely day :)
Answer:
Step-by-step explanation:
Because we know that the two lines going diagonal are equivalent, we also know that they are parallel because equivalent lines have the same slope, meaning they are parallel. We also know that the two interior angles should add to 180. Follow the steps in the image for the rest.
-Hope this helped
a doctor would like to estimate the mean difference in the number of hours of sleep for seniors in high school and seniors in college. to do so, he selects a random sample of 50 high school seniors from all high schools in his county. he also selects a random sample of 50 seniors from the colleges in his county. he would like to construct a 95% confidence interval for the true mean difference in the number of hours of sleep for seniors in high school and seniors in college. are the conditions for inference met?
No, the conditions for inference have not been met. The two samples must be independent, meaning that the individuals in the college sample should not also be in the high school sample. Without independent samples, it is not possible to construct a 95% confidence interval for the true mean difference.
1. Collect data from the two samples of seniors in high school and college.
2. Calculate the mean difference in the number of hours of sleep for the two samples.
3. Calculate the standard deviation of the differences in hours of sleep for the two samples.
4. Calculate the standard error of the mean difference.
5. Calculate the critical value for a 95% confidence interval.
6. Calculate the lower and upper bounds of the confidence interval by
adding and subtracting the critical value from the mean difference.
7. Interpret the confidence interval to determine the true mean difference in the number of hours of sleep for seniors in high school and colleg
Learn more about confidence interval here
https://brainly.com/question/24131141
#SPJ4
restaurants often slip takeout menus under zach's apartment door. so far, zach has collected 18 menus, including 4 for japanese food. what is the probability that one of zach's takeout menus, selected at random, will be from a japanese restaurant? write your answer as a fraction or whole number. p(japanese) =
So, the probability of selecting a menu from a Japanese restaurant is 4/18, which can also be simplified as 2/9.
The probability of selecting a Japanese restaurant menu from Zach's collection of 18 menus is found by taking the number of Japanese restaurant menus (4) and dividing it by the total number of menus in the collection (18). This can be written mathematically as:
p(japanese) = 4/18
So the probability of selecting a menu from a Japanese restaurant is 4/18, which can also be simplified as 2/9.
In other words, if Zach selects a menu at random from his collection, there is a 2/9 chance that it will be from a Japanese restaurant.
To learn more about Probability
visit; brainly.com/question/11234923
#SPJ4
what is the answer for understanding and ordering decimals?
Answer:
they always go smallest to largest!
7.65 x 2= 3.21
Step-by-step explanation:
For every 4 girls in Mr Hegarty's class there are 5 boys. What is the ratio of boys to girls in the class?
Give your answer in its simplest form.
Answer:
5:4
Step-by-step explanation:
girls = 4
boys = 5
ratio = boys:girls = 5:4
HOPE THIS HELPED
PLS HELP WILL MARK BRAINIEST!!!!!!!!!!!!!!!!!!!!!!!!!
Answer:
[tex]\textsf{1)} \quad 10000(1.06)^t[/tex]
2) €17,908.48
3) 0.5%
4) 120
[tex]\textsf{5)} \quad 10000(1.005)^{120}[/tex]
6) €18,193.97
7) More money.
Step-by-step explanation:
[tex]\boxed{\begin{minipage}{7 cm}\underline{Annual Compound Interest Formula}\\\\$ A=P\left(1+r\right)^{t}$\\\\where:\\\\ \phantom{ww}$\bullet$ $A =$ final amount \\ \phantom{ww}$\bullet$ $P =$ principal amount \\ \phantom{ww}$\bullet$ $r =$ interest rate (in decimal form) \\ \phantom{ww}$\bullet$ $t =$ time (in years) \\ \end{minipage}}[/tex]
Question 1Given:
P = €10,000r = 6% = 0.06Substitute the given values into the compound interest formula to write an expression that describes the given scenario over t years:
[tex]\implies A=10000(1+0.06)^t[/tex]
[tex]\implies A=10000(1.06)^t[/tex]
Question 2To calculate how much money will be in the fund after 10 years, substitute t = 10 into the equation from question 1:
[tex]\implies A=10000(1.06)^{10}[/tex]
[tex]\implies A=10000(1.79084769...)[/tex]
[tex]\implies A=17908.4769...[/tex]
Therefore, there will be €17,908.48 in the emergency fund after 10 years.
Question 3If the annual rate is 6%, the monthly interest rate is the annual rate divided by 12 (since there are 12 months in a year):
[tex]\implies \dfrac{6\%}{12}=0.5\%[/tex]
Question 4Given that are 10 years in the scenario, the exponent will be the number of months in 10 years:
[tex]\implies 10 \times 12 = 120[/tex]
Question 50.5% = 0.005
Therefore, the complete expression that describes the scenario, given an annual interest rate of 6% that compounds monthly over 10 years is:
[tex]\implies 10000(1 + 0.005)^{120}[/tex]
[tex]\implies 10000(1.005)^{120}[/tex]
Question 6To calculate how much money will be in the emergency fund after 10 years if the interest compounds monthly, calculate the expression from question 5:
[tex]\implies 10000(1.005)^{120}[/tex]
[tex]\implies 10000(1.81939673...)[/tex]
[tex]\implies 18193.9673...[/tex]
Therefore, there will be €18,193.97 in the emergency fund after 10 years.
Question 7Amount in fund when compounded annually = €17,908.48
Amount in fund when compounded monthly = €18,193.97
Therefore, there is more money in the emergency fund when it is compounded monthly as the compounding frequency is greater (interest is earned on both the principal and the interest, so the more frequent the compounding periods are, the more interest is earned).
The general rule about compounding in exponential functions is the higher the number of compounding periods, the greater the amount of compound interest.
In terms of compounding interest in investment:
The annual interest rate should be divided by the compounding frequency, and the exponent should be multiplied by the compounding frequency.What is a 2 factor graph theory?
In graph theory, a 2-factor is a subgraph of a given graph that includes every vertex of the original graph and has the property that every vertex has even degree (i.e. degree is a multiple of 2).
The term "2-factor" is used because it is a factor of the original graph that is made up of edges and every vertex has degree 2.
A 2-factor can also be defined as a set of cycles that cover all vertices of the graph. In other words, it is a collection of cycles such that every vertex belongs to exactly one cycle. A 2-factor can also be thought of as a cycle cover of a graph.
A graph that has a 2-factor is called a 2-factorizable graph. Not all graphs are 2-factorizable, for example a graph with an odd number of vertices can't have a 2-factor.
2-factors have many applications in various fields such as scheduling, coding theory, and computer science. They are also used to study the connectivity and robustness of graphs.
To know more on graph theory
https://brainly.com/question/29538026
#SPJ4
On the double number line, 3 minutes corresponds to 180 beats.
0 ? 120 180 240 300
Beats:
Minutes:
0 1
2
3
4
5
How many beats are there in 3 minutes? Type your answer as a number.
Three minutes equal 180 beats on the double number line. three minutes of 270 beats 2:180=90 , 3:270=90
How many beats are in 3 minutes ?In music, a beat is a pulse that occurs repeatedly. Simple meters are those in which the beat first breaks into two, and subsequently into four. There are two beat groups in double meters, three beat groups in triple meters, and four beat groups in quadruple meters.
For double, triple, and quadruple meters, there are several conducting patterns. One group of beats equals one measure (duple, triple, or quadruple). Bar lines divide the measures. Simple meters' time signatures specify two things: the beat unit, or note value that represents the beat, and the number of beats in each measure (the top number). Notes are graphically grouped by beat and connected by a beam.
To learn more about beats refer to :
https://brainly.com/question/888658
#SPJ1
when sarah rowed down black river with the current, she took one hour to go four miles. when she rowed back the same distance, at the same rowing speed, but against the current, her trip required two hours. what is the speed, in miles per hour, of the current in black river?
The speed of the current is 1 mile per hour.
To calculate we can start by using the formula: distance = speed x time.
Let's call the speed of the current "c" and the speed of Sarah's rowing "r".
When Sarah rows down the river with the current, her speed is the sum of her rowing speed and the current speed: distance = (r + c) * time
When she rows back against the current, her speed is the difference between her rowing speed and the current speed: distance = (r - c) * time
We know that the distance is four miles in both cases, and the time is one hour and two hours respectively.
So we can set up the following two equations:
(r + c) * 1 = 4
(r - c) * 2 = 4
Solving the first equation:
r + c = 4
Solving the second equation:
r - c = 2
Adding the two equations:
r = 3
We know that Sarah is rowing at a constant speed, so we can substitute this value back into one of the original equations:
(3 + c) * 1 = 4
c = 1
So the speed of the current is 1 mile per hour.
To learn more about the distance, visit:
brainly.com/question/15256256
#SPJ4
a second set of measurements were taken, and the efficiency was found to be greater than 100%. what reasons most likely explain why the second set had a different efficiency? select all that apply.
It must be less effective than 100%. Any time you switch from one source of energy to another, especially if there is effort involved, there is a cost.
An enzyme is a protein that must retain its three-dimensional structure in order for it to function as a "lock and key." A little alteration to the enzyme structure might render it inoperative.
Denaturation of proteins is common. The protein's structure can change as a result of environmental factors including pH and temperature. An increase in temperature should hasten the process, but an excessive increase might harm the enzyme. Therefore, the situation in which there is no change to the enzyme structure would be the "ideal" one.
For such more question on efficiency.
https://brainly.com/question/15418098
#SPJ4
Note : The complete question could be as bellow,
A second set of measurements were taken, and the efficiency was found to be greater than 100%. What reasons most likely explain why the second set had a different efficiency? Select all that apply:
Used the reciprocal of the efficiency formula
Raised the resistance force in a shorter amount of time
Used the incorrect conversion factor from pounds to Newtons for force Incorrect values for the resistance distance
Inaccurate readings from force sensor for effort force
Increase efficiency from reduced friction
Evaluate the expression.
Do not round your answer.
5- 3/2 to the second power
The result of.tge evaluation of the given expression as required is; 11 / 4.
What is the value of the expression upon evaluation?It follows from the task content that the value of the expression given be determined upon evaluation.
Since the given expression is; 5 - 3/2 to the second power
5 - (3/2)²
= 5 - 3²/2²
= 5 - 9/4
= 20 / 4 - 9 /4
On this note, the resulting expression is; ( 20 - 9 ) / 4 = 11/4.
Ultimately, the result of the expression evaluation as required to be determined is; 11 / 4.
Read more on evaluation of expressions;
https://brainly.com/question/3590570
#SPJ1
What is the measure of angle x?
Answer:
46
Step-by-step explanation:
The type of angle below is called an alternate angle where the opposite angle is the equal size.
As the angle given is 46 the alternating angle would be 46!
Have a lovely day :)
Answer:
46 because 46 is alternative angle
a rectangular pool is 30 feet wide and 40 feet long. it is surrounded on all four sides by a wooden deck that is x feet wide. the total area enclosed within the perimeter of the deck is 2576 square feet. what is the width of the deck?
On solving the provided question, we can say that length of the rectangle pool is is = 17.58
What is rectangle?A rectangle in Euclidean plane geometry is a quadrilateral with four right angles. You might also describe it as follows: a quadrilateral that is equiangular, which indicates that all of its angles are equal. The parallelogram might also have a straight angle. Squares are rectangles with four equally sized sides. A quadrilateral of the shape of a rectangle has four 90-degree vertices and equal parallel sides. As a result, it is sometimes referred to as an equirectangular rectangle. Because its opposite sides are equal and parallel, a rectangle is also known as a parallelogram.
[tex](30+2x)(40+2x)-1200=3696\\1200+60x+80x+4x^2 -1200=3696\\4x^2 +140x-3696=0\\x=17.58 or -52.58\\[/tex]
length is = 17.58
To know more about rectangle visit:
https://brainly.com/question/29123947
#SPJ4