QUICK! I need help with this question. ​

Answers are

360°
270°
180°
90°

QUICK! I Need Help With This Question. Answers Are36027018090

Answers

Answer 1
im assuming that means they're rotating it so that it's in the same position, which would mean that it rotated 360 degrees.

Related Questions

pls help will mark brainliest

A jar contains 4 white chips, 5 purple chips, and 1 black chip. Chips are selected randomly one at a time, and are not replaced.
P(3 whites)

A: 6/43
B: 2/39
C: 5/41
D: 1/36

Answers

Answer:1/30 is the correct answer

Step-by-step explanation:

first, calculate the total number of chips: 4+5+1=10

since we know that chips are not replaced.

probability of finding the first white chip: 4/10 (4 white chips,10 total)

after removing 1 white chip remaining white chips=3, total chips=9

probability of finding the second white chip:3/9 (3 white chips,9 total)

after removing 1 white chip remaining white chips=2, total chips=8

probability of finding the third white chip 2/8 (2 white chips,8 total)

after removing 1 white chip remaining white chips=1, total chips=7

Now the probability of finding 3 white chips is:

probability=(4/10) * (3/9) * (2/8)=1/30

true or false? a percentage can be converted to a decimal number by multiplying the percentage by 100, then using that result in a calculation​

Answers

Answer:

False

Step-by-step explanation:

False.  That is how a decimal is converted to a percent.  

A percent is converted to a decimal by  taking the percent and dividing by 100%

For example:

56% is converted to a decimal by dividing by 100%

56%/100%  The percents cancel out and when you divide by 100, you move the decimal two places to the left.  .65

Cari is searching online for airline tickets. Two weeks ago, the cost to fly from Hartford to Orlando was $220. Now the cost is $305. What is the percent increase? What would be the percent increase if the airline charges an additional $50 baggage fee with the new ticket price?

Answers

Considering the context of the question and the percentage analysis, it is concluded that a 38.64% charge has been hiked in the price of the ticket and if the extra $50 is charged for the baggage fee the hike is 61.36%.

White at is the Percentage?

A percentage is a number or ratio indicated as a fraction of 100. To get the percentage of any number, such number will be divided by the number of the whole and multiplied by 100. Hence, the percentage means, a part per hundred

In this case, Cari is searching online for airline tickets. Two weeks ago, the cost to fly from Hartford to Orlando was $220. Now the cost is $305

Hike in price = 305 - 220 = 85

Hike % = 85/220 * 100% = 38.64%

When the extra charge is $50 for extra baggage, the total price = is $355

Hike in price = 355 - 220 = 135

Hike % = 135/220 *100% = 61.36%

Hence, in this case, it is concluded that a 38.64% charge has been hiked in the price of the ticket and if the extra $50 is charged for the baggage fee the hike is 61.36%

Learn more about Percentage here: https://brainly.com/question/13714226

#SPJ1

If 7 more than twice a number is 5 less than three times the same number, what is the number?

Answers

Using the given information, the value of the number is 12

Determining the value of a number

From the question, we are to determine the value of the number.

From the given information, we have that
"7 more than twice a number is 5 less than three times the same number"

Let the number be x

7 more than twice a number means

2x + 7

5 less than three times the number is

3x - 5

Thus,

The equation becomes

2x + 7 = 3x - 5

Now, solve for x

2x + 7 = 3x - 5

7 + 5 = 3x - 2x

12 = x

x = 12

Hence, the value of the number is 12

Learn more on Determining a number here: https://brainly.com/question/26668947

#SPJ1

Write and simplify an expression for the perimeter of the figure. Will give the answer a good rating.

Answers

The perimeter of the figure, is represented by the expression, 14x + 16.

What is the Perimeter of a Figure?

The perimeter of a figure is the total length of the outer boundaries of the figure. It is the sum of all the sides of the figure.

The perimeter is used to determine the size of a figure and can be calculated by adding the lengths of all the sides together.

Therefore:

Perimeter of the figure = 4(2x - 1) + 2(3x + 10)

To simplify the expression 4(2x - 1) + 2(3x + 10), we can distribute the constants (4 and 2) to the expressions inside the parentheses.

First, we'll simplify 4(2x - 1) using the distributive property:

4(2x - 1) = 4(2x) + 4(-1) = 8x - 4

Next, we'll simplify 2(3x + 10) using the distributive property:

2(3x + 10) = 2(3x) + 2(10) = 6x + 20

Now we can add the two simplified expressions together:

8x - 4 + 6x + 20 = 14x + 16

So, the simplified form of 4(2x - 1) + 2(3x + 10) is 14x + 16.

Learn more about perimeter of a figure on:

https://brainly.com/question/28164415

#SPJ1

Lily works at a department store and creates a survey to determine how sales affect their business. Choose the survey method(s) that would result in a valid random sample of the community.

Answers

The survey methods that would result in a valid random sample of the community include:

Simple random samplingStratified random samplingSystematic samplingCluster sampling

Option E. All of the above is correct.

Which survey method leads to a random sample ?

Simple random sampling involves selecting a random sample of participants from a larger population using a random number generator or a random sampling software. This method ensures that every member of the population has an equal chance of being selected.

Stratified random sampling involves dividing the population into smaller groups or strata based on certain characteristics, such as age, gender, income, etc. A random sample is then selected from each stratum. This method is useful when the population is heterogeneous and you want to ensure that the sample is representative of the entire population.

Systematic sampling involves selecting participants at regular intervals from a list of the population. This method is useful when the population is ordered, such as a list of customers.

Cluster sampling involves selecting a random sample of clusters or groups from the population, and then sampling individuals within those clusters. This method is useful when the population is geographically dispersed or it's difficult to obtain a complete list of the population. So Lily can use any of these survey methods to come up with a sample of the community.

Find out more on survey methods at https://brainly.com/question/1177322

#SPJ1

Options for this question include:

Simple random samplingStratified random samplingSystematic samplingCluster samplingAll of the above

Suppose f left parenthesis x right parenthesis equals x squared plus 4 and g left parenthesis x right parenthesis equals 2 x plus 1.

Find the value of f(-2)g(-2).


17


-24


40


13

Answers

Answer:

C) -24

Step-by-step explanation:

We have two functions here:

[tex]f(x) = x^{2} + 4[/tex]

and

[tex]g(x) = 2x + 1[/tex]

Now, both of these functions will be multiplied together after they are figured out (since they are next to each other), and they will have -2 replace x. For function f, we get:

[tex]-2^{2} + 4[/tex]

For function g, we get:

[tex]2 * -2 + 1[/tex]

Simplifying these two gives us:

[tex](4 + 4) * (1 - 4)[/tex]

Simplifying further gives us:

[tex]8 * -3 = -24[/tex]

So, the value of f(-2)g(-2) is C) -24.

Hope this helped!

Answer:

B)  -24

Step-by-step explanation:

Given functions:

[tex]\begin{cases}f(x)=x^2+4\\g(x)=2x+1\end{cases}[/tex]

To find f(-2)g(-2), substitute x = -2 into both functions and multiply them:

[tex]\begin{aligned}\implies f(-2)g(-2)&=\left((-2)^2+4\right)\left(2(-2)+1\right)\\&=\left(4+4\right)\left(-4+1\right)\\&=8 \cdot -3\\&=-24\end{aligned}[/tex]

What is the most general form of a polynomial function of degree n that has real coefficients, and how do you determine the number of distinct roots of that polynomial function using the fundamental theorem of algebra and the factor theorem, while also taking into consideration any constraints or limitations imposed by the discriminant and the nature of the roots (real or complex)?

Answers

Answer:The most general form of a polynomial function of degree n that has real coefficients is:

f(x) = a_nx^n + a_{n-1}x^{n-1} + ... + a_2x^2 + a_1x + a_0

where a_n, a_{n-1}, ..., a_1, a_0 are real numbers, and a_n is not equal to zero.

The number of distinct roots of a polynomial function of degree n can be determined using the fundamental theorem of algebra, which states that a polynomial function of degree n has exactly n roots, counting multiplicities. This means that a polynomial function of degree n can have n distinct roots, n-1 distinct roots, or any integer value in between, depending on the multiplicities of the roots.

Using the factor theorem, it is possible to determine the number of distinct roots of a polynomial function by factoring it into its irreducible factors. If the polynomial function is fully factored, the number of distinct roots is equal to the number of irreducible factors.

However, the nature of the roots (real or complex) and constraints imposed by the discriminant are also important to consider. The discriminant of a polynomial function is the value of the expression b^2-4ac, where a, b, and c are the coefficients of the polynomial function in the form f(x) = ax^2+bx+c. The discriminant determines the nature of the roots of the polynomial function. If the discriminant is positive, the roots are real and distinct. If the discriminant is zero, the roots are real and repeated. If the discriminant is negative, the roots are complex and non-real.

So, the most general form of a polynomial function of degree n that has real coefficients, can be determined by the form of the polynomial, the number of distinct roots by the fundamental theorem of algebra, by factoring the polynomial into its irreducible factors and the nature of the roots is determined by the discriminant.

Step-by-step explanation:

Cornell drives 3 times the hours that Deborah does. Cornell and Deborah drive for a total of 8 hours. How long did each person drive?

Answers

Answer: Let's call the number of hours Deborah drives "d" and the number of hours Cornell drives "c".

We know that:

c = 3d (because Cornell drives 3 times the hours that Deborah does)

and

c + d = 8 (because they drive for a total of 8 hours)

We can use the first equation to substitute the value of c in the second equation:

3d + d = 8

4d = 8

d = 2

So Deborah drives 2 hours.

Now we can use the first equation to find the number of hours Cornell drives:

c = 3d

c = 3(2) = 6

So Cornell drives 6 hours.

Step-by-step explanation:

How much is 9.6 KB kilobytes

Answers

9.6 KB kilobytes is equal to 0.0096 MB

What is Unit of Measurement?

A unit of measurement is a definite magnitude of a quantity, defined and adopted by convention or by law, that is used as a standard for measurement of the same kind of quantity.

1kB=1000 bytes

1MB=1000 KB

1kB=1/1000MB=0.001 MB

9.6 KB is nothing but 9600 bytes

9.6 KB in MB we have to convert

Now multiply 9.6 with 0.001

9.6×0.001

0.0096 MB

Hence,  9.6 KB kilobytes is equal to 0.0096 MB

To learn more on Unit of Measurement click:

https://brainly.com/question/15402847

#SPJ1

The line plot shows the distance Lena walks each day for 10days. Each X represents Iday
Distances Walked
How many miles does Lena walk in 10days?
OA 23 miles
OB 11 miles
OC. 10 miles
OD. 19 miles
XX
X X
X.
Xx
X
X X
X
X
1 1 1 1 2 2 2 2 3
Distance (miles

Answers

Answer: Lena walks 63 miles in 10 days.

Step-by-step explanation:

To find out how many miles Lena walks in 10 days, you need to add up all the distances she walks each day.

From the information provided, it seems that the distances walked each day are:

23 miles, 11 miles, 10 miles, 19 miles and the remaining days is not given.

So, to find the total miles Lena walks in 10 days, you would add up the distances walked each day:

23 + 11 + 10 + 19 = 63 miles

So, Lena walks 63 miles in 10 days.

The total miles in 10 days will bed 14 miles. The closest option is OD, which is 19 miles.

How to calculate the distance covered?

To find the total distance Lena walks in 10 days, we need to add up all the distances on the line plot:

Starting from day 1, we can count the distances and add them up:

On day 1, Lena walks 1 mile

On day 2, Lena walks 2 miles

On day 3, Lena walks 1 mile

On day 4, Lena walks 1 mile

On day 5, Lena walks 2 miles

On day 6, Lena walks 1 mile

On day 7, Lena walks 2 miles

On day 8, Lena walks 1 mile

On day 9, Lena walks 1 mile

On day 10, Lena walks 2 miles

Adding up all these distances, we get:

1 + 2 + 1 + 1 + 2 + 1 + 2 + 1 + 1 + 2 = 14

Therefore, Lena walks a total of 14 miles in 10 days.

Thus, the closest option is OD, which is 19 miles.

To know more about the line plot follow

https://brainly.com/question/30250071

#SPJ2

Answer both questions please

Answers

The number of tiles in figure 70 and figure 93 are 142 and 188.

How many tiles are in figure 70?

Figure 2 = 6

Figure 3 = 8

The common difference = 8 - 6

= 2

figure 2 = a + (n - 1)d

Where,

a = first term

figure 2 = a + (n - 1)d

6 = a + (2 - 1)2

6 = a + (1)2

6 = a + 2

6 - 2 = a

a = 4

Figure 70 = a + (n -1)d

= 4 + (70-1)2

= 4 + (69)2

= 4 + 138

Figure 70 = 142

Figure 93 = a + (n -1)d

= 4 + (93 - 1)2

= 4 + (92)2

= 4 + 184

Figure 93 = 188

Therefore, figure 70 and 93 have 142 and 188 tiles respectively.

Read more on sequence:

https://brainly.com/question/6561461

#SPJ1

The floor of a round hut has a diameter of 4 yards. What is the floor's area?

Answers

The area of this circle is 12.5 yd²

What is incircle?

The incircle is defined as the largest circle that can be made in a triangle and is tangent to each side of the triangle.

The area of the circle is the product of the pie and the square of the radius.

The area of the circle = πr²

We are given that floor of a round hut has a diameter of 4 yards.

r = 2 d

Then we know that

Area = πr²

Substitute the values r = 2

π = 3.14

Area = 3.14(2)²

Area = 3.14 × 4

Area = 12.5663706 yd²

Learn more about the area;

brainly.com/question/1658516

#SPJ1

Write the equation of the line that passes through the points and

Answers

The equation of a line is 3y+2x+59.

When we have given one point and slope we can write the equation as

y-y1=m(x-x1)

here x1=-11,y1=-13,m=-2/3

y+11=-2/3(x+13)

=3y+2x+59

The equation becomes =3y+2x+59.

Learn more about slope,

https://brainly.com/question/16949303

principles of dalton atomic theory

Answers

Dalton's Atomic Theory (1804)

From his experiments and observations, as well as the work of peers of his time, Dalton proposed a new theory of the atom. This later became known as Dalton's atomic theory. The general tenets of this theory were as follows:

All matter is composed of extremely small particles called atoms.Atoms of a given element are identical in size, mass, and other properties. Atoms of different elements differ in size, mass, and other properties.Atoms cannot be subdivided, created, or destroyed.Atoms of different elements can combine in simple whole-number ratios to form chemical compounds.In chemical reactions, atoms are combined, separated, or rearranged.

According to Dalton’s atomic theory, all matter, whether an element, a compound, or a mixture is composed of small particles called atoms.

Dalton based his theory on two laws: the law of conservation of mass and the law of constant composition.

To learn more about "Dalton's Atomic Theory" here:

brainly.com/question/13157325

A rainstorm in Portland, Oregon, has wiped out the electricity in about 10% of the households in the city. A management team in Portland has a big meeting tomorrow, and all 6 members of the team are hard at work in their separate households, preparing their presentations. What is the probability that none of them has lost electricity in his/her household? Assume that their locations are spread out so that loss of electricity is independent among their households.

Answers

Answer:

The probability that a given household has lost electricity is 10%, or 0.1. So the probability that a given household has not lost electricity is 1 - 0.1 = 0.9.

Since the loss of electricity is independent among the households of the management team, we can find the probability that none of them has lost electricity by multiplying the probability of no loss in any one household (0.9) by itself 6 times, since there are 6 members of the team:

0.9 * 0.9 * 0.9 * 0.9 * 0.9 * 0.9 = 0.54

So the probability that none of the management team members has lost electricity in his or her household is  54%.

Find the perimeter of triangle ABC. Round your answer to two decimal places.

(9,-2) (5,1) (9,-3)

Answers

Answer: To find the perimeter of a triangle, we need to add the length of all three sides of the triangle.

To find the length of each side, we can use the distance formula which is the square root of (x2-x1)^2 + (y2-y1)^2.

The distance between point A (9,-2) and point B (5,1) is: √((9-5)^2 + (-2-1)^2) = √16 + 9 = √25 = 5.

The distance between point B (5,1) and point C (9,-3) is: √((9-5)^2 + (-3-1)^2) = √16 + 16 = √32 = 5.66.

The distance between point C (9,-3) and point A (9,-2) is: √((9-9)^2 + (-3- -2)^2) = √1 + 1 = √2 = 1.41

The perimeter is the sum of the length of all three sides:

Perimeter = 5 + 5.66 + 1.41 = 12.07

Round the answer to two decimal places, the perimeter of the triangle is 12.07.

Step-by-step explanation:

There is 25 pounds of dog food in a bag. There are approximately 2.2 kilograms in 1 pound. PLEASE HELP ME !! THANK YOU SMM!!
Which statement is true?

A. There is approximately 55 kilograms of dog food in the bag, because 1/2.2 = 55/22.
B. There is approximately 11.36 kilograms of dog food in the bag, because 1/2.2 = 25/11.36
C. There is approximately 55 kilograms of dog food in the bag, because 1/2.2 = 25/11.36
D. There is approximately 11.36 kilograms of dog food in the bag, because 1/2.2 = 11.36/25

Answers

The statement that is true is D. There is approximately 11.36 kilograms of dog food in the bag, because 1/2.2 = 11.36/25

To convert between pounds and kilograms, we use the conversion factor of 1 pound = 2.2 kilograms. This means that 1 pound is equal to 2.2 kilograms, and 2 pounds is equal to 4.4 kilograms, and so on.

In this case, we are given that there is 25 pounds of dog food in a bag, and we want to convert this to kilograms. To do this, we can multiply 25 pounds by the conversion factor of 1 pound = 2.2 kilograms.

25 pounds * (1 kilogram / 2.2 pounds) = 25/2.2 = 11.3636363636 kg.

So, there is approximately 11.36 kilograms of dog food in the bag.

The other options are incorrect. In option A, 1/2.2= 55/22 which is not equal to 25 pounds and the same case in option C. In option B the calculation is not correct as well because 1/2.2 = 25/11.36 doesn't make sense.

Therefore, the only true statement is D. There is approximately 11.36 kilograms of dog food in the bag, because 1/2.2 = 11.36/25

I think B I’m not sure tho

P(x ≤ 78 pounds) =
8%
78%
cannot be determined from graph

Answers

The probability of a measure less than 78 pounds is given as follows:

0.9452 = 94.52%.

How to obtain probabilities using the normal distribution?

The z-score of a measure X of a variable that has mean symbolized by [tex]\mu[/tex] and standard deviation symbolized by [tex]\sigma[/tex] is obtained by the rule presented as follows:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The z-score represents how many standard deviations the measure X is above or below the mean of the distribution, depending if the obtained z-score is positive or negative.Using the z-score table, the p-value associated with the calculated z-score is found, and it represents the percentile of the measure X in the distribution.

The mean and the standard deviation for this problem are given as follows:

[tex]\mu = 70, \sigma = 5[/tex]

The probability of a weight less than 78 pounds is the p-value of Z when X = 70, hence:

Z = (78 - 70)/5

Z = 1.6

Z = 1.6 has a p-value of 0.9452.

Missing Information

The mean and the standard deviation of the distribution are given as follows:

Mean: 70 pounds.Standard deviation: 5 pounds.

More can be learned about the normal distribution at https://brainly.com/question/25800303

#SPJ1

Answer: Cannot be determined from graph

Step-by-step explanation:

Write an equation of the line passing through point P(-6, 4) that is perpendicular to y + 8 = 2(x - 14). Graph the equations to check that the lines are perpendicular.

Answers

Answer: An equation of the line passing through point P(-6, 4) that is perpendicular to y + 8 = 2(x - 14) is:

y = -4x + 20

Step-by-step explanation:

The given equation is in slope-intercept form y = mx + b, where m is the slope of the line and b is the y-intercept. The slope of the line is 2, which means the line has a slope of 2 and is inclined at an angle of tan^-1(2).

To find an equation of a line that is perpendicular to this line, we need to find the negative reciprocal of the slope, which is -1/2. This means the slope of the line passing through point P(-6, 4) that is perpendicular to y + 8 = 2(x - 14) is -1/2.

Now we can use the point-slope form of a linear equation to find the equation of the line passing through point P(-6, 4) and having a slope of -1/2. The point-slope form of a linear equation is:

y - y1 = m(x - x1)

Where (x1, y1) is the given point, and m is the slope of the line. So by substituting the values we get:

y - 4 = -1/2(x + 6)

Which can be written as:

y = -1/2x + 4

So the equation of the line passing through point P(-6, 4) that is perpendicular to y + 8 = 2(x - 14) is:

y = -1/2x + 4

Graphing the equations can confirm that the lines are perpendicular as the slope of the first line is 2 and the slope of the second line is -1/2, the product of these slopes is -1 which means they are perpendicular to each other.

Write a function that represents the graph. (-6,-5) (6, 1) Students, write your response!​

Answers

Therefore , as a result, the answer to the given function problem is that the  f(x) = y  = - |x-4 | represents the given points.

What is the definition of function?

Mathematics encompasses a wide range of topics, including the study of numbers and their variations, equations and related structures, as well as the limits and potential uses of geometry. A "useful" is the connection between several inputs that together produce a particular output. A functional is an output-input relationship where each input yields a single, easily recognisable output. Every technique has both a territory, often known as a domain, and a city .

Here,

Given : (6,1)  and (-6,-5)

We need to choose which of the four potential functions corresponds to the graph; we have such a graph & four possible functions.

From putting the points in the below function f(x) , we get it represents the given points.

As a result, the essential task would be:

=>  y  = - |x-4 |

=> f(x) = y  = - |x-4 |

To learn more about the function, visit:

brainly.com/question/28193995

#SPJ1

Please help me with this question!

Answers

Measure of ∠CEA = 91°

What is arc?

The arc of a circle is defined as the part or segment of the circumference of a circle.  A straight line that could be drawn by connecting the two ends of the arc is known as a chord of a circle.

Given,

In figure

chord AB and chord CD intersect at E

m(arc CA) = 140°

m(arc DB) = 42°

∠CEA intercepts arc CA and has it vertex inside the circle

Thus,

∠CEA = (m(arc CA) + m(arc DB))/2

∠CEA = (140° + 42°)/2

∠CEA = 182°/2

∠CEA = 91°

∠CEA measures 91°

Learn more about arc here:

https://brainly.com/question/18741430

#SPJ1

Alison made 21/2 glasses of fruity iced tea for 7 her friends. Considering that each friend drank an equal quantity, how many glasses were served per person

Answers

Answer:

You could convert 21/2 to a whole number by multiplying it by 2 and then dividing by 2, so 21/2 = 21/2 = 10.5, then dividing the total by the number of people that is 10.5 / 7 = 1.5 glasses/person.

HELP
IMMAGE ATTACHED

Answers

Answer:

[tex]\frac{y-7}{y+8}[/tex]

y cannot equal -8

Step-by-step explanation:

[tex]\frac{(y-7)(y-5)}{(y+8)(y-5)}[/tex]           y-5 cancel out

[tex]\frac{y-7}{y+8}[/tex]

Here is a number machine. Input n -5 x 4 Output ​

Answers

The output when the input is 8 is 36 and the input when the output is 42 is 206

What are input and output?

You should be aware that input involves materials used in producing a particular thing while the output is the yielding result of the production.

(The input)  n*5 - 4 = (The output)

When the input is 8,

8 * 5 -4

= 40 - 4

= 36

When the output is 42.

(The input)  n× 5 - 4

(The input) 42× 5 -4

(The input) = 206

The input was 206.

Learn more about input and output in production on https://brainly.com/question/17405663

#SPJ1

Complete question:

Here is a number machine.

input

-5*3 output

a) Work out the output when the input is 8

b) Work out the input when the output is 42

A cookie factory uses 3 3/4 bags of flour in each batch of cookies. The factory used 7 1/2 bags of flour yesterday. How many batches of cookies did the factory make?

Answers

Answer:

To find out how many batches of cookies the factory made, we need to divide the total amount of flour used (7 1/2 bags) by the amount of flour used per batch (3 3/4 bags).

We can start by converting 7 1/2 bags of flour to a mixed number: 7 1/2 bags = 7 + 1/2 = 7.5 bags

Next, we can convert 3 3/4 bags of flour to a mixed number: 3 3/4 = 3 + 3/4 = 3.75 bags

Then, we can divide the total amount of flour used by the amount of flour used per batch:

7.5 bags / 3.75 bags/batch = 2 batches

Therefore, the factory made 2 batches of cookies yesterday

2 batches are the total number that the factory made

By selling a stool for Rs. 67.50, a carpenter loses 10 %. How much percent would he gain by selling it for Rs 82.50?

Answers

Answer:

Rs. 7.50

or a gain of 10%

Step-by-step explanation:

Let x be the price of the stool

10% = 10/100 = 0.10

Loss = 0.1x

Selling price at 10% loss = x - 0.1x = 0.x

We are given this sale price is 67.50

So

0.9x = 67.50

x = 67.50/0.9 = 75

If he sells it at 82.50, the profit would be 82.50 - 75 = 7.5

This would represent a gain of 7.5/75 x 100 percent

= 10%

Answer:

The carpenter would gain 10% profit.

Step-by-step explanation:

67.5 is 90% of 75.

82.50 is 110% of 75.

Anthony wants to plant a garden but is worried that rabbits will eat his crop so he decides to put up a fence around his plot. one side of the garden will be adjacent to a barn which is 22 feet long. he wants to be 176 square feet

Answers

Answer:

Step-by-step explanation:

.

The best way for Anthony to plan his garden is to create a rectangular plot. He can use the side of the barn as one side of the rectangle, and then measure out the other three sides. The total length of the three sides will be 176 feet. He can divide this into two sides that are 88 feet long and two sides that are 44 feet long. This will give him a rectangular plot that is 176 square feet.

Once Anthony has the dimensions of the plot, he can build a fence around it to protect it from rabbits. He can use a variety of materials such as wood, wire, or plastic mesh to build the fence. The fence should be at least four feet tall and buried at least six inches deep to be effective. If he chooses to use wire, he should use thick, galvanized wire to make sure that the rabbits cannot chew through it.

Once the fence is in place, Anthony can begin planting his garden. He should also consider adding a layer of mulch or straw around the outside of the fence to discourage the rabbits from digging underneath it. With the right planning and protection, Anthony should be able to enjoy a successful garden.

A car manual recommends changing the oil every 5000 miles and inspecting the engine coolant system every 15,000 miles how many miles will both be done together for the first time? for the second time?

Answers

The oil and coolant will be changed together after 15000 miles.

What is an expression?

The mathematical expression combines numerical variables and operations denoted by addition, subtraction, multiplication, and division signs.

Mathematical symbols can be used to represent numbers (constants), variables, operations, functions, brackets, punctuation, and grouping. They can also denote the logical syntax's operation order and other properties.

Given that a car manual recommends changing the oil every 5000 miles and inspecting the engine coolant system every 15,000 miles.

The change for both together for the first time will be after 15000 miles.

To know more about an expression follow

https://brainly.com/question/14348566

SPJ1

Help!!!
Whoever answers correctly gets brainliest

Answers

After 10 years, the investment compounded periodically will be worth $ 132. 53 more than the investment compounded annually.

How to find the investment worth ?

The worth of the investment compounded annually would be:

= investment principal x  ( 1 + Annual interest ) ^ number of years

= 9, 000 x ( 1 + 5 %) ¹⁰

= $ 14, 660.05

The worth of the periodically compounded interest investment would be:

= 9, 000 x ( 1 + 5 % / 4 ) ¹⁰ ˣ ⁴

= $ 14, 792. 58

The difference is :

= 14, 792. 58 - 14, 660. 05

= $ 132. 53

Find out more on investments at https://brainly.com/question/28020457

#SPJ1

Other Questions
southwest airlines hires people who are fun-loving and outgoing, who enjoy interacting with other people because putting fun into air travel is an essential ingredient of the company's culture. from a marketing perspective, this is an example of A 75,000-watt radio station transmits at 88 MHz. Calculate the energy of a single photon at the transmitted frequency.5.0x 10 -29 J/photon5.8 x 10 -32 J/photon5.8 x 10 -26 J/photon how many types of nonequivalent protons are present in each of the following molecules?ch3ch3c=chch3ch2c(ch3)2ch2ch3ch3ch2ch2ch2och3 You weigh 610 n. what would you weigh if the earth were six times as massive as it is and its radius were three times its present value? answer in units of n. How do you calculate manufacturing overhead rate? Write and equation for a line through the points (8,13) and(-12,18) during a health symposium the nurse teaches the group how to prevent food poisoning. which statement by one of the participants indicates the teaching is understood? which action contains the elements of verbal and nonverbal communication, active listening skills, refusal skills, and conflict-resolution skills? responses interpersonal communication interpersonal communication advocacy advocacy goal setting goal setting social health what type of braking is used to smoothly and gradually reduce brake pedal pressure at the end of a braking maneuver a child in the preoperational stage cannot understand a family tree, but a child in the concrete operational phase can. piaget claims that this is because a child in the concrete operational level can: group of answer choices classify things. think abstractly. memorize better. reason intuitively. Write the contents of an XHTML file cake.html. This file should contain JavaScript messages that prompts the user to enter the size of a cake (the diameter) and the price of a cake. Using the input that the user enters, calculate the price per square inch. If the government cuts taxes by 10 billion dollars and cuts spending by the same amount, rgdp will a. decrease by $10 billion.b. increase by $10 billion.c. remain the same.d. increase by some amount less than $10 billion.e. decrease by some amount less than $10 billion. Diversity in U.S. FamiliesAfter this class you should be able to:Summarize research on families: African American, Latino, Asian American, Native American, one-parent, couples without children, blended, and gay and lesbianWhat is the primary determinant for different types of families?Sociological studies Notes on African American familiesNotes on Latino American familiesNotes on Asian American familiesNotes on Native American familiesWhat comparisons do they make between poor and middle class families?Notes on one-parent familiesNotes on couples without childrenNotes on blended familiesNotes on gay and lesbian families Please help!!! Thanks a lot Solve the equation.12.5(3x-1)+132.4=(2.8-4x) 0.5Will reward brainliest Universality of cognitive development is.. THIS IS DUE TOMORROWUse your knowledge of social networking sites and the vocabulary that you learned in this unit to create a personal profile page in German. Review the Social Networking tutorial to fill out each category in the table correctly.For this task, you can use information that is specific to you, or you can make up information. As always, be creative and practice the vocabulary you learned. Insert a picture (of you or someone else) above the table, then fill out the table.the image can be a random image of a person from the internet that you used to base this off of and the information can be creative or made up as well! speaking forthe topic "Millitary regime an Civilian regime" Military Regime is Better Than Cuvilian Pregune 29 Write the equation of the line that passes through (17,-7) and (34,27) Which action is appropriate for an organization to consider when integrating a newapplication or platform that deals with sensitive information? Build all applications in the same programming language to enhance security. include security specialists at the beginning and throughout the process follow only proprietary best practices when designing an application to mitigate threats copy the best practices of the other organizations and implement them without changes