help with this question pls

The speed of the current is 1 mile per hour.

To calculate we can start by using the formula: distance = speed x time.

Let's call the speed of the current "c" and the speed of Sarah's rowing "r".

When Sarah rows down the river with the current, her speed is the sum of her rowing speed and the current speed: distance = (r + c) * time

When she rows back against the current, her speed is the difference between her rowing speed and the current speed: distance = (r - c) * time

We know that the distance is four miles in both cases, and the time is one hour and two hours respectively.

So we can set up the following two equations:

(r + c) * 1 = 4

(r - c) * 2 = 4

Solving the first equation:

r + c = 4

Solving the second equation:

r - c = 2

Adding the two equations:

r = 3

We know that Sarah is rowing at a constant speed, so we can substitute this value back into one of the original equations:

(3 + c) * 1 = 4

c = 1

So the speed of the current is 1 mile per hour.

To learn more about the distance, visit:

brainly.com/question/15256256

#SPJ4

Colton can rent the car for a total of 6 days while still staying within his means.

We are aware that hiring a car costs $72.37 per day, and that each mile travelled costs $0.06. We also know that Colton has a $450 spending limit and intends to go 275 miles.

We may set up the following inequality to determine how long Colton can afford to hire the car for:

72.37d + 0.06(275) <= 450

This inequality indicates that the entire cost must be less than or equal to Colton's $450 budget. It represents the cost of renting the car as well as the cost of the miles driven.

We must isolate d on one side of the inequality in order to solve for it. To calculate the cost of the miles driven, first multiply 0.06 by 275:

72.37d + 16.5 <= 450

After that, we will take 16.5 away from either side of the inequality:

72.37d <= 433.5

A final division of 72.37 will be applied to both sides of the inequality:

d <= 6

Therefore, Colton can rent the car for a total of 6 days while still staying within his means.

To know more about inequality visit :

brainly.com/question/30228778

#SPJ4

1) The definition of function F(x) is: B. F(x) = -(x + 2)²(x - 2).

2) The standard definition of the cubic function is: A. F(x) = ax³ + bx² + cx + d.

4) The approximate solution to the system of equations is given as follows: A. (-3.43, 6.30).

The Factor Theorem states that a polynomial function with roots(also called zeros) [tex]x_1, x_2, \codts, x_n[/tex], is represented by the product of it's linear factors [tex]x - x_1, x - x_2, \cdots x - x_n[/tex], according to the rule the rule presented as follows:

[tex]f(x) = a(x - x_1)(x - x_2) \cdots (x - x_n)[/tex]

In which a is the leading coefficient.

From the graph, the roots of the function are given as follows:

Meaning that the cubic function is defined as follows:

F(x) = a(x + 2)²(x - 2).

The y-intercept of the function, numerically, is given as follows:

F(0) = a(2² x (-2))

F(0) = -8a.

The y-intercept is positive, meaning that the leading coefficient is negative, and thus the option B is the correct option.

The general format of a cubic function, with leading coefficient a and constant d positive, is given as follows:

y = ax³ + bx² + cx + d.

Meaning that the correct option for item 2 is given by option A.

The solution to the system of equations is found through graphing, and is the point of intersection of the two functions.

From the graph given by the image presented at the end of the answer, using rounding, the approximate solution for item 4 is given by option A.

More can be learned about the Factor Theorem at https://brainly.com/question/30249951

#SPJ1

The ratio in simplest form in the three cases is 5 : 6, 36 : 29 and 1 : 5.

30 treadmills to 36 elliptical machines can be simplified to 5 treadmills to 6 elliptical machines. To simplify, you can divide both numbers by their greatest common factor, which in this case is 6.

30/6 = 5 and 36/6 = 6

So 30 : 36 = 5 : 6

180 red marbles to 145 blue marbles can be simplified to 12 red marbles to 11 blue marbles. To simplify, you can divide both numbers by their greatest common factor, which in this case is 5.

180/5 = 36 and 145/5 = 29

180 : 145 = 36 : 29

In the word "flashlight", the ratio of vowels to total letters is 2:8. The word "flashlight" has 2 vowels (a,i) and 10 total letters. To simplify divide by 2.

2 : 10 = 1 : 5

To know more on ratio

https://brainly.com/question/29087750

#SPJ4

The total number of different collections of pets your roommate can take is 10 + 10 = 20.

In this scenario, your roommate has two options for which pets to take with him: either the dog or the cat. If he takes the dog, he can take any two of the remaining five pets (fish, turtle, rock, pony). There are 5 choose 2 = 10 ways for him to do this. If he takes the cat, he can take any two of the remaining five pets (fish, turtle, rock, pony, dog). There are 5 choose 2 = 10 ways for him to do this.

Therefore, the total number of different collections of pets your roommate can take is 10 + 10 = 20.

To learn more about permutation and combination, refer to the link:brainly.com/question/13387529

#SPJ4

Answer:

2 1/5

Step-by-step explanation:

The unit rate of the relationship between the amount of water pumped and time is the amount of water pumped in one minute for 14 hours.

To calculate unit price, you need to divide the first term (quantity) by the second term (unit). The resulting value is the unit price.

For example, if you want to calculate the unit price for a bag of 4 $3 apples, divide the total cost ($3) by the number of apples (4).

$3 / 4 apples = $0.75 / apple

In this example, the unit price is $0.75 per apple. So the price per apple is $0.75.

Given by the equation:

The unit rate of water pumped versus time is the amount of water pumped in one minute, so:

28/2=14

That means 14 gallons of water is being pumped every minute.

Now you can calculate the water pumped in 3/2 minutes like this

14*3/2=21

So in total, water pumped in 12 minutes plus 3/2 minutes gives water pumped in 15/2 minutes.

14*15/2=105

To learn more about unit rate visit:

brainly.com/question/29099525

#SPJ1

Answer:

159

Step-by-step explanation:

The angle below is a co-interior angle

This means that both angle should add up to 180

Have a lovely day :)

Answer:

Step-by-step explanation:

Because we know that the two lines going diagonal are equivalent, we also know that they are parallel because equivalent lines have the same slope, meaning they are parallel. We also know that the two interior angles should add to 180. Follow the steps in the image for the rest.

-Hope this helped

The perimeter of the triangle is 96, rounded to the nearest hundredth.

To calculate the perimeter of the triangle, we need to first calculate the length of the hypotenuse.

The hypotenuse of a right triangle is calculated using the Pythagorean theorem, which states that the square of the hypotenuse is equal to the sum of the squares of the two sides.

Therefore, for this triangle, we have:

(Hypotenuse)² = (24)² + (32)²

Therefore, the Hypotenuse = √(24² + 32²)

Hypotenuse = √(576 + 1024)

Hypotenuse = √1600

Hypotenuse = 40

To calculate the perimeter, we need to add up all three sides of the triangle.

the perimeter = 24 + 32 + 40

the perimeter = 96

Therefore, the perimeter of the triangle is 96, rounded to the nearest hundredth.

Learn more about  right triangle here:

https://brainly.com/question/29285631

#SPJ4

Answer:

5:4

Step-by-step explanation:

girls = 4

boys = 5

ratio = boys:girls = 5:4

HOPE THIS HELPED

Answer:

There are 4 quarts in a gallon, so 3 1/2 gallons is equal to 3.5 x 4 = 14 quarts.

Since the shop packages its ice-cream in 1-quart containers, the shop will need 14 containers to fulfill the order.

Step-by-step explanation:

Answer: [tex]303^{\circ}[/tex]

Step-by-step explanation:

The point [tex]P[/tex] lies in the fourth quadrant, so the angle is given by [tex]360^{\circ}-\alpha[/tex], where [tex]\alpha[/tex] is the reference angle.

The reference angle is given by [tex]\arctan \left(\frac{\frac{\sqrt{7}}{4}}{\frac{\sqrt{3}}{4}} \right)=\arctan \left(\sqrt{\frac{7}{3}} \right)[/tex].

This means [tex]\theta=360^{\circ}-\arctan \left(\sqrt{\frac{7}{3}}} \right) \approx 303^{\circ}[/tex].

The value of x in the simplest radical form is 3.

The trigonometric functions in mathematics are real functions that connect the right-angled triangle's angle to the ratios of its two side lengths. They are extensively employed in all fields of geometry-related study, including geodesy, solid mechanics, celestial mechanics, and many others.

Here, we have

Given: Let the triangle be ΔABC

The triangle ABC is a right-angled triangle and the angles inside the triangles are 45°, 45° and 90°

tan θ = x / 3

Now , θ = 45°

So, tan 45° = x / 3

The value of x is 3.

Hence, the value of x is 3.

To learn more about trigonometric relations visit:

brainly.com/question/1143565

#SPJ1

Answer:

13 times

Step-by-step explanation:

lol, I actually did this right now. I got 13 times for both coins being heads, 9 times for each coin being tales, and exactly 30 times both were uneven. I hope this helps :)

The slope intercept form of the equation is B) y=2x-6.

What is slope intercept form of the equation?

When the slope of the line being studied is known, and the provided point is also the y intercept, the slope intercept formula, y = mx + b, is utilised (0, b).   It provides both a slope and an intercept, which is why the form is known as the slope-intercept form.

Here According to the table using two points [tex](x_1,y_1) =(0,-6)[/tex] and [tex](x_2,y_2)=(3,0)[/tex] .

Now using slope formula m = [tex]\frac{y_2-y_1}{x_2-x_1}[/tex]

=> m = [tex]\frac{0-(-6)}{3-0}[/tex]

=> m = [tex]\frac{6}{3} = 2[/tex]

Now using equation formula then

=> [tex]y-y_1=m(x-x_1)[/tex]

=> y-(-6)=2(x-0)

=> y+6 = 2x

=> y = 2x-6

Hence the slope intercept form of the equation is B) y=2x-6.

To learn more about slope intercept form refer the below link

https://brainly.com/question/25262302

#SPJ1

In graph theory, a 2-factor is a subgraph of a given graph that includes every vertex of the original graph and has the property that every vertex has even degree (i.e. degree is a multiple of 2).

The term "2-factor" is used because it is a factor of the original graph that is made up of edges and every vertex has degree 2.

A 2-factor can also be defined as a set of cycles that cover all vertices of the graph. In other words, it is a collection of cycles such that every vertex belongs to exactly one cycle. A 2-factor can also be thought of as a cycle cover of a graph.

A graph that has a 2-factor is called a 2-factorizable graph. Not all graphs are 2-factorizable, for example a graph with an odd number of vertices can't have a 2-factor.

2-factors have many applications in various fields such as scheduling, coding theory, and computer science. They are also used to study the connectivity and robustness of graphs.

To know more on graph theory

https://brainly.com/question/29538026

#SPJ4

Answer: a. in the step by step explanation.  b. 20x - 15

Step-by-step explanation:

I think that Denise thought that the 5 only appplied to 4x since they were closer and since she multiplied them both, she thought there would be no use of it.

Example - 2 (3x+2)

                 2 x 3x = 6x

                 6x + 2

Of course this is wrong since the real answer should be 6x + 12 but someoneone like Denise may see it that way, only multiplying the ones closest and not opening it fully.

Answer:

53

Step-by-step explanation:

Answer:

[tex]\textsf{1)} \quad 10000(1.06)^t[/tex]

2)   €17,908.48

3)  0.5%

4)  120

[tex]\textsf{5)} \quad 10000(1.005)^{120}[/tex]

6)  €18,193.97

7)  More money.

Step-by-step explanation:

[tex]\boxed{\begin{minipage}{7 cm}\underline{Annual Compound Interest Formula}\\\\$ A=P\left(1+r\right)^{t}$\\\\where:\\\\ \phantom{ww}$\bullet$ $A =$ final amount \\ \phantom{ww}$\bullet$ $P =$ principal amount \\ \phantom{ww}$\bullet$ $r =$ interest rate (in decimal form) \\ \phantom{ww}$\bullet$ $t =$ time (in years) \\ \end{minipage}}[/tex]

Given:

Substitute the given values into the compound interest formula to write an expression that describes the given scenario over t years:

[tex]\implies A=10000(1+0.06)^t[/tex]

[tex]\implies A=10000(1.06)^t[/tex]

To calculate how much money will be in the fund after 10 years, substitute t = 10 into the equation from question 1:

[tex]\implies A=10000(1.06)^{10}[/tex]

[tex]\implies A=10000(1.79084769...)[/tex]

[tex]\implies A=17908.4769...[/tex]

Therefore, there will be €17,908.48 in the emergency fund after 10 years.

If the annual rate is 6%, the monthly interest rate is the annual rate divided by 12 (since there are 12 months in a year):

[tex]\implies \dfrac{6\%}{12}=0.5\%[/tex]

Given that are 10 years in the scenario, the exponent will be the number of months in 10 years:

[tex]\implies 10 \times 12 = 120[/tex]

0.5% = 0.005

Therefore, the complete expression that describes the scenario, given an annual interest rate of 6% that compounds monthly over 10 years is:

[tex]\implies 10000(1 + 0.005)^{120}[/tex]

[tex]\implies 10000(1.005)^{120}[/tex]

To calculate how much money will be in the emergency fund after 10 years if the interest compounds monthly, calculate the expression from question 5:

[tex]\implies 10000(1.005)^{120}[/tex]

[tex]\implies 10000(1.81939673...)[/tex]

[tex]\implies 18193.9673...[/tex]

Therefore, there will be €18,193.97 in the emergency fund after 10 years.

Amount in fund when compounded annually = €17,908.48

Amount in fund when compounded monthly = €18,193.97

Therefore, there is more money in the emergency fund when it is compounded monthly as the compounding frequency is greater (interest is earned on both the principal and the interest, so the more frequent the compounding periods are, the more interest is earned).

The general rule about compounding in exponential functions is the higher the number of compounding periods, the greater the amount of compound interest.  

In terms of compounding interest in investment:

The cost of pair of gloves is $8.5 and cost of hat is $6.5. The solution has been obtained by using linear equation.

What is a linear equation?

The equation with the biggest degree of one is one that is linear. The lack of variables in a linear equation with an exponent larger than one is demonstrated by this. A straight line is produced by such an equation on the graph.

Let the cost of pair of gloves be 'x' and cost of hat be 'y'.

We are given that Cody bought two pairs of gloves and four hats for $43.00.

This can be represented as 2x + 4y = $43.00

Tori bought two pairs of gloves and two hats for $30.00.

This can be represented as 2x + 2y = $30.00

On subtracting both the equations, we get

⇒ 2y = 13

⇒ y = 6.5

Substituting this value in the equation, we get

⇒2x + 2(6.5) = $30.00

⇒x + 6.5 = 15

⇒x = 8.5

Hence, the cost of pair of gloves is $8.5 and cost of hat is $6.5.

Learn more about linear equation from the given link

https://brainly.com/question/30092358

#SPJ1

Since, there are multiple questions, so the question answered above is attached below.

Three minutes equal 180 beats on the double number line. three minutes of 270 beats 2:180=90 , 3:270=90

In music, a beat is a pulse that occurs repeatedly. Simple meters are those in which the beat first breaks into two, and subsequently into four. There are two beat groups in double meters, three beat groups in triple meters, and four beat groups in quadruple meters.

For double, triple, and quadruple meters, there are several conducting patterns. One group of beats equals one measure (duple, triple, or quadruple). Bar lines divide the measures. Simple meters' time signatures specify two things: the beat unit, or note value that represents the beat, and the number of beats in each measure (the top number). Notes are graphically grouped by beat and connected by a beam.

To learn more about beats refer to :

https://brainly.com/question/888658

#SPJ1

It must be less effective than 100%. Any time you switch from one source of energy to another, especially if there is effort involved, there is a cost.

An enzyme is a protein that must retain its three-dimensional structure in order for it to function as a "lock and key." A little alteration to the enzyme structure might render it inoperative.

Denaturation of proteins is common. The protein's structure can change as a result of environmental factors including pH and temperature. An increase in temperature should hasten the process, but an excessive increase might harm the enzyme. Therefore, the situation in which there is no change to the enzyme structure would be the "ideal" one.

For such more question on efficiency.

https://brainly.com/question/15418098

#SPJ4

Note : The complete question could be as bellow,

A second set of measurements were taken, and the efficiency was found to be greater than 100%. What reasons most likely explain why the second set had a different efficiency? Select all that apply:

Used the reciprocal of the efficiency formula

Raised the resistance force in a shorter amount of time

Used the incorrect conversion factor from pounds to Newtons for force Incorrect values for the resistance distance

Inaccurate readings from force sensor for effort force

Increase efficiency from reduced friction

Answer:

they always go smallest to largest!

7.65 x 2= 3.21

Step-by-step explanation:

The solution to the simultaneous equation is x = -1/2 and y = √71 / 2

What is a Linear Expression?

A linear expression is an algebraic statement where each term is either a constant or a variable raised to the first power. In other words, none of the exponents can be greater than 1.

For example, t² is a variable raised to the second power, but t is a variable raised to the first power.

x² + y² = 18 ----- 1

x + 2 = - 3x ---- 2

From equation 2

x + 2 = - 3x

x + 3x = -2

4x = -2

x = -2/4

x = -1/2

Substitute x in equation 1

(-1/2)² + y² = 18

1/4 + y² = 18

y² = 18 - 1/4

y² = (72 - 1)/4

y² = 71/4

y = √71 / 2

Learn more about linear expressions here: https://brainly.com/question/2030026

#SPJ1

Answer:

The radius of the circle is 5.1, and the diameter of the circle is 10.2

Step-by-step explanation:

In the shown circle, the point from the center to the edge is 5.1, so that is the radius. Then, the diameter of a circle is twice its radius, so we have:

5.1 * 2 = 10.2

So the diameter of the circle is 10.2.

The radius of the circle is 5.1, and the diameter of the circle is 10.2.

Hope this helped!

If Sₙ denotes the sum of the reciprocals of the non-zero digits of the integers from 1 to 10ⁿ inclusive , then the smallest positive integer n for which Sₙ is an integer is 63 .

The "Sₙ" be the sum of reciprocals of the non-zero digits of the integers from 1 to 10ⁿ inclusive ;

We Let [tex]K= \sum_{i=1} ^{9} \frac{1}{i}[/tex] ,

On further examination , we get that , [tex]S_{1} =K+1[/tex] ;

Since each digit "n" appears once and the number 1 appears for an extra time.

Now , we write  S₂ .

So ,Each term of K will appear 10 times in the units place and 10 times in the tens place ,

So , we get [tex]S_{2} = (n10^{n-1})K+1[/tex] ; and there are total "n" places ;

The denominator of K is written as [tex]D=2^{3} .3^{2} .5.7[/tex] .

For Sₙ to be an integer, [tex]n10^{n-1}[/tex] must be divisible by D , we must select "n" to be divisible by [tex]3^{2} .7[/tex]   .

And since need to find the smallest integer "n" , So , the n is [tex]3^{2} .7 = 63[/tex] .

Therefore , For Sₙ to be an integer , the smallest positive integer n is 63 .

The given question is incomplete , the complete question is

Let Sₙ be the sum of the reciprocals of the non-zero digits of the integers from 1 to 10ⁿ inclusive. find the smallest positive integer n for which Sₙ is an integer .

Learn more about Sums here

https://brainly.com/question/10417065

#SPJ4

Answer:

148

Step-by-step explanation:

first plug in w(x) into u(x):

u(w(x)) = 5(-5(x)+4)+3

then plug in -5 for x:

u(w(-5)) = 5(-5(-5)+4)+3

solve:

= 148

This is a composite function:

Composite functions are are functions that are written within each other like f(g(x).

To solve this problem, first solve the function within u(x), which would be w(x)

w(-5) = -5(-5) -4

        = 25 - 4

       = 21

Now, plug in that value into u(x) to get your final answer:

u(21) = 5(21) +3

         = 105 +3

       = 108

Answer: u(w(-5) = 108

No, the conditions for inference have not been met. The two samples must be independent, meaning that the individuals in the college sample should not also be in the high school sample. Without independent samples, it is not possible to construct a 95% confidence interval for the true mean difference.

1. Collect data from the two samples of seniors in high school and college.

2. Calculate the mean difference in the number of hours of sleep for the two samples.

3. Calculate the standard deviation of the differences in hours of sleep for the two samples.

4. Calculate the standard error of the mean difference.

5. Calculate the critical value for a 95% confidence interval.

6. Calculate the lower and upper bounds of the confidence interval by

adding and subtracting the critical value from the mean difference.

7. Interpret the confidence interval to determine the true mean difference in the number of hours of sleep for seniors in high school and colleg

Learn more about confidence interval here

https://brainly.com/question/24131141

#SPJ4

The result of.tge evaluation of the given expression as required is; 11 / 4.

It follows from the task content that the value of the expression given be determined upon evaluation.

Since the given expression is; 5 - 3/2 to the second power

5 - (3/2)²

= 5 - 3²/2²

= 5 - 9/4

= 20 / 4 - 9 /4

On this note, the resulting expression is; ( 20 - 9 ) / 4 = 11/4.

Ultimately, the result of the expression evaluation as required to be determined is; 11 / 4.

Read more on evaluation of expressions;

https://brainly.com/question/3590570

#SPJ1

The exact value of cos  is cos([tex]\frac{\pi }{12}[/tex])  = ([tex]\sqrt{2}[/tex] + [tex]\sqrt{6}[/tex]) /4

given that

Trigonometry is a field of mathematics that examines correlations between triangle side lengths and angles (from the Ancient Greek words "trigonon" and "metron"). The field was created in the Hellenistic era in the third century BC as a result of the use of geometry in astronomical research. While Indian mathematicians produced the earliest tables of values for trigonometric ratios (also known as trigonometric functions), such as sine, the Greeks concentrated on chord calculation.

Trigonometry has been used historically in fields like geodesy, surveying, celestial mechanics, and navigation.

Trigonometry has a wide variety of identities. In order to simplify an expression, identify a more practical version of an expression, or solve an equation, trigonometric identities are frequently employed to rewrite trigonometrical expressions.

now , we need to find the value of cos

[tex]\pi[/tex]/12 can be written as [tex]\pi[/tex]/3 and [tex]\pi[/tex]/4

using cos(-) we need to find

cos(A - B) = cos(A)cos(B)+sin(A)sin(B)

cos([tex]\frac{\pi }{3}[/tex] - [tex]\frac{\pi }{4}[/tex]) = cos([tex]\frac{\pi }{3}[/tex])cos([tex]\frac{\pi }{4}[/tex]) + sin([tex]\frac{\pi }{3}[/tex])sin([tex]\frac{\pi }{4}[/tex])

cos([tex]\frac{\pi }{12}[/tex]) = (1/2)(1/[tex]\sqrt{2}[/tex]) +([tex]\sqrt{3}[/tex]/2)(1/[tex]\sqrt{2}[/tex])

          = (1/2)([tex]\sqrt{2}[/tex]/2) + ([tex]\sqrt{3}[/tex]/2)([tex]\sqrt{2}[/tex]/2)

          = ([tex]\sqrt{2}[/tex]/4) + ([tex]\sqrt{6}[/tex]/4)

cos([tex]\frac{\pi }{12}[/tex])  = ([tex]\sqrt{2}[/tex] + [tex]\sqrt{6}[/tex]) /4

To learn more about cos:

https://brainly.com/question/2193114

#SPJ4