J.J. Thomson used magnetic and electric fields to measure the mass to charge ratio of a cathode ray particle.
What is a magnetic field?
Magnetic fields surround magnetized materials and are created by electric currents, such as those used in electromagnets, and time-varying electric fields. Since both the strength and direction of the magnetic field can change with location, it is described mathematically by a function assigning a vector to each point in space, called a vector field.To know more about magnetic field, click the link given below:
https://brainly.com/question/11514007
#SPJ4
reaction 1: reaction 2: reaction 3: the chemical equations and equilibrium expressions for two reactions at the same temperature are given above. based on the information, which of the following expressions can be used to calculate the value of for reaction 3 at the same temperature? (a) (b) (c) (d)
The expression for K3 = 1K1×1K2 when the chemical equations and equilibrium expressions for two reactions at the same temperature are given.
A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. For a reaction like aA -> A, the rate law frequently takes the form rate = k[A]n, where k is the proportionality constant known as the rate constant and n is the order of the reaction.
Given the reactions as:
CO(g)+3H2(g)⇄CH4(g)+H2O(g)
the rate law for the above equation is (K1) = [CH4][H2O]/[CO][H2]^3
Then [H2]^3 = [CH4][H2O]/K1[CO]
CO2(g)+H2(g)⇄CO(g)+H2O(g)
the rate law for the above equation is (K2) = [CO][H2O]/[CO2][H2]
[CO2] = [CO][H2O]/K2[H2]
CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)
Similarly the rate law for the above equation is (K3) = [CO2][H2]^4/[CH4][H2O]^2
Then K3 = [CO][H2][CH4][H2O][H2O]/K2[H2]K1[CO]
Then K3 = 1K1×1K2
To learn more about equilibrium click here https://brainly.com/question/29359391
#SPJ4
complete question: Reaction 1:CO(g)+3H2(g)⇄CH4(g)+H2O(g), K1=[CH4][H2O][CO][H2]3 . Reaction 2:CO2(g)+H2(g)⇄CO(g)+H2O(g), K2=[CO][H2O][CO2][H2]. Reaction 3:CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)then K3=?
The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3 for reaction 3 at the same temperature?
in the combustion of octane co2 and water are produced. starting with 22.4 g of cotane and excess o2 will produce how many grams of co2
69 grams of CO2 will produce in the combustion of octane where CO2 and Water is produced.
Combustion is defined as the chemical reaction between substances including oxygen. The reaction is accompanied by the generation of heat and light in the form of flame. The products CO2 and H2O forms when octane is burned. The process of combustion cannot take place in an atmosphere devoid of oxygen. The main ingredient of combustion is oxygen. The balanced chemical equation for combustion of octane is,
2C8H18 + 25O2 ----> 16CO2 + 18H2O
The molar mass of C8H18 = 114 g/mole
The molar mass of CO2 = 44 g/mole
The mass ratio of C8H18/CO2 is 2* 114 / (16 * 44)
22.4 g of octane generates, 69 gram of CO2.
To learn more about Combustion please visit:
https://brainly.com/question/29671504
#SPJ4
Figure 16.2 summarizes the classic method for separating a mixture of common cations by selective precipitation. Explain the chemistry involved with each of the four steps in the diagram.
With the aid of a reagent that precipitates one or more ions while leaving others in solution, ions in an aqueous solution can be separated using the selective precipitation technique.
What does "selective precipitation" entail?With the aid of a reagent that precipitates one or more ions while leaving others in solution, ions in an aqueous solution can be separated using the selective precipitation technique. For metallic elements, conduct a qualitative analysis.Proteins can be selectively precipitated in a variety of ways, including as a bulk technique to recover the majority of the proteins from a crude lysate, a selective technique to fractionate a subset of proteins from a protein solution, or a very specific technique to recover a single protein from a purification step.To learn more about precipitation technique refer to:
https://brainly.com/question/866725
#SPJ4
What is the molar mass of Carbon atoms in 1 mole of trolamine (C6H15NO3)?
Be sure to include the mass of all elements in the formula.
14.01g
48.00g
15.15g
72.06g
The molar mass of carbon atoms in 1 mole of trolamine is 72.06 g where the molar mass of compound is 149 g.
What is molar mass?Molar mass of a compound or a molecule is defined as the mass of the elements which are present in it.The molar mass is considered to be a bulk quantity not a molecular quantity. It is often an average of the of the masses at many instances.
Molar masses of an element are given as relative atomic masses while that of compounds is the sum of relative atomic masses which are present in the compound.
Molar mass of carbon atoms in 1 mole of trolamine is given as, 12.011×6=72.06 g
Thus, the molar mass of carbon atoms in 1 mole of trolamine is 72.06 g where the molar mass of compound is 149 g.
Learn more about molar mass,here:
https://brainly.com/question/22997914
#SPJ1
Place the steps required to determine whether or not a precipitate forms when two solutions are mixed in the correct order. Start with the first step at the top of the list. ++ Place these in the proper order. Note the ions present in the reactants. Use the solubility rules to determine whether or not either of the combinations gives an insoluble salt. Consider possible cation-anion combinations. Do you know the answer? No Idea Unsure Think so I know it Read -
1. Take note of the ions present in the reactants to determine the right order. 2. Consider various cation-anion pairings. 3. To ascertain if one of the combinations results in an insoluble salt, use the solubility criteria.
Positively charged ions are known as cations. Negatively charged ions are referred to as anions. A charged atom or molecule is an ion. A balanced atom will change into a positively charged cation if one or more of its electrons are lost. A balanced atom will change into a negatively charged anion if it gains one or more electrons. Ions include both anions and cations. They are drawn to one another because their electrical charges are in opposition. While an anion repels an additional anion, a cation repels other cations. An ion that has acquired one or more electrons and now has a net negative charge is called an anion.
learn more about Ions here:
https://brainly.com/question/1488567
#SPJ4
assignment is to list three different areas of science that changed significantly in the Scientific Revolution After you have come up with three areas of the sciences you will write three to four sentences on how these sciences contributed to the Scientific Revolution. Make sure you are going below the surface: who contributed and how they created change, what ideas were challenged, what questions did they want answered?
Three different areas of science changed significantly in the Scientific Revolution, abstract reasoning, quantitative thought, and an understanding of how nature works.
What is a scientific revolution?Focusing on quantitative analysis, understanding how nature functions, seeing nature as a machine, and developing an experimental scientific method were all hallmarks of the Scientific Revolution.
The world's understanding of the principles of motion and gravity improved thanks to the Scientific Revolution, which also laid the groundwork for several other discoveries and inventions.
Therefore, the Scientific Revolution brought about important changes in three different branches of science: abstract reasoning, quantitative thinking, and an understanding of how nature functions.
To learn more about the scientific revolution, refer to the link:
https://brainly.com/question/14328830
#SPJ1
match each soluble ionic compound with the number of moles of ions formed when 1 mole of each compound is dissolved into water. cacl2 cacl2 drop zone empty. nabr nabr drop zone empty. fe(no3)3 fe(no3)3 drop zone empty. 3 moles of ions 4 moles of ions 2 moles of ions need help? review these concept resources.
3 moles, 2 moles, 4 moles. soluble ionic compound with the number of moles of ions formed when 1 mole of each compound is dissolved into water. cacl2 cacl2 drop zone empty.
nabr nabr drop zone empty. fe(no3)3 fe(no3)3 drop zone empty. 3 moles of ions 4 moles of ions 2 moles of ions need help review these concept resources.Moles (nevi) are a form of skin growth that is rather frequent. Clusters of pigment-forming cells lead them to look as tiny, dark brown dots (melanocytes). The majority of people have 10 to 40 moles that form during childhood and adolescence and may alter or vanish over time. A non-cancerous condition of pigment-producing skin cells that is generally known as birth markings or moles.This form of mole is frequently big and is caused by a disease involving melanocytes, or pigment-producing cells (melanin). Melanocytic nevi can be rough, flat, or elevated in appearance. They might be present at birth or appear later in life. Melanocytic nevi can develop malignant in rare cases.
learn more about moles here:
https://brainly.com/question/26416088
#SPJ4
three, two, and four moles An ideal gas combination is made up of 4 moles of hydrogen, 2 moles of helium, and 1 mole of water vapour. What is the mixture's molar specific heat at a constant
Why are you asking this I wonder. Are you uncertain as to whether the term "hydrogen" refers to hydrogen molecules or hydrogen atoms (H)? (H2)
The query contains a hint: molar mass
We are dealing with the macro world which is the one in which we reside, and in this world, "hydrogen exists as H2 molecules. There has a 2 g/mol molar mass.
If a question reads "You are dealing with atoms while dealing with hydrogen atoms
You are working with molecules if an inquiry asks about "hydrogen molecules
Since hydrogen occurs as molecules in the larger universe, you are dealing with molecules if an inquiry asks, "hydrogen
Learn more about moles of hydrogen here:
https://brainly.in/question/25363072
#SPJ4
which of the following solutions are acidic? select all that apply. multiple select question. O caco3 (aq)O ch3ch2cooh (aq) O h3po4 (aq) O hbr (aq) O naoh (aq)
Acidic solutions include those with HBr, H3PO4, and CH3CH2COOH.Any liquid that has more hydrogen ions per volume than water is considered acidic.
An acidic solution is what, exactly?Any liquid that has more hydrogen ions per volume than water is considered acidic; liquids with less hydrogen ions per volume are not. Acidic solution. One who or which has a pH greater than 7.0 is said to be an alkaline.An aqueous solution that has been exposed to an acid has hydrogen ions released into it. A base is something that liberates hydroxide ions. In terms of how they react with organic materials, bases are caustic and acids are corrosive.Acidic solutions include those with HBr, H3PO4, and CH3CH2COOH.Any liquid that has more hydrogen ions per volume than water is considered acidic.To learn more about Acidic solutions refer to:
https://brainly.com/question/24255408
#SPJ4
which of the following correctly represents an oxidation or reduction reaction? choose all that are correctly matched? A.oxidation of pyruvate to CO 2B.oxidation of NAD +to NADH C.reduction of pyruvate to CO 2D. reduction of NAD + to NADH
Oxidation of pyruvate to CO2, oxidation of NAD+ to NADH, reduction of NAD+ to NADH correctly represents an oxidation or reduction reaction. Thus, option A, B, D is the answer.
An oxidation reaction is a chemical reaction in which a molecule loses one or more electrons. A reduction reaction is a chemical reaction in which a molecule gains one or more electrons.
Oxidation of pyruvate to CO2 represents an oxidation reaction because pyruvate loses electrons and becomes CO2 in this reaction.
Oxidation of NAD+ to NADH represents an oxidation reaction because NAD+ loses electrons and becomes NADH in this reaction.
Reduction of pyruvate to CO2 is not a correct statement because pyruvate is a molecule that loses electrons in the process of oxidation, not reduction.
Reduction of NAD+ to NADH represents a reduction reaction because NAD+ gains electrons and becomes NADH in this reaction.
Learn more about oxidation:
https://brainly.com/question/25798412
#SPJ4
: identify the structures of each amino acid and classify each amino acid. the structures of each amino acid are shown.
Aliphatic, aromatic, acidic, basic, acid amide, sulfur and cyclic amino acids. Based on characteristic of functional group amino acids are classified as: polar and non-polar amino acids.
What is meant by functional?
Functional refers to an object's operation or usefulness. It also denotes that it relates to how it performs or operates.A mathematical machine known as a function accepts one or more numbers as inputs and outputs another number.One or more functions may be inputs to a functional, which outputs a number. A Functional is a function of Functions, then.All biological activities, including digestion, elimination, respiration, and others, can be performed by a cell. The functional unit of life is referred to be such for this reason. Each and every living thing is made up of cells, which are the smallest unit of life.To learn more about functional refer to
https://brainly.com/question/22340031
#SPJ4
The amount of emitted photons detected by a PMT is directly proportional to the amount of time the detector is allowed to acquire light. Herb is making fluorescence measurements when his Xe source explodes. He is able to scrounge up an old Xe source he can use put it only has 42 percent of the power output of his original source. If his original scan time was 1.25 seconds, what will his scan time be with the new source?
If his original scan time was 1.25 seconds, 3 seconds will be his scan time be with the new source.
What is photon?The discrete packet (or quantum) containing electromagnetic (as well as light) energy known as a photon is referred to as a photon. In a vacuum, which is a region that is entirely empty, photons are always moving at the same speed as light to everyone observers.
Number of photons detected = (Power output of source) x (Scan time)
Power output of new source = 0.42 x Power output of original source
Number of photons detected = (Power output of new source) x (New scan time)
Number of photons detected = (0.42 x Power output of original source) x (New scan time)
Number of photons detected = (Power output of original source) x (1.25 seconds)
dividing both side by Power output of original source to get:
(New scan time) = (Number of photons detected) / (0.42 x Power output of original source)
(New scan time) = (1.25 seconds) / (0.42)
(New scan time) = 3 seconds
Therefore, 3 seconds will be his scan time be with the new source, if his original scan time was 1.25 seconds.
To know more about photon, here:
https://brainly.com/question/12015967
#SPJ1
Two forms of butane known as n-butane and iso-butane form an equilibrium according to the reaction n-butane (g) iso-butane (g) If the equilibrium constant for this reaction is 23,which set of concentrations listed below represents an equilibrium of these two compounds? 3) (n-butane] 0.04 M [iso-butane] = 0.27 M In-butane] 0.45 M liso-butane] 0.22 M In-butane] 0.23 M liso-butane] 0,01 M In-butane] 0.02 M fiso-butane] 0.46 M
If the equilibrium constant for this reaction is 23, set (3) (n-butane] 0.04 M [iso-butane] = 0.27 M, of concentrations represents an equilibrium of these two compounds.
The equilibrium constant for a reaction is the ratio of the product concentrations to the reactant concentrations at equilibrium, raised to their stoichiometric coefficients. In this case, the reaction is:
n-butane (g) <==> iso-butane (g)
The equilibrium constant for this reaction, Kc, is defined as:
Kc = [iso-butane]/[n-butane]
Therefore, if the equilibrium constant is given as 23, then at equilibrium:
[iso-butane]/[n-butane] = 23
Out of the given sets of concentrations, only set 3) represents an equilibrium of these two compounds:
[n-butane] = 0.04 M
[iso-butane] = 0.27 M
Because:
[iso-butane]/[n-butane] = 0.27/0.04 = 6.75 which is close to the equilibrium constant of 23. The other sets of concentrations represent different ratios of [iso-butane]/[n-butane] which is not equal to 23 and thus not in equilibrium.
To know more about equilibrium please refer: https://brainly.com/question/15118952
#SPJ4
The next few problems deal with calculating the pH of solutions of weak acids/bases (buffers). Here, we need to use the Henderson-Hasselbalch equation,
which relates pH, pKa (-log10Ka), and the ratio of the concentration of congugate acid (HA) and conjugate base (A-) as follows:
pH = pKa + log10([A-]/[HA])
You wish to prepare 150. milliliters of 0.0900 M sodium acetate, pH 4.80, from glacial acetic acid [a liquid; concentration = 17.5 M, pKa = 4.76] and sodium hydroxide [a solid; purity 99.9%; MW = 40.0].
1. What volume (in milliliters) of glacial acetic acid would you need to make the buffer?
2. What mass (in grams) of NaOH would you need to prepare 25.0 mL of 1.00 M NaOH?
3. What volume (in milliliters) of the 1.00 M NaOH would be needed to adjust the pH to 4.80?
To prepare 150 mL of 0.0900 M sodium acetate, pH 4.80, we need 74.72 mL of glacial acetic acid, 25 g of NaOH, and 12.6 mL of 1.00 M NaOH.
1. To prepare 150 mL of 0.0900 M sodium acetate, we need to use the Henderson-Hasselbalch equation, which relates pH, pKa (-log10Ka), and the ratio of the concentration of conjugate acid (HA) and conjugate base (A-).
pH = pKa + log₁₀([A-]/[HA])
[A-] = 0.0900 M, [HA] = 17.5 M, pKa = 4.76
To calculate the volume of glacial acetic acid needed, we can use the following equation:
pH = pKa + log₁₀([A-]/[HA])
We know that pH = 4.80, [A-] = 0.0900 M, pKa = 4.76
Therefore, log10([A-]/[HA]) = pH - pKa = 4.80 - 4.76 = 0.04
[A-]/[HA] = 10⁰·⁰⁴ = 1.82
[HA] = [A-]/1.82 = 0.0900 M/1.82 = 0.0495 M
Then, we can calculate the volume of glacial acetic acid needed by using the following equation:
V = n / C = (n / V) x V = (0.0495 M x 150 mL) / 0.0900 M = 74.72 mL
2. To prepare 25.0 mL of 1.00 M NaOH, we can use the following equation:
m = n / V = (n / C) x V = (1.00 M x 25.0 mL) / 1 = 25.0 g
3. To adjust the pH to 4.80, we need to use the Henderson-Hasselbalch equation again, and we can calculate the volume of 1.00 M NaOH needed.
pH = pKa + log₁₀([A-]/[HA])
We know that pH = 4.80, [A-] = 0.0900 M, pKa = 4.76
Therefore, log₁₀([A-]/[HA]) = pH - pKa = 4.80 - 4.76 = 0.04
[A-]/[HA] =10⁰·⁰⁴ = 1.82
[HA] = [A-]/1.82 = 0.0900 M/1.82 = 0.0495 M
The initial [HA] = 17.5 M, thus we need to add 1.82 x 0.0495 M = 0.088 M of NaOH to increase the [A-] and decrease the [HA] to reach the desired pH.
V = n / C = (n / V) x V = (0.088 M x 150 mL) / 0.0900 M = 12.6 mL
Learn more about the Henderson-Hasselbalch equation at
https://brainly.com/question/13423434
#SPJ4
The mass of a mole of carbon atoms is 12.011 grams. What is the mass of a single atom of carbon? 1.9 x 10-23 g atom 1.995 x 10-23 2 x (6.022 x 10²3) 2.0 x 10²3 atom atomn
The mass of a single atom of carbon is 1.9 x 10-²³ g/atom (option A).
How to calculate mass of single atom?An atom is the smallest possible amount of matter which still retains its identity as a chemical element, now known to consist of a nucleus surrounded by electrons.
According to this question, the mass of a mole of carbon atoms is 12.011 grams.
1 mole of carbon atom = 12g
1 mole of a carbon atoms = 6.022 × 10²³ atoms
Hence, mass of 6.022 × 10²³ atoms of carbon = 12g
Mass of 1 atom of carbon = 12 ÷ 6.022 ×10²³ = 1.9 × 10-²³ g/atom.
Therefore, 1.9 × 10-²³ g/atom is the mass of a single atom of carbon.
Learn more about atom at: https://brainly.com/question/29695801
#SPJ1
The gas chromatograph, in combination with the _________________, can separate the components of a drug mixture and then unequivocally identify each substance present in the mixture.
- Mass Spectrometer
The gas chromatograph, in combination with the mass Spectrometer, can separate the components of a drug mixture and then unequivocally identify each substance present in the mixture.
A mass spectrometer can only determine a molecule's mass after it has changed into a gas-phase ion. To do this, it charges molecules electrically and converts the resulting flow of electrically charged ions into a proportionate electrical current that a data device can then read. The components of a drug mixture are separated by the gas chromatograph and mass spectrometer, which then positively identify each component. By electrically charging molecules, which results in a flow of electrically charged ions, it does this.
learn more about chromatograph here:
brainly.com/question/29442779
#SPJ4
P4 + 5O2 → 2P2O5
How many grams of P2O5 would be produced with 2 moles of P4 used?
________ g P2O5
The answer is 567.76 grams.
We used the balanced equation for the reaction of P4 + 5O2 → 2P2O5. This equation tells us that for every 1 mole of P4 that reacts, 2 moles of P2O5 are produced.
Therefore, if we start with 2 moles of P4, we would end up with 4 moles of P2O5. To find the mass of 4 moles of P2O5, we can use the molar mass of P2O5 which is 141.94 g/mol.
To find the mass, we multiply the number of moles by the molar mass, so 4 moles * 141.94 g/mol = 567.76 grams.
Learn more about stoichiometry at,
https://brainly.com/question/14935523
Write a balanced chemical equation describing the dissolution (dissolving) of strontium fluoride. Determine the molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2. (Strontium nitrate is a highly soluble salt)
The balanced chemical equation for the dissolution of strontium fluoride in water is: SrF2 (s) + H2O (l) --> Sr(NO3)2 (aq) + 2F- (aq) and The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 is approximately 3.8 x 10^-7 mol/L.
How to calculate molar solubility of SrF2?
The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be determined using the solubility product constant (Ksp) of SrF2. The Ksp of SrF2 is 2.9 x 10^-11.
The solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be calculated by using the expression:
Ksp = [Sr2+] [F-]^2
where [Sr2+] is the molarity of the Sr2+ ions and [F-] is the molarity of the F- ions.
The solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 can be calculated by using the expression:
[Sr2+] = Ksp / [F-]^2
The molar solubility of SrF2 in a 0.5 mol/L solution of Sr(NO3)2 is approximately 3.8 x 10^-7 mol/L
To learn more about molar solubility, visit: https://brainly.com/question/30265969
#SPJ1
What is the mass, in grams, of 9.56 x 10 molecules of methanol (CH, OH) ?
The mass of given no. of molecules of methanol will be 508 grams.
First , we have to calculate the no. of moles. So, No of moles = No. of molecules / avagadros no. Therefore :
⇒9.56 x [tex]10^{23}[/tex] / 6.02 x [tex]10^{23}[/tex]
⇒15.875 moles
Now, We know that the molecular mass of methanol is 32 grams. So, we can calculate the mass by simply multiplying the molecular mass with moles.
Therefore,
⇒15.875 x 32
⇒508.00 grams
Learn more about mole concept here,
https://brainly.com/question/22540912
The complete question should be ,
What is the mass, in grams, of 9.56 x [tex]10^{23}[/tex] molecules of methanol (CH, OH) ?
What is the charge of the monatomic cation usually formed by each of the following metals? Remember to include the sign with each charge, and enter the number along with the correct sign of the charge in each case. (Do NOT re-enter the element symbols.)Zn Ag Cd
The charge of the monatomic cation usually formed by each of the following metals is: Zn: +2, Ag: +1, Cd: +2.
It's important to note that the charge of a cation is determined by the number of electrons that the atom loses to form the cation. The charge of a cation can be determined by looking at the element's position in the periodic table and its electron configuration, and also by knowing the common oxidation states of the elements. Some elements tend to lose electrons more readily than others, and that's why they form cations with different charges. A monoatomic cation is a cation (an ion with a positive charge) that is composed of only one atom. It is formed when an atom loses one or more electrons, leaving it with a net positive charge. Monoatomic cations are commonly formed by metals, which tend to lose electrons to form cations with a positive charge. The charge of a monoatomic cation is determined by the number of electrons that the atom loses to form the cation.
To know more about cation please refer: https://brainly.com/question/28710898
#SPJ4
with reference to their rf values, rank the four amino acids in terms of their solubility in the solvent used
The four amino acids that are ranked in terms of their solubility in the solvent used, according to the Rf values, are Leucine, Arginine, Alanine, and Glycine.
What is Rf value?The retention factor (Rf value) is important in chromatography because it can be used to predict where a specific substance will be located on the chromatogram. This is due to the fact that the Rf value measures how far a specific substance has traveled relative to the solvent front.The presence of a high retention factor indicates a strong interaction between the compound of interest and the surface. This also implies that the compound of interest is highly soluble in the mobile phase.Moving molecules with a small Rf are less soluble in the hydrophobic (non-polar) solvent they are larger and also have a greater affinity towards the hydrophilic paper than molecules with a larger Rf.To learn more about Rf value refer to :
https://brainly.com/question/17796724
#SPJ4
which of the statements best describes the carbon-carbon length and strength for the following compounds
The correct option is (2) i.e. Benzene and p-disubstituted benzene do not have alternating single and double Carbon-Carbon bonds. The C-C bond lengths in these compounds are all similar.
Benzene is a six-carbon aromatic hydrocarbon with a hexagonal ring structure and is characterized by its distinctive aroma. The carbon-carbon (C-C) bonds in benzene are intermediate in length between a single bond and a double bond, and are referred to as "aromatic" or "delocalized" bonds. This means that the electrons in the bonds are spread out over the entire ring, rather than being localized between two adjacent carbon atoms. p-Disubstituted benzene is a type of substituted benzene in which one or more of the hydrogens in the benzene ring have been replaced with a different group. Substitution of the benzene ring often leads to changes in the physical and chemical properties of the molecule. However, the C-C bond lengths in p-disubstituted benzene still have an average value that is between the values for the average C-C single bond length and the average C-C double bond length.
To know more about carbon please refer: https://brainly.com/question/22530423
#SPJ4
Question - Which one of the following statements best describes the C-C bond lengths in benzene and p-disubstituted benzene?
1) Benzene and p-disubstituted benzene have alternating single and double C-C bonds. These bond lengths are not similar to values for the average C-C single bond length and the average C-C double bond length, respectively.
2) Benzene and p-disubstituted benzene do not have alternating single and double C-C bonds. The C-C bond lengths in these compounds are all similar, and have an average value that is between the values for the average C-C single bond length and the average C-C double bond length.
3) Benzene and p-disubstituted benzene have alternating single and double C-C bonds. These bond lengths are similar to values for the average C-C single bond length and the average C-C double bond length, respectively.
A certain substance has a fixed composition of S and Cl atoms regardless of its source. Which of the following statements about the substance is true?A.) The substance is a homogenous mixtureB.) The substance contains atoms of silicon and chlorineC.) The substance is a heterogenous mixtureD.) The substance is a compound that contains two elementsE.) The substance must contain equal numbers of S and Cl atoms
The answer was the substance is a compound that contains two elements.
What is meant by elements ?
A fundamental object that is difficult to divide into smaller bits is known as an element.An element is a substance that cannot be broken down by non-nuclear reactions in chemistry and physics.A discrete component of a larger system or collection is referred to as an element in computers and mathematics.The names nihonium, moscovium, tennessine, and oganesson are the official names for elements 113, 115, 117, and 118, respectively.A pure element is one that is made up of atoms of the same kind. Since sodium exclusively contains sodium atoms, it is a pure element. While various atom types make up cement and glass, respectively.To learn more about elements refer to
https://brainly.com/question/20096027
#SPJ4
Osmosis may be defined as the movement of a solvent through a semipermeable membrane from a region of higher solute concentration to one of lower solute concentration True False
False. Osmosis may be defined as the movement of a solvent through a semipermeable membrane from a region of lower solute concentration to one of higher concentration.
Osmosis can be defined as the movement of solvent particles or water from lower solute concentration to higher solute concentration through the semipermeable membrane. This process does not require any energy. This requires only a concentration gradient. Semipermeable membranes are very thin layers of material which allows some things to pass through them. The movement of a solvent through a semipermeable membrane from a region of higher solute concentration to one of lower solute concentration is called diffusion.
To learn more about Osmosis please visit:
https://brainly.com/question/2811191
#SPJ4
What is the empirical formula for this crystalline material
The empirical formula for the given crystalline material is Cu₁₆O₂₀YBa₂
What is the empirical formula of a compound?The empirical formula of a compound is the simplest formula of a compound that shows the simplest ratio in which the elements are present in a compound.
The simplest whole-number ratio of atoms in a chemical molecule is its empirical formula. Sulfur monoxide's empirical formula, SO, and disulfur dioxide's empirical formula, S₂O₂, are two straightforward examples of this idea. Both have the same empirical formula of SO.
Learn more about empirical formulas at: https://brainly.com/question/13058832
#SPJ1
Why is the CH3OH polar and not non polar? Also why is the structure tetrahedral and not octahedral? It has 6 sides.
I am so confused
chemistry slay bslay slay slay
The third term of the sequence is 19. The term to term rule when we reverse the order of the sequence is subtract 13 then divide by 6.
How to find terms in a sequence?The sequence has three terms. Its term to term rule is as follows:
multiply by 6 and then add 13.
The first term of the sequence is -2.
By using the rule the third term can be found as follows:
Second term:
-2 × 6 + 13 = - 12 + 13 = 1
Third term
1 × 6 + 13 = 6 + 13 = 19
Therefore, the first three terms are as follows:
-2, 1, 19
Now, let's reverse the three terms of the sequence,
19, 1, -2
Therefore, the term to term rule of the sequence is as follows:
subtract 13 then divide by 6
Learn more on sequence here:
brainly.com/question/26151197
#SPJ1
If a channel of a particular cell preferentially transmits smaller ionic species across the membrane, given the following biologically relevant, isoelectronic ions, the channel is LEAST likely to transmit:
A.S2−
B.Cl−
C.K+
D.Ca2+
The channel is least likely to transmit smaller ionic species is D. Ca2+.
What are ions?
Ions are atoms or molecules that have an unequal number of protons and electrons, giving them a net electric charge. The charge can be positive (called cations) or negative (called anions). Ions are formed when atoms gain or lose electrons through chemical reactions or physical processes.
Ca2+ ions are larger than S2-, Cl- and K+, and therefore, it would be harder for a channel that preferentially transmits smaller ionic species to transmit Ca2+ ions across the membrane. The other ions mentioned (S2-, Cl- and K+) are all smaller than Ca2+ and therefore would be more likely to be able to pass through the channel.
It's important to note that this is a hypothetical scenario and the actual ion selectivity of a particular ion channel can depend on many factors like the size and charge of the ion, the structure of the channel pore and the presence of other molecules. It's also important to note that not all ion channels are selective and some allow multiple ions to pass through.
Therefore, the Ca2+ channel is least likely to transfer smaller ionic species.
To learn more about ions from the given link:
https://brainly.com/question/14389993
#SPJ4
You mix 260. mL of 1.20 M lead(II) nitrate with 300. mL of 1.90 M potassium iodide. The lead (II) iodide is insoluble. Which of the following is false? a) The final concentration of Pb2+ ions is 0.0482 M. b) You form 131 g of lead(II) iodide. c) The final concentration of K+ is 1.02 M. d>The final concentration of NO, is 1.02 M. e) All are true.
All are true. The resulting solution will have a NO3- ion concentration of 672 mmoles/580 mL, or 1.159 M.
Pb(NO3)2 volume = 260 mL = 0.26 L
Pb(NO3)2 has molarity of 1.2 M.
KI volume = 300 mL = 0.3 L
KI has a molarity of 1.9 M.
Pb(NO3)2 + 2KI reaction rightarrow PbI2 + 2KNO3
First potassium iodide.
Potassium iodide we must determine the moles of reactants present: Pb(NO3)2 moles = Pb molarity (NO3) 1.2 × 0.26 = 0.312 moles = 2 times Volume in L 1.9 x 0.3 = 0.57 moles of KI = Molarity of KI x Volume in L
We know from stoichiometry that For the reaction to proceed, 1 mole of KI requires 1/2 mole of Pb(NO3)
2. As a result, 0.57 mole of KI necessitates (1/2 * 0.57) mole of Pb(NO3)2 for the reaction to continue.
0.285 moles of Pb(NO3)2 required
We have 0.312 moles, which indicates that Pb(NO3)2 is present in excess.
You mix 260. mL of 1.20 M lead(II) nitrate with 300. mL of 1.90 M potassium iodide.The lead (II) iodide is insoluble all are true.
learn more about potassium iodide here:
https://brainly.com/question/28099104
#SPJ4
Calculate how many grams of Aluminum are needed to produce 21.6 grams of Aluminum oxide (Al2O3).
4Al + 3O2 → 2Al2O3
a
5.71 g Al
b
132 g Al
c
11.43 g Al
d
26.982 g Al
to make a 1% solution of glucose, you would dissolve gram(s) of glucose into enough water to make a 100ml solution.
To make a 1% solution of glucose, 1 gram of glucose would be needed to be dissolved into enough water to make a 100ml solution.
Weight/Volume percentage of a solution is defined as the percentage of mass of the solute in grams per 1 ml of volume of the solution. It is denoted by W/V%
W/V% = [tex]\frac{W}{V}[/tex] × [tex]100[/tex] .....[tex]eq[/tex]
Here, V = Volume of the solution in milliliters (ml)
W = Weight of the solute in solution in grams (g)
Volume of solution given in the question = 100 ml
W/V% of solution given in the question = 1 %
Thus putting the values in the [tex]eq[/tex] , we get
Mass or Weight of glucose needed to be dissolved in the solution (W):
= [(W/V%) × [tex]V[/tex]] / [tex]100[/tex]
= ([tex]1[/tex] × [tex]100[/tex]) / [tex]100[/tex]
= 1 gram
Hence, one gram of glucose is needed to be dissolved in a 100 ml solution to make it a 1 % solution of glucose.
Learn more about solution of glucose here:
https://brainly.com/question/14937397
#SPJ4
