Answer:
5880 ways
Step-by-step explanation:
For selections like this, we solve using the combination theory. Recall that
nCr = n!/(n-r)!r!
Hence given to find the number of ways 6 gentleman and 4 ladies can be choosen out of 10 gentleman and 8 ladies,
= 10C6 * 8C4
= 10!/(10-6)!6! * 8!/(8-6)!6!
= 10 * 9 * 8 * 7 * 6!/4 *3 *2 * 6! * 8 * 7 * 6!/2 * 6!
= 210 * 28
= 5880 ways
The arrangement can be done in 5880 ways
0.5 kilograms (kg) is equal to how many ounces? Round your answer to the
Answer:
17.637 ounces
Step-by-step explanation:
35.274 ounces is 1 kilogram so divide 35.274 by 2
Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.
Professor Iron always gives two exams in his communications class. He only uses the lower of the two scores that a student gets on the exams when he calculates the course grade. Put the grade on the first exam on the horizontal axis and the grade on the second exam on the vertical axis. What kind of preference a student should have for these two grades. Group of answer choices Perfect Complements Perfect Substitutes Cobb-Douglas Preference Neutral Preference
Answer:
Perfect complements
Step-by-step explanation:
Since minimum score of tests is to be considered. It is a case of perfect complements.
Correct option is
Perfect complements
Larissa is ordering nachos at a restaurant, and the server tells her that she can have up to four toppings: ground beef, black beans, refried beans, and sour cream. Since she cannot decide how many of the toppings she wants, she tells the server to surprise her. If the server randomly chooses which toppings to add, what is the probability that Larissa gets just refried beans and sour cream
Answer:
0.0625
Step-by-step explanation:
Given that :
Number of toppings = 4 (ground beef, black beans, refried beans, and sour cream)
The probability of choosing any particular topping at random from the four is :
Probability = required / total possible outcomes
Hence, P = 1 / 4 = 0.25
Hence, the probability of choosing : getting refried bean and sour cream :
P(refried bean) = 1/4
P(sour cream) = 1/4
P(refried bean and sour cream) = 1/4 * 1/4 = 1/16 =
0.0625
GIVING 25 POINTS AND BRAINIER IF ANSWERED!
What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.
Answer:
B. The question may not be directly stated.
Question 6 plz show ALL STEPS
Step-by-step explanation:
6a. Both the x and y coordinates are negative so this means isn't must be in the Third Quadrant.
6b. The measure of this using the unt circle is
[tex] \cos(x) - \frac{1}{2} [/tex]
[tex] \sin(x) = - \frac{ \sqrt{3} }{2} [/tex]
In the unit circle, this occurs about
an angle of 240 degrees. We can find coterminal angles within the interval of 2 pi to -2 pi. Just subtract 260 from theta.( which is 240)
[tex]240 - 360 = - 120[/tex]
So the angles in the interval is
240, -120.
6c. pi/2 is the same as 90 degrees so this means that
[tex](240 + 90) = 330[/tex]
In the unit circle, we know that at 330 degrees,
[tex] \cos(330) = \frac{ \sqrt{3} }{2} [/tex]
[tex] \sin(330) = \frac{1}{2} [/tex]
So the coordinates are
(sqr root of 3/2, 1/2).
6d. pi is the same as 180 degrees so this means that
[tex](240 - 180) = 60[/tex]
In the unit circle, we know that 60 degrees,
[tex] \cos(60) = \frac{1}{2} [/tex]
[tex] \sin(60) = \frac{ \sqrt{3} }{2} [/tex]
So the coordinates are
(1/2, sqr root of 3/2)
What is the slope of the line that passes through the points (10,8) and (-15,18)?
Write your answer in simplest form.
Answer:
I believe it is 2/5 fraction
Answer:
-2/5
Step-by-step explanation:
We can use the slope formula
m = ( y2-y1)/(x2-x1)
= ( 18-8)/(-15-10)
= 10/-25
= -2/5
Can someone please help me with part b ? It would be so appreciated you have no idea ;)
Answer:
absolutely yes, because pythagorean theorem is used in a right triangle
and when we match a line from the tee to the hole, we have a right triangle
Step-by-step explanation:
Help me! Thanks!!!!!!
Answer:
there are infinite solutions
Step-by-step explanation:
if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system
3/5x - 1/2x= 1, please help me to solve this
Answer:
x = - 10
Step-by-step explanation:
(6x -5x) / 10 = - 1
x = - 10
Which of the following is equal to -27?
Step-by-step explanation:
here's the answer to your question
Answer: Third Choice. 3i√3
Step-by-step explanation:
Concept:
Here, we need to know the idea of radical expression and an imaginary number.
A radical expression is any mathematical expression containing a radical symbol. If you need to multiply the number outside of radical back into the radical, then you need to square the number then multiply.
For example: 2√5. We need to first square 2, which gives us 4. Then, it becomes √(4 × 5) = √20Imaginary numbers are the numbers when squared it gives the negative result. An imaginary number is a complex number that can be written as a real number multiplied by the imaginary unit i, which is defined by its property i² = −1.
Solve:
3√3 = √(3 × 3²) = √27 FALSE
-3√(3i) = √(3i × (-3)²) = √27i FALSE
3i√3 = √(3 × (3i)²) = √-27 TRUE
3√(3i) = √(3i × 3²) = √27i FALSE
As we can see from above, only the third choice equals √-27.
Hope this helps!! :)
Please let me know if you have any questions
Please help, I'll give brainliest to the correct answer <3
A company recently purchased a new set of laser printers.
The value of the laser printers P, in dollars, t years after the purchase can be represented by the function P(t)=1,900(0.82)t.
Interpret the meaning of the function in the context of this situation.(1 point)
The initial value of the laser printers was $1,900, and the value increases by 82% each year.
The initial value of the laser printers was $1,558, and the value decreases by 82% each year.
The initial value of the laser printers was $1,558, and the value decreases by 18% each year.
The initial value of the laser printers was $1,900, and the value decreases by 18% each year.
Answer:
The initial value of the laser printers was $1,900, and the value decreases by 18% each year.
Step-by-step explanation:
Here ya go bestie <3
Help please ….. help
Answer:
Step-by-step explanation:
a) categorical
b) add all of the numbers and divide by how many numbers there were.
c) outliers means any that were far away from the rest of the data
d) not entirely, you can make an estimate based on it, but nat an exact answer.
HELP!!!!!!!!!!!!!!!!!!!
Calculate the future value of $2,500.00, earning interest at a rate of 2 1/2% that is compounded quarterly for 4 years.
A) $3,711.26
B) $2,563.09
C) $2,762.07
D) $5,910,086.00
Answer:
C) $2,762.07
you can use a compound interest calculator to find the answer
The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem
dN/dt = N(1 − 0.0008N), N(0) = 1.
Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?
Answer:
1250 supermarkets
Step-by-step explanation:
Given
[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]
[tex]N(0) = 1[/tex]
Required
Number of supermarkets over a long period of time
To do this, we simply set
[tex]\frac{dN}{dt} = 0[/tex]
So, we have:
[tex]N(1 - 0.0008N) = 0[/tex]
Split
[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]
Solve: [tex]1 - 0.0008N = 0[/tex]
Collect like terms
[tex]0.0008N = 1[/tex]
Make N the subject
[tex]N = \frac{1}{0.0008}[/tex]
[tex]N = 1250[/tex]
So:
[tex]\lim_{t \to \infty} N(t) = 1250[/tex]
A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.
Answer:
C
Step-by-step explanation:
the camdens drove 116 miles on 5 gallons of gas. at this rate, how many miles can they drive on 7 gallons of gas
Answer:
162.4 miles
Step-by-step explanation:
We can write a ratio to solve
116 miles x miles
----------------- = ------------
5 gallons 7 gallons
Using cross products
116*7 = 5x
Divide by 5
812 /5 = 5x/5
162.4 =x
162.4 miles
Find the x- and y-intercept of the line
X+4y=36
Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)
Answer:
The zeroes of the function are: 3 and 4
Step-by-step explanation:
The diameter of a regulation soccer ball is about 8 and three-fifths inches. This number was graphed on a number line.
A number line going from negative 9 to positive 9. Point A is between negative 9 and negative 8, point B is between negative 7 and negative 6, point C is between 6 and 7, point D is between 8 and 9.
Which point could be the point representing the graph of the diameter of the ball?
A
B
C
D
Answer:
D
Step-by-step explanation:
8 and 3/5 = 8.2 and 8.2 is between 8 and 9 so the answer is D.
You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.
Answer:
[tex]35.36,44.64[/tex]
Step-by-step explanation:
Sample size [tex]n=40[/tex]
Mean weight [tex]\=x =67[/tex]
Standard deviation [tex]\sigma=11.4[/tex]
Confidence Interval [tex]CI=0.99[/tex]
\alpha==0.01
Therefore
[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]
From table
[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]
Generally, the equation for Margin of error is mathematically given by
[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]
[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]
[tex]M.E=4.64[/tex]
Therefore Estimated mean is
[tex]\=x-M.E<\mu <\=x +E[/tex]
[tex]40-4.64<\mu< 40+4.64[/tex]
[tex]35.36<\mu < 44.64[/tex]
[tex]35.36,44.64[/tex]
ou invested 7000 between two accounts paying 4% and 9% annual interest, respectively. If the total interest earned for the year was $430 how much was invested at each rate? $ nothing was invested at and $ nothing was invested at
9514 1404 393
Answer:
$3000 at 9%$4000 at 4%Step-by-step explanation:
Let x represent the amount invested at 9%. Then 7000-x was invested at 4% and the interest earned was ...
9%·x +4%(7000-x) = 430
5%·x +280 = 430 . . . . . . . . . simplify
0.05x = 150 . . . . . . . . . . . subtract 280
x = 3000 . . . . . . . . . . divide by 0.05
$3000 was invested at 9%; $4000 was invested at 4%.
sin(180+0).cos(180+0)/cos(180+0).sin(180-0)
What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?
Answer:
17 units
Step-by-step explanation:
Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]
Plug in the points and simplify:
[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]
[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]
[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]
[tex]d = \sqrt{225 + 64[/tex]
[tex]d = \sqrt{289[/tex]
[tex]d = 17[/tex]
So, the distance between the points is 17 units
18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?
•
acute
•
obtuse
•
equiangular
•
right
Answer:
obtuse
aniuhafjhnfajfnha
What is the amswerdkdmxmmdmdmdm
Answer:
HUH?
Step-by-step explanation:
Can someone please help me thanks in advance!
Step-by-step explanation:
Bro your question is quiet blur... Please help me out..
hope it Wonderful.
^_^....!_!_
Find the measure of the incanted angle to the nearest degree
Answer:
34⁰
Step-by-step explanation:
let unknown angle be x
cos x=19/23
cos x=0.826
x=cos inverse of 0.826
x=34.3⁰
rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible
= 2025
When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)
For this, you divide the given lengths using the numbers that divides all through.
I have added an image to this answer. Go through it for more explanation
A product is introduced into the market. Suppose a product's sales quantity per month q ( t ) is a function of time t in months is given by q ( t ) = 1000 t − 150 t 2 And suppose the price in dollars of that product, p ( t ) , is also a function of time t in months and is given by p ( t ) = 150 − t 2 A. Find, R ' ( t ) , the rate of change of revenue as a function of time t
Answer:
[tex]r'(t) = 298t -850[/tex]
Step-by-step explanation:
Given
[tex]q(t) = 1000t - 150t^2[/tex]
[tex]p(t) = 150t - t^2[/tex]
Required
[tex]r'(t)[/tex]
First, we calculate the revenue
[tex]r(t) = p(t) - q(t)[/tex]
So, we have:
[tex]r(t) = 150t - t^2 - (1000t - 150t^2)[/tex]
Open bracket
[tex]r(t) = 150t - t^2 - 1000t + 150t^2[/tex]
Collect like terms
[tex]r(t) = 150t^2 - t^2 + 150t - 1000t[/tex]
[tex]r(t) = 149t^2 -850t[/tex]
Differentiate to get the revenue change with time
[tex]r'(t) = 2 * 149t -850[/tex]
[tex]r'(t) = 298t -850[/tex]
