Four friends plan to rent a car to go on a camping trip. At the campground the friends sign up to go on a mountain bike tour

Answers

Answer 1

The algebraic expression G x C, where G represents the total number of gallons needed and C represents the cost per gallon.

In mathematics, an expression is a combination of one or more numbers, variables, and/or operators that represent a quantity or a mathematical relationship.

To calculate the total cost of gasoline, we first need to determine how many gallons of gasoline will be needed for the entire trip. This can be done by dividing the total distance traveled by the car's miles per gallon (MPG) rating. Let's use "G" to represent the total number of gallons needed.

G = Total Distance Traveled / MPG

To find the total cost of gasoline, we can multiply the number of gallons needed by the cost per gallon. Let's use "T" to represent the total cost of gasoline.

T = G x C

Using the expression we developed earlier, we can now find the total cost of gasoline for the full-size car:

=> T = G x C

To know more about expression here.

https://brainly.com/question/14083225

#SPJ4

Complete Question:

Four friends plan to rent a car to go on a camping trip. They will drive a total of 450 miles. The cost of gasoline is $2.20 per gallon Type of Car SUV Full size Compact Rental Cost $283 $215 $183 Insurance Cost $120 $108 $95 Miles per Gallon 24 25 33 Total Gas Cost $ $ $ Cost per Person.

Write an algebraic expression for the total cost of the gasoline.


Related Questions

Fatima has a total of​ $8 to spend to make fruit smoothies. She will use two types of fruit. The table to the right shows the cost of each type of fruit per cup.

For the mango and pineapple​ mixture, find a linear equation in standard form that models how much mango and pineapple she can​ buy, where x is cups of mango and y is cups of pineapple.


Mango=0.50
Pineapple=0.75
Strawberry=1.00

Answers

Answer:

0.75y + 0.5x = 8.00

Step-by-step explanation:

Step 3: Apply the slope formula: m =
2-3
-1-6
m=
(1/5)
(-1/7)
(1/7)
32-).
X2 X1

Answers

The slope formula is m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are two points on the line and m is the slope of the line. To use the formula, you need to know the coordinates of two points on the line. If you have the coordinates of two points, you can substitute them into the formula to find the slope.

What information is in the text but not in the graph?

Answers

Answer:

B. More money was given than expected in 1994

Step-by-step explanation:

Nowhere is it mentioned what amount was expected as donations. Only actual amounts received are shown on the graph

Hence this is an assumption and not necessarily fact

how many three-digit numbers can be formed from the digits 0, 1, 2, 3, 4, 5, and 6 if each digit can be used only once? how many of these are odd numbers? how many are greater than 330?

Answers

By using the concept of combinations, we have determined that there are 210 three-digit numbers that can be formed using the digits 0-6 without repeating any of them. Among them, there are 90 odd numbers and 120 numbers greater than 330.

Combinations are a fundamental concept in mathematics, particularly in the field of combinatorics, which deals with counting and arranging objects.

To solve this problem, we can use the concept of combinations, which is a way of counting the number of ways we can choose k items from a set of n items. In this case, we want to find the number of three-digit numbers we can form from the set {0, 1, 2, 3, 4, 5, 6}, without repeating any of the digits.

First, we can determine the number of ways we can choose the first digit. Since there are seven digits to choose from, we have 7 options for the first digit.

Next, we can determine the number of ways we can choose the second digit. Since we have already used one of the digits, we only have 6 options left for the second digit.

Finally, we can determine the number of ways we can choose the third digit. Since we have used two of the digits, we only have 5 options left for the third digit.

Therefore, the total number of three-digit numbers we can form is given by the product of the number of choices for each digit:

7 x 6 x 5 = 210

So there are 210 different three-digit numbers that can be formed using the digits 0, 1, 2, 3, 4, 5, and 6, without repeating any of the digits.

To find the number of odd numbers, we need to consider that the last digit must be either 1, 3, or 5, since these are the only odd digits in the set. We can choose the first two digits in the same way as before, and then choose one of the three odd digits for the last digit. Therefore, the number of odd three-digit numbers is:

6 x 5 x 3 = 90

To find the number of three-digit numbers greater than 330, we need to consider that the first digit must be either 3, 4, 5, or 6. We can choose the first digit in 4 ways, and then choose the remaining two digits as before. Therefore, the number of three-digit numbers greater than 330 is:

4 x 6 x 5 = 120

To know more about combination here.

https://brainly.com/question/28998705

#SPJ4

take your time in 2-6

Answers

For #5 55 would come next and for #6 37 would come next. Hope that was helpful!

Please help (will mark as brainlest)

Answers

Answer:

TRIANGLE PROBLEM:

area : 6a^4

perimeter : 12a^2

SIMPLIFY problem:

-40c^2+26a^2+30ac

EVALUATE & FACTOR:

(q^2 - p) ( p^2 - q)

and the solved form is 240

hope it helps :)

Step-by-step explanation:

lol im an rsm kid too. but i hope these are right,

first i'm gonna start with 263 c.

AREA = 4a^2 * 3a^2 divided by 2.  

12a^4 divided by 2 = 6a^4.

AREA = 6a^4

Perimeter you can find with the pythag. th.

(4a^2) ^2 + (3a^2 ) ^2 = c^2

16a^4 + 9a^4 = c^2

, the missing side is 5a^2

therefore the perimeter is 4a^2 + 3a^2 + 5a^2 = 12a^2

ok next, im gonna do 266

the answer is -40c^2+26a^2+30ac

make sure to check this w/ symbo or mthway

ok last one!!

factored form is (q^2 - p) ( p^2 - q)

and the solved form is 240

which of the following are true statements? select all that apply: 1. a 95% confidence interval is a random interval that contains the true parameter 95% of the time 2. the true parameter is a random value that has 95% chance of falling in the 95% confidence interval 3. i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5. 4. the true parameter (unknown to me) is 0.5. if i sample data and construct a 95% confidence interval, the interval will contain 0.5 95% of the time. answer :

Answers

Among the following statements, The true statements are:

Option (1) a 95% confidence interval is a random interval that contains the true parameter 95% of the time, (2)the true parameter is a random value that has 95% chance of falling in the 95% confidence interval, (3) i perform a linear regression and get a 95% confidence interval from 0.4 to 0.5. there is a 95% probability that the true parameter is between 0.4 and 0.5, (4) the true parameter (unknown to me) is 0.

A 95% confidence interval is a random interval that contains the true parameter 95% of the time.

The true parameter is NOT a random value, and it is not correct to say that it has a 95% chance of falling in the 95% confidence interval.

If you perform a linear regression and get a 95% confidence interval from 0.4 to 0.5,

it means that if you repeated the same experiment many times, 95% of the resulting confidence intervals would contain the true parameter.

It is not correct to say that there is a 95% probability that the true parameter is between 0.4 and 0.5 because the true parameter is either in the interval or not.

If the true parameter is 0.5 and you sample data and construct a 95% confidence interval, the interval may or may not contain 0.5.

The 95% confidence interval is a statement about the probability of the interval containing the true parameter, not about the probability of the true parameter being any specific value.

For more such questions on parameter

https://brainly.com/question/29344078

#SPJ4

Help me with this math homework pls!

Rewrite every expression underneath, while replacing every sign "x" implied.

23 + 8b = .......
㎡ - 5g = .......
⅛ q + 7a/3 = .....
12k (g+h) =......
(2x + 3)(2 - 5x) = ......

Answers

The following expressions rewritten below;

23 + 8bm² - 5g(3q + 56a) / 2412kg + 12kh -10x² -11x + 6

How to write algebraic expressions?

23 + 8b

No common terms or factors

= 23 + 8b

㎡ - 5g

No common terms or factors

= m² - 5g

1/8 q + 7a/3

= (3q + 56a) / 24

12k (g+h)

= 12kg + 12kh

(2x + 3)(2 - 5x)

= 4x - 10x² + 6 - 15x

combine like terms

= -10x² -11x + 6

Therefore, algebraic expressions are solved by multiplying and combining like terms.

Read more on algebra:

https://brainly.com/question/4344214

#SPJ1

Sketch and graph please

Answers

We have drawn the graph for the given inequality.

What is inequality?

Inequality is a mathematical statement that compares two values or expressions and shows their relative size. It is represented by the symbols >, <, ≥, or ≤, which respectively mean "greater than", "less than", "greater than or equal to", and "less than or equal to". Inequalities can also include variables and can be used to describe a range of possible values for that variable.

For the given inequality y ≤ 3/5x-5

we can draw the graph as shown below:

Hence, we have drawn the graph for the given inequality.

To learn more about the inequalities, visit:

https://brainly.com/question/25275758

#SPJ1

In what time will the simple interest on Rs7560 be Rs1102. 50 at 25/4% per annum

Answers

The simple interest on Rs 7560 will be Rs 1102.50 at a rate of 25/4% per annum after approximately 1 month (0.09 years).

Simple interest is a type of interest that is calculated only on the principal amount of a loan or investment, and not on any accumulated interest. It is usually calculated as a percentage of the principal amount, multiplied by the time period for which the interest is being calculated.

We can use the formula for simple interest to solve this problem:

Simple Interest (SI) = Principal (P) x Rate (R) x Time (T)

We know that the principal is Rs 7560, the rate is 25/4% per annum, and the interest is Rs 1102.50. Substituting these values into the formula, we get:

1102.50 = 7560 x (25/4) x T

Simplifying:

1102.50 = 47250T/4

Multiplying both sides by 4 to eliminate the fraction:

1102.50 x 4 = 47250T

4410 = 47250T

Dividing both sides by 47250:

T = 4410/47250

T = 0.093 or approximately 0.09 years.

To convert this to months or days, we can multiply by 12 or 365, respectively.

To learn more about simple interest click on,

https://brainly.com/question/27976154

#SPJ4

Simplify.
(5x-2+3x²)+(4x+3)
O 3x² +9x-1
O 12x4 +1
O 3x²+x+5
O 3x² +9x+1

Answers

The simplified version is: 3x^2 + 9x +1

Answer:

3x² + 9x + 1

Step-by-step explanation:

5x - 2 + 3x² + 4x + 3

= 9x - 2 + 3x² + 3

= 9x + 1 + 3x²

= 3x² + 9x + 1

there 10 cars in a race. in how many ways can three cars finish the race as the 1st, 2nd, and the 3rd places?

Answers

There are 10 cars in a race, in 720 ways can three cars finish the race as the 1st, 2nd, and the 3rd places.

An arrangement of particulars in a specific order is appertained to as a permutation. Then, the factors of sets are arranged in a direct or successional order. For case, the set A = ,6 has a permutation of 2, which is. There's no other way to organise the factors of set A, as you can see.

There are 10 cars in the race,

Three cars finish the race in the 1st ,2nd and 3rd order

1st finish the race have 10 chances

P(A) = 10

2nd finish the race have 9 chances

P(B) = 9

3rd finish the race have 8 chances

P(C) = 8

The number in which this can be put,

= P(A) x P(B) x P(C)

= 10*9*8

=720 ways

Therefore, in 720 ways can three cars finish the race as the 1st, 2nd, and the 3rd places.

Learn more about Permutation:

https://brainly.com/question/3933713

#SPJ4

Each of these graphs of residuals is from the same set of data using different lines to fit the data. Which graph is most likely to represent the residuals from the best fit line?EXPLAIN YOUR REASONING.

Answers

The graph which is most likely to represent the residuals from the best fit line is Option C.

What is Graph?

Graph is a mathematical representation of a network and it describes the relationship between lines and points.

Given that from the graphs of residuals is  the same set of data using different lines to fit the data.

The best fit line is the line that minimizes the sum of the squared residuals.

In other words, it is the line that has the smallest sum of the squared differences between the actual data points and the predicted values from the line.

The residuals represent the differences between the actual data points and the predicted values, and any systematic pattern in the residuals would suggest that the line is not a good fit for the data.

Hence, Option C is correct, the graph which is most likely to represent the residuals from the best fit line.

To learn more on Graph click:

https://brainly.com/question/17267403

#SPJ1

I need help on this problem pleaseeeeeeeeeee

Answers

Y=mx+b

A. Y=7.65x+50

B . 149.45-50= 99.45. 99.45/7.65=13 13 Hours

C. Y=7.65x48= $376.20 For 2 Days



Please give me Brainlyiest

car rental company a charges an $80 service fee plus $22 per day. car rental company b does not have a service fee and charges $32 per day. which equation will help determine how many days it will take for the average charge per day for company a to be the same as the average charge per day for company b? responses 32d

Answers

Equation that will help determine how many days it will take for the average charge per day for company a to be the same as the average charge per day for company b is [tex]\frac{80+22d}{d} = 32d[/tex]

For finding the equation we will first form separate equations of both company a and company b and then we will equate the formed equation to find the number of days.

Let the number of days be d.

For company a, we will first add the service charges and per day charge multiplied with number of days, and then divide the sum with number of days.

= [tex]\frac{80+22d}{d}[/tex]

For company b, we will multiply the per day charges with the number of days.

= [tex]32d[/tex]

Now, we will equate both the formed equation

[tex]\frac{80+22d}{d} = 32d[/tex]

To know more about equation

https://brainly.com/question/29657988

#SPJ4

A 3 inch radius circle is drawn inside a 7 inch radius circle. If you throw a dart at these circles, what is the probability AS A PERCENT that you land inside the smaller circle? Round to the nearest whole percent. Use 3.14 for pi.​

Answers

Answer:

Step-by-step explanation:

Which of the following sequences is an arithmetic sequence?
O {1, 2, 4, 7,...}
O {1, -2, 4, -8,...}
O {1, 4, 7, 10, ...}
O {1, 3, 9, 27,...}

Answers

The answer is: C {1,4,7,10,….}

Answer:

The third option

Step-by-step explanation:

The third option, {1, 4, 7, 10, ...} is an arithmetic sequence because you add 3 to get from 1 to 4, and then you add 3 to get to 7, and then you add another 3 to get to 10.

The population of rabbits on an island is growing exponentially. In the year 2000, the population of rabbits was 950, and by 2003 the population had grown to 1000. Predict the population of rabbits in the year 2013, to the nearest whole number.

Answers

The population of rabbits in the year 2013 is 1186.

How to predict the population of rabbits in the year 2013?

To predict the population of rabbits in the year 2013, we can use exponential growth. The formula for exponential growth is:

P = P₀ * e^(rt)

where:

P = final population

P₀ = initial population (950)

r = the growth rate (we need to find this)

t = time elapsed (13 years)

We can use the data from 2003 to find the growth rate:

1000 = 950 * e^(r * 3)

1000 = 950 * e^(3r)

1000/950 = e^(3r)

ln (1000/950) = 3r

r = (ln(1000 / 950)) / 3

r = 0.0171

Now that we have the growth rate, we can use it to find the population in 2013:

P = 950 * e^(0.0171 * 13)

P = 1186

Learn more about exponential growth on:

https://brainly.com/question/24845778

#SPJ1

choose the best data type for each of the following so that any reasonable value is accommodated but no memory storage is wasted. give an example of a typical value that would be held by the variable, and explain why you chose the type you did.

Answers

a. The best data type for the number of siblings would be an integer.

An example of a typical value for this variable would be 3, as someone might have 3 siblings. An integer is the best data type because the number of siblings is a whole number and can never be a fraction or a negative number.

b. The best data type for the final grade in this class would be a floating-point number. An example of a typical value for this variable would be 85.5, as a final grade may include decimal points. A floating-point number is the best data type because a final grade can have a decimal point and may include fractions.

c. The best data type for the population of Earth would be a long integer. An example of a typical value for this variable would be 7,794,798,739, as of the year 2020. A long integer is the best data type because the population of Earth is a large number and cannot be expressed using a regular integer.

d. The best data type for the population of a U.S. county would be an integer. An example of a typical value for this variable would be 100,000, as the population of a county can vary greatly. An integer is the best data type because the population of a county is a whole number and can never be a fraction or a negative number.

e. The best data type for the number of passengers on a bus would be an integer. An example of a typical value for this variable would be 20, as a bus can carry a varying number of passengers. An integer is the best data type because the number of passengers on a bus is a whole number and can never be a fraction or a negative number.

f. The best data type for one player's score in a Scrabble game would be an integer. An example of a typical value for this variable would be 45, as a score in Scrabble is calculated in whole numbers. An integer is the best data type because a score in Scrabble is a whole number and can never be a fraction or a negative number.

g. The best data type for one team's score in a Major League Baseball game would be an integer. An example of a typical value for this variable would be 7, as a team's score is calculated in whole numbers. An integer is the best data type because a team's score is a whole number and can never be a fraction or a negative number.

h. The best data type for the year a historical event occurred would be an integer. An example of a typical value for this variable would be 1776, as the year the United States declared independence. An integer is the best data type because a year is a whole number and can never be a fraction or a negative number.

i. The best data type for the number of legs on an animal would be an integer. An example of a typical value for this variable would be 4, as many animals have four legs. An integer is the best data type because the number of legs an animal has is a whole number and can never be a fraction or a negative number.

j. The best data type for the price of an automobile would be a floating-point number. An example of a typical value for this variable would be $25,000.50, as a price for a car can include decimal points. A floating-point number is the best data type because the price of a car can have a decimal point and may include fractions.

For more questions like Data type click the link below:

https://brainly.com/question/14581918

#SPJ4

For what values of x and y must ABCD be a parallelogram?

Answers

The correct answer is,

x = 39

y =21

What is Parallelogram ?

A different type of quadrilateral known as parallelogram has both pairs of its opposite sides parallel and equal.

The figure shows a parallelogram ABCD with the parameters AB II CD and AD II BC. Furthermore, AB = CD and AD = BC.

In a parallelogram, the opponent angles are equal.. So it means that side /A is equal to side /C, let's equate the two angles and solve for x;

5y - 3 = x + 3y

2y - x = 3                            ........(1)

Also, consecutive angles of a parallelogram are supplementary,

therefore,

/C + /D = 180

x + 3y + 2x = 180

3x + 3y = 180

x + y = 60                                  .......(2)

Now, add equations (1) and (2)

(2y-x) + (y+x) = 3 + 60

3y = 63

y = 21

now put this value of y in (2) we get,

x + y = 60

x + 21 = 60

x = 39

To know more about Parallelogram, visit:

https://brainly.com/question/16715772

#SPJ1

I really need help! Can you help??

Answers

Answer:

To convert 6 feet into meters, first create a conversion factor to convert from feet to meters. Make sure the original unit is in the denominator, then cancel feet. Next, multiply the original measure by the conversion factor to get 1.8288 meters, or 1.83 meters if you simplified it.

Step-by-step explanation:

1 13. In the first few days of its life, the length of an earthworm I is thought to be proportional to the square root of the number of hours n which have elapsed since its birth. If a worm is 2 cm long after 1 hour, how long will it be after 4 hours? How long will it take to grow to a length of 14 cm?​

Answers

The length of earthworm will be 4 cm after 4 hours. And the length is 14 cm after 49 hours.

What is meant by Proportion?

Proportions are defined when two or more ratios are made to be equal to each other.

Two quantities are said to be directly proportional if a positive change in one quantity also lead to a positive change in the other quantity.

If a is proportional to b, we denote it as a ∝ b.

Given,

Length of an earthworm, l ∝ square root of the number of hours, n, which have elapsed since it's birth.

l ∝ √n

l = k √n, for some constant k.

If a worm is 2 cm long after 1 hour, we can write it as,

2 = k × √1

⇒ k = 2

So the proportionality constant is 2.

After 4 hours,

l = k √4

l = 2 × 2 = 4 cm

If the length is 14 cm,

14 = 2 √n

√n = 14 / 2

√n = 7

n = 7² = 49 hours

Hence the length of worm is 4 cm after 4 hours. It will take 49 hours to grow to a length of 14 cm.

Learn more about Proportional Relationships here :

https://brainly.com/question/15785739

#SPJ9

you shuffle a standard deck of cards, then draw four cards.(a) what is the probability all four are the same suit? (b) what is the probability all four are red? (c) what is the probability each has a different suit?

Answers

a) Probability that all four are the same suit = 0.0106 b) Probability that all four are red =0.055 c) Probability each has a different suit = 0.105

Total number of cards =52

No. of cards for each suit =13

Total types of four suit =4 (heart, spades, diamonds, clubs)

Total numbers of ways = [tex]^{52}C_4[/tex] =270,725 ways

a) number of ways choosing four cards of the same suit

= [tex]^{13}C_4+^{13}C_4+^{13}C_4+^{13}C_4[/tex]

= [tex]4 \times ^{13}C_4\\[/tex]

= [tex]4 \times \frac{13!}{4!(13-4)!}[/tex]

=2860 ways

Probability that all four are the same suit is 2860/270,725 = 0.0106

b) Number of ways all four cards are red

=[tex]^{26}C_4[/tex]

= 4,950 ways

Probability that all four are red = 4950/270,725 =0.055

c)  Number of ways each card has a different suit

=[tex]^{13}C_1\times^{13}C_1\times^{13}C_1\times^{13}C_1[/tex]

= 28,561 ways

Probability each has a different suit is 28561/270725 = 0.105

To know more about probability

https://brainly.com/question/11092157

#SPJ4

Enter the denominator of the fraction is simplest form that is equal to 0.7

Answers

The simplest form of the fraction equivalent to 0.7 is 7/10

What is fraction?

A fraction is a part of a whole number, and a way to split up a number into equal parts.

Given that, to show the denominator of the fraction in the simplest form that is equal to 0.7

To convert 0.7 into a fraction, we have to write it in p/q form, where p and q are positive integers.

we can write .7 as 0.7/1

now to remove the decimal point we will multiply and divide by 10

therefore,

0.7/1 ×  10/10  = 7/10

Hence, the simplest form of the fraction equivalent to 0.7 is 7/10

Learn more about fractions, click;

https://brainly.com/question/1301963

#SPJ9

NEED HELP
Solve for x.
X=

Answers

The measure of the angle x would be 25.2°.

What is a circle theorem?

The circle theorem is a set of mathematical rules and relationships that apply to circles and their components, such as chords, tangents, and angles. These theorems describe how the different parts of a circle relate to each other and are used to solve geometric problems involving circles. Some common circle theorems include the inscribed angle theorem, the chord-chord theorem, and the tangent-secant theorem.

By using the circle theorem, we can write

5x-7 = 119

5x = 119 + 7

5x = 126

x = 126/5

x = 25.2°

Hence, the measure of the angle x would be 25.2°.

To learn more about the circle theorem, visit:

https://brainly.com/question/26594685

#SPJ1

2. 20 m 24 m 24 26 m​

Answers

Note that the body starts "with an initial velocity and moves with uniform acceleration."(Option C)

What is Acceleration?

In mechanics, acceleration is defined as the rate of change of an object's velocity with respect to time. Vector quantities are accelerations. The orientation of an object's acceleration is determined by the orientation of its net force.

The distance covered by the particle in nth second

Sₙ = u + a/2(2n-1)

S₈ = 20m

S₈ = u + a/2(2x(8-1)

20 = u + 7.5a ...................()

S₉ = 22 = u + a/2(2*9-1)

22 = u + 8.5a ..................(2)

By solving equations 1 and 2 we have :

u=5m/s , a=2m/s²

Thus,

S₁₀ = u+ a/2(2*10-1)

S₁₀ = 5 + 1/2 * 2 (2 * 10-1)

S₁₀ = 5 + 19

S₁₀ = 24m

Thus, it is correct to state that the body starts with the initial velocity and moves with uniform acceleration, and the correct option is C.

Learn more about Acceleration:
https://brainly.com/question/12550364
#SPJ1

Full Question:

A body covers 20 m, 22 m, 24 m, in 8th, 9th, and 10th seconds respectively. The body starts:

from rest and moves with uniform velocity.

from rest and moves with uniform acceleration.

with an initial velocity and moves with uniform acceleration.

with an initial velocity and moves with uniform velocity.

2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs

Answers

There are 8.75 pounds of meat for 7 dogs

How to find the value of x?

Ratio is used to compare two or more quantities. It is used to indicate how big or small a quantity is when compared to another.

Since 2.5 pounds of meat for 2 dogs x pounds of meat for 7 dogs. We can write:

2.5/2 = x/7

2*x = 2.5*7

2x = 17.5

x = 17.5/2

x = 8.75

Learn more about ratio on:

brainly.com/question/2328454

#SPJ1

Which expressions are equivalent to 4 � 4b4, b ? Choose all answers that apply: Choose all answers that apply: (Choice A) A � + 2 ( � + 2 � ) b+2(b+2b)b, plus, 2, left parenthesis, b, plus, 2, b, right parenthesis (Choice B) B 3 � + � 3b+b3, b, plus, b (Choice C) C 2 ( 2 � ) 2(2b)

Answers

B=3b-b

C= 2b expressions are equivalent to 4 � 4b4, b .

b+2(b+2b)=b+2(3b)=b+6b=7b

3b+b=4b

2(2b)=4b Option B and C produce the outcome 4b. They are the expressions that are comparable to 4b as a result. We can also get an equivalent equation by multiplying or dividing both sides of an equation by the same nonzero value. If x4=2x+7, we can add 4 to both sides to get the following equation, which is equivalent: x4+4=2x+7+4. Of course, both sides of the equation can be made simpler. Constants x=2x+7+4 on the left side cancel each other out. If two systems of equations have the same solution, they are equivalent (s). In algebra, two equations are said to be equivalent if their roots or solutions are the same. The same number, symbol, or expression must be added to or subtracted from both sides of an equation to produce an equivalent equation.

Learn more about equivalent from

brainly.com/question/2972832

#SPJ4

QUESTION FOR FOR LIH04

Answers

D. Stop motion. Stop motion is a form of animation where objects are moved in small increments between individual frames, creating the illusion of movement when the frames are played in sequence. This is the technique that Mario is using to animate his spoon.

the probability that it will rain tomorrow is 0.3. if it rains tomorrow, the probability that it will rain on the following day is 0.9. if it does not rain tomorrow, the probability that it will rain on the following day is 0.08. round your answers to three decimal places.

Answers

the probability that it will rain on the following day, given that it rained tomorrow, is 0.75. Rounded to three decimal places, the answer is 0.750.

Given the probabilities, you can use Bayes' theorem to calculate the probability that it will rain on the following day, given that it rained tomorrow. Bayes' theorem states that: P(A|B) = P(B|A) * P(A) / P(B)

Where: P(A|B) is the likelihood that event A will occur assuming event B has already happened. P(B|A) is the probability of event B given that event A has occurred. The prior probability of event A is P(A). The prior probability of event B is P(B).

In this case, let A be the event that it rains on the following day and B be the event that it rains tomorrow.

So, P(A|B) = P(B|A) * P(A) / P(B) = 0.9 * 0.3 / P(B)

To calculate P(B), you can use the total probability theorem:

P(B) = P(B|A) * P(A) + P(B|~A) * P(~A) = 0.9 * 0.3 + 0.08 * 0.7 = 0.327

Now, you can substitute the values into the formula for P(A|B) to get:

P(A|B) = 0.9 * 0.3 / 0.327 = 0.75

So, the probability that it will rain on the following day, given that it rained tomorrow, is 0.75. Rounded to three decimal places, the answer is 0.750.

To learn more about Bayes' theorem click here

brainly.com/question/17010130

#SPJ4

Other Questions
Today, Courtney wants to invest less than $5,000 with the goal of receiving $5,000 back sometime in the future. Which one of the following statements is correct?A.The period of time she has to wait until she reaches her goal is unaffected by thecompounding of interest.B.The lower the rate of interest she earns, the shorter the time she will have to wait to reach hergoal.C.She will have to wait longer if she earns 6 percent compound interest instead of 6 percentsimple interest.D.The length of time she has to wait to reach her goal is directly related to the interest rate sheearns.E.The period of time she has to wait decreases as the amount she invests today increases. !!!!!!!!!Please help!!!!!!!! Enchanted creatures who are known for their beauty, mystery, and supernatural powers.a. Diwatab. Encantadia The principle of heredity discovered by Mendel states that each diploid individual has two alleles at one locus and these two alleles separate when gametes are formed, one allele enters each gamete. It's called principle? Antonia needs to compress an image file to send to a client, but she doesnt want them to end up with a poorer quality image than the original. She needs to be sure that:to change the hueto change the layoutto change the saturation True/False: Python formats all floating-point numbers to two decimal places when outputting using the print statement. In the middle of the test, Keith discovered that he could only answer ten out of the fifty questions. Question 15 options: only--misplaced modifier of the fifty questions--misplaced modifier Correct In the middle of the test--misplaced modifier Question 1 (1 point)A massive asteroid in our solar system's asteroid belt, having an estimated mass of 2.6 x1021 kg and an orbital speed of 14900 m/s. Determine the amount of kinetic energypossessed by the asteroid. how large a cargo can it lift, assuming that the skin and structure of the balloon have a mass of 950 kg ? neglect the buoyant force on the cargo volume itself. What is single party dictatorship exerting control over all aspects of life? a complex system of relating certain emotional and spiritual characteristics to certain scale patterns is best defined as . true or false: the rule of thirds is the process of dividing an image into thirds, using two horizontal lines and two vertical lines, and positioning the most important elements inside the squares the lines create. a class of 150 undergraduate psychology students participates in a study on memory. each student is given a list of 20 words to memorize. at the end of one minute study period, each student is asked to jot down as many of the 20 words as they can. is this a designed experiment or an observational study? designed experiment observational study Find the slope of the line through each pair of points. ) (11, 8), (- 13, 11) how long should your rsum be at the beginning of your career? a patient with a cvc has redness and drainage at the exit site. which intervention is the most appropriate who was leading the mexican army in their attack on the alamo? g histidine is an important amino acid with an aromatic side chain that contains two nitrogens. which nitrogen do you think would get protonated in acid the southern manifesto group of answer choices was written before the civil war. was written by southern officials who declared that their states were not bound by supreme court decisions outlawing racial segregation. argued in favor of national government power. invalidated the tenth amendment. Someone help, please!