.A solution that serves as a pH indicator may be made using red cabbage, which is frequently available in homes. In essence, the color of the cabbage depends on the acidity of the solution and a pigment molecule called flavin or anthocyanin.
To determine whether a material is an acid or a base, red cabbage indicator is a purple-colored solution
Vinegar is an acid and its pH value is less than 7 and hence
Red color is produced
Baking soda is base and its pH value is greater than 7 and between 8-9
and the color produced is sky blue
Bleach is the green which is also a basic and because the pH value is 10-11
Householder cleaner is having pH 11-13 which is basic and hence the yellow is the color of household cleaner .
A basic solution goes away from being basic and toward the center of the pH scale when an acid is introduced. The base is "neutralized" in this manner.
Learn more about pH value here
https://brainly.com/question/19584961
#SPJ10
entir
What is the striking back of
the
bunsen-
burner?
Answer:
With too little air, the gas mixture will not burn completely and will form tiny carbon particles that are heated to glowing, making the flame luminous. With too much air, the flame may burn inside the burner tube; that is, it may strike back.
what is the percent composition of each element within the compound
Answer:
The percentage composition of a given compound is defined as the ratio of the amount of each element to the total amount of individual elements present in the compound multiplied by 100. Here, the quantity is measured in terms of grams of the elements present.
please give me brainliest
How many moles of fluorine atoms are in a sample of fluorine that contains 7.45 x 10^24 fluorine atoms? (Report your answer to one place past the decimal point.
Based on the calculations, the number of moles of fluorine atoms present is equal to 12.4 moles.
How to calculate the moles of fluorine atoms?In order to determine the number of moles of fluorine atoms, we would calculate the number of atoms in 1 mole of an fluorine atoms in accordance with Avogadro's constant.
1 mole of fluorine atom = 6.02 × 10²³ molecules
X moles of fluorine atom = 7.45 × 10²⁴ molecules
Cross-multiplying, we have:
X = 7.45 × 10²⁴/6.02 × 10²³
X = 12.4 moles.
Read more on moles here: https://brainly.com/question/27952083
#SPJ1
A hydrate of zinc nitrate has the formula Zn(NO3)2 . xH2O. If the mass of 1 mol of anhydrous zinc nitrate is 63.67% of the mass of 1 mol of the hydrate, what is the value of x?
MM Zn(NO₃)₂ = 189.36 g/mol
mass 1 mol Zn(NO₃)₂ = 189.36 g
mass hydrate = 100 / 63.67 x 189.36 = 297.409 g
mass 1 mol hydrate = 297.409 g
MM hydrate = 297.409 g/mol
MM hydrate = MM Zn(NO₃)₂ + MM xH₂O
297.409 = 189.36 + x(18)
x = 6
Calculate how many grams would be required to prepare 600. 0 ml of 0. 150 m of naf? molar mass of naf is 41. 9 g/mo
Considering the definition of molarity and molar mass, the mass of NaF required is 3.771 grams.
Definition of molarityMolar concentration or molarity is a measure of the concentration of a solute in a solution and indicates the number of moles of solute that are dissolved in a given volume.
The molarity of a solution is calculated by dividing the moles of solute by the volume of the solution:
[tex]molarity=\frac{number of moles}{volume}[/tex]
Molarity is expressed in units [tex]\frac{moles}{liters}[/tex].
Definition of molar massThe molar mass of substance is a property defined as its mass per unit quantity of substance, in other words, molar mass is the amount of mass that a substance contains in one mole.
Mass of NaF requiredIn this case, you know:
molarity= 0.15 M= 0.15 [tex]\frac{moles}{L}[/tex]number of moles= ?volume= 600 mL= 0.6 LReplacing in the definition of molarity:
[tex]0.15\frac{moles}{L} =\frac{number of moles}{0.6 L}[/tex]
Solving:
0.15 [tex]\frac{moles}{L}[/tex] × 0.6 L= number of moles
0.09 moles= number of moles
The molar mass of NaF is 41. 9 g/mol. So, you can apply the following rule of three: If by definition of molar mass 1 mole of the compound contains 41.9 grams, 0.09 moles of the compound contains how much mass?
[tex]mass=\frac{0.09 molesx41.9 grams}{1 mole}[/tex]
mass= 3.771 grams
Finally, the mass of NaF required is 3.771 grams.
Learn more about
molar mass:
brainly.com/question/5216907
brainly.com/question/11209783
brainly.com/question/7132033
brainly.com/question/17249726
molarity:
brainly.com/question/9324116
brainly.com/question/10608366
brainly.com/question/7429224
#SPJ12
How many electrons are in a ion that has 16 protons and 59 neutrons if it has negative 2 charge?
some one please help me
Answer:
measure their densities
Which of the following is using chemical potential energy?
O A. An apple hanging on a tree
B. A water wheel turning in a stream
OC. A hiker eating an energy bar
OD. A petal falling from a flower
Among the following options eating an energy bar by a hiker using a chemical potential energy.
Wha is chemical potential energy ?Chemical potential energy is the energy stored in the chemical bonds of a substance.
The food we eat contains stored chemical energy.
As the bonds between the atoms in food loosen or break, a chemical reaction takes place, and new compounds are created.
The energy produced from this reaction keeps us warm, helps us move, and allows us to grow
Hence, eating an energy bar by a hiker using a chemical potential energy.
Learn more about chemical energy here ;
https://brainly.com/question/18644734
#SPJ1
Pls tell me how to solve this!
Answer:
12 seconds
Explanation:
Time taken by 50cm³ of oxygen to diffuse from pinhole
= 1 minute = 60 seconds
⠀
⠀
[tex] \textsf{ Rate of oxygen} \sf (O_2) = \frac{50}{60} [/tex]
⠀
⠀
⠀
Let time taken by 50cm³ of hydrogen to diffuse from pinhole = t seconds
⠀
⠀
[tex] \textsf {Rate of hydrogen } \sf(H_2) = \frac{50}{t} [/tex]
⠀
⠀
⠀
According to the formula
[tex] \sf \frac{Rate \: of \: hydrogen(H_2)}{Rate \: of \: oxygen(O_2) } = \sqrt{ \frac{Molar \: mass \: of \: O_2}{Molar \: mass \: of \: H_2} } [/tex]
⠀
⠀
[tex] \large \sf \frac{50}{t} \div \frac{50}{60} = \sqrt{ \frac{\cancel{32}\small 16}{\cancel2} } \\ \\ \sf \large \frac{ \cancel{50}}{t} \times \frac{60}{ \cancel{50}} = \sqrt{16} \\ \\ \sf \large \frac{60}{t} = 4 \\ \\ \sf \large \frac{ \cancel{60} \: \small12}{ \cancel4} = t \\ \\ \large \underline{ \boxed{ \tt t = 12 \: seconds}}[/tex]
⠀
⠀
⠀
Henceforth, the time taken by 50cm³ of hydrogen to diffuse is 12 seconds.⠀
⠀
Thank you!What is the volume in L of a 0.825 mole sample of Ar at 600 mm Hg and 300 K?
Answer:
V = 25.7 L
Explanation:
To find the volume of Argon (Ar), you need to use the Ideal Gas Law equation. This looks like:
PV = nRT
In this formula,
> P = pressure (atm)
> V = volume (L)
> n = number of moles
> R = constant (0.0821 L*atm/K*mol)
> T = temperature (K)
While there is a different constant that can be used if you want to keep the pressure in mmHg, there is a more common constant used when the pressure is in atm. So, to find the volume, you need to (1) convert mmHg to atm (by dividing by 760) and then (2) calculate the volume (using Ideal Gas Law).
(Step 1)
600 mm Hg 1 atm
------------------- x --------------------- = 0.789 atm
760 mm Hg
(Step 2)
PV = nRT
(0.789 atm) x V = (0.825 mole)(0.0821 L*atm/K*mol)(300 K)
(0.789 atm) x V = 20.32
V = 25.7 L
A 25.0 g sample of metal at
16.0 °C is warmed to 22.1 °C
by 259 J of energy.
What is the change in temperature
for the metal?
The answer to this question is change in temperature will be 6.1 and specific specific heat capacity of metal will be 1698.36.
According to the formula of Calorimetry
Q = msΔT
where, Q = Quantity of heat absorbed (in joules)
M = Mass of water sample given (in kilogram)
S = specific heat capacity of metal
ΔT = Change in temperature
We have given,
Mass as 25 gram which is equal to 0.025 Kg.
Change in temperature as 6.1
Quantity of heat absorbed as 259 J
Applying to the formula of Calorimetry
Q = msΔT
259 = 0.025 × s × 6.1
s = 1698.36
So, specific heat capacity of metal came out to be 1698.36 and the change in temperature will be 6.1
Learn more about Calorimetry here:
https://brainly.com/question/1407669
#SPJ10
Answer: specific heat is 1.7
Explanation:
after you answer this question itll then tell you to find the specific heat
functions of intercalary meristems
You are trying to determine the
mass of sodium chloride required to
create a 0.875 m solution in 534 g of
water. How many moles of NaCl are
required?
Answer:
Answer:
Mass = 27.291 g
Explanation:
Given data:
Mass of sodium chloride = ?
Mass of water = 534 g
Molality = 0.875 m
Solution:
Molality:
It is the number of moles of solute into kilogram of solvent.
Formula:
Molality = number of moles of solute / kilogram solvent
Mathematical expression:
m = n/kg
Now we will convert the g into kg.
Mass of water = 534 g× 1kg/1000 g = 0.534 kg
Now we will put the values in formula.
0.875 m = n / 0.534 kg
n = 0.467 mol
Now we will calculate the mass of sodium chloride:
Mass = number of moles × molar mass
Mass = 0.467 mol × 58.44 g/mol
Mass = 27.291 g
What is the oxidation state of Hg in Hg2Cl₂?
O A. +1
OB. -1
O C. +2
OD. -2
Answer:
+1
Explanation:
The oxidation state of Hg in Hg2Cl2 is +1. It has +1 state. 0=2Hg +2 (-1) Hg=+1. Mercury chloride (HgCl2) is considered as the dominant form of mercury in coal combustion flue gas. The oxidation state of an atom is the charge of this atom after ionic approximation of its heteronuclear bonds. The oxidation number is synonymous with the oxidation state. Determining oxidation numbers from the Lewis structure (Figure 1a) is even easier than deducing it from the molecular formula (Figure 1b). The oxidation number of each atom can be calculated by subtracting the sum of lone pairs and electrons it gains from bonds from the number of valence electrons. Bonds between atoms of the same element (homonuclear bonds) are always divided equally. When dealing with organic compounds and formulas with multiple atoms of the same element, it's easier to work with molecular formulas and average oxidation numbers (Figure 1d). Organic compounds can be written in such a way that anything that doesn't change before the first C-C bond is replaced with the abbreviation R (Figure 1c). Unlike radicals in organic molecules, R cannot be hydrogen. Since the electrons between two carbon atoms are evenly spread, the R group does not change the oxidation number of the carbon atom it's attached to.
source: www.chegg.com
Answer: O A. +1
Explanation: i took the test
Choose the correct statements when comparing 1 mole of carbon
monoxide and one mole of helium gas.
a: they weigh the same
b: they have the same amount of particles
c: they occupy the same volume
Answer: they have the same amount of particles
Explanation:
This statement is true by Avogadro's Law, which states that in a mole of any substance, there are [tex]6.022 \times 10^{23}[/tex] particles.
2.3 moles of CaBr2 contains how many molecules
Avogadro's law states that in every mole of a substance, there are [tex]6.022 \times 10^{23}[/tex] molecules.
This means that in 2.3 moles, there are [tex]2.3(6.022 \times 10^{23})=\boxed{1.4 \times 10^{24} \text{ (to 2 sf)}}[/tex]
12.11 liters of gas at atmospheric pressure is compressed into a 0.669 L gas cylinder. What is the pressure (mm Hg) of the compressed gas if its temperature remains constant?
a. 1.38e4
b. 42.0
c. 93.8
d. 18.1
Answer:
a. [tex]P_2=1.38*10^4[mmHg][/tex]
Explanation:
If the Temperature of a gas remains constant (and if the amount of gas molecules doesn't change), then compressing the gas from 12.11 L to 0.669L will increase its pressure through Boyle's Law: [tex]P_1V_1=P_2V_2[/tex]
We'll also need to recall that atmospheric pressure with units of mmHg (since that is the unit requested in the answer) is 760 mmHg.
Letting the initial Pressure and Volume be the P1 and V1, and the final pressure be the P2 and V2, we can substitute and solve:
[tex]P_1V_1=P_2V_2[/tex]
[tex](760[mmHg])(12.11[L])=P_2(0.669[L])[/tex]
[tex]\dfrac{(760[mmHg])(12.11[L \!\!\!\!-])}{0.669[L \!\!\!\!-]}=\dfrac{P_2(0.669[L]\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----})}{0.669[L]\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----}}[/tex]
[tex]13757.2496[mmHg]=P_2[/tex]
Since the final pressure is only measured to 3 significant figures, we round the pressure accordingly
[tex]13800[mmHg]=P_2[/tex]
Note that in scientific notation, this is [tex]P_2=1.38*10^4[mmHg][/tex], occasionally written as [tex]1.38\text{E}4[mmHg][/tex]
What units are represented by the numbers marked on the meterstick.
Answer:
Centimeters
Centimeter
⇒ metric unit of length equal to 0.01 (1/100) of a meter
The bonds of the product store 27 KJ more energy than the bonds of the reactants how is energy conserved during this reaction
A.The reaction creates 27 kj of energy when bonds form.
B.The reaction system absorbs 27 kj of energy from the surroundings.
C.The reaction uses up 27 kj of energy when bonds break.
D.The surroundings absorb 27 kj of energy from the reaction system.
ANSWER: the answer is b
If the bonds of the product store 27 KJ more energy than the bonds of the reactants, It means the surroundings absorb 27 kj of energy from the reaction system Hence, Option (D) is the correct answer
What is the Exothermic reaction ?An exothermic process releases heat, causing the temperature of the immediate surroundings to rise.
The bonds of the product store 27 KJ more energy than the bonds of the reactants, It means that energy has been absorbed by the surrounding as the product formed is more stable due to more stronger bond
This can be inferred from more stored energy with in the bonds and Thus, It is a exothermic reaction.Hence, Option (D) is the correct answer
Learn more about exothermic reaction here ;
https://brainly.com/question/9799465
#SPJ1
What mass of solute will dissolve in 100g of water at the following temperatures?
• KNO3 at 70°C =
• NaCl at 100°C=
• NH₂Cl at 90°C=
[tex]KNO_3[/tex] at 70°C = 130 gram
NaCl at 100°C= 40 gram
NH₂Cl at 90°C= 70 gram
What is solubility?Solubility is defined as the maximum amount of a substance that will dissolve in a given amount of solvent at a specified temperature.
Amount of a substance (called the solute) that dissolves in a unit volume of a liquid substance (called the solvent) to form a saturated solution under specified conditions of temperature and pressure. Solubility is expressed usually as moles of solute per 100 grams of solvent.
Hence,
[tex]KNO_3[/tex] at 70°C = 130 gram
NaCl at 100°C= 40 gram
NH₂Cl at 90°C= 70 gram
Learn more about solubility here:
https://brainly.com/question/14366471
#SPJ1
30 points!!!! Answer fast
EXPERIMENT: MAGNETISM Bar Magnet
1. Place the bar magnet on a table.
2. Put a sheet of glass or plastic over the magnet.
3. Sprinkle the iron filings over the sheet evenly.
4. On a separate paper, sketch the magnet. Show the lines made by the iron filings. Horseshoe Magnet
5. Place a horseshoe magnet on the table.
6. Put a sheet of glass or plastic over the magnet.
7. Sprinkle the iron filings over the sheet.
8. On a separate paper, sketch the magnet. Show the lines made by the iron filings. N Pole to N Pole
9. Place two bar magnets N pole to N pole with an inch between them.
10. Put a piece of glass or plastic over the magnets.
11. Sprinkle the iron filings over the glass or plastic.
12. On a separate paper sketch the magnets. Show the lines made by the iron filings. N Pole to S Pole
13. Turn one of the bar magnets around so the magnets are N pole to S pole with an inch between.
14. Sprinkle the iron filings over the glass or plastic.
15. On a separate paper sketch the magnets. Show the lines made by the iron filings.
From the information you have observed, determine the following:
What rule of magnetism is illustrated by the lines of the iron filings in Step 12?
What rule of magnetism is illustrated by the lines of the iron filings in Step 15?
Why was glass or plastic used to separate the filings from the magnets in the experiments?
Did the glass or plastic stop the passage of the magnetic lines of force?
Did the iron filings almost or completely bridge the open end of the horseshoe magnet?
The magnetism is either created inside a given element by passing some number of charges,Q across it or it is due to the interaction with a permanent magnet.
What is Magnetism ?
A physical phenomenon produced by the motion of electric charge, which results in attractive and repulsive forces between objects.
The magnet consists the characteristics of having an optimum amount of energy (P.E inside it) inside it.
As, the energy lines are either directed outwards from the north pole of the magnet, the south pole of the magnet consumes or absorbs the magnetic rays(energy lines) originated from the north pole of the magnet.
The right hand rule of magnetism is illustrated in the 12 point of the question.Learn more about magnetism here ;
https://brainly.com/question/2841288
#SPJ1
How many individual carbon atoms are contained in one mole of carbon? (Input your answer with scientific notation using "e-notation". (For example, the speed of light in m/s is 3.0 x 108; in "e-notation" this is 3.0e8.) Report your answer to two places past the decimal point. Moodle is looking for a number only, no units.)
6.023 ×[tex]10^{23}[/tex] individual carbon atoms are there in one mole of carbon.
Mass of a 1 [tex]C_{12}[/tex] atom= 12 amu
1 amu = 1.66 ×[tex]10^{-27}[/tex] gm
∴ 12 amu =1.99 ×[tex]10^{-21}[/tex] gm
∴Mass of a 1 [tex]C_{12}[/tex] atom=1.99 ×[tex]10^{-21}[/tex] gm
Mass of C in 1 mole = 12 gm
∴Total number of atoms of carbons in 1 mole = 12 ÷ 1.99 ×[tex]10^{-21}[/tex]
∴Total number of atoms of carbons in 1 mole= 6.023 ×[tex]10^{23}[/tex] atoms
6.023 ×[tex]10^{23}[/tex] individual carbon atoms are there in one mole of carbon.
The number 6.023 ×[tex]10^{23}[/tex] is known as Avogadro's number, which represents the number of individual atoms present in a one mole of substance with respect to [tex]C_{12}[/tex] atoms.
Learn more about Avogadro's number here...
https://brainly.com/question/14138110
#SPJ10
7 on the pH scale represents what?
Answer:
seven on the ph scale is the neutral point
Explanation:
The range goes from 0 - 14, with 7 being neutral. pHs of less than 7 indicate acidity, whereas a pH of greater than 7 indicates a base. pH is really a measure of the relative amount of free hydrogen and hydroxyl ions in the water.
A 250.ml sample of water was
boiled to 97.0°C then placed on
the counter to cool. If the water
cooled to11.0°C, how much heat
did it lose? Remember the
specific heat of water is 4.184
J/g°C.
Answer: The solubility of this gaseous solute will be,
Explanation :
First, we have to calculate the concentration of solute.
Now we have to calculate Henry's law constant.
Using Henry's law :
where,
C = concentration of solute =
p = partial pressure = 27.59 kPa
= Henry's law constant =?
Now put all the given values in the above formula, and we get:
Now we have to calculate the solubility of this gaseous solute when its pressure is 79.39 kPa.
Therefore, the solubility of this gaseous solute will be,
The Oxidation number of iron in the Complexion [Fe(CN) 6]³^- is what?
+3
Hence, the magnetic behaviour of the complex is paramagnetic. The oxidation number of the central metal atom: The oxidation number of the metal iron is +3.
Answer:
the oxidation number of iron in the complexion is +3 or x=+3
An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.
Can you find the difference between the following changes? why? a)rolling of chapati from dough b) baking of chapati
Answer:
They have different temperatures.
Explanation:
Answer:
a. when we are rolling the dough it only changes the shape, its a physical change.
b. we cant change the shape once its cooked, its a chemical change
Explanation:
hope it helps
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Answer:
1-bromo-6-chloro-5-methylheptane
Explanation:
There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.
The longest carbon chain consists of 7 carbons.
There are no double bonds, based on the saturation and substituents.
So you have a 1-bromo-6-chloro-5-methylheptane.
Hope that was the brainliest answer!
The volume of a gas is inversely proportional to the pressure of a gas is known as:.
Answer:
Boyle's law states this.
How many grams Fe2O3 would be
required to make 187 g Fe?
Fe₂O3 + 3CO → 2Fe + 3CO₂
266.63g of Fe2O3 would be required to make 187 g Fe in accordance with the following equation: Fe₂O3 + 3CO → 2Fe + 3CO₂.
How to calculate mass?The mass of a product or reactant can be calculated using stoichiometry as follows:
According to this question, iron oxide reacts with carbon monoxide as follows:
Fe₂O3 + 3CO → 2Fe + 3CO₂
1 mole of Fe2O3 produces 2 moles of Fe
Moles of Fe = 187/56 = 3.34mol
3.34/2 = 1.67 moles of Fe2O3 will be required to produce 3.34 moles of Fe.
mass of Fe2O3 = 1.67 mol × 159.69 g/mol = 266.63g
Therefore, 266.63g of Fe2O3 would be required to make 187 g Fe in accordance with the following equation: Fe₂O3 + 3CO → 2Fe + 3CO₂.
Learn more about mass at: https://brainly.com/question/14122402
#SPJ1
