Which of the following is an example of a continuous random variable?a. A Bernoulli trial
b. Binomial random variable
c. Normal random variable
d. Discrete uniform random variable

Answers

Answer 1

An example of a continuous random variable is a Normal random variable.

What is a normal random variable?

A random variable is a variable with an unknown value or a function that gives values to each of the results of an experiment. A random variable can be either discrete (having definite values) or continuous (any value in a continuous range).

Here, we have

We have to determine the example of a continuous random variable.

We concluded that the example of a continuous random variable is a normal random variable.

Hence, an example of a continuous random variable is a Normal random variable.

To learn more about the normal random variable from the given link

https://brainly.com/question/4079902

#SPJ1


Related Questions

WILL GIVE 200 POINTS !!!!> find the x intercept and the y intercept. write each intercept as an ordered pair. y=5x-10

Answers

Answer:x intercept (2,0)

Yintercept (0,-10)

Step-by-step explanation:

y=mx+b b= y intercept

To find x you just solve

Y=5x-10

10=5x

2=x

Consider the quadratic function f(x) = x2 – 5x + 12. Which statements are true about the function and its graph? Select three options.

The value of f(–10) = 82
The graph of the function is a parabola.
The graph of the function opens down.
The graph contains the point (20, –8).
The graph contains the point (0, 0).

Answers

The only correct option for the given quadratic function, is the graph of the function is a parabola. (there is only one correct option)

What is a quadratic function?

A quadratic function is a polynomial function with one or more variables in which the highest exponent of the variable is two.

Given is a quadratic function f(x) = x² - 5x + 12, there are some options given, we need to select the option which are correct according to the given quadratic function,

So, firstly we will plot the graph of the given function,

From the graph, we get,

The function is a parabola which opens up, the points (20, -8) and (0, 0) do not lie in the graph,

Now, finding the value of f(-10), put x = -10

(-10)² - 5(-10) + 12 = 100+52+12 = 164

Hence, in the conclusion the only correct option for the given quadratic function, is the graph of the function is a parabola. (there is only one correct option)

Learn more about quadratic function, click;

https://brainly.com/question/18958913

#SPJ9

Solve the question with Steps

Answers

The solution of the question sin(50)sin(80)cos(50)cos(80) is cos^2(80o), the correct option is D.

What are trigonometric identities?

Trigonometric identities are the functions that include trigonometric functions such as sine, cosine, tangents, secant, and, cot. Trigonometric ratio can be defined in terms of ratios of perpendicular, bases and hypotenuse. These are defined only in right angled triangles (triangles whose one angle is of 90 degree measure).

Given;

sin(50)sin(80)cos(50)cos(80)

Now,

=sin(20°)cos(80°) – cos(20°)sin(80°)

=sin(A-B) = sinA.cosB – cosA.sinB

=sin(20°-80°)

=sin(-60°)

=cos^2(80o)

Therefore, by trigonometry the answer will be cos^2(80o).

Learn more about trigonometric;

https://brainly.com/question/21286835

#SPJ1

Find the area of the figure. Round to the nearest tenth, if necessary.

Answers

The solution is the area of the figure is 53.17.

What is area of trapezoid?

The area of a trapezoid is found using the formula, A = ½ (a + b) h,

where 'a' and 'b' are the bases (parallel sides) and 'h' is the height .

here, we have,

from the given figure we get,

a = 10,

b = 6

h = 8

so, A = 64

again, the cut triangle is a equilateral triangle with side = 5

then, area of triangle = √3/4 * 5^2

                                   = 10.82

so, required area = 53.17

Hence, The solution is the area of the figure is 53.17.

To learn more on area of trapezoid click:

brainly.com/question/15640807

#SPJ1

Please help me with this !

Answers

The length of side AB within quadrilateral ABCD is 14.301 meters.

How to determine the length of a missing by trigonometry

In this problem we find a geometric system formed by a quadrilateral and two diagonals, whose parameters are listed below:

CD = 20 m

m ∠ BCD = 20°

m ∠ ACB = 40°

m ∠ ADC = 45°

m ∠ ADB = 50°

The missing side can be found by combining law of sine and law of cosine:

Law of sine

20 / sin 65° = BD / sin 20°

BD = 7.548

20 / sin 75° = AD / sin 60°

AD = 17.932

Law of cosine

AB = √(AD² + BD² - 2 · AD · BD · cos ADB)

AB = √(17.932² + 7.548² - 2 · 17.932 · 7.548 · cos 50°)

AB = 14.301

To learn more on quadrilaterals: https://brainly.com/question/29248318

#SPJ1

Find the area of the figure below, round to the nearest whole number.

Answers

The area of the triangle with side lengths 28 and 21 and an angle of 118 degrees is 260 squared unit.

What is the area of the given triangle?

A triangle is simply a two-dimensional polygon with 3 sides and 3 interior angles.

The area of a triangle can be determine using the formula;

A = ( a × b × sin( C ) ) / 2

From the diagram;

Side a = 28side m = 21Angle R = 118Area A = ?

Plug the given values into the above formula.

A = ( a × b × sin( C ) ) / 2

A = ( a × m × sin( R ) ) / 2

A = ( 28 × 21 × sin( 118° ) ) / 2

A = ( 588 × sin( 118° ) ) / 2

A = ( 588 × 0.8829 ) / 2

A = 519.17 / 2

A = 260 square unit.

Therefore, the area of the triangle is 260 square unit.

Option D) 260 is the correct answer.

Learn more about area of triangles here: brainly.com/question/19305981

#SPJ1

The area of the figure  to the nearest whole number is 260

Calculating the area of a triangle involving angles.

The area of a triangle is the region contained by the triangle's sides. The length of the sides and internal angles affect a triangle's area differently from one triangle to the other.

From the given triangle:

The required area of a triangle is:

[tex]A = a*b * \dfrac{sin \gamma}{2}[/tex]

where;

a and b are the two sides givenγ = the given angle

[tex]A = 28*21 * \dfrac{sin \ 118}{2}[/tex]

A = 14 × 21 × sin 118

A = 14 × 21 × 0.8830

A = 259.602

A = 260

Learn more about calculating the area of triangles here:

https://brainly.com/question/17335144

#SPJ1

Find the nth term #2

Answers

The formula to calculate the nth term of the sequence is an = -3n+18.

What is an arithmetic progression?

The difference between any two consecutive integers in an arithmetic progression (AP) sequence of numbers is always the same amount. It also goes by the name Arithmetic Sequence.

Given that the arithmetic series is 15,12,9,6.....

The nth term of the arithmetic sequence will be calculated as:-

an = a₁ + (n-1)d

The first term is 15 and the common difference for the series is 12-15 = -3.

The nth term will be calculated as:-

an = a₁ + (n-1)d

an = 15 + (n-1)-3

an = 15 -3n +3

an = -3n + 18

Therefore, an = -3n+18 is the formula to find the nth term in the sequence.

To know more about arithmetic sequences follow

https://brainly.com/question/6561461

#SPJ1

composite functions homework

Answers

The value of the composite functions of h(g(x)) is h(g(x)) = -20x + 6.

What is composite function?

In mathematics, a function is composed when two functions, f and g, are used to create a new function, h, such that h(x) = g(f(x)). The function of g is being applied to the function of x, in this case. Therefore, a function is essentially applied to the output of another function.

Given that, h(x) = 4x + 6 and g(x) = -5x.

The value of h(g(x)) is calculated by substituting x = -5x in the equation of h(x).

h(g(x)) = 4(-5x) + 6

h(g(x)) = -20x + 6

Hence, the value of the composite functions of h(g(x)) is h(g(x)) = -20x + 6.

Learn more about composite function here:

https://brainly.com/question/29048585

#SPJ1

Kevin entered a pie eating contest. He ate 4 pies in 132 seconds. How many pies can he eat in 198 seconds?

Answers

Answer:

He can eat 6 pies in 198 seconds.

Step-by-step explanation:

Divide

132÷4=33

Divide

198÷33=6 pies in 198 seconds

What is the area of this shape?
8m
6m
10m
5m

Answers

Answer:

68 m²

Step-by-step explanation:

we have two rectangles side by side, the larger one measures 8m by 6m, the smaller one 5m by 4m, the 4 meters is the difference between the base  (10m) and the 6m side, so we find the areas and add them using the formula A = L x W, the result is not in the choices but it is right.

6 * 8 + 4 * 5 =                     remember PEMDAS

48 + 20 =

68 m²

Find the average rate of change, problem in picture

Answers

The average rate of change of the function over the interval (-1, 2) is 3.

What is Average Rate of Change of a Function?

Average rate of change of a function is defined as the rate at which the value of the function is changing with respect to the change in the input values.

Difference quotient of a function over an interval is also the same concept as the average rate of change of a function.

Average rate of change of a function f(x) over an interval (a, b) is [tex]\frac{f(b) - f(a)}{b-a}[/tex].

Given interval is (-1, 2).

From the graph, f(-1) = -4 and f(2) = 5

Average rate = [tex]\frac{f(2) - f(-1)}{2--1}[/tex] = (5 - -4) / (3) = 9/3 = 3

Hence the given function has an average rate of change over the interval (-1, 2) at 3.

Learn more about Average Rate of Change here :

https://brainly.com/question/13235160

#SPJ1

Find the length of CB

Answers

C is 22 and B is 20, then the length of CB is √(22² + 20²) = √(884) = 29.

What is length?

Length is a measurement of size and it can be measured in a variety of waste including inches sentiment of metres feet miles and more. Playing these an important concept in mathematics, science and engineering and many others build it to used to calculate the dimensions of this area. And more it is also used to measure the time it takes to travel.

The length of CB can be determined by using the Pythagorean theorem, which states that the square of the length of the hypotenuse (the longest side of a right triangle) is equal to the sum of the squares of the other two sides. Since CB is the hypotenuse of a right triangle, the length of CB can be determined by solving the following equation:

C² + B² = CB²

Therefore, when given the lengths of sides C and B, the length of CB can be calculated by taking the square root of the sum of the squares of C and B.

To know more about length click-

https://brainly.com/question/29813582

#SPJ1

A survey is taken at a movie theater in Wayside. The first 100 people who entered the theater were asked about their favorite type of movie. What is true about this situation?

The population is the first 100 people at the theater, and the sample is the total number of people who go to the movie theater.
The population is the total number of people who go to the movie theater, and the sample is the first 100 people at the theater.
The population is the number of people who go to the movie theater, and the sample is the number of people in the town of Wayside.
The population is the number of people in the town of Wayside, and the sample is the number of people who go to the movie theater.

Answers

What is true about the population and sample of the survey is that;'

The population is the total number of people who go to the movie theater, and the sample is the first 100 people at the theater.

How to Identify the Population and sample of the data?

In statistics, the population is defined as the entire group that you want to draw conclusions about. However, the sample is defined as the specific group that you will collect data from. The size of the sample is always less than the total size of the population. In research, a population doesn't always refer to people.

Now, we are told that a survey is taken at a movie theater in Wayside. The first 100 people who entered the theater were asked about their favorite type of movie.

Thus, the sample will be 100 people surveyed as they are part of the entire people at the movie theater.

Read more about Population and sample at; https://brainly.com/question/7301139

#SPJ1

Given the costs associated with insurance, why do companies provide insurance plans to employees?

Answers

Company should provide insurance policies to employees because the employees are assets to them.

What is meant by Insurance Policies?

An insurance policy is a contract between the insurance company and the person getting the insurance.

Employees are assets of a company.

Companies should look after by insuring this asset like any other asset.

Although it is not the only factor for an employee to stick to a company, it is also one of the contributing factor for the employees to stick to a company longer.

It is a very good benefit for the employee since the premium is paid by the employer for the employee.

Hence companies should provide insurance policies to employees.

Learn more about Insurance Policies here :

https://brainly.com/question/29829383

#SPJ9

A sample of blood pressure measurements is taken for a group of​ adults, and those values​ (mm Hg) are listed below. The values are matched so that 10 subjects each have a systolic and diastolic measurement. Find the coefficient of variation for each of the two​ samples; then compare the variation.
Systolic
116
130
157
94
155
122
115
138
124
122

Diastolic
82
78
74
51
89
88
56
63
72
83

Answers

Answer:

To find the coefficient of variation (CV) of a sample, we divide the standard deviation by the mean and multiply by 100 to get the percentage.

1. For the systolic sample:

•Find the mean:

mean = (116 + 130 + 157 + 94 + 155 + 122 + 115 + 138 + 124 + 122) / 10 = 130

•Find the standard deviation:

sum = (116 - 130)^2 + (130 - 130)^2 + (157 - 130)^2 + (94 - 130)^2 + (155 - 130)^2 + (122 - 130)^2 + (115 - 130)^2 + (138 - 130)^2 + (124 - 130)^2 + (122 - 130)^2

sum = 165.4

std = sqrt(sum/9) = 7.3

•Calculate the coefficient of variation:

CV = (std / mean) × 100 = (7.3 / 130) × 100 = 5.62%

2. For the diastolic sample:

•Find the mean:

mean = (82 + 78 + 74 + 51 + 89 + 88 + 56 + 63 + 72 + 83) / 10 = 72.5

•Find the standard deviation:

sum = (82 - 72.5)^2 + (78 - 72.5)^2 + (74 - 72.5)^2 + (51 - 72.5)^2 + (89 - 72.5)^2 + (88 - 72.5)^2 + (56 - 72.5)^2 + (63 - 72.5)^2 + (72 - 72.5)^2 + (83 - 72.5)^2

sum = 624.75

std = sqrt(sum/9) = 12.24

•Calculate the coefficient of variation:

CV = (std / mean) × 100 = (12.24 / 72.5) × 100 = 16.82%

So the CV for systolic is 5.62% and the CV for diastolic is 16.82%. We can see that the diastolic measurement has higher variation than the systolic measurement.

For every 12 loaves of bread that a bakery bakes for sale, 5 cakes are baked. If 96 loaves of bread were baked, how many cakes would have been baked?​

Answers

Answer:

Step-by-step explanation:

Here's a step by step explanation of how to calculate the number of cakes baked if the bakery baked 96 loaves of bread:

First, determine the number of sets of 12 loaves of bread that were baked:

96 loaves of bread ÷ 12 loaves per set = 8 sets of 12 loaves

Next, determine the number of cakes baked for each set of 12 loaves of bread:

For every set of 12 loaves, 5 cakes are baked.

Finally, multiply the number of sets by the number of cakes baked per set to find the total number of cakes baked:

8 sets × 5 cakes per set = 40 cakes

So, if the bakery baked 96 loaves of bread, they would have baked 40 cakes.

Answer:

40

Step-by-step explanation:

12 times 8 equals 96 and 5 times 8 equals 40, there for 40 cakes will be backed

Whats the correct answer answer asap for brainlist

Answers

Answer:

this is not belongs to mathematics

Step-by-step explanation:

Help me with this question

Answers

The volume of the cylinder will be 666 cubic centimeters. Then the correct option is D.

What is the volume?

Volume is a measurement of three-dimensional space that is utilized. It is frequently mathematically quantified using SI-derived units or different imperial or US traditional units. The concept of length is linked to the notion of capacity.

The radius and height of the cone and the cylinder are the same. Then the ratio of the volume of the cylinder to the volume of the cone is 3. Then we have

(Volume of the cylinder) / (Volume of the Cone) = 3

Volume of the cylinder  / 222 = 3

Volume of the cylinder = 666 cubic cm

The volume of the cylinder will be 666 cubic centimeters. Then the correct option is D.

More about the volume link is given below.

https://brainly.com/question/1578538

#SPJ1

what is 4y - 2x= -8 in slope-intercept form

Answers

Answer is y = 1/2x -2

Step by step

y intercept form is y = mx + b

To change to this form we want to first isolate y

4y - 2x = -8
Add 2x to both sides

4y -2x +2x = 2x -8
Simplify

4y = 2x -8

Now we need y to stand alone without a coefficient. Divide both sides by 4.

4/4y = 2/4x - 8/4
Simplify

y = 1/2x -2

The 2 triangles below are similar. Find the missing side. Use your notes to help you. In your answer, type out your proportion and the solution.
PLEASE HURRY !!

Answers

The length of side DF is 5 units.

Similar Triangles :

If two figures possess the same shape but not necessarily the same size, they are considered to be similar. We may remark that all circles are similar as an example. Equilateral triangles and squares are similar to one another. Although similar figures need not be congruent, all congruent figures are similar.

Property 1:

Two triangles are similar if their respective sides have the same ratio and their corresponding angles are equal.

Property 2:

The corresponding angles of two similar triangles will have equal values . Equiangular triangles are what they are called.

Now by property 1,

The pairs of  corresponding sides of similar traingles are proportional .

Therefore, in the given triangles,

[tex]\frac{BA}{ED} =\frac{AC}{DF}[/tex]

[tex]\frac{6}{3} =\frac{10}{x} \\\\x=5[/tex]

Hence, the value of x = 5 units.

Learn more about similarity , visit :

https://brainly.com/question/26451866

#SPJ1

What is the solution to the image below?

5

10

-5

10

Answers

Answer: x=10

Step-by-step explanation:

The correct answer is 10………x=10

11) Scientists studied the growth rates of two types of the flu virus. The growth rate of the first virus is modeled by the equation y = P * 3 ^ x where P is the number of people initially infected with the virus in a given population. The growth rate of the second virus could be modeled by v = P * 9 ^ x The growth rate of the second virus could be expressed as P * 3 ^ k What is the value of k? Show the work that gives your solution method. y =

Answers

The value of k is given as follows:

k = 2x.

How to obtain the value of k?

The exponential function that models the growth of the first virus is given as follows:

y = P(3)^x.

The exponential function that models the growth of the second virus is given as follows:

y = P(9)^x = P(3)^k.

We have that 9 is the second power of 3, hence we have that:

y = P(3²)^x = P(3)^k.

Applying the power of power rule, we have that:

y = P(3)^(2x) = P(3)^k.

Hence the value of k is given as follows:

k = 2x.

More can be learned about exponential functions at https://brainly.com/question/30113628

#SPJ1

What are the exact value of a and b?

Answers

Answer:

a = 5, b = 5√3

Step-by-step explanation:

Use sin law

sin A/a = sin C/c

sin 30/a = sin 90/10

sin 30/(sin90/10) = a

a = 5

sin B/b = sin C/c

sin 60/b = sin 90/10

sin 60/(sin90/10) = b

b = 5√3

(a) The perimeter of a rectangular parking lot is 330 m.
If the length of the parking lot is 92 m, what is its width?

Answers

Answer: Width = 73 m

Step-by-step explanation:

Perimeter = Length(2) + Width(2)

330 - (92 x 2)

330 - 184 = 146

146 = Width of 2 sides

146/2 = 73 m

PLEASEEEEE HELPPPPP!!!

Answers

The required trigonometric ratios are as follows: sin t = 1/2 and cos t = √3/2.

What are Trigonometric functions?

Trigonometric functions are defined as the functions which show the relationship between the angle and sides of a right-angled triangle.

According to the given figure, we have a right triangle ΔABC which has:

AB = 1/2

BC = √3/2

CA = AB² + BC²

CA = √(1/2)² + (√3/2)²

CA = √1/4 + 3/4

CA = √4/4 = 1

As we know that the trigonometric ratios are as follows:

sin (180°- t) = AB/CA

sin t = (1/2)/1

sin t = 1/2

cos (180°- t) = BC/CA

cos t = (√3/2)/1

cos t = √3/2

Learn more about Trigonometric functions here:

brainly.com/question/6904750

#SPJ1

Divide the following using long division method: 96431÷63
[tex]96431 \div 63 \: longdivision \: method[/tex]

Answers

Answer:

So the answer is 1535 with a remainder of 18.

Step-by-step explanation:

  63

96431

-----

96431 - 54249 = 42182

-----

42182

 4218

-----

  420

  ---

   18

   ---

Help me with this question……

Answers

Answer:

the square root(route?) of four

Step-by-step explanation:

2x2=4, that dot is near two....

a grocery store got a delivery of 24 pounds of almonds into containers of 0.75 pounds of almonds in each how many containers can they fill with almonds?

Answers

Answer:32

Step-by-step explanation: 24 divided by .75=32

Graph the line with slope -1 passing through the point (1,-5)

Answers

Answer:

please review the attachment

What is the standard deviation of the discrete random variable if the variance is 1.56?

Answers

Answer: Approximately 1.25

Reason:

The standard deviation is the square root of the variance.

[tex]\text{Standard deviation} = \sqrt{\text{variance}}\\\\\text{Standard deviation} = \sqrt{1.56}\\\\\text{Standard deviation} \approx 1.24899959967968\\\\\text{Standard deviation} \approx 1.25\\\\[/tex]

Round the answer however you need to, or however your teacher instructs. I rounded to two decimal places since 1.56 is to two decimal places.

The standard deviation of the discrete random variable if the variance is 1.56 is 1.25

Given that, a discrete random variable has a variance of 1.56, we need to find its standard deviation

We know that,

The standard deviation is the square root of the variance.

Standard deviation = √ variance

Standard deviation = √1.56

Standard deviation = 1.24899959967968

Standard deviation = 1.25

Learn more about standard deviation click;

https://brainly.com/question/23907081

#SPJ2

Other Questions
The diagram summarizes the steps in one round of the Krebs cycle.Krebs Cycle diagramWhich chemical reaction in the cycle transfers energy to an energy carrier?A.2-carbon molecule + 4-carbon molecule 6-carbon glucoseB.ATP ADPC.Pyruvate ion acetyl-CoA + CO2D.FAD FADH2 why is kamau's mother's reaction to seeing her son different from his fsther reaction 10 point cuz its all i got rnIn the scale drawing, what is the area of the lawn (that is, the area of the whole backyard, except for the deck)? -) Balance the following equation:_____ P +__0 __ P4010DP:O:P:0:0 a tiny amount of magnesium chloride contains 150 magnesium ions and 300 chloride ions. the correct formula for magnesium chloride is This year, Clean Machine used 4,508.8 gallons of soap. That is 16.5% less than last year, How many gallons of soap did the company use last year? (round your answer to the nearest tenth) Of the 125 persons applying for a certain job at data processing center,79 had previous work experience and 62 had college degree, while 38 has both work experience and college degree. i)How many applicants did not have college degree ii)how many applicants did not have experience iii) how many applicants had college degree but no experience iv)how many applicants had either college degree or experience but not both Whose thoughts and feelingsis the Narrator revealing inthis passage from "The Gift ofthe Magi?"45- The Magi, as you know,were wise men--wonderfullywise men--who brought giftsto the Babe in the manger.They invented the art of givingChristmas presents. Beingwise, their gifts were no doubtwise ones, possibly bearingthe privilege of exchange incase of duplication. A concert venue wants to make at least $3,750.00 profit for their Saturday night show.Adult tickets cost $10.00 and children's tickets cost $5.00. The venue can seat up to500 people. Find three combinations of adult and children's tickets that will make theprofit goal and not be more than 500 total people. Enter your answer as ordered pairs(A,C) separated by a comma where A is the number of adult tickets sold and C' isthe number of children's tickets sold. 10m+ 4 n 2 10, m, plus, start fraction, n, squared, divided by, 4, end fraction when m=5m=5m, equals, 5 and n=4n=4n, equals, 4. Which of these is a possible boiling point for a 1.0 M solution of sugar in water? The normal boiling point of water is 100 degrees celsius99.7 -0.3100.3 1 What is the MOST effective way to rewrite sentence 7?A In Manhattan, the noise level was intolerable Walton discovered.B Walton discovered the noise level living in Manhattan was intolerable.CThe noise level living in Manhattan, Walton discovered, was intolerable.D Living in Manhattan, Walton discovered the noise level was intolerable. a small game company is designing an online game, where thousands of players can create their own in-game objects. the current design uses a mysql database in amazon rds to store data for player-created objects. which use cases suggest that dynamodb might be a better solution? (select two). Evaluate the expression if x= -2 and y=7.(xy)^2 - 2x^5Thank you. btw this is Algebra I An art teacher is making packages (they are women then)What is Alice Walker implying about the woman of today by using these words to describe the woman of her mother's generation ? The greater the speed of gas particles in a container, the:greater the pressurefewer collisions there will belower the temperaturelower the pressure what is the electric flux through one side of a cube that has a single point charge of placed at its center? Eleanor and Park Questions: Chapter 16-20What conflicts does Park have with his dad? Why? Why is the setting significant in the book The Ultimate Gift