Solve 3x + 6 = 34
Answers:
−2
4
6
10

Answers

Answer 1

Answer:

To solve the equation 3x + 6 = 34, we need to isolate x on one side of the equation.

First, we can start by subtracting 6 from both sides of the equation to get:

3x + 6 - 6 = 34 - 6

Simplifying this, we get:

3x = 28

Next, we divide both sides by 3 to isolate x:

3x/3 = 28/3

Simplifying this, we get:

x = 28/3

This is not one of the answer choices listed. However, we can approximate the answer to the nearest integer. Using a calculator, we get:

x ≈ 9.333

Rounding to the nearest integer, we get:

x ≈ 9

Therefore, the answer closest to the solution of the equation 3x + 6 = 34 is 10.


Related Questions

A rectangular tank measuring 40 cm long, 30 cm wide and 35 cm high was filled with water to a hight of 15 cm. 4800 cm3 of water were poured into water. find the new height of water

answer ASAP

Answers

A rectangular tank measuring 40 cm long, 30 cm wide and 35 cm high was filled with water to a hight of 15 cm. 4800 cm3 of water were poured into water ,The new height of the water in the tank is approximately 19.83 cm.

To find the new height of water in the tank after pouring in 4800 cm³ of water, we can use the concept of ratios.

First, let's calculate the initial volume of water in the tank before pouring in the additional water. The initial volume can be calculated as the product of the length, width, and initial height:

Initial volume = 40 cm * 30 cm * 15 cm = 18,000 cm³

Next, we add the volume of the water poured in:

Total volume = Initial volume + Volume poured in = 18,000 cm³ + 4800 cm³ = 23,800 cm³

To find the new height, we divide the total volume by the base area of the tank (length * width):

New height = Total volume / (Length * Width) = 23,800 cm³ / (40 cm * 30 cm) = 19.83 cm (rounded to two decimal places)

As a result, the tank's new water level is roughly 19.83 centimetres high.

for such more question on height

https://brainly.com/question/16269079

#SPJ8

PLEASE HELPPPPPPPPPP

Answers

Answer:  

Step-by-step explanation:

The degree is 4 the leading coefficient is even/positive.  There are 3 distinct real 0's and 3 relative extreme values

Explanation:

4th degree.   Degree is the highest exponent.  The number of 0's (times it hits the curve)tells you the degree.  The curve goes through the x 2 times, which means 2 x's. Then it bounces off x 1 time which means there are 2 x's there too but because this one bounces off it means it's not a distint solution it's a multiplicity ex (x-3)².  So that accounts for 4 solutions

Even/positive coefficient.  That's the first number in the equation.  Because it's facing up it's a positive but all the ends are both facing up so that tells you it's even.  Think of a parabola that is an even function, this follows those rules too.

3 distinct zeroes.    This is explained in 4th degree.   Zeroes are solutions, when it hits x axis.  Goes through x 2 times and bounces once.  So there are 3 distinct zeroes

3 relative extreme values. This is how many "mini" max and mins you have.  

If your grocery bills over the last four weeks were &203, $195,$180 and $238 what was the average bill?

Answers

Answer:

204

Step-by-step explanation:

Sum: 816

Count: 4

Median: 199

Geometric Mean: 202.92942642991

Largest: 238

Smallest: 180

Range: 58

To pay for a $15,500 motorcycle, Jane made a down payment of $3300 and took out a loan for the rest. On the loan, she paid monthly payments of $219.23 for 5 years. What is the total amount Jane ended up paying for the motorcycle (including down payment and monthly payments)

Answers

Answer:

$16,453.80

Step-by-step explanation:

5 × 12 months = 60 months (the time she payed the monthly payments in months)

219.23 × 60 = 13, 153.8

13,153.8+3,300= $16,453.80.

The accompanying diagram represents the market for violins.

Suppose that a new technology allows beginner-level violin producers to make violins at a substantially lower (marginal) cost while retaining the same quality.

a. Use the graph to illustrate the effect that this will have on the supply and demand of beginner-level violins and then answer the following three questions.

b. How much does this new technology increase consumer surplus?

Market for Violins
Quantity of violins (in thousands)
0
10
20
30
40
50
60
70
80
90
100
0
30
60
90
120
150
180
210
240
270
300
S
D

Increase in consumer surplus: $
2400
c. How much does this new technology increase producer surplus?
Increase in producer surplus: $
2400
d. How much does this new technology increase total (or social) surplus?
Increase in total surplus: $
4800

Answers

a. The new technology leads to an increase in the supply of beginner-level violins, resulting in a rightward shift of the supply curve. The demand curve remains unchanged unless otherwise specified.

b. The new technology increases consumer surplus by $2400, as represented by the shaded area between the original demand curve and the new demand curve up to the new equilibrium quantity.

c. The new technology increases producer surplus by $2400, represented by the shaded area between the original supply curve and the new supply curve up to the new equilibrium quantity.

d. The new technology increases total surplus by $4800, which is the sum of the increase in consumer surplus and the increase in producer surplus.

a. To illustrate the effect of the new technology on the supply and demand of beginner-level violins, we need to consider the following:

Supply: The new technology allows beginner-level violin producers to make violins at a substantially lower marginal cost while maintaining the same quality. This means that the supply of beginner-level violins will increase. We can show this on the graph by shifting the supply curve to the right.

Demand: The demand for beginner-level violins will depend on factors other than the new technology. If there is no change in demand, the demand curve will remain the same. However, if there is an increase in demand due to factors such as increased interest in learning the violin, we would see a shift in the demand curve to the right.

By shifting the supply curve to the right or the demand curve to the right, or both, we can represent the effect of the new technology on the market for beginner-level violins.

b. The increase in consumer surplus can be calculated by finding the area of the triangle formed by the original demand curve, the new demand curve, and the new equilibrium quantity of violins. This represents the additional benefit consumers receive from the lower price due to the new technology.

In the given graph, the increase in consumer surplus is represented by the shaded area between the original demand curve and the new demand curve, up to the new equilibrium quantity. The dollar value of this increase can be calculated by multiplying the increase in quantity by the average difference in price between the original and new equilibrium.

c. The increase in producer surplus can be calculated by finding the area of the triangle formed by the original supply curve, the new supply curve, and the new equilibrium quantity of violins. This represents the additional profit that producers receive from the higher quantity sold at the same or slightly reduced price due to the lower marginal cost from the new technology.

In the given graph, the increase in producer surplus is represented by the shaded area between the original supply curve and the new supply curve, up to the new equilibrium quantity. The dollar value of this increase can be calculated by multiplying the increase in quantity by the average difference in price between the original and new equilibrium.

d. The increase in total (or social) surplus is the sum of the increase in consumer surplus and the increase in producer surplus. In this case, the increase in total surplus would be the sum of the increases calculated in parts b and c.

Therefore, the increase in total surplus due to the new technology is represented by the shaded area between the original supply and demand curves and the new supply and demand curves, up to the new equilibrium quantity. The dollar value of this increase can be calculated by adding the dollar values of the increase in consumer surplus and the increase in producer surplus. In this example, the increase in total surplus is $4800.

for such more question on equilibrium quantity.

https://brainly.com/question/29792134

#SPJ8

The total shaded area of these two identical cubes is 162 cm2. Calculate the volume of 8 such cubes

Answer ASAP

Answers

Answer:

the volume of 8 identical cubes is approximately 386.744 cm³.

Step-by-step explanation:

Let's assume the side length of a cube is represented by "s."

The total shaded area of two identical cubes is given as 162 cm². Since there are two cubes, each cube contributes half of the total shaded area.

Area of a single cube = (Total shaded area) / 2

= 162 cm² / 2

= 81 cm²

The area of each face of a cube is equal to the side length squared. Therefore, we can set up the equation:

6s² = 81 cm²

Dividing both sides by 6:

s² = 81 cm² / 6

= 13.5 cm²

Taking the square root of both sides:

s = √(13.5 cm²)

≈ 3.674 cm (rounded to three decimal places)

Now that we know the side length of a single cube, we can calculate the volume of 8 identical cubes.

Volume of a single cube = s³

= (3.674 cm)³

≈ 48.343 cm³ (rounded to three decimal places)

Volume of 8 cubes = Volume of a single cube * 8

= 48.343 cm³ * 8

= 386.744 cm³


cinetica?
Un automóvil de 800 kg se desplaza a 50km/h cuál será su energía cinética.

Answers

The kinetic energy of this car is equal to 77160.49 Joules.

How to calculate the kinetic energy of this car?

In Mathematics, the kinetic energy of a physical object can be calculated by using the following equation (formula):

K.E = 1/2 × mv²

Where:

K.E represent the kinetic energy.m represent the mass.v represent the speed or velocity.

Note: 50 km/h to m/s = 50 × 1000/3600 = 13.89 m/s

By substituting the given parameters into the formula for the kinetic energy of a physical object, we have the following:

Kinetic energy, K.E = 1/2 × 800 × 13.89²

Kinetic energy, K.E = 400 × 192.90

Kinetic energy, K.E = 77160.49 Joules.

Read more on kinetic energy here: https://brainly.com/question/25959744

#SPJ1

Complete Question:

An 800 kg car travels at 50 km/h, what will its kinetic energy be?

Will 5 divided by 0.4 be rational or irrational and why

Answers

Answer:

Step-by-step explanation:

no

I want to write an equation for a line that passes through 2 of the data points collected. The points are (8,5) and (-12, -9). Is 7x - 10y = 3 a good model? Why?

Answers

Answer:

No

Step-by-step explanation:

Slope is [tex]\frac{-9-5}{-12-8}=\frac{-14}{-20}=\frac{7}{10}[/tex]

[tex]y-y_1=m(x-x_1)\\y-5=\frac{7}{10}(x-8)\\y-5=\frac{7}{10}x-\frac{28}{5}\\10y-50=7x-56\\10y+6=7x\\6=7x-10y[/tex]


Therefore, 7x-10y=3 would not be a good model, but it's very close

Is gender associated with a person's environmental awareness? Two hundred randomly selected individuals were surveyed about their environmental awareness. Participants were asked about recycling, use of aerosol sprays, and various other environmental concerns. A point system was developed to score the individuals' responses. Once the points were tallied, individuals were broken up into categories of environmental awareness. Those with scores of 8 to 10 were considered to be very environmentally aware, scores of 4 to 6 moderately aware, and 3 or less not aware. The results are shown in the following table:

Very environmentally aware Moderately environmentally aware Not environmentally aware
Male 30 21 45
Female 42 34 28
Run an appropriate test of significance at α = 5 to see if the data provide evidence that gender is associated with one's environmental awareness.

Answers

The chi-square test of independence is a useful statistical method that can be used to test the null hypothesis that there is no association between two categorical variables. When the assumptions of the test are satisfied, this hypothesis can be tested using the chi-square statistic. The following problem can be solved using the chi-square test of independence:

Is gender associated with a person's environmental awareness? Two hundred randomly selected individuals were surveyed about their environmental awareness. Participants were asked about recycling, use of aerosol sprays, and various other environmental concerns.

A point system was developed to score the individuals' responses. Once the points were tallied, individuals were broken up into categories of environmental awareness.

Those with scores of 8 to 10 were considered to be very environmentally aware, scores of 4 to 6 moderately aware, and 3 or less not aware.

The results are shown in the following table: Very environmentally aware Moderately environmentally aware Not environmentally aware Male 302145 Female 423428 We will use a chi-square test of independence to test the null hypothesis that gender is not associated with one's environmental awareness.

We begin by specifying the null and alternative hypotheses: H0: Gender and environmental awareness are independent.

Ha: Gender and environmental awareness are dependent. We choose a significance level of α = 0.05. We can now proceed with the chi-square test of independence.

First, we will calculate the expected frequencies. The expected frequency for each cell can be found by multiplying the row total by the column total and then dividing by the sample size.

The expected frequencies are shown in the following table: Very environmentally aware Moderately environmentally aware not environmentally aware Male 22.5716.6176.81 Female 49.424.826.19 Next, we calculate the chi-square statistic using the formula: X2 = ∑(O - E)2/E where O is the observed frequency and E is the expected frequency.

The chi-square statistic is 18.66. We now need to find the degrees of freedom.

The degrees of freedom for a chi-square test of independence are given by df = (r - 1)(c - 1) where r is the number of rows and c is the number of columns. In this case, there are 2 rows and 3 columns, so df = (2 - 1)(3 - 1) = 2.

We can now use a chi-square distribution table to find the critical value of the chi-square distribution with 2 degrees of freedom and a significance level of 0.05.

The critical value is 5.99. Since the calculated value of the chi-square statistic (18.66) is greater than the critical value (5.99), we reject the null hypothesis.

We have sufficient evidence to conclude that gender and environmental awareness are dependent. Therefore, we can conclude that gender is associated with a person's environmental awareness.

For more such questions on chi-square test

https://brainly.com/question/4543358

#SPJ8

Joseph has been assigned a reading that will help him understand the physical laws that keep airplanes in the air. He's a bit
nervous about flying, too, so he really wants to understand how flight works. In addition to taking a deep breath and clearing
away distractions, how should be start making sense of the the reading?
O a.
Joseph needs to think about why this is an important article to him. Then he needs to keep reading it over and over until he
knows it well.
O b. Joseph needs to read the whole thing once, then bring questions to his professor during the next class period.
c. Joseph needs to determine the thesis and topic sentences. Each topic sentences will explain one aspect of the thesis.

Answers

Joseph needs to determine the thesis and topic sentences. Each topic sentences will explain one aspect of the thesis. Option C

To start making sense of the reading on the physical laws that keep airplanes in the air, Joseph can follow a systematic approach to enhance his understanding and alleviate his nervousness about flying. While options (a) and (b) might have some merit, option (c) is a more effective strategy for comprehending and synthesizing the information.

Option (a) suggests repeatedly reading the article until Joseph knows it well. While repetition can help reinforce understanding, it might not be the most efficient method for Joseph.

Reading the same material multiple times without actively engaging with the content may not result in deeper comprehension. It's important for Joseph to actively process the information and apply critical thinking.

Option (b) suggests reading the entire article once and then bringing questions to his professor during the next class period. While seeking clarification from the professor is beneficial, reading the article only once might not provide a solid foundation for asking insightful questions. Joseph could benefit from a more comprehensive understanding of the material before seeking clarification.

Option (c) is a more effective approach. Joseph should begin by identifying the thesis and topic sentences of the article. The thesis statement will outline the main idea or argument, while the topic sentences will provide an overview of the key points discussed in the article.

Once Joseph has identified the thesis and topic sentences, he can focus on each topic sentence individually. By breaking down the content into manageable segments, Joseph can ensure that he comprehends each aspect of the thesis before moving on to the next.

Moreover, Joseph can actively engage with the material by taking notes, summarizing each section in his own words, and making connections to real-world examples or personal experiences. This active approach will enhance his understanding and help him internalize the concepts.

For more such questions on thesis visit:

https://brainly.com/question/29118932

#SPJ8

Drag each equation to the correct location on the table.
Sort the models based on whether they represent exponential growth or exponential decay.
A = A₂(0.95)
A = Pert
N=20,000(1.12)
N= Noekt, where k>0
N= Noe, where k<0
A = Ao (1)

Answers

The Growth functions are:

[tex]N = 2000(1.12)^{t}[/tex]

[tex]N = N_{0} e^{kt}[/tex] where k > 0

The Decay Functions are:

[tex]A = A_{0}(0.95)^{t}[/tex]

[tex]N = N_{0} e^{kt}[/tex] where k < 0

[tex]A = Pe^{-rt}[/tex]

[tex]A = A_{0}(1 - \frac{r}{n})^{nt}[/tex]

How to Identify Exponential Growth or decay Functions?

Exponential growth and decay function:

Exponential growth refers to when the quantity is increasing over time, while exponential decay refers to when the quantity is decreasing over time.

The general form of growth functions is:

y = [tex]ab^{kt}[/tex]

where: a ≠ 0 and b ≠ 0

The conditions for the functions are:

1) When b > 1, k > 0, it represents exponential growth function

2) When 0 < b < 1, k > 0, it represents exponential decay function

3) When b > 1, k < 0, it represents exponential decay function

Thus:

Growth functions are:

[tex]N = 2000(1.12)^{t}[/tex]

[tex]N = N_{0} e^{kt}[/tex] where k > 0

Decay Functions are:

[tex]A = A_{0}(0.95)^{t}[/tex]

[tex]N = N_{0} e^{kt}[/tex] where k < 0

[tex]A = Pe^{-rt}[/tex]

[tex]A = A_{0}(1 - \frac{r}{n})^{nt}[/tex]

Read more about Exponential Growth or decay Functions at: https://brainly.com/question/29634879

#SPJ1

in a party everyone present received 2 gifts from each of the other people present. If 480 gifts were exchanged,how many people attended the party

Answers

Answer:240

Step-by-step explanation:

divide 480 by the amount of gift everybody gets . 2

Answer:

I think the answer would be 240 people that received a gift.

Step-by-step explanation:

If there were 240 people at the party that received gift then we would check by dividing 480 and 2.

Why?

Simply because if there was 480 gifts and 2 were given to each person then it would only make sense that , that’s as the amount.

(2 persons would have 4 gifts, and if there was 240 people then there would be 480 gift brought to the party)

You pick two digits 0 through 9 at random without replacement and write them in the order picked what is the probability that you have written the first two digits of your phone number assume there are no repeats of digits in your phone number give your answer as a fraction

Answers

Alright, so let's assume your phone number has no repeated digits. The first task is to select the first digit of the two-digit number. Since phone numbers don't start with zero, you have 9 choices (1 through 9).

The next task is to select the second digit. Because we've already used one digit, and we're assuming there are no repeats in the phone number, we have 9 choices left (0 and the 8 digits that were not selected first).

That gives us a total of 9 * 9 = 81 possible two-digit numbers.

Now, your phone number has a specific first two digits, right? There's only one such combination that matches your phone number.

So the probability that the two-digit number you've selected matches the first two digits of your phone number is 1 in 81, or 1/81.

Think of it this way, my friend: Imagine you have a bag with 81 marbles, each marble has a unique two-digit number on it. You close your eyes and reach into the bag to pick a marble. The chance that you'll pick out the marble with your phone number's first two digits is just like finding one special marble in a bag of 81. It's quite the quest, isn't it? But that's what makes the game of probability so interesting!

Identify the solution for this system of equations
{4x + y = 7
{2y + 3= 3x - 16

A. (1,3)
B. (3,-5)
C. (7,-1)
D. No solution

Answers

The solution for the system of equations is (x, y) = B. (3, -5).

The correct option is B. (3, -5).

To find the solution for the system of equations:

{4x + y = 7

{2y + 3 = 3x - 16

We can solve it using the method of substitution or elimination. Let's use the method of elimination:

First, let's multiply the second equation by 2 to eliminate the variable y:

2(2y + 3) = 2(3x - 16)

4y + 6 = 6x - 32

Rearranging this equation, we get:

6x - 4y = 38 ----(1)

Now we have the system of equations:

4x + y = 7 ----(2)

6x - 4y = 38 ----(1)

Next, let's multiply equation (2) by 4 to eliminate the variable y:

4(4x + y) = 4(7)

16x + 4y = 28

Now we have the system of equations:

16x + 4y = 28 ----(3)

6x - 4y = 38 ----(1)

Adding equations (3) and (1) eliminates the variable y:

(16x + 4y) + (6x - 4y) = 28 + 38

22x = 66

x = 66/22

x = 3

Substituting the value of x into equation (2), we can solve for y:

4(3) + y = 7

12 + y = 7

y = 7 - 12

y = -5

for such more question on system of equations

https://brainly.com/question/12526075

#SPJ8

Please help
Factor

f(x) = 2×2 - 9x- 18
(2x + [?])(x - [ ])

Answers

Step-by-step explanation:

The quadratic expression f(x) = 2x^2 - 9x - 18 can be factored as (2x + 3)(x - 6). So, the missing values in the given expression (2x + [?])(x - [ ]) are 3 and 6, respectively.

Answer:

(2x + 3)(x -6)

Step-by-step explanation:

2x² -9x -18

2 × -18 = -36

Find factors of -36 which you multiply will give -36 but when same factors are added will give -9.

-12 × 3 = -36

-12 + 3 = -9

2x²-12x +3x -18

2x(x - 6) + 3(x -6)

(2x + 3)(x -6)

Find the area if the following circle circumference = 280cm find r from c

Answers

[tex]\textit{circumference of a circle}\\\\ C=2\pi r ~~ \begin{cases} r=radius\\[-0.5em] \hrulefill\\ C=280 \end{cases}\implies 280=2\pi r\implies \cfrac{280}{2\pi }=r\implies \cfrac{140}{\pi }=r \\\\[-0.35em] ~\dotfill\\\\ \textit{area of a circle}\\\\ A=\pi r^2 ~~ \begin{cases} r=radius\\[-0.5em] \hrulefill\\ r=\frac{140}{\pi } \end{cases}\implies A=\pi \left( \cfrac{140}{\pi } \right)^2 \\\\\\ A=\pi \cdot \cfrac{140^2}{\pi^2}\implies A=\cfrac{19600}{\pi }\implies A\approx 6238.87~cm^2[/tex]

For problems 6-7, state the postulate or theorem you would use to prove the triangles are similar.

Answers

Answer:

AA Postulate

Step-by-step explanation:

To prove that two triangles are similar in problem 6-7, we would use the Angle-Angle (AA) postulate. This postulate states that if two angles of one triangle are congruent to two angles of another triangle, then the triangles are similar.

A triangle has two sides of lengths 5 and 13. What value could the length of
the third side be? Check all that apply.
A. 5
B. 24
C. 8
D. 2
O E. 19
F. 10
>
SUBMIT

Answers

Answer:

Answer is simple

Step-by-step explanation:

just apply the Pythagoras theorem if u have Hypo nd perpendicular given than B(base) square will be B²=5²-13²

B²=✓144

=12

What numbers are missing from the pattern below? Enter your answer, using
a comma to separate each number.
120, 5, 48, 70, ?, ?, ?, ?, 120, 5, 48, 70
Answer here

Answers

To identify the missing numbers in the given pattern, let's examine the sequence:

120, 5, 48, 70, ?, ?, ?, ?, 120, 5, 48, 70

From observing the pattern, we can notice that it follows a specific sequence:

1st number: Multiply the following number by 2 and subtract 10: 5 * 2 - 10 = 0
2nd number: Add 43 to the previous number: 0 + 43 = 43
3rd number: Add 27 to the previous number: 43 + 27 = 70

Using this pattern, we can continue:

4th number: Multiply the previous number by 2 and subtract 10: 70 * 2 - 10 = 130
5th number: Add 43 to the previous number: 130 + 43 = 173
6th number: Add 27 to the previous number: 173 + 27 = 200
7th number: Multiply the previous number by 2 and subtract 10: 200 * 2 - 10 = 390

Therefore, the missing numbers are: 0, 43, 130, 173, 200, 390

If your grocery bills over the last four weeks were &203,&195,$180 and &238, what was the average bill?

Answers

Answer: $204

Step-by-step explanation:

203 plus 195 plus 180 plus 238 equals 816

816 divided by 4 equals 204

203+195=398

398+180=578

578+238=816

816/4=204

3
X-4
What is the center of f(x)?
Let f(x)
=
+2.

Answers

None of the answer choices (2,4), (2,-4), (4,2), or (4,-2) are applicable to the function f(x) = 3/(x-4) + 2. The function does not have a center point in the traditional geometric sense. Option E.

he function f(x) = 3/(x-4) + 2 does not have a center in the traditional sense. The concept of a center is typically associated with geometric figures such as circles or ellipses.

The function f(x) = 3/(x-4) + 2 represents a rational function. It does not have a central point or location like a circle, which has a center at (h, k). In this case, we are dealing with a rational expression involving x.

The equation f(x) = 3/(x-4) + 2 describes a vertical shift of the graph of the function 3/(x-4) by 2 units upward. However, this vertical shift does not correspond to a center point.

The function f(x) = 3/(x-4) + 2 does not have a center point. The concept of a center is not applicable in this context as it is commonly associated with geometric figures rather than rational functions. Option E is correct.

For more such question on function. visit :

https://brainly.com/question/11624077

#SPJ8

Solve for the measure of the indicated arc.
O Saved 41°
O
49°
45°
51⁰
131
M
?
K
45°

Answers

The value of x and the measure of the intercepted arc of the circle is 2 and 140 degrees respectively.

What is the value of x and the measure of the indicated arc?

An inscribed angle is simply an angle with its vertex on the circle and whose sides are chords.

The relationhip between an an inscribed angle and intercepted arc is expressed as:

Inscribed angle = 1/2 × intercepted arc.

From the image:

Inscribed angle Q = 70 degrees

Intercepted arc = 69x + 2

Value of x = ?

To solve for x, plug the given values into the above formula and solve for x:

Inscribed angle = 1/2 × intercepted arc.

70 = 1/2( 69x + 2 )

Multiply both sides by 2

2 × 70 = 2 × 1/2( 69x + 2 )

140 = 69x + 2

140 - 2 = 69x

138 = 69x

x = 138/69

x = 2

Now, to find the value of the intercepted arc:

Intercepted arc = 69x + 2

Plug in x = 2

Intercepted arc = 69( 2 ) + 2

Intercepted arc = 138 + 2

Intercepted arc = 140 degrees.

Therefore, the Intercepted arc measure 140 degrees.

Learn more about inscribed angles here: brainly.com/question/29017677

#SPJ1

System A -x-27-8=0 x-27= 8

The system has no solution.
O The system has a unique solution:
(x,7) =
O The system has infinitely many solutions.
They must satisfy the following equation: y =

Answers

The system has infinitely many solutions, and they can be expressed in the form (x, y) = (x, x - 27), where x can take on any real value.

The given system of equations is:

x - 27 - 8 = 0

x - 27 = 8

To solve this system, let's start by simplifying the second equation:

x - 27 = 8

Adding 27 to both sides, we get:

x = 35

Now we can substitute the value of x into the first equation

x - 27 - 8 = 0

35 - 27 - 8 = 0

8 - 8 = 0

0 = 0

We see that the equation is satisfied, which means that the system is consistent. However, the system is not unique because it has infinitely many solutions. This is because when we simplified the second equation, we obtained a value for x (x = 35) that satisfies both equations.

The system can be represented by the equation y = x - 27. Since x can take on any value, y will also vary accordingly. Therefore, the solutions to the system can be written as (x, y) = (x, x - 27), where x is any real number.

In summary, the system has infinitely many solutions, and they can be expressed in the form (x, y) = (x, x - 27), where x can take on any real value.

for more such question on infinitely   visit

https://brainly.com/question/30221799

#SPJ8

2.81729 please round to the nearest dollar​

Answers

Answer:

3

Step-by-step explanation:

3

2.81729 to the nearest dollar the asnwer is 3

Patient Name: Tom
Disease: Blastomycosis
Weight: 22 lbs

The Veterinarian has prescribed 10 mg/kg of ketoconazole PO q 12h

Concentration: 200 mg Tablets
Formula: D x W/C: Calculate the amount of medication needed for 60 days.

will mark brainliest!.

Answers

To calculate the amount of medication needed for 60 days, we can use the formula D x W/C, where:

D is the prescribed dosage (10 mg/kg),
W is the weight of the patient (22 lbs),
C is the concentration of the medication (200 mg tablets).

First, we need to convert the weight from pounds to kilograms. Since 1 lb is approximately 0.4536 kg, the weight of the patient in kg would be:

22 lbs * 0.4536 kg/lb = 9.9792 kg (approximately 10 kg)

Next, we can calculate the total dosage needed per day:

Dosage per day = D x W = 10 mg/kg * 10 kg = 100 mg/day

To calculate the number of tablets needed for 60 days, we multiply the dosage per day by the number of days:

Total dosage for 60 days = Dosage per day * 60 days = 100 mg/day * 60 days = 6000 mg

Now we can calculate the number of tablets needed:

Number of tablets = Total dosage / Concentration = 6000 mg / 200 mg/tablet = 30 tablets

Therefore, for a 60-day treatment, Tom will need 30 tablets of ketoconazole.

I need help with trigonometry.
I have an exam tmr, so could somebody tell me how to find lengths of a triangle and how to find the angles.
I knew how to, but i uave forgotten, and it's really irritating me.
Please

Answers

Certainly! I can help you with trigonometry. To find the lengths of a triangle and the angles, we typically use the trigonometric ratios: sine, cosine, and tangent. These ratios relate the angles of a right triangle to the lengths of its sides.

To find the lengths of a triangle:

1. If you have one angle and the length of one side, you can use the sine, cosine, or tangent ratio to find the lengths of other sides.2. If you have two sides and the included angle, you can use the Law of Cosines to find the length of the third side.3. If you have two angles and the length of one side, you can use the Law of Sines to find the lengths of the other sides.

To find the angles of a triangle:

1. If you have the lengths of two sides, you can use the Law of Cosines to find the measure of the included angle.2. If you have the lengths of two sides and the included angle, you can use the Law of Cosines to find the measure of the third side.3. If you have the lengths of two sides and the measure of the included angle, you can use the Law of Sines to find the measures of the other angles.

Remember to use the appropriate trigonometric ratio or trigonometric formula depending on the given information. Also, keep in mind the restrictions and conventions for angles and sides in triangles, such as the Pythagorean theorem and the sum of angles in a triangle.

I hope this helps! Good luck with your exam. If you have any specific questions or examples, feel free to ask.

[tex]\huge{\mathfrak{\colorbox{black}{\textcolor{lime}{I\:hope\:this\:helps\:!\:\:}}}}[/tex]

♥️ [tex]\large{\underline{\textcolor{red}{\mathcal{SUMIT\:\:ROY\:\:(:\:\:}}}}[/tex]

total surface area of a cuboid is 112^2 find x

Answers

123 this ensures that the sfheifdskdf d

The table below shows the number of days, y, needed to complete a project as a function of the number of full-time staff,
x, working on the project. Which rational function best models the data in the table?
People Working, x
36
18
8
6
Days, y
2
4
9
12

Answers

The rational function that best models the data in the table is: y = 72/x.

To determine the rational function that best models the given data, we can analyze the relationship between the number of full-time staff (x) and the number of days needed to complete the project (y).

Let's examine the data in the table:

People Working, x: 36, 18, 8, 6

Days, y: 2, 4, 9, 12

Based on the data, we can observe that as the number of full-time staff increases, the number of days needed to complete the project decreases. This suggests an inverse relationship between x and y.

One rational function that represents an inverse relationship is of the form y = k/x, where k is a constant. This function implies that as x increases, y decreases, and vice versa.

To find the specific value of k, we can use one of the data points from the table. Let's use the first data point (x=36, y=2):

2 = k/36

To solve for k, we can cross-multiply:

2 * 36 = k

k = 72

Therefore, the rational function that best models the data in the table is:

y = 72/x

This function suggests that the number of days needed to complete the project is inversely proportional to the number of full-time staff. As the number of staff increases, the number of days decreases, following a hyperbolic trend.

Please note that while this rational function provides a reasonable approximation of the data, it may not perfectly fit all the data points. Further analysis and additional data points could refine the model for greater accuracy.

for more such question on rational  visit

https://brainly.com/question/30339525

#SPJ8

Solve the equation. -3x+1+10x=x+4

Answers

Answer:

x = 1/2

Step-by-step explanation:

-3x + 1 + 10x = x + 4

7x + 1 = x + 4

6x + 1 = 4

6x = 3

x = 3/6

x = 1/2

Answer:

the solution to the equation is x = 1/2.

Step-by-step explanation:

To solve the equation -3x + 1 + 10x = x + 4, we can start by simplifying both sides of the equation:

Combine like terms on the left side:

(-3x + 10x) + 1 = x + 4

7x + 1 = x + 4

Next, we want to isolate the x term on one side of the equation. We can do this by subtracting x from both sides and subtracting 1 from both sides:

7x - x + 1 - 1 = x - x + 4 - 1

6x = 3

Finally, to solve for x, we divide both sides of the equation by 6:

6x/6 = 3/6

x = 1/2

So, the solution to the equation is x = 1/2.

Other Questions
Which of the following is true?a. Each EU country has its own external tariff on goods entering the country. b. Tariff rates applied to goods entering the EU are determined based on the type of good and the origin of the good. c. For the purpose of assessing the tariffs in the EU, the type of good will be determined using the same tariff classification system and the rest of the world's trading countries. d. All of the above are correct. Sketch the graph of y=g(x) by transforming the graph of y=f(x). Next, determine the horizontal asymptote by taking the limit of g(x). Then select the correct horizontal asymptote.* f(x)=9 ^x,g(x)=9 ( 5x+10 )3 *This question is worth four points. In order to receive full credit, you must show your work or justify your answer. y=1 y=7 y=3 y=8 None of these answers are correct. Dr. Harvey is therapist at a nearby clinic. When deciding on a treatment plan, he always references the current research in the field, and makes his decision based on which therapies have clear research support. What type of therapy is Dr. Harvey practicing? A.psychodynamic treatment B.syndrome-based treatment C.rapprochement treatment D.evidence-based treatment calvin spice invested $16,000 today in a fund that earns 8% compounded annuallyusefactor tables"To what amount will the investment grow in 2 years? To what amount would the investment grow in 2 years if the fund earns 8% annual interest compounded semiannually? (Round factor values to 5 decimal places, eg1.25124 and final answers to decimal placeseg 458.581)1.investment at 8% anunal intrest2.investment at 8% annual intrest, compaound anuanaly Suppose that your deadlock detection algorithm finds that there is a system deadlock. You know the following:The system is a batch systemYou are allowed to manually intervene with the deadlocked processesThe system has several processes that are low priority, and you are allowed to reallocate resources to processes as needed so long as you allow the original process to run eventually.The operating system is unlikely to deadlockGiven these parameters, what deadlock recovery method would you recommend? Why? Be sure to address each of the supplied parameters in your answer (they'll lead you to the right answer!). This should take no more than 5 sentences. Dividing Partnership Income Tyler Hawes and Piper Albright formed a partnership, investing $104,000 and $156,000, respectively. Determine their participation in the year's net income of $280,000 under each of the following independent assumptions: a. No agreement concerning division of net income. b. Divided in the ratio of original capital investment. c. Interest at the rate of 5% allowed on original investments and the remainder divided in the ratio of 2:3. d. Salary allowances of $38,000 and $49,000, respectively, and the balance divided equally. e. Allowance of interest at the rate of 5% on original investments, salary allowances of $38,000 and $49,000, respectively, and the remainder divided equally. Based off lewis theory and lewis structures. Which compound(s)would be expected to have both ionic and covalent bonds?NH4ClO4HC2H3O2Mg(OH)2H2SO4H3O+ A ball is shot out of a cannon at ground level. Its height H in feet after t sec is given by the function H(t) = 128t - 16t. a. Find H(2), H(6), H(3), and H(5). Why are some of the outputs equal? b. Graph the function and from the graph find at what instant the ball is at its highest point. What is its height at that instant? c. How long does it take for the ball to hit the ground? d. What is the domain of H? e. What is the range of H? The doubling period of a bacterial population is 1515 minutes.At time t=80t=80 minutes, the bacterial population was 90000.What was the initial population at time t=0t=0?Find the size of the bacterial population after 5 hours. Using dynamic programming with O(mn) runtime, find the length of the longest common substring given two strings k = k1, k2,.....k3 and r = r1, r2,......r3. That is, find the largest p for which there are indices i and p with ki, ki+1....ki+p-1 = ri, ri+1,.....rj+p+1. Name as many products as you can that are in Coca-Colas productmix. The radius of a right circular cone is increasing at 2 cm/sec and the height is decreasing at 3 cm/sec. Find the rate of change of the volume of the cone when the radius is 9 cm and the height is 12 cm. You might think that n-1 multiplications are needed to compute z", since I" = I. II But observe that, for instance, since 6 = 4 + 2, I = 11 = (1) 1. (Note: in binary, 6 is 110) Thus can be computed using three multiplications: one to computer, one to compute (r2)2, and one to multiply (22)2 times z. Similarly, since 11 8+2+1, = xxx = ((x)) xI (Note: in binary, 11 is 1011) So all can be computed using five multiplications. These potential patterns can be rewritten as: 26 = 21-22712120-20 211 21-230-22.71-21.1.20 a. Write an algorithm to take a real number z and a positive integer n and compute z". As you build the algorithm, note the relationship between the binary representation of n and the z2 terms that are included in the product. Remember that we can "shift" the binary digits of a number to the right by dividing by 2 (truncating to keep the value an integer) b.extra credit Analyze your algorithm in part (a) and determine the number of multiplications performed in terms of the value of n. c. Compare your algorithm's time complexity from part (b), with the solu- tion value of [log2 (n)]. If they are different, how much do they differ, and if not, what techniques did you use to approach your solution? the gas phase reaction a b + c s endothermic is carried out isothermally and isobarically in a PBR having a catalyst mass of 500 kg. If 100 mol/s of A are fed with an initial concentration of 1 mol/dm3, what conversion is achieved? The reaction rate constant k=0.1111 dm3/kg-s What main primary source does Euchner use for his analysis?O newspaper reportsO personal lettersO photographsO King's speech In response to the U.S. Supreme Court's Obergefell decision we discussed as an example of the resolution of a circuit split, Justice Scalia wrote the following in his dissenting opinion (italics in original): "...This Court...consists of only nine men and women, all of them successful lawyers, who studied at Harvard or Yale Law Schools. Four of the nine are natives of New York City. Eight of them grew up in the east and west coast states. Only one hails from the vast expanse in-between. Not a single South-westerner or even, to tell the truth, a genuine Westerner (California does not count). Not a single evangelical Christian (a group that comprises about one quarter of Americans), or even a Protestant of any denomination. The strikingly unrepresentative character of the body voting on today's social upheaval would be irrelevant if they were functioning as judges, answering the legal question whether the American people had ever ratified a constitutional provision [on the question at issue]. But of course the Justices in today's majority are not voting on that basis; they say they are not. And to allow the policy question [at issue] to be considered and resolved by a select, patrician, highly unrepresentative panel of nine is to violate a principle even more fundamental than no taxation without representation: no social transformation without representation." Christian (a group that comprises about one quarter of Americans), or even a Protestant of any denomination. The strikingly unrepresentative character of the body voting on today's social upheaval would be irrelevant if they were functioning as judges, answering the legal question whether the American people had ever ratified a constitutional provision [on the question at issue]. But of course the Justices in today's majority are not voting on that basis; they say they are not. And to allow the policy question [at issue] to be considered and resolved by a select, patrician, highly unrepresentative panel of nine is to violate a principle even more fundamental than no taxation without representation: no social transformation without representation." Explain whether you agree or disagree with this restrictive view of federalism and the role of judges in our common law system. e-mail headers contain which of the following information? (choose all that apply.)a. the sender and receiver e-mail addressesb. an esmtp number or reference numberc. the e-mail servers the message traveled through to reach its destinationd. the ip address of the receiving servere. all of the above Together, two teachers have a total of 40 students. Ms. fielder has 6 more students than Mr. Pearce. How many students does Ms. Felder have We are going to work with the HR database. Therefore, you should add HR sample databases to your SSMS by following steps: 1. On the Blackboard, open the "Assignment 2 -> Databases" folder. 2. Download the Create_HR.sql file. Then, open SSMS and execute the query to create the HR database. 3. Download the Load_HR_Data.sql file. Then, open SSMS and execute the query to populate the HR database (inserting data into the tables). Open the HR database as your default database, then complete assignment 2. # Question (using JOIN commands) mark Tables1 Write a SQL query to find the first name, last name, department number, and department name for each employee. (40 rows affected) 1 departments & employees2 Write a SQL query to find the first name, last name, department, city, and state province for each employee. (40 rows affected) 1 departments & employees & locations3 Write a SQL query to find all those employees who work in department ID 8 or 4. Return first name, last name, department number and department name. (7 rows affected) 1 departments & employees4 Write a SQL query to find those employees who earn less than the employee of ID 112. Return first name, last name, and salary. (20 rows affected) 1 employees5 Write a SQL query to find those employees who have or not any department. Return first name, last name, department ID, department name. (40 rows affected) 1 departments & employees # Question (using SUBQUERIES) mark Tables6 Write a SQL query to find those employees who get higher salary than the employee whose ID is 112. Return first name, last name. (19 rows affected) 1 employees7 Write a SQL query to find those employees whose salary matches the smallest salary of any of the departments. Return first name, last name, and department ID. (14 rows affected) Tip: use IN operator, and MIN function 2 employees8 Write a SQL query to find those employees who have a manager and do not work in those departments where manager ids are in the range 100, 200 (Begin and end values are included.) Return all the fields of the employees. (2 rows affected) Tip: use Not IN, BETWEEN, IS NOT NULL operators. 2 departments & employees SUM 10 calculate the amount of heat needed to melt 129g of solid hexanel (C6H14) and bring it to a temperature of 3.5 degrees C. be sure you answer has a unit symbol and the correct number of significant digits127g of hexane