how many moles of FeCl3 are produced when 3.0 mole.of Fe react eith excess Cl2 gas?
A scientist places a large beaker containing 325 g of 50degree Celsius water into a microwave. He has to run the microwave for 3 minutes until the water reaches a temperature at 92 degree Celsius. Calculate the amount of energy absorbed by the water.
The amount of energy absorbed by the 325g of water is 57,057J. Details about calorimetry can be found below.
How to calculate energy?The energy absorbed by a mass of substance can be calculated using the following formula;
Q = mc∆T
Where;
Q = quantity of heat absorbedm = mass of substancec = specific heat capacity∆T = change in temperatureQ = 325g × 4.18 × (92 - 50)
Q = 57,057J
Therefore, the amount of energy absorbed by the 325g of water is 57,057J.
Learn more about energy at: https://brainly.com/question/3609481
#SPJ1
water boils at 100 degrees celsius at sea level. If the water in this experiment did not boil to 100 degrees celsius, what could the reason be?
Answer:
It depends on how high you are above sea level
Explanation:
I did an experiment in my Scince class that showed, the less air that is around water will lessen it’s boiling level. We put water in a glass beaker inside of our vacuum chamber, we made a vacuum in he chamber. Making a vacuum is like being on a mountain, the less air the lower the boiling point. The water then began to boil due to the water evaporating. When we reached to maximum vacuum that we could the water started to boil at 61°C. No the water was not very hot, it was just warm water that just so happened to also be boiling, cool right!!! Anyways, we played with dry ice the next day.
Hoped this helped.
Hope I earned your star rating or helpful rating from this.
the air pressure around the experiment is lower than at sea level
How would you describe the kinetic energy of the particles in a solid?
Answer:
Solid objects have the least kinetic energy
Explanation:
because solid particles vibrate in place. Gases have the most kinetic energy because their particles move very quickly.
Select two descriptions of this matter
Answer:
this image represents both a crystalline solid [you can tell because it is clearly a solid, and it has a tightly packed/organized into rows layout}
and a pure element [you can tell this because it is pure--meaning that it is not a mixture (which is why it's not classified as a homogenous mixture instead)]
hope this helps!
Answer:
1 and 4
Explanation:
Pure element because it is made by same type of atom.
Crystalline solid because its structure define it as a solid
What are the blue and yellow circles, the red circles, and the darkest blue ?
Answer:
The Red Circles: Liquid, Blue and Yellow Circles: Solid, and Purple Circles: Gas
Explanation:
Should be it based on the picture and given information.
Hazmat Poison gas is in what class?
HAZMAT Class 6 Toxic and infectious substances.
Answer:
CLASS 2 Gases
Explanation:
Hope this helps
2. A solution is made by dissolving 3.88 g of NaCl in enough water to make 67.8 mL of solution. What is the concentration of sodium chloride in units of weight/volume percent?
The concentration of sodium chloride in the solution is 5.72% (weight/volume percent).
How to calculate the weight/volume percent concentration?Weight/volume percent concentration (w/v) expresses the amount of solute (in grams) dissolved in a given volume of solution (in milliliters). Specifically, it is defined as the weight of the solute divided by the volume of the solution, multiplied by 100.
To calculate the weight/volume percent concentration, we need to determine the mass of NaCl per volume of the solution.
First, we need to convert the volume of the solution from milliliters (mL) to liters (L):
67.8 mL = 0.0678 L
Next, we calculate the concentration of NaCl in grams per liter (g/L):
Concentration = Mass of solute ÷ Volume of solution
Concentration = 3.88 g ÷ 0.0678 L
Concentration = 57.2 g/L
Finally, we convert the concentration to weight/volume percent by multiplying by 100:
Weight/volume percent = Concentration x 100
Weight/volume percent = 57.2 g/L x 100
Weight/volume percent = 5.72%
Therefore, the concentration of NaCl in the solution is 5.72% (weight/volume percent).
Learn more about concentration here:
https://brainly.com/question/10725862
#SPJ1
explain how magic numbers are related to nuclear stabilize
Answer:
A magic number is a number of nucleons (either protons or neutrons, individually) that form complete bands within the atomic nucleus. As a result, atomic nuclei with a magic number of protons or neutrons are significantly more persistent than other nuclei.
Enter the coefficient of C₂H6O that correctly balances the equation:
C₂H60+302 → 2CO2 + 3H₂O
Answer:
1 C₂H₆O
Explanation:
The given equation:
C₂H₆O + 3 O₂ ---> 2 CO₂ + 3 H₂O
Reactants: 2 carbon, 6 hydrogen, 7 oxygen
Products: 2 carbon, 6 hydrogen, 7 oxygen
As you can see, the amount of each element on both sides is identical. Therefore, the reaction is already balanced. This means that the coefficient in front of C₂H₆O is 1. When writing the equation, writing the one is insignificant and usually left out.
Pyroxene and Olivine are two minerals formed by the cooling of lava, whereas quartz and feldspar are formed as magma cools.
a. Based on the way they form, which two minerals will be comparatively bigger in size?
b. Why? Provide scientific evidence to support your answer
Quartz and Feldspar will be comparatively larger in size since they are formed from cooling of magma while Pyroxene and Olivine are formed by the cooling of lava.
What is the difference between magma and Lava?Magma is molten rock that is found deep within the earth's crust whereas Lava is molten rocks that comes up and flows on the earth's surface.
Minerals formed from magma and lava have comparatively different sizes.
Minerals formed from magma are larger in size than minerals formed from Lava. This is because minerals formed from magma undergo slower cooling, and thus, have a longer time to grow in size. However, minerals formed from lava have a relatively shorter cooling time and do not grow into very large sizes.
Therefore, Quartz and Feldspar will be comparatively larger in size since they are formed from cooling of magma while Pyroxene and Olivine are formed by the cooling of lava.
Learn more about magma and lava at: https://brainly.com/question/14886424
#SPJ1
IUPAC NAME OF CH3CH2CH(CH3)CH2CH(C3H7)-CH3?
Answer:
the IUPAC name is: 2-ethyl-3-methyl-pentanal
Answer:
Thus IUPAC name is: 3-methylpentane. Was this answer helpful?
Explanation:
hope it will help you
ZnS (s) + AIP(s) → AI₂S₂(s) + Zn P₂(s)
Answer:
3 ZnS (s) + 2 AIP(s) ---> AI₂S₃(s) + Zn₃P₂(s)
Explanation:
I believe you are asking for this reaction to be balanced. However, after looking more closely, those are not the products that would be created from the reactants. Assuming this is a double-displacement reaction, and taking the most common charges of the ions into consideration, the actual products would be AI₂S₃(s) + Zn₃P₂(s). I apologize if I assumed incorrectly.
For an equation to be balanced, there needs to be the same amount of each element on both sides of the equation.
The unbalanced equation:
ZnS (s) + AIP(s) ---> AI₂S₃(s) + Zn₃P₂(s)
Reactants: 1 zinc, 1 sulfur, 1 aluminum, 1 phosphorus
Products: 3 zinc, 3 sulfur, 2 aluminum, 2 phosphorus
As you can see, there is an unequal amount of each element on the reactants and products side. To balance the equation, coefficients in front of the compound(s) will be necessary.
The balanced equation:
3 ZnS (s) + 2 AIP(s) ---> AI₂S₃(s) + Zn₃P₂(s)
Reactants: 3 zinc, 3 sulfur, 2 aluminum, 2 phosphorus
Products: 3 zinc, 3 sulfur, 2 aluminum, 2 phosphorus
Which Ions oxidize aluminum?
Li^+, Ca^2+, Ag+, Sn^2+
Aluminum can be oxidized by [tex]Li^{+}[/tex] and [tex]Ca^{2+}[/tex]
What is oxidizing?Some of the metal corrodes (or oxidizes) and forms the corresponding metal oxide on the surface as a result of a chemical reaction between the metal surface and the oxygen in the air. The corrosion products that occur in some metals, like steel, are highly apparent and loose.
According to reactivity series (The array of metals in the descending order of their reactivities is referred to as the metals' reactivity series. It is sometimes referred to as the metals in the activity series.)
Lithium and calcium ions are more reactive than aluminum ion and they are less electronegative.
Since silver and tin are more electronegative than aluminum so, they cannot oxidize aluminum.
∴ [tex]Li^{+}[/tex] and [tex]Ca^{+2}[/tex] ions can oxidize aluminum.
Learn more about electronegativity here https://brainly.com/question/16446391
#SPJ10
Which of the following is a simple design model that uses the concepts define, optimize, and develop solutions iteratively and in any order?
A. Infused Design
B. FORFLOW
C. Munich Procedural Model
D. Next Generation Design Model
The Munich Procedural Model is a simple design model that uses the concepts define, optimize, and develop solutions iteratively and in any order. C
What is the Munich procedural design?The Munich procedural model is a design that illustrates several opportunities regarding the order in which design process and stages beyond mere iteration should take.
A procedural model commonly used for development is the V-model.
Hence, the Munich Procedural Model is a simple design model that uses the concepts define, optimize, and develop solutions iteratively and in any order.
Learn more about procedural designs here:
https://brainly.com/question/22654163
#SPJ1
CH3CH₂OH + 0₂ → CO₂ + H₂O
CH3 CH₂OH + 30₂ → 2CO₂ + 3H₂O
What is an open system?
A. A system that allows energy to move in and out but not mass
B. A system that allows energy and mass to move in and out of it
C. A system that allows mass to move in and out but not energy
OD. A system that does not allow energy or mass to move in or out of
it
Answer:
An open system is :-
B. A system that allows energy and mass to move in and out of it.
Example :-
Water boiling in a pot on a stove. (Without lid).
Explain the term 'end point'?
What do you mean by a 1.0 M solution?
Answer:
According to me end point is the end of a reaction
Which of the following hereditary conditions is characterized by abnormally shaped blood cells?
Acne
Heart disease
Sickle cell anemia
Type 1 diabetes
Answer:
Sickle cell anemia
Explanation:
is an inherited genetic abnormality of hemoglobin (the oxygen-carrying protein found in red blood cells) characterized by sickle (crescent)-shaped red blood cells and chronic anemia caused by excessive destruction of the abnormal red blood cells.
Answer:
Sickle cell
Explanation:
I just took the test and it was correct.
Why is there a delay for the tides to react to the Moon's and Sun's gravitational effect?
A. Gravity is one of the slower forces in nature having to travel great distances.
B. The gravitational forces must overcome inertia and friction for the tides to take effect on water.
C. Water is relatively immune to the force of gravity delaying the tidal process.
D. There is no delay because the effects of gravity is constantly acting on bodies of water.
There is no delay because the effects of gravity are constantly acting on bodies of water. Hence, option D is correct.
What is the gravitational effect?Gravitation or just gravity is the force of attraction between any two bodies.
The Moon exerts over twice the gravitational pull of the Sun on Earth's tides because of its proximity to Earth. -The lunar tidal bulges are about twice the size of the solar tidal bulges. -The Sun's contribution to the tides is less than that of the Moon.
When the sun and moon are perfectly unaligned (they form a 90-degree angle relative to the earth), there are still tides because the moon's gravitational gradient is stronger than the sun's. The sun's gravitational gradient never completely cancels out the moon's.
Hence, option D is correct.
Learn more about the gravitational effect here:
https://brainly.com/question/14433868
#SPJ1
Which of the following is a heterogeneous mixture?
a) milk
b) air
c) oil and vinegar
d) vinegar in water
Answer:
c) oil and vinegar
Explanation:
A heterogeneous mixture is a mixture that does not have a "uniform composition" (meaning that the entire mixture is not thoroughly mixed to be the exact same. In different parts of the mixture, there is a non-consistent / differing composition.)
Oil and vinegar, as you may know, do not thoroughly mix when put together--different parts of the mixture are made of different compositions. Some parts are made of oil, and some are a concentration of vinegar, but because they are not able to be mixed entirely, the mixture is considered a heterogeneous mixture. If you were to take different samples of different parts of the liquid, you would have a clear separation of oil and vinegar.
Milk is thoroughly milk--if you take out a tablespoon, it will be milk entirely--and it will have the same composition as all of the other milk in the bottle.
Air is complicated--and it can be described as either, but the question was likely intending the answer of oil and vinegar.
Vinegar and water do thoroughly mix. Vinegar absorbs water on a molecular level, so the mixture is thoroughly mixed when put together.
(Hope this helps!)
What is one advantage of wind and hydroelectric power?
A. They are effective in any type of environment.
B. Neither harms wildlife.
C. Neither produces pollutants.
D. Both are inexpensive.
What is one advantage of wind and hydroelectric power?
A. They are effective in any type of environment.
B. Neither harms wildlife.
C. Neither produces pollutants.
D. Both are inexpensive.
Explanation:
one of the qnswer is flood control, irrigation support, and clean drinking water
Coffe is a solution of organic substance in water
Answer:
Verdadero!
no se en que mas quieres que te ayude? o cual realmente quieres que sea la respuesta?
If a snail crawls at a rate of 228.16cm/s, what is its speed in miles per hour?
If a snail crawls at a rate of 228.16cm/s, Its speed in miles per hour will 5.10 miles/hour
What is speed ?
The rate at which someone or something moves or operates or is able to move or operate.
Snail covers distance in 1 seconds = 228.16 cm
It covers in 60 seconds (1 min) = 228.16 cm x 60 = 6mtrs
It covers in 60 minutes (1 hour) = 228.16 cm x 60 x 60 = 821376 cm
Now, lets convert cm to miles :
As, 1 cm = 6.21371 x 10⁻⁶ miles
Thus, 821376 cm = 5.10 miles
hence, If a snail crawls at a rate of 228.16cm/s, Its speed in miles per hour will 5.10 miles/hour
Learn more about speed here :
https://brainly.com/question/22610586
#SPJ1
What is the best definition of the enthalpy of vaporization, ^ Hvap?
A. The change in the disorder of a system when a liquid changes to a
gas
B. The change in the disorder of a system when a molecule forms
from its atoms
C. The energy needed to raise the temperature of a liquid to the
boiling point
D. The energy needed to change a liquid into a gas
Answer: D. The energy needed to change a liquid into a gas
A 8.63 g sample of a compound contains 5.51 g of iron, Fe, 1.02g of phosphorus, P, and oxygen, O. Calculate the empirical formula for the compound
The empirical formula for the compound is [tex]Fe_3PO_4[/tex] if A 8.63 g sample of a compound contains 5.51 g of iron, Fe, 1.02g of phosphorus, P, and oxygen, O.
What is the empirical formula?An empirical formula tells us the relative ratios of different atoms in a compound.
We need to calculate the number of moles:
Given data:
Mass of iron - 5.51 g
Mass of phosphorus -1.02g
Mass of oxygen -2.1 g
Moles of iron - [tex]\frac{mass}{molar \;mass}[/tex]
Moles of iron - [tex]\frac{5.51 g}{56 g/mol}[/tex]
0.098 mole
Moles of phosphorus [tex]-\frac{mass}{molar \;mass}[/tex]
Moles of phosphorus - [tex]\frac{1.02g}{31 g/mol}[/tex]
0.032 moles
Moles of oxygen -[tex]\frac{mass}{molar \;mass}[/tex]
Moles of oxygen - [tex]\frac{2.1 g}{16 g/mol}[/tex]
0.13moles
Dividing each mole using the smallest number that is divided by 0.032moles.
Fe:P:O :: 3:1:4
The empirical formula for the compound is [tex]Fe_3PO_4[/tex].
Learn more about empirical formula here:
brainly.com/question/14044066
#SPJ1
diffrentiate between equation and chemical formula
A chemical equation is the symbolic representation of a chemical reaction in the form of symbols and formulae, wherein the reactant entities are given on the left-hand side and the product entities on the right-hand side with a plus sign between the entities in both the reactants and the products and an arrow that points towards the products, and shows the direction of the reaction. The coefficients next to the symbols and formulae of entities are the absolute values of the stoichiometric numbers. The first chemical equation was diagrammed by Jeen Beguin in 1615.
A chemical formula is a way of presenting information about the chemical proportions of atoms that constitute a particular chemical compound or molecule, using chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus and minus signs.
Hope this helps you!
Answer:
Explanation:
Chemical Formula:Represents the composition of a substance or compoundUses symbols and subscripts to indicate the types and numbers of atoms in a moleculeExample: H2O represents the chemical formula for waterChemical Equation:Represents a chemical reactionShows the reactants and products involved in the reactionUses chemical formulas and symbolsReactants are on the left side, products on the right side, separated by an arrowExample: 2H2 + O2 → 2H2O represents the reaction of hydrogen gas and oxygen gas to form waterIn summary:Formula describes composition, equation describes a reactionFormula uses subscripts for atom count, equation uses symbols and arrowsfor the following reaction how many grams of h20 will be produced if you react 3.7 grams of B2H6? B2h6 +3O2-2hbo2+ 2 H20
Answer:
4.8 g H₂O
Explanation:
To find the mass of water, you need to (1) convert grams B₂H₆ to moles B₂H₆ (via molar mass from periodic table), then (2) convert moles B₂H₆ to moles H₂O (via mole-to-mole ratio from reaction coefficients), and then (3) convert moles H₂O to grams H₂O (via molar mass from periodic table).
It is important to arrange the ratios/conversions in a way that allows for the cancellation of units (the desired unit should be in the numerator). The final answer should have 2 sig figs because the given value (3.7 grams) has 2 sig figs.
Molar Mass (B₂H₆): 2(10.811 g/mol) + 6(1.008 g/mol)
Molar Mass (B₂H₆): 27.67 g/mol
1 B₂H₆ + 3 O₂ ---> 2 HBO₂ + 2 H₂O
^ ^
Molar Mass (H₂O): 15.998 g/mol + 2(1.008 g/mol)
Molar Mass (H₂O): 18.014 g/mol
3.7 g B₂H₆ 1 mole 2 moles H₂O 18.014 g
---------------- x --------------- x ----------------------- x ----------------- = 4.8 g H₂O
27.67 g 1 mole B₂H₆ 1 mole
What is the primary purpose of a rate law?
Oto determine if a chemical reaction will be exothermic or endothermic
O to determine the amount of product that is formed from the concentration of reactants
O to show the relationship between the concentration of reactants and the reaction rate
O to show a relationship between the amounts of gas that can dissolve into a liquid
The rate law uses the molar concentrations of reactants to determine the reaction rate. Hence, option (C) is the correct option
What is rate law ?A rate law shows how the rate of a chemical reaction depends on reactant concentration.
For a reaction such as aA → products, the rate law generally has the form
rate = k[A]ⁿ,
where,
k is a proportionality constant called the rate constantn is the order of the reaction with respect to A.Typically, increased concentrations of reactants increases the speed of the reaction, because there are more molecules colliding and reacting with each other.
Hence , The rate law uses the molar concentrations of reactants to determine the reaction rate. Hence, option (C) is the correct option
Learn more about rate law here ;
https://brainly.com/question/4222261
#SPJ1
Is CaO a molecular compound?
Answer:
It's a Ionic compound
Explanation:
To tell if CaO (Calcium oxide) is ionic or covalent (also called molecular) we look at the Periodic Table that and see that Ca is a metal and O is a non-metal. When we have a metal and a non-metal the compound is usually considered ionic.
Because we have a metal and non-metal in CaO there will be a difference in electronegativity between the metal and non-metal. This difference results in an electron(s) being transferred from the metal (lower electronegativity) to the non-metal (higher electronegativity). The results in the metal becoming a postitive ion and the non-metal a negative ion. The two opposite charges are attracted and form the ionic bond between atoms in Calcium oxide.
