please help me! A business owner invested $7,000 in a treasury bond paying 4.3% compounded semiannually. After 30 years, the value of the bond will be $25,084.20. If the business owner's investment was compounded continuously instead of twice per year, what would be the difference in the account balance after 30 years? $345.31 $318.22 $286.74 $228.59

Answers

Answer 1

Using compounding we know that after 30 years, the account balance has changed by $345.31.

What is continually compounded?

Theoretically, continually compounded interest indicates that interest is continuously earned on an account balance as well as reinvested into the balance so that additional interest is generated.

So, a business owner put $7,000 into a Treasury bond paying a semiannual compound interest rate of 4.3%.

The bond's value after 30 years is $25,084.20.

Instead of compounding twice a year, the investment made by the business owner was made continuously.

After 30 years, we must determine the difference in the account balance.

Think of the continuously compounding recipe:

A = Pe∧rt

We have, p = 7000.

r = 4.3% = 0.043

t = 30

Then,

A = 7000e∧(0.043*30) = 25429..51

A = $25429.51

Therefore, using compounding we know that after 30 years, the account balance has changed by $345.31.

Know more about compounded continuously here:

brainly.com/question/14303868

#SPJ1

Correct question:

A business owner invested $7,000 in a treasury bond paying 4.3% compounded semiannually. After 30 years, the value of the bond will be $25,084.20. If the business owner's investment was compounded continuously instead of twice per year, what would be the difference in the account balance after 30 years?


Related Questions

2[73-(4x5)]
I think the answer is 106 but can someone double check? Thanks

Answers

Answer:

yes its 106

Step-by-step explanation:

brainly removed my answer

During a sale, a store offered a 35% discount on a tablet computer that originally sold for $340. After the sale, the discounted price of the tablet computer was marked up by 35%. What was the price of the tablet computer after the markup? Round to the nearest cent.

Answers

The marked-up price of the discounted tablet computer is $298.35.

What is the percentage?

A percentage is a value per hundredth. Percentages can be converted into decimals and fractions by dividing the percentage value by a hundred.

Given, During a sale, a store offered a 35% discount.

So, The discounted price of the computer tablet is,

= [(100 - 35)/100]×340.

= (65/100)×340.

= $221.

Now, The price is marked up by 35% which is,

= [(100 = 35)/100]×221.

= (135/100)×221.

= $298.35.

Learn more about percentages here :

https://brainly.com/question/24159063

#SPJ9

In physics lab, you measure three quantities: x, y, and z. Suppose that x=2.5 kg, y=0.8 m, and z=4.9 kg/m. Which of the mathematical combinations might be meaningful?(x/y) - z(x/z) - yx+y+z(xz) + yxyzx - (y/z)xy/z(x-y)/z

Answers

meaningful: (x/y) - z, xyz, (x/z) - y, xy/z
not meaningful: x+y+z, x - (y/z), (x-y)/z, (xz) + y

In physics lab, when you measure three quantities of x, y, and z, you can use these mathematical combinations to find meaningful relationships between these quantities:  

(x/y) - z(x/z) - yx - (yz)

In this case, x=2.5 kg, y=0.8 m, and z=4.9 kg/m.

Based on the given quantities' scale, we know that x, y, and z have a relationship where:

z = x/y

Then, the mathematical combinations that might be meaningful are:

- (x/y) - z: This combination gives you the difference between the ratio of x and y, and z. This could be meaningful if you are trying to find the difference between two quantities that have different units.

- (x/z) - y: This combination gives you the difference between the ratio of x and z, and y. This could be meaningful if you are trying to find the difference between two quantities that have different units.

- x - (yz): This combination gives you the difference between the ratio of x and z, and y. This could be meaningful if you are trying to find the difference between two quantities that have different units.

Learn more about Mathematical Combinations here: brainly.com/question/23327429

#SPJ11

The graph of f(x) = ce^x crosses the y -axis at (0, c) where c is some constant: Where does the graph of g (x) = f(x)- d cross the y -axis? The graph of g (x) = f(x) -d crosses the Y ~axis

Answers

The graph of g(x)=f(x)-d crosses the y-axis at (0,c-d).

What does y-intercept mean?

The point on a line where it crosses the y-axis is known as the y-intercept. To put it another way, it is the value of y when x is equal to 0.

It is given that graph  [tex]f(x)=ce^{x}[/tex] crosses the y-axis at (0,c).

Because at x=0,

[tex]f(0)=ce^{0}\\f(0)=c[/tex].

So, if g(x)=f(x)-d

[tex]g(x)=ce^{x}-d[/tex]

when x=0:

[tex]g(0)=ce^{0}-d\\g(0)=c-d[/tex]

So the graph of g(x)=f(x)-c touches the y-axis at (0,c-d).

To learn more about exponential graphs, refer to the link below:

https://brainly.com/question/2456547

#SPJ1

PROBLEM SOLVING
Question 8
Three sets of traffic lights (A, B and C) all turn red at 9 a.m. exactly. Light set A turns red every 2 minutes, light
set B turns red every 3 minutes and light set C turns red every 5 minutes. How long does it take for all three
lights to turn red again at the same time?

Answers

answer:
2*3*5=30 minutes

PLEASE HELP DUE TOMORROW:
Instructions: Fill in each matching colored box with same solution that makes each equation true. For example, if one red box was 3 then all the other red boxes must be 3. (JUST AN EXAMPLE)

Answers

Answer:

red=7

pink=4

purple=15

dark pink=22

gray=18

there are 14 people in an office with 5 different phone lines. if all the lines begin to ring at once, how many groups of 5 people can answer these lines?

Answers

There are 2002 groups of 5 people that can answer the 5 phone lines.

This is a combination problem, because we want to choose groups of 5 people from a group of 14, and the order in which we choose the people does not matter.

The formula for the number of combinations of n objects taken r at a time is:

C(n,r) = n! / (r! * (n-r)!)

In this case, we want to choose 5 people out of a group of 14, so we can plug those values into the formula:

C(14,5) = 14! / (5! * (14-5)!)

Simplifying the factorial terms:

C(14,5) = (1413121110) / (54321)

C(14,5) = 2002

Therefore, there are 2002 groups of 5 people that can answer the 5 phone lines.

To learn more about combinations:

https://brainly.com/question/14305145

#SPJ4

Why would you want to transform a set of raw scores into a set of z-scores? Check all that apply. a. To make a distribution with a mean of 1 and a standard deviation of 0 b. To be able to describe the location of a raw score in the distribution of raw scores c. To make all the transformed scores greater than 0 d. To make it possible to compare scores from two different distributions

Answers

For a z-score, We  transform a set of raw scores into a set of z-scores because we can compare scores from two different distributions i.e. D.

What exactly is the z-score?

The z-score is a statistical measurement that describes a value's relationship to the mean of a collection of values. The z-score formula is

z = (x - μ)/σ

x = data point

μ = mean

σ = standard deviation

Mean:- The sum of a collection of numbers divided by the total number of numbers in the set is known as the arithmetic mean, sometimes known as the arithmetic average or simply the mean or average. A survey, experiment, or observational research is usually used to create the collection.

Now,

As Z-scores are standardized scores that identify and define each score's exact placement within a distribution. We may conduct meaningful comparisons of z-scores across various samples or groups by converting our data (raw score).

hence,

          We transform a set of raw scores into a set of z-scores because we can compare scores from two different distributions.

To know more about z-score visit the link

https://brainly.com/question/15016913?referrer=searchResults

#SPJ1

If 30% of a number is 42 and 70% of the same number is 98, find 40% of that number.

Answers

Answer:

56 is 40% of the original number

Step-by-step explanation:

Let [tex]n[/tex] represent the original number

We are given that  

30% of number is 42

70% of the same number is 98

Lets convert the precents to decimals

30% as a decimal is [tex]0.3[/tex]

70% as a decimal is [tex]0.7[/tex]

We can create an equation for each scenario

[tex]0.3n=42\\0.7n=98[/tex]

We can choose either one to evaluate [tex]n[/tex].

[tex]0.3n=42[/tex]

Lets solve for [tex]n[/tex].

Divide both sides by [tex]0.3[/tex].

[tex]n=\frac{42}{0.3}[/tex]

Evaluate [tex]\frac{42}{0.3}[/tex].

[tex]n=140[/tex]

Now that we know what the original number is we can calculate what 40% of the number is.

40% as a decimal is [tex]0.4[/tex].

[tex]140*0.4=56[/tex]

Factorise 3y²+12y ‼️‼️‼️

Answers

Answer:

3y(y + 4)

Explanation:

[tex]3y^{2} + 12y\\3(y^{2} + 4y)\\3y(y + 4)\\[/tex]

A plumbing company charges $50 for a house visit plus $35 per hour for the labor. Write an equation in slope-intercept form that models the situation

Answers

The equation in slope-intercept form that models the plumbing company situation is y = 35x + 50, where x is the number of hours of labor and y is the total cost.

Convert 2000 feet per minute to miles per hour. Round to the nearest tenth.
A. 17600 miles per hour
B. 22.7 miles per hour
C. 154.8 miles per hour
D. 1363.6 miles per hour

Answers

Answer:

Step-by-step explanation:

You are currently converting speed units from foot per minute to miles per hour 1 ft/min = 0.011363636 mph foot per minute ft

so 0.011363636 times 2000 equals 27.727272

so your answer is [B]

Jerald is having drain issues at his home and decides to call a plumber. The plumber charges $45 to come to his house and $50 for every hour they work. If the plumber charges Jerald a total of $250, how many hours did the plumber work?

Answers

The equation to the context is 50x + 45 = 250 and the plumber worked for 4.1 hours.

What is an equation?

An equation is written in the form of variables and constants separated by the operation of multiplication and division,

An equation states that terms in different forms on both sides of the equality sign are equal.

Multiplication and division do not separate the terms of an equation.

Let, 'x' represents the number of hours worked by the plumber.

Therefore, The equation can be represented as,

50x + 45 = 250.

50x = 205.

5x = 20.5.

x = 20.5/5.

x = 4.1 hours.

learn more about equations here :

https://brainly.com/question/10413253

#SPJ9

The data in the table was produced by a researcher studying the
number of vegetables people ate for one week. Group A and Group B,
each with 20 people, recorded the vegetables that they ate. If a person
is chosen at random from those who ate at least 7 vegetables, what is
the probability that the person belonged to Group A?

Answers

The probability that the person belonged to Group A is given as follows:

Probability = number of people in Group A that ate at least 7 vegetables / total number of people that ate at least 7 vegetables.

How to calculate a probability?

A probability is calculated as the division of the desired number of outcomes by the total number of outcomes.

The outcomes for this problem are given as follows:

Desired: People that ate at least 7 vegetables and belong to group A.Total: People that ate at least 7 vegetables.

More can be learned about probability at https://brainly.com/question/24756209

#SPJ1

A plane is flying at a speed of 175 miles per hour.
The pilot plans on flying at this speed for the next
250 miles, plus or minus 25 miles. Find
the minimum and maximum number of hours th
plane will travel at that speed.

Answers

The maximum number of hours is 1.6 hours and the minimum  number of hours is 1.6 hours.

What is the speed?

The speed formula can be defined as the rate at which an object covers some distance. Speed can be measured as the distance travelled by a body in a given period of time. The SI unit of speed is m/s.

Given that, a plane is flying at a speed of 175 miles per hour.

The distance covered by the pilot, d = 250 ± 25 miles

We know that, speed = Distance/Time

The equation for the maximum number of hours is given as;

175 =(250+25)/t

t=275/175

t=1.6 hours

The equation for the minimum number of hours is given as;

175 =(250-25)/t

175=225/t

t=225/175

t=1.3 hours

Therefore, the maximum number of hours is 1.6 hours and the minimum  number of hours is 1.6 hours.

To learn more about the speed, distance, and time visit:

brainly.com/question/4978052.

#SPJ9

help i dont understand this fully

Answers

The value is 81 and it’s 19 more than j therefore you would need to add 19 to j to get 81. So the answer is the 2&4 box
Hope that helped

answer and explain for 10 points.

Answers

Answer:

The answer is 6 with a remainder of 2.

Step-by-step explanation:

3 times 6 is 18.

Then if you subtract 18 from 20 you get 2.

So 3 goes into twenty, 6 times, and you get a remainder of 2.

Regis leans a 10-foot ladder against a wall. The base of the ladder makes a 65 angle with the ground.
A: What is the distance, In feet, from the base of the ladder to the base of the wall? Round to the nearest tenth of a foot.
B: Regis needs to move the ladder so that it reaches a window 9.6 feet above the ground.
How many feet closer to the building does he need to move the base of the ladder?

Answers

The distance from the base of the ladder to the wall is 4.23 feet. And the inclination angle will be 73.74°.

What is trigonometry?

Trigonometric functions examine the interaction between the dimensions and angles of a triangular form.

The length of the ladder is 10 feet. And the inclination angle is 65°. Then the distance from the bottom of ladder to the wall is given as,

cos 65° = x / 10

x = 4.23 feet

If the ladder reaches a window 9.6 feet above the ground, then the angle is given as,

sin θ = 9.6 / 10

sin θ = sin 73.74°

     θ = 73.74°

The distance from the base of the ladder to the wall is 4.23 feet. And the inclination angle will be 73.74°.

More about the trigonometry link is given below.

https://brainly.com/question/22698523

#SPJ9

Consider Juan Soto's wins above replacement statistics for the four seasons in the table. In which season did he have the greatest value to his team?

Answers

Answer: 2021

Step-by-step explanation:

2
The area of a rectangular window is 3726 cm².
If the length of the window is 69 cm, what is its width?
Width of the window: cm

Answers

3726\69 = 54 so therefore the width is 54cm

-112-11 > -6+13a
Answer: x>

Answers

Answer:

a < -9

Step-by-step explanation:

-112-11 > -6+13a

-123 > -6 + 13a

-117 > 13a

-117 / 13 > a

-9 > a

a < -9

If all of the diagonals are drawn from a vertex of an n-gon, how many triangles are formed?A) n - 2B) n - 1C) nD) n + 1

Answers

The correct answer to the given question about all of the diagonals drawn from a vertex of an n-gon is option b) n-1

If all of the diagonals are drawn from a vertex of an n-gon, the number of triangles formed is equal to the number of non-diagonal sides of the n-gon. To see why, imagine selecting a vertex of the n-gon and drawing all of the diagonals from that vertex. Each diagonal connects that vertex to a non-adjacent vertex of the n-gon, which splits the n-gon into a series of triangles. The total number of triangles formed is equal to the number of non-diagonal sides of the n-gon, because each non-diagonal side forms one triangle with the selected vertex and one of its adjacent vertices. An n-gon has n sides, so the number of non-diagonal sides is equal to n - 3. This is because each vertex is connected to two adjacent vertices, so there are n - 2 diagonal sides emanating from the selected vertex, and the remaining n - 2 sides are non-diagonal. In addition, there are three sides at the selected vertex that are not counted as non-diagonal sides, so we subtract 3 from n - 2 to get n - 3. Therefore, the answer is (B) n - 1.

To learn more about diagonals click here

brainly.com/question/12274248

#SPJ4

9
?
Encuentra la longitud de arco del semicirculo.

Answers

Para encontrar la longitud de arco de un semicírculo, primero debes encontrar el radio del semicírculo, que es la mitad del diámetro. Después, usa la fórmula para la longitud de arco: Longitud de arco = π x radio x ángulo / 180. Por lo tanto, si el radio del semicírculo es r y el ángulo es θ, la longitud de arco del semicírculo es πrθ/180.

HELP ME PLEASEEEE
Round each fraction to help you estimate the solution for the following equation
nine-tenths minus four-tenths equals.

Options
1. 0
2. 1/2
3. 1
4. 1 1/2

Answers


Your question: around each fraction to help you estimate the solution for the following equation ( nine-tenths minus four-tenths equals.

Answer:

2. 1/2

On a coordinate plane, how are the locations of the points (2 , -1) and (2 , 1) related?

Answers

On a coordinate plane, locations of the points (2 , -1) and (2 , 1) related by reflection across the x-axis.

It is given that the locations of the two points are (2 , -1) and (2 , 1).

We have to find the relation between two points.

From the given points (2 , -1) and (2 , 1), it is clear that the y-coordinates are same but the sign of x-coordinates are opposite.

If a figure is reflected across the y-axis, then we change the sign of y-coordinate and the x-coordinates remain same,

So, it is reflection across the x-axis.

To know more about axis

https://brainly.com/question/12632774

#SPJ4

A map of a highway has a scale of 2 inches = 33 miles. The length of the highway on the map is 6 inches. There are 11 rest stops equally spaced on the highway, including one at each end. You are making a new map with a scale of 1 inch = 30 miles. How far apart are the rest stops on the new map?

Answers

Thus, the required rest stops are approximately 4.09 miles apart on the new map.

What is the scale factor?

The scale factor is defined as the ratio of the modified change in length to the original length.

Here,
The total length of the highway in miles can be found by using the scale of the original map. Since 2 inches on the map represent 33 miles in reality, 6 inches on the map represent:

= 6 inches × (33 miles/2 inches) = 99 miles

Since there are 11 equally spaced rest stops along the highway,

= (99 miles)/(11 intervals) = 9 miles per interval

To create the new map with a scale of 1 inch = 30 miles, we need to use a scale factor of (1/2) × (30/33) = 15/33.

Therefore, the distance between each rest stop on the new map can be found by multiplying the distance between rest stops on the old map by the scale factor,

= (9 miles per interval) × (15/33) = 4.09 miles per interval

So, the required rest stops are approximately 4.09 miles apart on the new map.

Learn more about Scale factors here:

https://brainly.com/question/23434258
#SPJ9

Find the volume of a rectangular prism with the following dimensions: V = lwh Length:
4m Width
: 0.3 m Height
: 1.5 m​

Answers

Answer:

  1.8 m³

Step-by-step explanation:

You want the volume of the rectangular prism with dimensions L=4 m, W = 0.3m, H = 1.5 m.

Volume

The volume formula is given in the problem statement:

  V = LWH

Substituting the given values of L, W, H, we find the volume to be ...

  V = (4 m)(0.3 m)(1.5 m)

  V = 1.8 m³

The volume of the rectangular prism is 1.8 cubic meters.

Susan bought 2/5 as many boxes of butter cookies as chocolate cookies. She spent $156 altogether. Each box of butter cookies cost $2 less than each box of chocolate cookies. The total cost of the chocolate cookies was $84 more than the total cost of the butter cookies. How many boxes of cookies did Susan buy?

Answers

Susan bought 6 boxes of chocolate cookies, and 2/5(6) = 2.4 or 2 boxes of butter cookies.

How to find number of boxes of cookies did Susan buy?

Let's call the number of boxes of chocolate cookies that Susan bought "C". Then, she bought 2/5 as many boxes of butter cookies, which is 2/5C.

Let's call the cost of each box of chocolate cookies "x". Then, the cost of each box of butter cookies is x-2, since each box of butter cookies costs $2 less.

We know that the total cost of the chocolate cookies was $84 more than the total cost of the butter cookies. This can be expressed as:

Cx = 2C/5(x-2) + 84

Simplifying this equation, we get:

3/5Cx = 84 + 2/5C(2)

Multiplying both sides by 5/3, we get:

Cx = 140 + 4C/3

We also know that the total cost of all the cookies was $156, which can be expressed as:

Cx(x) + (2/5C)(x-2) = 156

Substituting Cx from the previous equation, we get:

(140 + 4/3C)(C) + (2/5C)(C-2) = 156

Simplifying and solving for C, we get:

C = 6

So Susan bought 6 boxes of chocolate cookies, and 2/5(6) = 2.4 or 2 boxes of butter cookies.

To know more about Dollar visit:

brainly.com/question/29846475

#SPJ1

The quadrilateral is a trapezoid. What is the value of x?A)48B)4C)25D)5

Answers

The quadrilateral is a trapezoid, the value of  x is  5  in given trapezoid.

An isosceles trapezoid can be defined as a trapezoid whose non-parallel sides and base angles have the same measure. That is, if the two opposite sides (bases) of a trapezoid are parallel and the two non-parallel sides are of equal length, it is an isosceles trapezoid. See the diagram below. It indicates that sides c and d are of equal length and opposite sides a and b (the base of the trapezoid) are parallel to each other.

The given trapezoid is An isosceles trapezoid .

From the given diagram, the expression below is true:

2(5x - 1) = 21 + 27

(21+27)/2 = 5x -1

24 = 5x-1

x=5

To know more about isosceles trapezoid  click here;

https://brainly.com/question/21192911

#SPJ4

The given question is incomplete, the complete question is:

The quadrilateral is a trapezoid. What is the value of x?

A)48

B)4

C)25

D)5

and the Question image is attached in image section.

Solve pls! Lots of points! Question down below!

Answers

Answer:1024 grid squares

Step-by-step explanation:

Let's call the side length of the original piece of graph paper "x".

Since, side length of the cut out square is then (x-2) because the cut out square has to have an integer number of grid squares, and each side of the square would take up 2 grid squares on the graph paper.

The number of grid squares in the cut out square is then (x-2)^2.

The number of grid squares left on the graph paper is 124, so we have:

x^2 - (x-2)^2 = 124

Expanding the right side:

x^2 - x^2 + 4x - 4 = 124

Simplifying:

4x = 128

therefore:

x = 32

therefore original graph paper contains 32 grids i.e 32^2 = 1024

Answer:

  any of {128, 133, 140, 160, 224, 320, 380, 700, 1024}

  1024 if the original grid was square

Step-by-step explanation:

You want to know how many grid squares are on a piece of graph paper if a square number of grid squares can be cut from it to leave 124 grid squares.

Square graph

If the graph is square to begin with, a square of x² can be removed from its size (x+a)² to leave 124 squares. That is ...

  (x +a)² -x² = 124

  (a)(2x+a) = 124

The factor pairs of 124 are ...

  124 = 1·124 = 2·62 = 4·31

Of these, only 2 and 62 differ by an even number, so we have a=2 and x=30.

The graph paper could be 32 units square originally, having 1024 grid squares.

Rectangular graph

There is nothing in the problem statement that requires the original graph paper be square. If it is not necessarily square, there are 13 possible shapes it could be. Those have 9 different possibilities for numbers of grid squares.

The graph paper could have originally had this number of grid squares:

128 = 4×32 = 8×16. The square removed is 2².133 = 7×19. The square removed is 3².140 = 5×28 = 7×20 = 10×14. The square removed is 4².160 = 8×20 = 10×16. The square removed is 6².224 = 14×16. The square removed is 10².320 = 16×20. The square removed is 14².380 = 19×20. The square removed is 16².700 = 25×28. The square removed is 24².1024 = 32×32. The square removed is 30². . . . . discussed above

__

Additional comment

You may notice that removing a 24×24 square from a graph that is 25×28 leaves no border on one side.

These values were found using a search script.

<95141404393>

Other Questions
The coefficient of x in the expansion of (2-x)(3 + bx) is 45. Find possible values of theconstant b. compared to 20-year-olds, 35-year-olds are less likely to: a. require a warm-up period before exercise. b. perform any job requiring manual labor. c. engage in energy-demanding sports. d. bounce back quickly after a physiologically stressful activity. A large tank hold 1. 9 time 10 to the 7th power gallons of oil. How much oil can be stored in 9 tanks. Scientific notation something is wrong with your executive assistant. they have been late to work 12 times in the last month. they have been forgetting to spell check outgoing documents. additionally, they seem depressed. you need to find out what is bothering them before their poor work performance puts their job in jeopardy. you should use . what is the system that consists of the skin and its accessory organs PLS HELP FAST ONLY TEN MIN LIFT WILL GIVE BRIANLIEST IF RIGHTLOTS OF POINTS why are changes in inventories included as part of investment spending? Who is the president signed the emancipation proclamation? 2. A young kid is playing catch with himself by throwing a ball straight up. How fast does he throw it ifthe ball comes back to his hands a second later? What was the maximum height of the ball? Ignore airresistance. on a certain sight-seeing tour, the ratio of the number of women to the number of children was 5 to 2. what was the number of men on the sight-seeing tour? The greater the blank of a moving object, the blank it has two examples of characters 1. There are 3 main types of chemical formulas: empirical, molecular and structural.Structural formulas identify the location of chemical bonds between the atoms of amolecule. Consider the following molecular structure below:(a) Redraw the structure in the form of expanded and condensed structures.(b) Classify the carbons labelled a and b as primary, secondary or tertiary.[4 marks] Which example is most clearly a form of media?(a) A diagram of the first rocket launched into space(b) An argument about commercial space travel(c) A gesture to draw the audience's attention to an image (d) A reference to scientists who improved space travel if something costs 9.95 how much you give them and how much is your change? why did banks believe that mortgage-backed securities protected them from defaults Ismail tried to prove that sin()=cos(90)sin()=cos(90)sine, left parenthesis, theta, right parenthesis, equals, cosine, left parenthesis, 90, degree, minus, theta, right parenthesis using the following diagram. His proof is not correct. Solve the equation.7x2 + 5 - x = 6x2 + 10 Which choice best describes EBradiusdiameterLine FPoint based on the information from the periodic table, which mistake did darrell make on his diagram? a nitrogen should have six electrons instead of seven. b nitrogen should have eight protons instead of six. c nitrogen should have seven protons instead of six. d nitrogen should have eight electrons instead of seven.