What is the simplified form of StartRoot 100 x Superscript 36 Baseline EndRoot ?

10x Superscript 18
10x Superscript 6
50x Superscript 18
50

Answers

Answer 1

The simplified form of the expression √(100x³⁶) will be 10x¹⁸. Then the correct option is A.

What is simplification?

Making anything easier to accomplish or comprehend, as well as making it less difficult, is the definition of simplification.

The expression is given below.

⇒ √(100x³⁶)

Then the simplified form of the expression will be

⇒ √[(10x¹⁸)²]

⇒ 10x¹⁸

Then the correct option is A.

More about the simplification link is given below.

https://brainly.com/question/12616840

#SPJ1

Answer 2

Answer:

Step-by-step explanation:

Expert-Verified Answer

18 people found it helpful

ValeryMillan and many other Tutors are verifying Brainly answers

Tutors in math & science270 000 students helped

Want MORE expert-verified answers like this one? Try Brainly Tutor and get personalized help from a pro in minutes!

AFOKE88

Ace

13K answers

73.3M people helped

The simplified form of √(400x¹⁰⁰) is;

D; 20x⁵⁰

We want to find the simplified form of √(400x¹⁰⁰)

Now, according to laws of indices;

√ab = √a × √b

Thus;

√(400x¹⁰⁰) = √400 × √(x¹⁰⁰)

⇒ 20√(x¹⁰⁰)

Also according to law of indices;

a⁴ = a²  × a²

Thus;

x¹⁰⁰ = x⁵⁰ × x⁵⁰

Thus;

√(x¹⁰⁰) = √(x⁵⁰ × x⁵⁰)

⇒ x⁵⁰

Our final answer is;

20x⁵⁰


Related Questions

A thief steals an ATM card and must randomly guess the correct five-digit pin code from a 7-key keypad. Repetition of digits is allowed. What is the probability of a correct guess on the first try?

Answers

Answer:

1/(7^5)=1/16807

Step-by-step explanation:

Assuming 7-key mean zero up to 7,

# of possible codes = 17^5 = 16807

=====

Probability of first try correct = 1/7^5

which of the following are identities? check all that apply A. cot^2x+1=csc^2x B.tan^2=1-sec^2x C.sin2^x=1=cos^2x D.sin^2x+cos^2x=1

Answers

Sin^2x+cos^x=1 from there you can derive the other two identities by dividing by cos and sin
The answer is A and D

A company had the following purchases and sales during its first year of operations:


Purchases Sales
January: 10 units at $120 6 units
February: 20 units at $125 5 units
May: 15 units at $130 9 units
September: 12 units at $135 8 units
November: 10 units at $140 13 units

Answers

The final answer of the Inventory is $3540.

What is Inventory?

The term inventory refers to the raw materials used in production as well as the goods produced that are available for sale.

FIFO means first in, first out. It means that it is the first purchased inventory that is the first to be sold

Ending inventory comprises of goods bought in May, September and November

cost of the ending inventory :

(4 x $130) + (12 x $135) + (10 x$140) = $3540

Learn more about Inventory from:

https://brainly.com/question/15118949

#SPJ1

Which formula finds the probability that a point on the grid below will be in the blue area? A grid contains 20 squares. 10 squares are shaded blue. P (blue) = StartFraction total number of squares over number of blue squares EndFraction P (blue) = StartFraction number of blue squares over total number of squares EndFraction P (blue) = StartFraction number of blue squares over number of white squares EndFraction P (blue) = StartFraction number of white squares over number of blue squared EndFraction

Answers

The formula that finds the probability that a point on the grid below will be in the blue area is represented by the option:

P (blue) = StartFraction number of blue squares over the total number of squares EndFraction.

The probability = 1/2.

The probability of an event defines the chance of the occurrence of that event. It is given by the ratio of the total number of outcomes favorable to the event to the total number of outcomes in the experiment.

If we suppose an event to be A, the total number of possible outcomes favorable to A be n, and the total number of outcomes in the experiment be S, then the probability of event A can be given as:

P(A) = n/S.

In the question, we are asked to find the formula that defines the probability that a point on the grid will be in the blue area, where the grid contains 20 squares, 10 of them being shaded blue.

We take the event that the chosen point is in the blue area as A.

The total number of outcomes favorable to this event A can be given by n, which will be equal to the number of blue squares = 10

The total number of outcomes in the experiment can be given by S, which will be equal to the number of squares = 20.

Now, the formula for the probability of event A can be written as

P(A) = n/S = 10/20 = 1/2.

The formula that finds the probability that a point on the grid below will be in the blue area is represented by the option:

P (blue) = StartFraction number of blue squares over the total number of squares EndFraction.

Learn more about the Probability of an event at

https://brainly.com/question/7965468

#SPJ10

Let f(t) represent the temperature of a turkey baking in an oven as a function of time (t) in the oven (in minutes). This means time (t) is the independent variable and temperature of the turkey f(t) is the dependent variable. The turkey was in the oven for 360 minutes and then removed. Note that when something is baked in an oven, the temperature of the oven stays constant. The graph of the function is shown below.

Describe the rate of change pattern over each interval of the graph listed below.
a. 0 < t < 345
b. 345 < t < 360
c. t > 360

Explain what is happening in each interval of your graph in terms of the turkey and its temperature, using complete sentences.

Let's say that the turkey sat on the counter for an additional hour (beyond the 390 minutes) and its temperature cooled to 80 degrees. Write that value in function notation.

Answers

Answer:

a. When the time is greater than 0, but less than 345 minutes, the temperature of the turkey is increasing at roughly a linear rate.

b. When the time ranges from 345 to 360 minutes, the temperature of the turkey stays constant, at 165 degrees.

c. When the time is greater than 360 minutes, the temperature of the turkey decreases.

height of 24cm with a radius of 7cm. What is the total surface area of the cone?

Answers

Answer:

the answer to this problem is 703.7 in^2

Let −5, 3 be a point on the terminal side of θ. Find the exact values of cosθ, cscθ, and tanθ.

Answers

The value of cosθ = 3/√34, cscθ = -√34/5, and tanθ = -5/3 if the (−5, 3) be a point on the terminal side of θ.

What is the Pythagoras theorem?

The square of the hypotenuse in a right-angled triangle is equal to the sum of the squares of the other two sides.

We have (−5, 3) be a point on the terminal side of θ.

Perpendicular = -5

Base = 3

From Pythagoras' theorem:

Hypotenuse² =  (3)² + (-5)²

Hypotenuse = √34

cosθ = 3/√34

cscθ = -√34/5

tanθ = -5/3

Thus, the value of cosθ = 3/√34, cscθ = -√34/5, and tanθ = -5/3 if the (−5, 3) be a point on the terminal side of θ.

Learn more about Pythagoras' theorem here:

https://brainly.com/question/21511305

#SPJ1

f(x)= 2x^3 + 6x^2 -5x - 3, g(x)= 3x-4 find (f-g)(x)

Answers

The difference in the given functions is 2x^3 + 6x^2 -8x + 1

Difference of functions

Given the following function a shown

f(x)= 2x^3 + 6x^2 -5x - 3

g(x)= 3x-4

Take the difference

(f-g)(x) = f(x) - g(x)

Substitute

(f-g)(x)  = 2x^3 + 6x^2 -5x - 3 - (3x - 4)

Expand

(f-g)(x)  = 2x^3 + 6x^2 -5x - 3 - 3x + 4

(f-g)(x) = 2x^3 + 6x^2 -8x + 1

Hence the difference in the given functions is 2x^3 + 6x^2 -8x + 1

Learn more on polynomials here: https://brainly.com/question/2833285

#SPJ1

HELP pls. Which statement correctly demonstrates using limits to determine a vertical asymptote of

Answers

Answer:

Step-by-step explanation:

An auto mechanic charges (C) an initial fee of $50 and then $40 per hour. If (h) represents hours, how much will the mechanic charge if they worked 10 hours in one day?


$450
$400
$550
None of these choices are correct.

Answers

Answer:

$800

Step-by-step explanation:

per hour $40×10hours=$400

$400÷$50=8 times initial fee

8×$50=$400 total initial fee

$400hours fee+$400 initial fee=$800 total payment

Which of the following is a correctly written algebraic equation?
2 + 0.2x
5b - 5x + 2
a - 3x=0
3(x/5)

Answers

Answer:a-3x=0Step-by-step explanation:

ln Mathematics,algebra deals with representing numbers with symbols ( x, y ,z) in a mathematical expression.

A mathematical equation is a mathematical expression with equality sign.the answer that suits the definition is:a-3x=o

Number of Potatoes
36
24
12
5
10
Number of Pounds
x
15
Use the graph to find the unit rate.
potatoes per pound

Answers

36/15=2.4/1
2.4 potatoes per pound

what is the sign of f on the interval -5/9 < X < 2/3

Answers

Note that the sign of f on the interval -5/9 < x < 2/3 is negative. (Option B)

What is the explanation for the above?

To determine the sign of f(x) on the interval -5/9 < x < 2/3, we need to evaluate f(x) at a test point within this interval and determine if it is positive or negative.

Since we know that f(x) has zeros at x = -4, x = -5/9, and x = 2/3, we can use these points as our reference to choose test points.

Specifically, since the zeros at x = -5/9 and x = 2/3 are not included in the interval -5/9 < x < 2/3, we can choose any test point within this interval, such as x = 0.

Evaluating f(x) at x = 0, we get:

f(0) = (3(0) - 2)(0 + 4)(9(0) + 5)

= (-2)(4)(5)

= -40

Since f(0) is negative, we can conclude that f(x) is negative on the interval -5/9 < x < 2/3.

Therefore, the sign of f on the interval -5/9 < x < 2/3 is negative


Learn more about interval at:

https://brainly.com/question/30486507

#SPJ1

Full Question:

f(x) = (3x - 2) (x+4) (9x +5) has zeros at x = -4, x = -5/9, and x = 2/3, that is the sign of f on the interval -5/9 < x < 2/3?

NEED HELP ASAP !!!

Simplify: √16r
O 47²
O 473
87²
O 8-3

Answers

Answer:

4 r^3

Step-by-step explanation:

sqrt ( 16 r^6 )    = sqrt ( 4^2 * (r^3)^2  )    =   4 r^3

Daniel plays a shooting game in a funfair. He needs 48 points to get a skateboard. Each shot that hits the target will be given 6 points while 4 points will be deducted for every failed attempt. Daniel has already failed in three attempts. how many shots that are needed to hit the target for him to win the skateboard​

Answers

He need 60 points or 10 shots.

If f(x) =
√2x+3
6x-5
a. 1
b. -2
then f() =
C. -1
d. - 13

Answers

Answer:

put 1/2as a value of x in the equation and then solve .then the answer will be -1

Answer:

[tex]C.\ f\left( \frac{1}{2} \right) =-1[/tex]

Step-by-step explanation:

[tex]f\left( x\right) =\frac{\sqrt{2x+3} }{6x-5}[/tex]

In order to calculate f(1/2) ,all we have to do

is replacing x by 1/2 in the expression of f.

Then

[tex]f\left( \frac{1}{2} \right) =\frac{\sqrt{2\left( \frac{1}{2} \right) +3} }{6\left( \frac{1}{2} \right) -5 }[/tex]

        [tex]=\frac{\sqrt{1+3} }{3-5}[/tex]

        [tex]=\frac{\sqrt{4} }{-2}[/tex]

        [tex]=\frac{2}{-2}[/tex]

        [tex]=-1[/tex]

find sin(x/2), cos (x/2), and tan(x/2) from the given information.
Sin(x)= 15/17, 0 < x <90

sin(x/2)= ?
cos(x/2)=?
tan(x/2)= 0.6

I need help with sin and cos. I know what tan is.

Answers

Step-by-step explanation:

sin(x/2) = sqrt((1 - cos(x))/2)

cos(x/2) = sqrt((1 + cos(x))/2)

tan(x/2) = sin(x/2)/cos(x/2)

sin(x) = 15/17

so, we can assume the Hypotenuse of the right-angled triangle is 17, the vertical leg is 15.

via Pythagoras we get the 3rd, horizontal side :

17² = 15² + side²

289 = 225 + side²

64 = side²

side = 8

cos(x) = 8/17

sin(x/2) = sqrt((1 - 8/17)/2) = sqrt(9/34) = 3/sqrt(34) =

= 0.514495755...

cos(x/2) = sqrt((1 + 8/17)/2) = sqrt(25/34) = 5/sqrt(34) =

= 0.857492926...

tan(x/2) = 3/sqrt(34) / 5/sqrt(34) = 3/sqrt(34) × sqrt(34)/5 =

= 3/5 = 0.6

I keep putting in the formula but I keep getting the answer wrong​

Answers

Answer:

314 in²  (nearest whole number)

Step-by-step explanation:

Radius of a regular polygon: The distance from the center of the polygon to any vertex.  The radius of a hexagon is equal to the length of one side.

Therefore, from inspection of the given diagram:

radius = 11 in  ⇒  side length = 11 in

To find the area of a regular polygon, we first need to calculate the apothem.   The apothem is the line drawn from the center of the polygon to the midpoint of one of its sides.

[tex]\textsf{Length of apothem (a)}=\dfrac{s}{2 \tan\left(\frac{180^{\circ}}{n}\right)}[/tex]

where:

s = length of one siden = number of sides

Given:

s = 11 inn = 6

Substitute the given values into the formula and solve for a:

[tex]\implies \textsf{a}=\dfrac{11}{2 \tan\left(\frac{180^{\circ}}{6}\right)}=\dfrac{11\sqrt{3}}{2}[/tex]

Area of a Regular Polygon

[tex]\textsf{A}=\dfrac{n\:s\:a}{2}[/tex]

where:

n = number of sidess = length of one sidea = apothem

Given:

n = 6s = 11[tex]\textsf{a}=\dfrac{11\sqrt{3}}{2}[/tex]

Substitute the given values into the formula and solve for A:

[tex]\implies \sf A=\dfrac{6 \cdot 11 \cdot \dfrac{11\sqrt{3}}{2}}{2}[/tex]

[tex]\implies \sf A=314.3672216...[/tex]

[tex]\implies \sf A=314\:\:in^2\:\:(nearest\:whole\:number)[/tex]

Shashi has a rectangular garden. The length of the garden is 4 feet less than twice the width. The area of the garden is 448 square feet. What is the length of the garden?

Answers

Answer:

28 feet

Step-by-step explanation:

Area of a rectangle is :

A = L × W

We are given A and a expression for L, so let's substitute :

448 = (2W-4) × W

Now we expand the left side :

2W²-4w = 448

Subtract 448 from both sides :

2W²-4W-448 = 0

Divide everything by 2 :

W²-2W-224 = 0

Now we factorise :

Find 2 numbers that multiply to give -224 and add to give -2 :

-16 and 14

Rewrite -2W with -16W and +14W :

W² - 16W + 14W -224 = 0

W(W-16)  +14(W-16) = 0

(W+14)(W-16) = 0

W = -14 ,  W = 16

Only take positive value since this is lengths :

W = 16

Now we substitute W into the expression to find L :

L = (2W -4)

L = 2(16) - 4

L = 32 - 4

L = 28

Units will be feet since it is a length

Hope this helped and have a good day

Answer this! Thanks so much in advance (:

Answers

Answer:

ai) m = 17, applicable past x = 23/17; aii) m = 4; applicable past 3 dad jokes

Step-by-step explanation:

to calculate slope you use the (y2 - y1) / (x2 - x1) equation

so for the first one

(62 - 11) / (5 - 2)

51 / 3 = 17

the equation for this is y = 17x + b

plug in values to find b

11 = 34 + b

b is -23

y = 17x - 23

because distance cannot be negative we must find when x is exactly 0 to find where it is applicable

17x = 23

x = 23/17

for the second one we can subtract again

(10 - 2) / (5 - 3)

8 / 2

4 is the slope

like before we must find b and then find where y is 0

y = 4x + b

2 = 12 + b

b = -10

y = 4x - 10

4x = 10

x = 5/2

since you cannot have 1/2 a dad joke we round up from 2 1/2 to 3

Jack and Susan bought together 28 books. Susan bought 11 books. Which one of the
following equations represents the number of books bought by Jack? Let x be the
number of books bought by Jack.

Answers

Answer:

11 + x = 28

Step-by-step explanation:

The number of books they bought must add to 28.

Find x and y please help

Answers

Answer:

x is 130°,y is 60°

Step-by-step explanation:

x is corresponding to 130° therefore they are equal to find y since the angle on a straight line is 180° you subtract 180 from 130 and get 50 then you have gotten the other interior angle then add both interior angles and subtract by180 then you get the y

Answer:

X = 130° Y = 60°

both the lines are parallel

therefore, X= 130° ( if two lines are parallel their corresponding angles are equal)

Y + 70° = X ( sum of tow interior angle is equal to exterior)

Y + 70= 130

Y = 130 - 70

Y = 60°

What is the midpoint of AB?

Answers

Answer: Point G.

Step-by-step explanation:

Count the number of spaces between points A and B. Then divide that number by 2 and count that many spaces from one point.

14/2=7

I hope this helps!! Pls mark brainliest :)

point G is the answer, literally look at it, anyways trust

Please answer both questions I will give u brainliest if ur right

Answers

first one b 315, second d

Step-by-step explanation:

18*=3*+315

7*+4*=a*

What is the measure of complemnt angle

a)42° b) 35°

Answers

Answer:

90°

Step-by-step explanation:

A complement angle is the same as a right angle

Hii!

___________________________________________________________

Answer:

[tex]\sf 48\textdegree[/tex][tex]\sf 55\textdegree[/tex]

Step-by-step explanation:

The sum of complementary angles is always 90 degrees.

We can find the complements of these two angles by setting up an equation.

x+42=90

Subtract 42 from both sides

x=48

This problem can be solved the same way!

x+35=90

Subtract 35 from both sides

x=55

--

Hope that this helped! Best wishes.

--

what is the least common multiple of the numbers 8 and 12?
A. 24
B. 8
C. 4
D.96

Answers

The LCM of 18 and 12 is A.24

Answer:

A. 24

Step-by-step explanation:

Least common multiple of 8 and 12 = 24

8× 1 = 8 12×1 = 12

8×2 = 16 12×2=24

8×3 = 24

L.C.M (8,12) = 24

The greatest multiple that occurs in both the multiples of 8 and 12, is 24.

Hence, the least common multiple here is 24.

Christine splits 4/5 pounds of candy with 5 people. What is the unit rate in pounds per person. In simplest form

Answers

Answer:

4/25

Step-by-step explanation:

4/5 ÷ 5 = 4/5 × 1/5 = 4/25

pls someone help me asap :)

Answers

Answer:

right angle

acute

acute

obtuse

obtuse

Step-by-step explanation:

Since angle <ABC is a straight line, the angle is 180 degrees. This means all the angles in between should also add up to 180 degrees. Using this knowledge you can solve for the value of angle <FBE which is going to be equal to 180 - (40 + 25 + 50) = 65.

< DBF = <DBE + <EBF

< DBF = 25 + 65 = 90 (right angle)

<EBD = 25 (given) (acute)

<DBC = 50 (given) (acute)

<ABE = <ABF + <FBE

<ABE = 40 + 65

<ABE = 105 (obtuse)

<CBF = <CBD + <DBE + <EBF

<CBF = 50 + 25 + 65

<CBF = 140 (obtuse)

Which of the following is the best buy?

a 6 oz box of rice for $0.90
a 12 oz box of rice for $1.93
a 16 oz bag of rice for $2.42
a 9 oz box of rice $1.25

Answers

The best buy is (d) a 9 oz box of rice $1.25

How to determine the best buy?

The best buy is the product that has the least unit rate.

The unit rate is calculated as:

Unit = Price/Weight

So, we have:

Box 1:

Unit rate = $0.90/6 oz = $0.150 per oz

Box 2:

Unit rate = $1.93/12 oz = $0.161 per oz

Box 3:

Unit rate = $2.42/16 oz = $0.151 per oz

Box 4:

Unit rate = $1.25/9 oz = $0.139 per oz

The least unit price is $0.139 per oz for box 4

Hence, the best buy is (d) a 9 oz box of rice $1.25

Read more about unit rates at:https://brainly.com/question/7567839

#SPJ1

Translate and solve using proportions what percent of 120 is15

Answers

Answer:

12.5%

Step-by-step explanation:

To find what percent of 120 15 is, we must find what 15/120 is.

15/120 = 0.125. To convert to a percent, we move the decimal two places to the right. So, the answer is 12.5%.

Brainliest, please :)

Answer:

12.5%

Step-by-step explanation:

Other Questions
Endosymbiosis is considereda(n)...A. state.B. experiment.C. law.D. theory. State five importance of socializat 1The consent form is signed by the participant but is missing the participant's initials in several places. Which strategy helps to prevent this from occurring in the future with other participants? A. Conduct consent interviews in a quiet, separate room with no distractions or interruptions. B. The person obtaining the participant's consent must be present when the form is signed. C. Create and use a checklist to ensure that every detail in the informed consent process is completed. D. All of the above. Students in a reading class have three options for their book project: making a brochure, writing a news article, or designing a computer presentation. from past years, the teacher has determined that 20% of students usually choose to make a brochure, 30% of students usually choose to write a news article, and the remaining students usually choose to design a computer presentation. if the teacher uses 20 colored chips in three different colors to model this situation, how many colored chips should she use to represent each book project option? making a brochure: blue chips writing a news article: yellow ships designing a computer presentation: red chips One forth of one third of two fifths of a number is 15. What is the number? What is the ratio of the circumference of a circle to its radius? How effective is it to submit vendor invoices only? (x^2 + x - 17) + (x 4) divide using polynomial long division what is the value of sin(80)cos(20)-cos(80)sin(20) in oliver twist how does dickens show that asking for more was absolutely against the rules and that oliver was being treated as though he has done something very wrong? In photosynthesis, plants use energy from the sun to produce glucose, c6h12o6 , and oxygen from the reaction of carbon dioxide and water. 6co2 + 6h2o --> c6h12o6 + 6o2 what mass, in grams, of glucose is produced when 3.00 mol of water react with carbon dioxide? What is the theoretical yield of NaBrwhen 2.36 moles of FeBr3 reacts?2FeBr3 + 3Na2S FS3 + 6NaBr[?] mol NaBrRound your answer to the hundredths place Find the value of :[tex] \sf log_{3 \sqrt{2} }(324) [/tex] John walked from his home to work, it took him 12 min and the distance covered was 3 km. calculate the average speed in m/s what are tissues composed of in addition to cells? if someone ask you to write the tens in 1,567 would you write 67 or 6 if someone asks you to write the tens in 145,677 would you write 77 or 7if someone asks you to write the hundredths in 146,888would you write 688 or 8 or 888?? explain pls During prerace, an athlete who weighs 70 kg would need between _____ and _____ g of carbohydrate daily. Qu oracin es impersonal?Naden en el lago si quieren.Se puede nadar en este lago.Las autoridades permiten nadar en este lago.Se renen para nadar en el lago. Use the formula A=bxh to find the base of a parallelogram if the area is 228 cm and the height is 12 cm.O aObOOd19 cm1.9 cm19 cm 2none of the above As fully as you can, explain what ishmael means by "mother culture," and "her" relationship to us as individuals