Answers
Answer:
See below
Explanation:
The way to calculate this
speed of light = wavelength * frequency
3 x 10 ^8 m/s = wavelength * 2450000000 Hz
wavelength = .12245 meters
= 1.2245 x 10^-1 Meters
The wavelength of a microwave with a frequency of 2450 mhz is 1.2245 x 10⁻¹ meters.
What is wavelength?The wavelength is the time period or spatial period between the periodic wave and the distance between two waves. A microwave is a form of electromagnetic radiation.
The frequency of a microwave, f = 2450 MHz
We need to find the wavelength and the period of the microwaves
c = f λ
c = speed of light = 3 x 10 m/sec. 8 c = λf where λ = wavelength, f = frequency. Length
The relation between the wavelength and frequency is given by
The speed of light = wavelength x frequency
3 x 10⁸ m/s = wavelength x 24500 Hz
Wavelength = .12245 meters
1.2245 x 10⁻¹ Meters
Therefore, the wavelength of a microwave with a frequency of 2450 MHz is 1.2245 x 10⁻¹ meters.
To learn more about wavelength, refer to the link:
https://brainly.com/question/13091031
#SPJ5
Related Questions
12.11 liters of gas at atmospheric pressure is compressed into a 0.669 L gas cylinder. What is the pressure (mm Hg) of the compressed gas if its temperature remains constant?
a. 1.38e4
b. 42.0
c. 93.8
d. 18.1
Answers
Answer:
a. [tex]P_2=1.38*10^4[mmHg][/tex]
Explanation:
If the Temperature of a gas remains constant (and if the amount of gas molecules doesn't change), then compressing the gas from 12.11 L to 0.669L will increase its pressure through Boyle's Law: [tex]P_1V_1=P_2V_2[/tex]
We'll also need to recall that atmospheric pressure with units of mmHg (since that is the unit requested in the answer) is 760 mmHg.
Letting the initial Pressure and Volume be the P1 and V1, and the final pressure be the P2 and V2, we can substitute and solve:
[tex]P_1V_1=P_2V_2[/tex]
[tex](760[mmHg])(12.11[L])=P_2(0.669[L])[/tex]
[tex]\dfrac{(760[mmHg])(12.11[L \!\!\!\!-])}{0.669[L \!\!\!\!-]}=\dfrac{P_2(0.669[L]\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----})}{0.669[L]\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!\!{----}}[/tex]
[tex]13757.2496[mmHg]=P_2[/tex]
Since the final pressure is only measured to 3 significant figures, we round the pressure accordingly
[tex]13800[mmHg]=P_2[/tex]
Note that in scientific notation, this is [tex]P_2=1.38*10^4[mmHg][/tex], occasionally written as [tex]1.38\text{E}4[mmHg][/tex]
Can you find the difference between the following changes? why? a)rolling of chapati from dough b) baking of chapati
Answers
Answer:
They have different temperatures.
Explanation:
Answer:
a. when we are rolling the dough it only changes the shape, its a physical change.
b. we cant change the shape once its cooked, its a chemical change
Explanation:
hope it helps
Can someone help me please
Answers
Answer:D
Explanation:
Use the vertex form, y=a(x−h)2+ky=a(x-h)2+k, to determine the values of aa, hh, and kk.a=14a=14h=6h=6k=1k=1Find the vertex (h,k)(h,k).(6,1)(6,1)Find pp, the distance from the vertex to the focus.Find the distance from the vertex to a focus of the parabola by using the following formula.14a14aSubstitute the value of aa into the formula.14⋅1414⋅14Simplify.Combine 4 and 1/4 .1 /4/4Simplify by dividing numbersDivide 4 by 44.1/1Divide 1 by 1/1.Y=0 The Answer is DTemperature is one of the conditions that affects both physical and chemical change. Support the statement with an example.
Answers
Temperature affects both physical and chemical change because it modifies the state of matter and also it alters the rate of chemical reactions.
How does temperature affect physicochemical properties?Temperature affects physical properties by increasing the motion of constituent atoms and thus altering the state of matter.
Moreover, in a chemical reaction, an increase in temperature also affects the conversion rate of a reactant to one or more products.
In conclusion, temperature affects both physical and chemical change because it modifies the state of matter and also it alters the rate of chemical reactions.
Learn more about temperature effects here:
https://brainly.com/question/17928400
#SPJ1
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Answers
Answer:
1-bromo-6-chloro-5-methylheptane
Explanation:
There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.
The longest carbon chain consists of 7 carbons.
There are no double bonds, based on the saturation and substituents.
So you have a 1-bromo-6-chloro-5-methylheptane.
Hope that was the brainliest answer!
Lucite contains 59.9 g C, 8.06 g H,
and 32.0 g O. You want to
determine the empirical formula.
How many moles of H are in the
sample?
{?} mol H
Answers
59.9g C x (mol C / 12.01 g C) = 4.98 mol C
8.06g H x (mol H / 1.00 g H) = 8.06 mol H
32.0 g O x (mol O / 16.0 g O) = 2 mol O
So when you set it up you have
C4.98 H8 O2
You divide each by the smallest mol. The smallest mol is 2
C2 H4 O2.5
However you can’t have half a mol in the empirical formula. If the value ends in 0.5, you multiply everything by 2
You’re left with
C2H8O5
The EMPIRICAL formula for lucite is C2H8O5
Note empirical is not the same as chemical formula.
Answer:
8.00
Explanation:
I hope the spurs get wembanyama so bad
some one please help me
Answers
Answer:
measure their densities
The volume of a gas is inversely proportional to the pressure of a gas is known as:.
Answers
Answer:
Boyle's law states this.
The limiting reactant, O2, can form up to 2.7 mol Al2O3. What mass of Al2O3 forms?
Al2O3 : 101.96 g/mol
[?] g Al₂O3
Answers
Answer:
280 g Al₂O₃
Explanation:
To find the mass, you need to multiply the given value by the molar mass. This will cause the conversion because the molar mass exists as a ratio; technically, the ratio states that there are 101.96 grams per every 1 mole Al₂O₃. It is important to arrange the ratio in a way that allows for the cancellation of units. In this case, the desired unit (grams) should be in the numerator. The final answer should have 2 sig figs to reflect the given value (2.7 mol).
Molar Mass (Al₂O₃): 101.96 g/mol
2.7 moles Al₂O₃ 101.96 g
------------------------ x ------------------- = 275 g Al₂O₃ = 280 g Al₂O₃
1 mole
Neither n2 nor o2 are greenhouse gases because
Answers
Neither N₂ or O₂ are greenhouses gases because they do not cause the greenhouse effect.
What are greenhouses gases?Greenhouse gases trap heat in the atmosphere causing the temperature of the planet to rise.
Greenhouse gases cause the greenhouse effect.
What is the greenhouse effect?
The greenhouse effect is the warming up of the planet due to greenhouse gases.
Greenhouse gases include
carbondioxidemethanenitrous oxide and water vapourSo, neither N₂ or O₂ are greenhouses gases because they do not cause the greenhouse effect.
Learn more about greenhouse gases here:
https://brainly.com/question/2531992
#SPJ12
: 2NaOH + H,S0A - Na,SO A + 2H,0 How many moles of sodium sulfate (Na,SO,) reproduced when 5.0 moles of sodium hydroxide (Na0H) are reacted with excess sulfuric acid? A 2.5 moles B 1.0 moles C 5.0 moles D 2.0 moles
Answers
From the reaction, we can see that the number of moles produced is 2.5 moles of Na2SO4
What is a reaction?Chemical reaction involves the combination between two or more species. In this case, the reaction equation is; 2NaOH + H2S04 ----> Na2SO4 + 2H20.
Now we are told that sulfuric acid is in excess hence NaOH is the limiting reactant.
If 2 moles of NaOH produces 1 mole of Na2SO4
5 moles of NaOH produces 5 moles * 1 mole/ 2 moles
= 2.5 moles of Na2SO4
Learn more about chemical reaction:https://brainly.com/question/22817140
#SPJ1
Task 2. Protecting Your Model Village from Tsunamis In this task, you will design a model village to withstand the effects of a tsunami. Estimated time to complete: 1 hour You will need the following materials: 2 pieces of printer paper, 8 inches × 11 inches 2 pieces of card stock, 8 inches × 11 inches 1 piece of cardboard, 8 inches × 11 inches a long, shallow plastic container, around 30 inches long, 15 inches wide, and 5 inches deep tape or glue a small plate or tray water a ruler a small bag of sand, about 2 pounds Hypothesis and Data Collection
Part A Before you design your model village, write down the problems you observed in task 1. What were the largest risks to the community? What happened to the homes?
Part B Design a model village that addresses the problems you identified. Consider the following questions: Does elevation play a factor? If so, can the elevation be changed to protect the homes? Could the residents build a structure that would prevent a tsunami from reaching the community? What would this structure look like? How would the residents build it? What could limit the erosion of the beach?
Part C After you design your model, build your homes and place them in the same positions as they were in task 1. Build any additional structures you think will help protect these homes. Repeat the tsunami experiment from task 1, pushing the waves three to four times.
Analyze and Extend Part A Did your results match your predictions about the additional structure protecting the homes?
Part B To prevent damage from natural hazards, scientists must consider the best ways to keep people safe while also considering practicality in terms of cost, interference of new structures in day-to-day life, and other such factors. If your plan worked, was it a practical solution for the community? Can you think of any downsides to your plan? If it didn’t work, how would you improve your plan? Can you foresee any problems with executing your plan?
Part C. Tsunami evacuation plans often consider the elevation of the community and its distance from the shoreline when deciding which towns to evacuate. How could this data help in building new homes and communities along coastal areas that are prone to tsunamis?
Part D
The home in the picture below is from a tsunami-prone area. Based on the results of your experiment, do you think the structure of this home would protect against tsunamis? I'LL GIVE BRAINLIEST TOO.
Answers
The structure of this home would protect against tsunamis due to its height and hard structure.
Does the structure of this home would protect against tsunamis?Yes, in my opinion, the structure of this home would protect against tsunamis because of 8 foot tall wall that is present around the house. This wall is enough to protect the house from tsunamis due to its long height and hard composition.
So we can conclude that the structure of this home would protect against tsunamis due to its height and hard structure.
Learn more about tsunamis here: https://brainly.com/question/7697233
#SPJ1
An elemen belongs to group 17 of the periodic table. This element is most likely a.
Answers
Answer:
halogen
Explanation:
group 17 contains halogens
Answer:
The group 17 falls int he halogen category the element most likely Fluorine Chlorine Bromine Tennessine
Explanation:
Choose the correct statements when comparing 1 mole of carbon
monoxide and one mole of helium gas.
a: they weigh the same
b: they have the same amount of particles
c: they occupy the same volume
Answers
Answer: they have the same amount of particles
Explanation:
This statement is true by Avogadro's Law, which states that in a mole of any substance, there are [tex]6.022 \times 10^{23}[/tex] particles.
entir
What is the striking back of
the
bunsen-
burner?
Answers
Answer:
With too little air, the gas mixture will not burn completely and will form tiny carbon particles that are heated to glowing, making the flame luminous. With too much air, the flame may burn inside the burner tube; that is, it may strike back.
How many grams MnO2 are needed
to generate 126.0 g Zn(OH)2?
Zn + 2MnO₂ + H₂O → Zn(OH)2 + Mn₂O3
Answers
The mass of manganese oxide (MnO2) that is needed to generate 126.0 g Zn(OH)2 is 220.56 g.
Mass of manganese oxide needed
The mass of MnO2 that is needed to generate 126.0 g Zn(OH)2 is calculated as follows;
Zn + 2MnO₂ + H₂O → Zn(OH)2 + Mn₂O3
From the reaction above;
2(87 g/mol of MnO₂) ---------> 99.4 g/mol of Zn(OH)2
174 ---------------------> 99.4
? -------------------------> 126
= (126 x 174)/99.4
= 220.56 g
Learn more about manganese oxide here: https://brainly.com/question/13284464
#SPJ1
Answer:
220.56
Explanation:
Which of the following is using chemical potential energy?
O A. An apple hanging on a tree
B. A water wheel turning in a stream
OC. A hiker eating an energy bar
OD. A petal falling from a flower
Answers
Among the following options eating an energy bar by a hiker using a chemical potential energy.
Wha is chemical potential energy ?Chemical potential energy is the energy stored in the chemical bonds of a substance.
The food we eat contains stored chemical energy.
As the bonds between the atoms in food loosen or break, a chemical reaction takes place, and new compounds are created.
The energy produced from this reaction keeps us warm, helps us move, and allows us to grow
Hence, eating an energy bar by a hiker using a chemical potential energy.
Learn more about chemical energy here ;
https://brainly.com/question/18644734
#SPJ1
Which of the following statements are true of thermal energy and kinetic
energy?
Check all that apply.
A. All the molecules or atoms in motion have kinetic energy.
B. All the molecules or atoms in motion have thermal energy.
C. Each molecule or atom in motion has thermal energy.
D. Each molecule or atom in motion has kinetic energy.
Answers
Answer:
A. All the molecules or atoms in motion have kinetic energy.
B. All the molecules or atoms in motion have thermal energy.
C. Each molecule or atom in motion has thermal energy.
D. Each molecule or atom in motion has kinetic energy.
Explanation:
How many individual carbon atoms are contained in one mole of carbon? (Input your answer with scientific notation using "e-notation". (For example, the speed of light in m/s is 3.0 x 108; in "e-notation" this is 3.0e8.) Report your answer to two places past the decimal point. Moodle is looking for a number only, no units.)
Answers
6.023 ×[tex]10^{23}[/tex] individual carbon atoms are there in one mole of carbon.
Mass of a 1 [tex]C_{12}[/tex] atom= 12 amu
1 amu = 1.66 ×[tex]10^{-27}[/tex] gm
∴ 12 amu =1.99 ×[tex]10^{-21}[/tex] gm
∴Mass of a 1 [tex]C_{12}[/tex] atom=1.99 ×[tex]10^{-21}[/tex] gm
Mass of C in 1 mole = 12 gm
∴Total number of atoms of carbons in 1 mole = 12 ÷ 1.99 ×[tex]10^{-21}[/tex]
∴Total number of atoms of carbons in 1 mole= 6.023 ×[tex]10^{23}[/tex] atoms
6.023 ×[tex]10^{23}[/tex] individual carbon atoms are there in one mole of carbon.
The number 6.023 ×[tex]10^{23}[/tex] is known as Avogadro's number, which represents the number of individual atoms present in a one mole of substance with respect to [tex]C_{12}[/tex] atoms.
Learn more about Avogadro's number here...
https://brainly.com/question/14138110
#SPJ10
What is the oxidation state of Hg in Hg2Cl₂?
O A. +1
OB. -1
O C. +2
OD. -2
Answers
Answer:
+1
Explanation:
The oxidation state of Hg in Hg2Cl2 is +1. It has +1 state. 0=2Hg +2 (-1) Hg=+1. Mercury chloride (HgCl2) is considered as the dominant form of mercury in coal combustion flue gas. The oxidation state of an atom is the charge of this atom after ionic approximation of its heteronuclear bonds. The oxidation number is synonymous with the oxidation state. Determining oxidation numbers from the Lewis structure (Figure 1a) is even easier than deducing it from the molecular formula (Figure 1b). The oxidation number of each atom can be calculated by subtracting the sum of lone pairs and electrons it gains from bonds from the number of valence electrons. Bonds between atoms of the same element (homonuclear bonds) are always divided equally. When dealing with organic compounds and formulas with multiple atoms of the same element, it's easier to work with molecular formulas and average oxidation numbers (Figure 1d). Organic compounds can be written in such a way that anything that doesn't change before the first C-C bond is replaced with the abbreviation R (Figure 1c). Unlike radicals in organic molecules, R cannot be hydrogen. Since the electrons between two carbon atoms are evenly spread, the R group does not change the oxidation number of the carbon atom it's attached to.
source: www.chegg.com
Answer: O A. +1
Explanation: i took the test
how many electrons do noble gases have
Answers
Noble gases have 8 electrons in the outermost shells.
What are noble gases?They are the chemical elements that belong to group 8A of the periodic table.
They belong to group 8 because they have 8 electrons in their outermost shells. Their electron configuration is an octet. In other words, they do not need to donate or accept electrons to be stable.
Noble gases include helium, neon, argon, etc.
More on noble gases can be found here: https://brainly.com/question/11764545
#SPJ12
functions of intercalary meristems
Answers
A sealed container can hold
0.325 L of gas at 1.00 atm
and 293 K. How many moles of gas
can the container hold?
Answers
0.216 moles of gas can the container hold if a sealed container can hold 0.325 L of gas at 1.00 atm and 293 K.
What is an ideal gas equation?The ideal gas law (PV = nRT) relates the macroscopic properties of ideal gases. An ideal gas is a gas in which the particles (a) do not attract or repel one another and (b) take up no space (have no volume).
PV=nRT, where n is the moles and R is the gas constant. Then divide the given mass by the number of moles to get molar mass.
Given data:
R = gas constant = 0.08206 L.atm / mol K
T = temperature, Kelvin
V=5 L
P = 1.05 atm
T = 296 K
Putting value in the given equation:
[tex]\frac{PV}{RT}=n[/tex]
[tex]n= \frac{1.05 atm\; X \;5 L}{ 0.08206 L.atm / mol K X 296 K}[/tex]
Moles = 0.216 moles
Hence, 0.216 moles of gas can the container hold if a sealed container can hold 0.325 L of gas at 1.00 atm and 293 K.
Learn more about the ideal gas here:
https://brainly.com/question/27691721
#SPJ1
Answer:
0.014
Explanation:
Use the formula PV=nRT; there are calculators for it online as well.
what is the approximate distance from the far edge of one lobe to the far edge of the other?
Answers
The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
What is distance between far edge of two lobes in solar system?
This distance measures the outer space between the edges of the two lobes in a given time.
The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.
Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
Learn more about distance here: https://brainly.com/question/2854969
#SPJ11
A 25.0 g sample of metal at
16.0 °C is warmed to 22.1 °C
by 259 J of energy.
What is the change in temperature
for the metal?
Answers
The answer to this question is change in temperature will be 6.1 and specific specific heat capacity of metal will be 1698.36.
According to the formula of Calorimetry
Q = msΔT
where, Q = Quantity of heat absorbed (in joules)
M = Mass of water sample given (in kilogram)
S = specific heat capacity of metal
ΔT = Change in temperature
We have given,
Mass as 25 gram which is equal to 0.025 Kg.
Change in temperature as 6.1
Quantity of heat absorbed as 259 J
Applying to the formula of Calorimetry
Q = msΔT
259 = 0.025 × s × 6.1
s = 1698.36
So, specific heat capacity of metal came out to be 1698.36 and the change in temperature will be 6.1
Learn more about Calorimetry here:
https://brainly.com/question/1407669
#SPJ10
Answer: specific heat is 1.7
Explanation:
after you answer this question itll then tell you to find the specific heat
What is the volume in L of a 0.825 mole sample of Ar at 600 mm Hg and 300 K?
Answers
Answer:
V = 25.7 L
Explanation:
To find the volume of Argon (Ar), you need to use the Ideal Gas Law equation. This looks like:
PV = nRT
In this formula,
> P = pressure (atm)
> V = volume (L)
> n = number of moles
> R = constant (0.0821 L*atm/K*mol)
> T = temperature (K)
While there is a different constant that can be used if you want to keep the pressure in mmHg, there is a more common constant used when the pressure is in atm. So, to find the volume, you need to (1) convert mmHg to atm (by dividing by 760) and then (2) calculate the volume (using Ideal Gas Law).
(Step 1)
600 mm Hg 1 atm
------------------- x --------------------- = 0.789 atm
760 mm Hg
(Step 2)
PV = nRT
(0.789 atm) x V = (0.825 mole)(0.0821 L*atm/K*mol)(300 K)
(0.789 atm) x V = 20.32
V = 25.7 L
A 20.0-ml sample of glucose Iv solution has a mass of 20.6g.what is the density of the glucose
Answers
Taking into account the definition of density, the density of the glucose is 1.03 [tex]\frac{g}{mL}[/tex].
What is densityDensity is defined as the property that matter, whether solid, liquid or gas, has to compress into a given space.
In other words, density is a quantity that allows us to measure the amount of mass in a certain volume of a substance. Then, the expression for the calculation of density is the quotient between the mass of a body and the volume it occupies:
[tex]density=\frac{mass}{volume}[/tex]
From this expression it can be deduced that density is inversely proportional to volume: the smaller the volume occupied by a given mass, the higher the density.
Density of the glucoseIn this case, you know that:
Density= ?Mass= 20.6 gVolume= 20 mLReplacing in the definition of density:
[tex]density=\frac{20.6 g}{20 mL}[/tex]
Solving:
density= 1.03 [tex]\frac{g}{mL}[/tex]
In summary, the density of the glucose is 1.03 [tex]\frac{g}{mL}[/tex].
Learn more about density:
brainly.com/question/952755
brainly.com/question/1462554
#SPJ1
An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.
Answers
An endergonic reaction absorbs free energy
pls help
1.
when a magnet spins within a coil of wires, what is produced?
-blue sparks
-glowing light
-nuclear energy
-an electric current
2.
when an electric current flows through a wire:
-a gravitational field is created around the wire
-the wire becomes very cold
-the wire begins to spin
-a magnetic field is created around the wire
help pls
Answers
Answer:
1d and 2d is the answer. Hope it helps
A 250.ml sample of water was
boiled to 97.0°C then placed on
the counter to cool. If the water
cooled to11.0°C, how much heat
did it lose? Remember the
specific heat of water is 4.184
J/g°C.
Answers
Answer: The solubility of this gaseous solute will be,
Explanation :
First, we have to calculate the concentration of solute.
Now we have to calculate Henry's law constant.
Using Henry's law :
where,
C = concentration of solute =
p = partial pressure = 27.59 kPa
= Henry's law constant =?
Now put all the given values in the above formula, and we get:
Now we have to calculate the solubility of this gaseous solute when its pressure is 79.39 kPa.
Therefore, the solubility of this gaseous solute will be,
