Triangle 1 and Triangle 2 are congruent triangles.
Triangle 2 is obtained by translating Triangle 1 two units to the right and five units upwards.
When we translate a figure, we move it to a new position while keeping the shape and size of the figure the same. In this case, Triangle 2 has the same shape and size as Triangle 1, but it has been moved two units to the right and five units upwards.
To understand this concept better, let's consider an example.
Suppose Triangle 1 has vertices at (1, 2), (3, 4), and (5, 6). To obtain Triangle 2, we add 2 to the x-coordinates and 5 to the y-coordinates of each vertex. So, the vertices of Triangle 2 would be (1+2, 2+5), (3+2, 4+5), and (5+2, 6+5), which simplifies to (3, 7), (5, 9), and (7, 11).
Therefore, Triangle 2 has vertices at (3, 7), (5, 9), and (7, 11).
In general, when we translate a triangle, all the corresponding sides and angles remain the same. So, Triangle 1 and Triangle 2 are congruent triangles.
Learn more about Congruent Triangles here:
https://brainly.com/question/30097377
#SPJ11
Describe the different allotropes of carbon. Match the words in the left column to the appropriate blanks in the sentences on the right. Reset Help graphite In dispersion forces , carbon atoms are arranged in sheets. Within each sheet, the atoms are covalently bonded to one another by a network of sigma and pi bonds. Neighboring sheets are held together by Ionic bonds nanotubes In hydrogen bonds each carbon atom forma tour to four other carbon atoms in a tetrahedral geometry are long carbon structures, which consist of sheets of interconnected Cs rings that assume the shape of a cylinder (ike a roll of chicken wire) fullerenes covalent bonds diamond occur as soccer ball-shaped clusters of 60 carbon atoms (Co) and are black solids similar to graphite-the individual clusters are held to one another by What are the three categories of ceramics? Check all that apply. metallic ceramics hydride ceramics oxide ceramics silicate ceramics nonoxide ceramics borate ceramics nonmetallic ceramics Submit Province Anouare Dani What is the difference between the valence band and the conduction band? Match the words in the left column to the appropriate blanks in the sentence on the right. Reset Help valence band conduction band In band theory, electrons become mobile when they make a transition from the occupied molecular orbital into higher-energy empty molecular orbitals. For this reason, the occupied molecular orbitals are often called the and the unoccupied orbitals are called the highest lowest Review Constantie Consider the face centered cubic structure shown here Part A What is the length of the ine Gabeled e) that runs diagonaly across one of the faces of the cube in terms of the atomic radius? Express your answer in terms of C-4 Prvi An Correct Part Use the answer to Port And The Pythagoratheromo derive expression for the edge engine (t) in terms of Express your answer in terms of ΑΣΦ Submit Previous Answers Request Answer Review ContiPod Table Consider the body cerradbructure shown here Part A ✓ DO PI What is the length of their beled that runs from one comer of the cube diagonalt the center of the cube to the other comer in terms of the wome Express your answer in terms of Screen 020-07- Correct Part Use there there to drive an expression for the longth of the treated and diagonally across one of these be inform the edge 09 Post Express your newer in terms of OVO AL O Sub AM Review Constants Periodic Table Consider the body-centered Cubic structure shown here Part A What is the length of the line labeled c) that runs from one comer of the cube dagonally through the center of the cube to the other comes in terms of the atomic radial Express your answer in terms of ✓ Correct Part Use the moderne noget at ons only one of the focus of the cute in form the edge Express your answer in terms of IVOS - 5.6577 Submit * Incorrect; Try Again: 21 attempt remaining
The different allotropes of carbon are graphite, nanotubes, fullerenes, and diamond.
Describe the structure and properties of graphite.Graphite is an allotrope of carbon where carbon atoms are arranged in sheets, forming a two-dimensional hexagonal lattice.
Within each sheet, carbon atoms are covalently bonded to one another by a network of sigma and pi bonds, resulting in a strong and stable structure.
However, these sheets are held together by weak dispersion forces, allowing them to slide over each other easily. This characteristic gives graphite its slippery and lubricating properties. Graphite is an excellent electrical conductor due to the presence of delocalized electrons within the sheets, allowing electricity to flow through the planes.
Learn more about allotropes
brainly.com/question/13904504
#SPJ11
It is desired to prepare 600 mL of 0.100 noal NaOH for use in the reaction: HBr+NaOH⟶NaBr+H 2
O How many grams of NaOH are needed? 2 2 more group attempts remaining It is desired to prepare 800 mL of 0.300 noal NaOH for use in the reaction: HNO 3
+NaOH⟶NaNO 3
+H 2
O How many grams of NaOH are needed? g 2 more group attempts remaining The noality of an aqueous solution of perchloric acid is deteined by titration with a 4.04×10 −2
N barium hydroxide solution. If 34.3 mL of barium hydroxide are required to neutralize 19.8 mL of the acid, what is the noality of the perchloric acid solution? 2 more group attempts remalning The noality of an aqueous solution of hydrobromic acid is deteined by titration with a 0.310 N sodium hydroxide solution. If 31.0 mL of sodium hydroxide are required to neutralize 25.2 mL of the acid, what is the noality of the hydrobromic acid solution? N 2 mere oroup attempts remaining
We can see that 2.3994 grams of NaOH are needed to prepare 600 mL of 0.100 M NaOH
How many grams of NaOH are needed?To determine the mass of NaOH needed, we can use the formula:
Mass = Volume × Concentration × Molar Mass
Given:
Volume (V) = 600 mL = 600 cm³Concentration (C) = 0.100 mol/LMolar Mass of NaOH (M) = 22.99 g/mol + 16.00 g/mol + 1.01 g/mol = 39.99 g/molSubstituting the values into the formula, we have:
Mass = 600 cm³ × 0.100 mol/L × 39.99 g/mol
To cancel out the units, we can convert mL to L:
Mass = 0.600 L × 0.100 mol/L × 39.99 g/mol
Mass = 2.3994 g
Which means that approximately 2.3994 grams of NaOH are needed to prepare 600 mL of 0.100 M NaOH solution for the given reaction.
Learn more about chemical reactions at:
https://brainly.com/question/11231920
#SPJ4
1. True or False: Entropy is related to work. Briefly explain
your reasoning.
2. True or False: Entropy is directly proportional to the
multiplicity of a system. Briefly explain
your reasoning.
1. The given statement " Entropy is related to work" is false. Work is defined as energy transferred While entropy can be a factor in determining the efficiency of a system. 2. The given statement "Entropy is directly proportional to the multiplicity of a system" is true. As the number of arrangements or possible states of a system increases, so does its multiplicity, which in turn increases the system's entropy.
1. False: Entropy is not related to work. Entropy can be defined as the amount of disorder in a system. On the other hand, work is defined as energy transferred due to the application of force over a certain distance. While entropy can be a factor in determining the efficiency of a system, it is not directly related to work.
2. True: Entropy is directly proportional to the multiplicity of a system. Multiplicity is a measure of the number of ways that a system can be arranged while maintaining a constant energy level.
As the number of arrangements or possible states of a system increases, so does its multiplicity, which in turn increases the system's entropy.
This relationship is captured by the second law of thermodynamics, which states that the entropy of a closed system always increases over time.
Therefore, it is true that entropy is directly proportional to the multiplicity of a system.
Read more about Entropy at https://brainly.com/question/17185767
#SPJ11
Schiff's reagent is used to test for the presence of aldehydes as well as a dye for staining biological tissue. You have been given a few tissue sample to stain, but first you need to make a stock of Schiff's reagent. You need to make 700mls of Schiff's reagent. Schiff's reagent is an aqueous solution containing: - 1.5. 10−3M Fuchsin (C20H20 N3HCl) - 8. 10−2M Hydrochloric acid ( HCl ) You have a stock of Fuchsin powder and Sodium Bisulfited powder. You also have a 3M stock solution of Hydrochloric acid. To make a 700mls of Benedict's solution, you will need: - grams of Fuchsin; grams of Sodium Bisulfited: mls of Hydrochloric acid.
From the question;
1) The mass of the Fuchsin is 0.35 g
2) The mass of the sodium bisulphite 6.3 g
3) The mass of the HCl is 2.2 g
What is the moles?The mole allows chemists to relate the mass of a substance to the number of atoms or molecules it contains. The molar mass of a substance is the mass of one mole of that substance and is expressed in grams per mole.
We know that;
Number of moles = Concentration * volume
Number of moles = mass/Molar mass
Mass of fuchsin = 0.0015 * 0.7 * 338
= 0.35 g
Mass of the sodium bisulphite = 0.086 * 0.7 * 104
= 6.3 g
Mass of the Hydrochloric acid = 0.086 * 0.7 * 36.5
= 2.2 g
Learn more about moles:https://brainly.com/question/15209553
#SPJ4
Calculate the theoretical yield of virstatin in this
reaction.
1,8-naphthalic anhydride 0.50g
4-aminobutanoic acid 0.90 g
The theoretical yield of virstatin can be calculated based on the moles of reactants using the equation provided. In this case, the theoretical yield is calculated to be 0.148 g, but the actual yield may differ due to various factors.
The theoretical yield of virstatin can be calculated using the following equation:
Theoretical yield = moles of 1,8-naphthalic anhydride * moles of 4-aminobutanoic acid / moles of virstatin
The molar masses of 1,8-naphthalic anhydride, 4-aminobutanoic acid, and virstatin are 197.193 g/mol, 105.108 g/mol, and 283.283 g/mol, respectively.
Using these values, we can calculate the theoretical yield of virstatin as follows:
Theoretical yield = 0.50 g * 0.90 g / 283.283 g/mol = 0.148 g
Therefore, the theoretical yield of virstatin in this reaction is 0.148 g.
It is important to note that the actual yield of virstatin may be lower than the theoretical yield due to factors such as incomplete reaction, side reactions, and losses during purification.
To know more about theoretical yield refer here :
https://brainly.com/question/32891220#
#SPJ11
100 mL of a0.5mM butfer solution made from acetic acid and sodium goetato with PHH5.O is diluted to 4 L. What is the rho H of the dilated Solution?
The rho H of the diluted solution is 1.976 × 10^(-5).
The given terms in the question are: 100 mL, 0.5 mM, acetic acid, sodium acetate, pH 5.0, and diluted to 4 L.The initial molarity of the buffer can be calculated using the following formula: Molarity (M) = (moles of solute) / (liters of solution)
As per the question, we have 100 mL of 0.5 mM buffer solution made from acetic acid and sodium acetate. The moles of solute can be calculated as follows: Number of moles = (mass of solute) / (molar mass of solute)
We know the molar mass of acetic acid (CH3COOH) is 60.05 g/mol.
So, the mass of acetic acid in 100 mL of 0.5 mM buffer solution can be calculated as follows: mass of acetic acid = (molarity × volume × molar mass) / 1000= (0.5 × 100 × 60.05) / 1000= 3.003 g
Similarly, the mass of sodium acetate (NaC2H3O2) in 100 mL of 0.5 mM buffer solution can be calculated as follows: Number of moles of sodium acetate = (concentration × volume) / 1000= (0.5 × 100) / 1000= 0.05 moles Mass of sodium acetate = (number of moles × molar mass)= (0.05 × 82.03)= 4.1015 g
Now, we need to calculate the pH of the buffer solution.PH = pKa + log([salt]/[acid])Here, the pKa of acetic acid is 4.76. The concentration of the acetate ion ([salt]) can be calculated using the following formula:[salt] = moles of salt/volume of solution (in L)
The concentration of the acetic acid ([acid]) can be calculated using the following formula:[acid] = moles of acid/volume of solution (in L) Moles of acetic acid = mass / molar mass= 3.003 / 60.05= 0.04999 moles
Concentration of acetic acid = 0.04999 / 0.1= 0.4999 M Concentration of acetate ion = 0.05 / 0.1= 0.5 MpH = 4.76 + log(0.5/0.4999)= 4.76 + 0.002= 4.762 Now, we need to calculate the rho H of the diluted solution. Rho H = 10^(-pH)Rho H = 10^(-4.762)= 1.976 × 10^(-5)
to know more about buffer solution here:
brainly.com/question/31367305
#SPJ11
Draw the structure of 3-methylheptane and copy it in the InChl foat into the space.
To draw the structure of 3-methylheptane, we first need to understand what the molecule is. 3-methylheptane is an organic compound that has a molecular formula of C8H18. It is a branched hydrocarbon with a chain length of seven carbon atoms and a methyl group attached to the third carbon atom. To draw the structure of 3-methylheptane, we will need to follow a few simple steps:
Step 1: Draw a chain of seven carbon atoms in a straight line.
Step 2: Attach a methyl group (CH3) to the third carbon atom of the chain.
Step 3: Add hydrogen atoms to each carbon atom of the chain, making sure that each carbon atom has four bonds.
The resulting structure should look like this:
CH3 CH3
| |
CH3 - C - C - C - C - C - C - C
| |
H H
To copy the structure of 3-methylheptane in the InChl format, we can use the following code:
InChI=1S/C8H18/c1-4-5-6-7-8(2)3/h8H,4-7H2,1-3H3
This code represents the molecular formula of 3-methylheptane in a unique and standardized way that can be used to identify and search for the compound in various databases and chemical systems. Overall, the structure of 3-methylheptane is a simple yet important example of organic chemistry, and understanding its properties and applications can help us better understand the behavior of other hydrocarbons and organic compounds in nature and industry.
To know more about hydrocarbon visit:
https://brainly.com/question/30666184
#SPJ11
A chemist adds 0.45L of a 0.0438 mol/L potassium peanganate KMnO4 solution to a reaction flask. Calculate the millimoles of potassium peanganate the chemist has added to the flask. Be sure your answer has the correct number of significant digits.
The chemist has added approximately 19.71 millimoles of potassium permanganate (KMnO₄) to the flask, calculated by multiplying the volume of the solution (0.45 L) by the molarity of the solution (0.0438 mol/L) and converting to millimoles.
To calculate the millimoles of potassium permanganate (KMnO₄) added to the flask, we need to multiply the volume of the solution (in liters) by the molarity of the solution (in moles per liter).
To calculate the millimoles, we can use the following conversion factor:
1 mole = 1000 millimoles
Millimoles of KMnO₄ = Volume (L) × Molarity (mol/L) × 1000 (mmol/mol)
Plugging in the values:
Millimoles of KMnO₄ = 0.45 L × 0.0438 mol/L × 1000 mmol/mol
Millimoles of KMnO₄ = 19.71 mmol (rounded to two decimal places)
Therefore, the chemist has added approximately 19.71 millimoles of potassium permanganate (KMnO₄) to the flask.
To know more about potassium permanganate refer here :
https://brainly.com/question/14571753#
#SPJ11
4. Two volatile liquids, A & B, are mixed together. Under the conditions in the room, a pure sample of liquid A would have a vapor pressure of 40 torr, and a pure sample of liquid B would
Vapor pressure is the pressure of the gas phase in a dynamic equilibrium with the liquid or solid phase. The vapor pressure of a liquid increases with temperature.
The intermolecular forces of a substance influence the magnitude of its vapor pressure. In general, liquids with stronger intermolecular forces have lower vapor pressures than liquids with weaker intermolecular forces. Two volatile liquids, A & B, are mixed together. A pure sample of liquid A has a vapor pressure of 40 torr, and a pure sample of liquid B has a vapor pressure of 80 torr.
:X(A) = n(A) / (n(A) + n(B))and dx(B) = n(B) / (n(A) + n(B))where n(A) is the number of moles of liquid A, and n(B) is the number of moles of liquid B. Given :P(A) = 40 torrP(B) = 80 torr To find: P(total) when the mixture contains 4.0 moles of liquid A and 2.0 moles of liquid B we can use the following steps Calculate the mole fraction of each component:[tex]X(A) = n(A) / (n(A) + n(B))X(A) = 4.0 / (4.0 + 2.0) = 0.67X(B) = n(B) / (n(A) + n(B))X(B) = 2.0 / (4.0 + 2.0) = 0.33Calculate the vapor pressure of the mixture: P(total) = X(A)P(A) + X(B)P(B)P(total) = (0.67)(40 torr) + (0.33)(80 torr)P(total) = 26.8 torr + 26.4 torrP(total) = 53.2[/tex]torr
Therefore, the vapor pressure of the mixture of 4.0 moles of liquid A and 2.0 moles of liquid B is 53.2 torr.
To know more about Vapor pressure visit:
brainly.com/question/29640321
#SPJ11
Help
8.1 Question 8 Write the equation representing the reaction of diatomic fluorine with gaseous ammonia. 8.2 The reaction equations given below represent the hydrolysis of some xenon compounds. Co
8.1 The reaction of diatomic fluorine with gaseous ammonia is given as follows:F2(g) + 3NH3(g) → 6HF(g) + N2(g)8.2(i) XeF6(s) + 12H2O(l) → 2XeO3(s) + 12HF(aq) + 3O2(g) + 18H2O(l)(ii) XeO4(g) + 2H2O(l) → XeO6(s) + 4OH-(aq)The hydrolysis of xenon compounds is given as:
i) The hydrolysis of XeF6(s) in the presence of water yields xenon trioxide, fluorides, and oxygen gas. The reaction can be represented as ; XeF6(s) + 3H2O(l) → XeO3(s) + 6HF(aq) + 1.5O2(g)
ii) The hydrolysis of XeO4(g) results in the formation of xenon trioxide and hydroxide ions. The reaction can be represented as:XeO4(g) + 2H2O(l) → XeO6(s) + 4OH-(aq)
Know more about diatomic fluorine here,
https://brainly.com/question/20350141
#SPJ11
As was also discussed in class, high energy astrophysical events { e.g., a magnetar giant are { can, and have, signicantly impact(ed) the atmosphere of the Earth. Answer the following questions about such events: (a) The Earth's atmosphere has a total mass Matm 5,148 x10^21 g, and { by number is 78% molecular nitrogen N2 and 22% molecular oxygen O2. How many nitrogen and oxygen molecules are in the Earth's atmosphere? Answer this ques- tion assuming that the mass of one N2 molecule is mN2 = 28x1,660 10^(-24) g and the mass of one O2 molecule is mO2 = 32x1,660 10^(-24) g.
The number of nitrogen molecules in the Earth's atmosphere is 1.081 × 10^44 molecules, and the number of oxygen molecules in the Earth's atmosphere is 2.136 × 10^44 molecules.
The given mass of the Earth's atmosphere is M atm = 5.148 × 10^21 g. Assuming that the mass of one N2 molecule is mN2 = 28 × 1.660 × 10^(-24) g and the mass of one O2 molecule is mO2 = 32 × 1.660 × 10^(-24) g, we can find the number of nitrogen and oxygen molecules in the Earth's atmosphere as follows:
Step 1: Number of N2 molecules in Earth's atmosphere:
N2 molecules in Earth's atmosphere = (mass of N2 in Earth's atmosphere) / (mass of one N2 molecule)
Mass of N2 in Earth's atmosphere = (78/100) × M atm= (78/100) × 5.148 × 10^21= 4.01664 × 10^21 g
N2 molecules in Earth's atmosphere = (4.01664 × 10^21 g) / (28 × 1.660 × 10^(-24) g/molecule)= 1.081 × 10^44 molecules
Step 2: Number of O2 molecules in Earth's atmosphere:
O2 molecules in Earth's atmosphere = (mass of O2 in Earth's atmosphere) / (mass of one O2 molecule)
Mass of O2 in Earth's atmosphere = (22/100) × M atm= (22/100) × 5.148 × 10^21= 1.13256 × 10^21 g
O2 molecules in Earth's atmosphere = (1.13256 × 10^21 g) / (32 × 1.660 × 10^(-24) g/molecule)= 2.136 × 10^44 molecules
Therefore, the number of nitrogen molecules in the Earth's atmosphere is 1.081 × 10^44 molecules, and the number of oxygen molecules in the Earth's atmosphere is 2.136 × 10^44 molecules.
Learn more about nitrogen and oxygen molecules:
https://brainly.com/question/11324506
#SPJ11
Propionic acid is a weak acid with a Ka of 1.34×10^−5 . a. What is the pKa ? b.Over what pH range would propionic acid be part of an effective buffer? c. Assume that a propionic acid buffer system is prepared to produce a pH of 4.77. If the total concentration of HA and A − is 0.207M, what are the concentrations of each species? d. What is the concentration of H + at this pH(4.77) ?
Propionic acid would be part of an effective buffer within approximately ±1 unit of its pKa. So, the pH range for an effective propionic acid buffer would be around 4.87 ± 1, or 3.87 to 5.87.
a. The pKa can be calculated by taking the negative logarithm (base 10) of the Ka:
pKa = -log10(Ka)
Using the given Ka of propionic acid (CH3CH2COOH), we can calculate the pKa:
pKa = -log10(1.34×10⁻⁵)
pKa = -log10(Ka)
Given Ka = 1.34×10⁻⁵, we can calculate:
pKa = -log10(1.34×10⁻⁵) ≈ 4.87
b. Propionic acid would be part of an effective buffer within approximately ±1 unit of its pKa. So, the pH range for an effective propionic acid buffer would be:
pKa ± 1
The effective buffer range is approximately pKa ± 1, so for propionic acid, the buffer range would be around 4.87 ± 1, or 3.87 to 5.87.
c. To determine the concentrations of HA (propionic acid) and A⁻ (conjugate base), we can use the Henderson-Hasselbalch equation:
pH = pKa + log10([A⁻]/[HA])
Given:
pH = 4.77
Total concentration of HA and A⁻ = 0.207 M
Using the Henderson-Hasselbalch equation:
pH = pKa + log10([A⁻]/[HA])
Substituting the given values:
4.77 = 4.87 + log10([A⁻]/[HA])
Simplifying:
log10([A⁻]/[HA]) = 4.77 - 4.87
log10([A⁻]/[HA]) = -0.10
Taking the antilog of both sides:
[A⁻]/[HA] = [tex]10^{(-0.10) }[/tex]
[A⁻]/[HA] ≈ 0.794
Since the total concentration of HA and A⁻ is 0.207 M, we can set up the following equation:
[A⁻] + [HA] = 0.207
Substituting [A⁻]/[HA] = 0.794:
0.794[HA] + [HA] = 0.207
1.794[HA] = 0.207
[HA] ≈ 0.115 M
Substituting the value of [HA] into the equation, we can find [A⁻]:
[A⁻] = 0.207 - [HA]
[A⁻] ≈ 0.207 - 0.115
[A⁻] ≈ 0.092 M
Therefore, the concentrations are approximately:
[HA] ≈ 0.115 M
[A⁻] ≈ 0.092 M
d. The concentration of H⁺ can be determined by using the equation:
[H⁺] = [tex]10^{-pH}[/tex]
Substituting the given pH:
[H⁺] = [tex]10^{(-4.77)}[/tex]
[H⁺] ≈ 1.99 × 10⁻⁵ M
To know more about buffer follow the link:
https://brainly.com/question/31156212
#SPJ4
On average, an airplane produces 15 kg of carbon dioxide (CO2) per kilometre. A big airline with a very large fleet of planes hopes to keep emissions down and sets a goal of attaining a fleet average of 11 kg per kilometre. To see if the goal is being met, they check the CO2 emissions for 41 trips chosen at random, finding a sample mean of 12 kg per kilometre and a sample standard deviation of 2.5 kg per kilometre. Is there strong evidence that they have failed to attain their CO2 emission goal at a significance level of 5%? Conduct the appropriate hypothesis test.
(i) State the null and alternative hypotheses. Explain any notation you use.
(ii) Calculate the test statistic.
(iii) Identify the rejection region(s)(iv) State the conclusions.(v) Construct and interpret a 95% confidence interval for the population mean carbon dioxide (CO2) per kilometre. (vi) What assumptions were made when conducting the hypothesis test and confidence interval, and how would these assumptions be checked?
The test statistic is 2.08. Since the calculated test statistic (z = 2.08) falls in the rejection region (z > 1.645), we reject the null hypothesis.
(i) Alternative hypothesis: Ha: μ > 11 kg per kilometre (there is a significant difference between the sample and population mean)Where μ represents the population mean carbon dioxide (CO2) per kilometre.
(ii) The test statistic is given by
: z = (X - μ) / (σ / √n)
Where X = sample mean
= 12 kg per kilometre
μ = population
mean = 11 kg per kilometre
σ = population standard deviation
= 2.5 kg per kilometre
n sample size = 41
Therefore, z = (12 - 11) / (2.5 / √41)
= 2.08
(iii) Using a significance level of 5%, the rejection region is given by z > 1.645
(iv)This means that there is strong evidence that the airline has failed to attain their CO2 emission goal at a significance level of 5%.
(v) The 95% confidence interval is given by:
X ± zα/2(σ / √n) = 12 ± 1.96(2.5 / √41)
= (11.29, 12.71)
This means that we can be 95% confident that the true population mean carbon dioxide (CO2) per kilometre falls within the interval (11.29, 12.71) kg per kilometre.
(vi) The assumptions made when conducting the hypothesis test and confidence interval are:1. The sample is a random sample from the population2.
The population follows a normal distribution or the sample size is sufficiently large (n > 30)The normality assumption can be checked using a normal probability plot or a histogram. If the plot/histogram shows a roughly bell-shaped distribution, the normality assumption is met. Otherwise, the sample size can be checked. If the sample size is greater than 30, the central limit theorem can be used to approximate a normal distribution.
Learn more about hypothesis -
brainly.com/question/32456224
#SPJ11
a two step reaction mechanism is proposed for a gas phase reaction, as represented above. which of the follwoing correctly identifies both the chemical equation for step 1 and the rate law for the overall reaction? Step 1: (slow) Step 2: NO3(g) + CO(g) + NO2(g) + CO2(g) (fast) Overall: NO2(g) + CO(g) + NO(g) + CO2(g) A two-step reaction mechanism is proposed for a gas-phase reaction, as represented above. Which of the following correctly identifies both the chemical equation for step 1 and the rate law for the overall reaction? A ) The chemical equation for step 1 is 2 NO2(g) → NO(g) + NO3(g), and the rate law is rate = (NO,]. ( B ) The chemical equation for step 1 is NO2(g) + CO(g) + NO(g) + CO2(g), and the rate law is rate = [NO2][CO). c) The chemical equation for step 1 is NO3(g) + 2 CO(g) + NO(g) + 2 CO2(g), and the rate law is rate = [NO2][CO). D) The chemical equation for step 1 is NO3(g) + NO2(g) + 2 CO(g) + NO(g) + NO2(g) + 2 CO2(g), and the rate law is rate = [NO3][NO2][CO]".
The chemical equation for step 1 is 2 NO2(g) → NO(g) + NO3(g), and the rate law is rate = [NO2].
In the proposed two-step reaction mechanism, step 1 is the slow step, while step 2 is the fast step. In step 1, the chemical equation is 2 NO2(g) → NO(g) + NO3(g). This equation suggests that two molecules of NO2 react to form one molecule of NO and one molecule of NO3. Since step 1 is the slow step, it determines the overall rate of the reaction.
The rate law for the overall reaction is determined by the rate-determining step, which is step 1 in this case. The rate law is an expression that relates the rate of the reaction to the concentrations of the reactants. The rate law for the overall reaction can be written as rate = k[NO2], where k is the rate constant and [NO2] represents the concentration of NO2. This rate law indicates that the rate of the reaction is directly proportional to the concentration of NO2.
In summary, the chemical equation for step 1 is 2 NO2(g) → NO(g) + NO3(g), and the rate law for the overall reaction is rate = [NO2].
Learn more about rate law
brainly.com/question/14779101
#SPJ11
step by step please
8. The heat required to raise the temperature of a large cup of water (for coffec) from room temperature to boiling is approximately 100 {~kJ} . Express this quantity of heat in kilocalori
The amount of heat needed to raise the temperature of a large cup of water (for coffee) from room temperature to boiling is roughly 100 kJ.
Convert this amount of heat to kilocalories. The relationship between kilojoules and kilocalories is: 1 kilocalorie (kcal) = 4.184 kilojoules (kJ)Therefore, to convert 100 kJ to kilocalories:1. Determine the number of kilocalories per kilojoule.100 kJ × (1 kcal ÷ 4.184 kJ) = 23.85 kcal.Thus, the amount of heat needed to raise the temperature of a large cup of water from room temperature to boiling is about 23.85 kcal.
Learn more about the Heat:
https://brainly.com/question/934320
#SPJ11
2. The average density of human blood is 1.06 g/mL. What is the mass of blood (in kg ) in an adult with a blood volume of 1.5 gal? (1gal=3.78 L) 3. A small cube of aluminum measures 15.6 mm on each side and weighs 4.20 g. What is the density of aluminum in g/cm2 ? 4. To prevent bacterial infection, a doctor orders 4 tablets per day of amoxicilin for 10 days. If each tablet contains 250mg of amoxicillin, how many ounces of medication are given in 10 days? ( 1 oz =28 g; report answer to 2 significant figures) 5. An empty graduated cylinder weighs 45.70 g and filled with 40.0 mL of water (d=1.00 g/mL). A piece of lead submerged in the water brings the total volume to 67.4 mL and the mass of the cylinder and the contents to 396.4 g. What is the density of the lead (in g/cm3 )?
The mass of blood in an adult is 6.01 g.3. The density of lead is 13.0 g/cm³.
To calculate the mass of blood, the density of blood, and the blood volume is given. Using the given values of blood volume, the mass of blood can be calculated as follows:
Mass = Density × Volume
Given, blood volume = 1.5 gallons
= 1.5 × 3.78
= 5.67 L
Given, density of blood = 1.06 g/mL
Therefore,
Mass of blood = 1.06 × 5.67
= 6.01 g
The density of aluminum is required to be calculated.
The volume of the cube is V = l³
= (15.6 mm)³
= (1.56 cm)³
= 3.844 cm³
The mass of the cube is m = 4.20 g.
The density of aluminum is given as,
Density = mass / volume
Density = 4.20 g / 3.844 cm³
Density = 1.09 g/cm³
Hence, the density of aluminum in g/cm² is 1.09 g/cm².4. The amount of medication is given in mg, which needs to be converted to ounces.
To convert mg to ounces, 1 oz = 28,000 mg
Total amount of medication = 4 tablets/day × 250 mg/tablet × 10 days
= 10,000 mg
In ounces, the total amount of medication = (10,000 mg) / (28,000 mg/oz)
= 0.36 oz
≈ 0.36 ounces
Hence, the total amount of medication given in 10 days is 0.36 ounces.
The density of lead is to be calculated. The graduated cylinder has been filled with water, and its volume is given. The total volume is given after a piece of lead is added to the cylinder. The difference in volumes of the cylinder and water gives the volume of lead. The mass of the cylinder and water is given, from which the mass of lead can be calculated.
Volume of water = 40.0 mL
Volume of cylinder and lead = 67.4 mL
Volume of lead = Volume of cylinder and lead - Volume of water
= 67.4 mL - 40.0 mL
= 27.4 mL
Mass of cylinder and water = 396.4 g
Mass of water = Volume of water × Density of water
= 40.0 mL × 1.00 g/mL
= 40.0 g
Mass of lead = Mass of cylinder and water - Mass of water
= 396.4 g - 40.0 g
= 356.4 g
The density of lead is given as,
Density of lead = Mass of lead / Volume of lead
Density of lead = 356.4 g / 27.4 mL
= 356.4 g / 27.4 cm³
= 13.0 g/cm³
To know more about the density, visit:
https://brainly.com/question/29775886
#SPJ11
for a given reaction, the rate constant k was measured as a function of temperature t. from the data, a ln(k) versus \frac{1}{t} plot was generated, and the data was fit to a straight line. if the activation energy for the reaction is 42.04 \frac{kj}{mol} , then what is the slope (in joules) of the ln(k) versus \frac{1}{t} plot? (r
The slope of the ln(k) versus 1/t plot is -42,040 J/mol.
What is the value of the slope in joules/mol for the ln(k) versus 1/t plot?The slope of the ln(k) versus 1/t plot provides valuable information about the activation energy of a reaction. In this case, the given activation energy is 42.04 kJ/mol.
To determine the slope in joules, we need to convert the activation energy to joules by multiplying it by 1000 (1 kJ = 1000 J). Therefore, the activation energy is 42,040 J/mol.
Since the slope of the ln(k) versus 1/t plot represents the negative activation energy divided by the gas constant (R), the slope can be calculated as -42,040 J/mol.
Learn more about chemical kinetics.
brainly.com/question/31146511
#SPJ11
which of the following statements is (are) true for the compound (r)-2-butanol?
The following statements are true for the compound (R)-2-butanol:The IUPAC name of (R)-2-butanol is (R)-butan-2-ol.
It has a specific rotation value of +13.5°.It is an optically active compound because it can rotate the plane-polarized light to the right or clockwise, and thus, the prefix ‘R’ indicates its right-handedness.2-Butanol, also known as sec-butanol, is a colorless, water-soluble alcohol with a mild odor. (R)-2-butanol, also known as (R)-butan-2-ol, is a chiral organic compound that belongs to the family of secondary alcohols.
to know more about chemical reactions visit:
https://brainly.com/question/29762834
#SPJ11
Gatorade is an example of a:
Heterogencous Mixture
Homogeneous Mixture
Compound
Pure substance
Gatorade is an example of a homogeneous mixture.
A homogeneous mixture, also known as a solution, is a combination of substances that have a uniform composition throughout. In other words, the components of a homogeneous mixture are evenly distributed and cannot be easily distinguished.
Gatorade is made up of water, sugar, electrolytes, and flavorings. When these ingredients are mixed together, they form a solution where all the components are uniformly distributed. When you drink Gatorade, you don't see separate layers or particles floating around because it is a homogeneous mixture.
In contrast, a heterogeneous mixture would have visible differences in its components. For example, a salad with different vegetables and dressing is a heterogeneous mixture because you can see the separate components.
A compound, on the other hand, is a substance made up of two or more elements chemically combined. Gatorade does not fit this definition as it is a mixture of different substances rather than a compound.
Lastly, a pure substance is a substance that consists of only one type of particle, either an element or a compound. Gatorade contains multiple substances, so it is not a pure substance.
To summarize, Gatorade is an example of a homogeneous mixture because its ingredients are evenly distributed throughout the drink.
Learn more about homogeneous mixture here: https://brainly.com/question/16938448
#SPJ11
this alcohol was synthesized in three steps starting from a type of compound called an allene. an allene is a special type of diene that has two alkenes sharing a single carbon. the shared carbon is indicated by the dot. assuming the allene is the limiting reactant, what is the percent yield of this overall reaction? you started with 0.73 g of allene, and obtained 0.236 g of the product alcohol. (4 pts)
The percent yield of the overall reaction, starting from 0.73 g of allene and obtaining 0.236 g of the product alcohol, is 32.33%.
In this reaction, the starting material, allene, undergoes a series of steps to form the desired product, alcohol. The allene is considered the limiting reactant, meaning it is fully consumed in the reaction before any other reactants. The goal is to determine the percent yield of the overall reaction, which is a measure of how efficiently the desired product was obtained.
To calculate the percent yield, we need to compare the actual yield (the amount of product obtained) to the theoretical yield (the maximum amount of product that could have been obtained if the reaction proceeded with perfect efficiency).
Given that 0.73 g of allene was used as the starting material and 0.236 g of the product alcohol was obtained, we can calculate the theoretical yield using the stoichiometry of the reaction. However, since the reaction pathway and stoichiometry are not provided, we cannot determine the exact molar ratio between the allene and the alcohol. Therefore, we cannot calculate the theoretical yield accurately.
Nonetheless, we can still calculate the percent yield by dividing the actual yield by the theoretical yield (assuming 100% efficiency) and multiplying by 100. In this case, the percent yield is obtained by dividing 0.236 g (the actual yield) by the theoretical yield (which we cannot calculate) and multiplying by 100.
Therefore, the percent yield of the overall reaction is 32.33%.
Learn more about Percent yield
brainly.com/question/17042787
#SPJ11
Explain your answer. Thanks in
advance
What is the relationship between the following compounds? A. constitutional isomers B. different representations of the same molecule C. different molecules D. isotopes
A. Constitutional isomers: Compounds with the same molecular formula but different connectivity of atoms. B. Different representations of the same molecule: Various visual depictions of the identical chemical compound. C. Different molecules: Distinct chemical compounds with varying molecular formulas. D. Isotopes: Different forms of an element with the same number of protons but varying number of neutrons.
A. Constitutional isomers.
Constitutional isomers are compounds that have the same molecular formula but differ in the connectivity or arrangement of atoms. They have distinct chemical structures, meaning their atoms are bonded together in different ways.
B. Different representations of the same molecule.
Different representations of the same molecule refer to different ways of visually depicting the same chemical compound. For example, structural formulas, line-angle formulas, and Newman projections are different representations that convey the same molecular structure.
C. Different molecules.
Different molecules refer to distinct chemical compounds with different molecular formulas. They can have different arrangements of atoms and varying chemical properties.
D. Isotopes.
Isotopes are different forms of an element that have the same number of protons but differ in the number of neutrons. They have identical chemical properties but may have different physical properties due to variations in atomic mass.
The relationship between the compounds mentioned is best described as constitutional isomers (A) since they have the same molecular formula but differ in connectivity. They are not different representations of the same molecule (B), different molecules (C), or isotopes (D), as those terms imply different scenarios. Understanding these relationships is crucial in organic chemistry to differentiate between various types of chemical compounds.
To know more about Constitutional isomers click here:
https://brainly.com/question/31383016
#SPJ11
In today's experiment, we will be purifying a compound by recrystallizing it from water. How hot should we make the solution? Between 50 ∘
C and 55 ∘
C, measured with a theometer. Boil the heck out of it. Just below boiling. Between 80 ∘
C and 85 ∘
C, measured with a theometer. Just use hot water straight from the tap. A gentle boil.
Recrystallization is a common method used to purify solid substances. It involves dissolving the impure substance in a solvent and then allowing it to cool to form crystals. The pure substance will form the crystals first, while the impurities remain in the solvent.
The impurities can then be removed by filtering the crystals and washing them with a suitable solvent. Water is a commonly used solvent for recrystallization, as it is inexpensive and non-toxic. The temperature of the solvent is an important factor to consider when recrystallizing a compound. If the solvent is too hot, the compound may dissolve completely, making it difficult to remove the impurities. If the solvent is too cold, the compound may not dissolve enough to allow for effective purification.
The ideal temperature range for recrystallization is between 50 °C and 55 °C. This temperature can be measured using a thermometer. It is important to avoid boiling the solvent during recrystallization, as this can lead to loss of the compound through evaporation. Instead, a gentle boil or just below boiling is recommended. It is also possible to use hot water straight from the tap, provided that the temperature is within the recommended range.
To know more about common method visit:
brainly.com/question/30242985
#SPJ11
Which statement best provides evidence that the substance is a mutagen Brainly?.
The statement that best provides evidence that the substance is a mutagen is: "The substance has been shown to induce DNA mutations in laboratory tests."
Mutagens are substances that can cause changes, or mutations, in the DNA of living organisms. To determine whether a substance is a mutagen, it is necessary to conduct laboratory tests specifically designed to assess its potential mutagenic properties.
In these tests, the substance is exposed to a variety of biological systems, such as bacteria or mammalian cells, to observe if it induces DNA mutations. If the substance is found to cause DNA mutations in these tests, it is considered a mutagen.
The statement "The substance has been shown to induce DNA mutations in laboratory tests" is the best evidence that supports the substance being a mutagen. This statement indicates that the substance has undergone specific laboratory experiments, where it has been observed to cause changes in the DNA structure. Such observations are crucial in determining the mutagenic potential of a substance.
By inducing mutations in DNA, mutagens can increase the risk of developing genetic disorders and certain types of cancer. Therefore, identifying substances with mutagenic properties is essential for ensuring public health and safety.
Learn more about Mutagens
brainly.com/question/13244993
#SPJ11
please answer all of part A questions
Would measuring the melting point of your recrystallized sample before drying affect the observed melting point? Why or why not? Calculate the percent recovery for the recrystallization, making sure t
Measuring the melting point of a recrystallized sample before drying can potentially affect the observed melting point. This is because the melting point of a substance is influenced by the energy required to break intermolecular forces and transition from a solid to a liquid state. The percent recovery for the recrystallization process is 90%.
The presence of residual solvent or moisture in the sample can alter the melting behavior, potentially lowering the observed melting point or causing a broader melting range. This is because the melting point of a substance is influenced by the energy required to break intermolecular forces and transition from a solid to a liquid state.
If there is excess solvent or moisture present, it can interfere with these forces and affect the melting behavior of the compound. Additionally, impurities or contaminants may also impact the observed melting point, further complicating the measurement.
To calculate the percent recovery for the recrystallization, you need to know the initial amount of the compound before recrystallization and the final amount of the compound after recrystallization and drying.
Let's assume you started with 20 grams of the compound, and after recrystallization and drying, you obtained 18 grams of pure compound.
Percent Recovery = (Final amount / Initial amount) x 100
= (18 g / 20 g) x 100
= 90%
Therefore, the percent recovery for the recrystallization process is 90%.
To know more about recrystallized sample click here:
https://brainly.com/question/30545580
#SPJ11
The complete question is:
please answer all part A questions, we need to address the following:
Would measuring the melting point of your recrystallized sample before drying affect the observed melting point? Why or why not?
Calculate the percent recovery for the recrystallization, making sure to include all relevant data.
Aqueous hydrochloric acid (HCl) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (Natl) and liquid water ( H.O). What is the theoretical yleld of water foed from the reaction of 2.9 g of hydrochloric acid and 6.1 g of sodium hydroxide? Round your answer to 2 significant flgures.
The theoretical yield of water from the reaction of 2.9 g of hydrochloric acid and 6.1 g of sodium hydroxide is 1.4 g.
calculate the theoretical yield of water formed from the reaction of hydrochloric acid (HCl) and sodium hydroxide (NaOH), we need to determine the limiting reactant first.
The limiting reactant is the one that is completely consumed and determines the maximum amount of product formed.
Calculate the moles of HCl and NaOH:
Molar mass of HCl = 1.01 g/mol (hydrogen) + 35.45 g/mol (chlorine) = 36.46 g/mol
Molar mass of NaOH = 22.99 g/mol (sodium) + 16.00 g/mol (oxygen) + 1.01 g/mol (hydrogen) = 39.99 g/mol
Moles of HCl = mass / molar mass = 2.9 g / 36.46 g/mol
Moles of NaOH = mass / molar mass = 6.1 g / 39.99 g/mol
Determine the mole ratio between HCl and water from the balanced equation:
HCl + NaOH → NaCl + [tex]H_2O[/tex]
From the balanced equation, the ratio between HCl and [tex]H_2O[/tex]is 1:1. This means that for every mole of HCl, we will produce 1 mole of water.
Since the ratio is 1:1, the limiting reactant will be the one that has fewer moles. Let's compare the moles of HCl and NaOH to find the limiting reactant:
Moles of HCl = 2.9 g / 36.46 g/mol = 0.0795 mol
Moles of NaOH = 6.1 g / 39.99 g/mol = 0.1528 mol
Since HCl has fewer moles, it is the limiting reactant.
We can calculate the theoretical yield of water, which will be the same as the moles of HCl:
Theoretical yield of water = 0.0795 mol
Convert this to grams, we can use the molar mass of water:
Molar mass of [tex]H_2O[/tex]= 1.01 g/mol (hydrogen) + 16.00 g/mol (oxygen) = 18.01 g/mol
Theoretical yield of water in grams = moles of water × molar mass of water
= 0.0795 mol × 18.01 g/mol
Rounding the answer to two significant figures:
Theoretical yield of water = 1.4 g
The theoretical yield of water from the reaction of 2.9 g of hydrochloric acid and 6.1 g of sodium hydroxide is 1.4 g.
To know more about yield of water refer here
https://brainly.com/question/16359786#
#SPJ11
Incorrect The balanced equation for the reaction is Zn+2HCl ->ZnCl _(2)+H_(2) Determine the moles of HCl required for reaction with 1.4gZn and subtract that amount from the mol of HCl available.
The moles of HCl required for the reaction with 1.4g of Zn can be determined by stoichiometry and subtracting that amount from the total moles of HCl available.
The balanced equation for the reaction between zinc (Zn) and hydrochloric acid (HCl) is given as:
Zn + 2HCl → ZnCl₂ + H₂
From the balanced equation, we can see that 1 mole of Zn reacts with 2 moles of HCl. To determine the moles of HCl required for the reaction with 1.4g of Zn, we need to convert the mass of Zn to moles.
Using the molar mass of Zn (65.38 g/mol):
Moles of Zn = Mass of Zn / Molar mass of Zn
Moles of Zn = 1.4 g / 65.38 g/mol ≈ 0.0214 mol
According to the balanced equation, the mole ratio between Zn and HCl is 1:2. Therefore, 0.0214 mol of Zn would react with 2 × 0.0214 mol = 0.0428 mol of HCl.
To find the amount of HCl available, you would subtract the moles of HCl required (0.0428 mol) from the total moles of HCl available.
learn more about moles here
https://brainly.com/question/30892840
#SPJ11
Provide the formula and name of a pure substance that has dipole-dipole interactinne Edit View Insert Format Tonle.
Formula of a pure substance that has dipole-dipole interaction is HF, hydrogen fluoride. Dipole-dipole interaction happens between polar covalent molecules, and it is an attractive force between the partially charged ends of the molecules.
A pure substance that has dipole-dipole interactions is hydrogen fluoride (HF). The interaction between dipole molecules can either be attraction or repulsion; attraction occurs when a positively charged end of a molecule attracts the negatively charged end of another molecule, and repulsion happens when similarly charged ends interact. A dipole molecule is formed by the separation of charges, and it results from a molecule that has polar covalent bonds with a significant difference in electronegativity values.
HF molecule has a dipole moment of 1.82D and is an example of a polar covalent molecule with an uneven distribution of electrons. It has a boiling point of -83.6°C, a melting point of -92°C, and a density of 1.15 g/cm³. The high boiling and melting points of HF are as a result of the dipole-dipole interaction, which is more significant than that of London forces.
Dipole-dipole interactions depend on the magnitude of the dipole moment and the distance between the molecules. If the dipole moment is high and the molecules are close, the interaction will be stronger. When dipole-dipole interactions are significant, the boiling and melting points of a substance are relatively higher.
Know more about Dipole here:
https://brainly.com/question/30889172
#SPJ11
20 m| of diethy| ether is added to an Erlenmeyer flask containing a
NaCl salt. The flask is swirled for 2 minutes and the contents are
remains on the filter paper?
1. seprated salt
2. A mix of sand and salt
3.Nothing
The answer is 1. The salt will be separated from the mixture.
Diethyl ether is a nonpolar solvent, while NaCl is an ionic compound. When the diethyl ether is added to the mixture of NaCl and swirled, the ether will dissolve the NaCl due to its polar nature. The swirling helps in maximizing the contact between the solvent and the salt, facilitating the dissolution process.
However, when the mixture is filtered, the diethyl ether, being a volatile organic compound, will evaporate quickly, leaving behind the dissolved NaCl. The solvent evaporates because of its low boiling point and volatility, allowing the solid salt to remain on the filter paper.
As a result, the NaCl salt will be separated from the diethyl ether, forming a solid residue on the filter paper.
Therefore, option 1, "separated salt," is the correct answer.
learn more about salt here
https://brainly.com/question/5306491
#SPJ11
Consider the following energy-level diagram for a particular electron in an atom.
AE
Based on this diagram, which of the following statements is incorrect?
The wavelength of a photon emitted by the electron jumping from level 2 to level 1 is given by
2==
he
|ΔΕ|
If the electron is in level 1, it may jump to level 2 by absorbing a photon with energy of AE.
If the electron is in level 1, it may jump to level 2 by absorbing any photon having energy of at least
ΔΕ.
We would observe an electron jumping from level 2 to level 1 as a single line in a line spectrum.
If the electron is in level 2, it may jump to level 1 by emitting a photon with energy of AE.
The correct statement is;
The wavelength of a photon emitted by the electron jumping from level 2 to level 1 6 is given by λ=hc/ΔE. Option A
What is electron energy levels?
The electrons are grouped in distinct energy levels or shells encircling the atomic nucleus, according to the Bohr model of the atom. An integer value, commonly represented by the letters K, L, M, N, and so forth, is used to identify each energy level. The K shell is the innermost and has the lowest energy level of all the energy levels, which are arranged in ascending order of energy.
The movement of the electron from one energy level to the other would give the wavelength of the photon produced as λ=hc/ΔE.
Learn more about energy levels:https://brainly.com/question/30546209
#SPJ1
You need to make an aqueous solution of 0.222M iron(III) chloride for an experiment in lab, using a 250 mL volumetric flask. How much solid iron(III) chloride should you add? grams
A 250 mL volumetric flask is needed to generate a 0.222M iron(III) chloride aqueous solution for a scientific experiment. Therefore, you should add approximately 9.04 grams of solid iron(III) chloride to make a 0.222 M aqueous solution in a 250 mL volumetric flask.
To calculate the amount of solid iron(III) chloride needed, we can use the formula:
Amount of solid (in grams) = Concentration (in moles/L) × Volume (in L) × Molar mass (in g/mol)
Given:
Concentration = 0.222 M
Volume = 250 mL = 0.25 L
Molar mass of iron(III) chloride = 162.2 g/mol
Using the formula:
Amount of solid (in grams) = 0.222 mol/L × 0.25 L × 162.2 g/mol
Calculating the result:
Amount of solid (in grams) = 9.0393 g
Therefore, you should add approximately 9.04 grams of solid iron(III) chloride to make a 0.222 M aqueous solution in a 250 mL volumetric flask.
To know more about aqueous solution
https://brainly.com/question/19587902
#SPJ4
