Which of the following sets is equal to {1, 2, 3, ...)?
{x| xER, x>1}
{x|xER, x> or equal to 1}
{x|xEN, x> or equal to 1}

Which Of The Following Sets Is Equal To {1, 2, 3, ...)?{x| XER, X>1}{x|xER, X> Or Equal To 1} {x|xEN,

Answers

Answer 1

Answer:

[tex]\{x~ | ~x\in \mathbb{N}, x \geq 1\}[/tex]

Step-by-step explanation:


Related Questions

What is the sum of the geometric sequence 1, 3, 9, ... if there are 10 terms? (5 points)

Answers

Answer:

[tex]S_n = \frac{1 (1 - 3^{10})}{1 - 3} = 29524[/tex]

Step-by-step explanation:

There's a handy formula we can use to find the sum of a geometric sequence, and here it is

[tex]S_n = \frac{a_1 (1 - r^n)}{1 - r}[/tex]

The value n represents the amount of terms you want to sum in the sequence. The variable r is known as the common ratio, and a is just some constant. Let's find those values.

First lets visualize this sequence

[tex]n_1 = 1\\n_2 = 1 + 3\\n_3 = 1 + 3 + 3^2\\n_4=1+3+3^2+3^3\\...[/tex]

Okay so there's clearly a pattern here, let's write it a bit more concisely. For each n, starting at 1, we raise 3 to the (n-1) power, add it to what we had for the previous term.

[tex]S_n = \sum{3^{n-1}} = 3^{1 - 1} + 3^{2 - 1} + 3^{3-1} ...[/tex]

Our coefficients of r, and a, are already here! As you can see below, r is just 3, and a is just 1.

[tex]S_n = \sum{a*r^{n-1}}[/tex]

To finish up lets plug these coefficients in and get our sum after 10 terms.

[tex]S_n = \frac{1 (1 - 3^{10})}{1 - 3} = 29524[/tex]

Choose the expression that represents “divide 0.04 by n.”

Answers

Answer:

.04/n=4/100n or 4÷100n

Homework:Assignment 3 Question 20 Score: 0 of 1 point A vending machine dispenses coffee into ​-ounce cup. The amount of coffee dispensed into the cup is normally distributed with a standard deviation of ounce. You can allow the cup to overfill ​% of the time. What amount should you set as the mean amount of coffee to be​ dispensed?

Answers

Answer:

19.92

Step-by-step explanation:

To overfill 5% of the time ;

The Zscore (value) to the left of (1 - 0.05) = 0.95 is 1.645

Using this Zscore value with the Zscore formula :

Zscore = (x - μ) / σ

σ = 0.05 ; x = 20 ounce

Substituting into the Zscore formula :

1.645 = (20 - μ) / 0.05

1.645*0.05 = 20 - μ

0.08225 = 20 - μ

μ = 20 - 0.08225

μ = 19.91775

μ = 19.92

if 2 shirts cost 18.80, how much would 9 shirt cost.

Answers

Answer:

84.60

Step-by-step explanation:

We can write a ratio to solve

18.80             x

---------   = --------------

2 shirts    9 shirts

Using cross products

18.80 *9 = 2x

169.2 =2x

Divide each side by 2

169.2/2 =2x/2

84.60 =x

write fifty and two hundreds eight thousandths as a mixed decimal

Answers

Answer:

Pretty sure it's 0.528

There are 8 midsize cars and 15 compact cars and 6 will be selected. What is the probability of selecting all midsize cars?

Answers

Answer:

Assuming order does not matter, the probability of selecting all midsize cars is 0.000277373, or [tex]\frac{4}{14421}[/tex].

Step-by-step explanation:

First, we must find the n(Total arrangements of selections)=(8+15)C6

n(Total arrangements of selections)=23C6

n(Total arrangements of selections)=100,947

Second, we must find the n(Arrangements where all are midsize cars)=8C6

n(Arrangements where all are midsize cars)=28

To find the probability of selecting all midsize cars, we divide the n(Arrangements where all are midsize cars) by the n(Total arrangements of selections):

P(All midsize cars)= [tex]\frac{28}{100,947}[/tex]

P(All midsize cars)= [tex]\frac{4}{14421}[/tex]=0.000277373.

Bạn được một cá nhân thuê làm tư vấn tài chính, anh ta nhận được 2 đề nghị hợp ký đồng làm
việc với thời hạn 5 năm theo 2 sự lựa chọn sau:
- Lựa chọn 1: Lương 3 triệu/năm
- Lựa chọn 2: Lương 1.5 triệu/năm và được thưởng 9 triệu khi kết thúc hợp đồng làm việc.
a. Nếu lãi suất 8% bạn sẽ khuyên anh ta nhận lựa chọn nào?
b. Nếu lãi suất tăng 10% theo bạn có cần phải đổi lựa chọn không?

Answers

I don’t know the language

Place the labels in the chart
If you can draw this out for me or describe were they are that will be very helpful:)

Answers

Answer:

Check the image

Given parallelogram RUST and m< RUT=43, what other angle has the same measurement

Answers

9514 1404 393

Answer:

  (b) ∠STU

Step-by-step explanation:

Transversal UT between parallel sides RU and ST creates alternate interior angles RUT and STU. These are congruent.

  ∠STU has the same measure as ∠RUT

_____

The figure shown is a trapezoid, not a parallelogram.

Using a directrix of y = 5 and a focus of (4, 1), what quadratic function is created?
HELP PLS

Answers

Answer:

(x-4)^2=-8(y-3)

This is a parabola.

Step-by-step explanation:

Since the directrix is horizontal, the parabola faces up or down. Since the focus is below the directix it faces down. This means p will be negative in the equation (x-h)^2=4p(y-k).

p also tells us the half the distance between the focus and the directrix. The distance between 1 and 5 is 4, so p=-2.

The vertex is half way point between focus (4,1) and directrix y=5.

So the vertex is (4, [1+5]/2 )= (4 ,6/2)=(4,3). This is (h,k) in our equation.

(x-h)^2=4p(y-k)

(x-4)^2=4×-2(y-3)

(x-4)^2=-8(y-3)

Assume 2 in every 3000 students at the local community college have to quit due to serious health issues. An insurance company offers them ​$12000 policy for ​$40a year. What is the amount the insurance company should expect to make on average on every student that​ pays?
The amount the insurance company should expect to make on average on every student that pays is ​$

Answers

Answer:

$32

Step-by-step explanation:

Multiply $40*3000 students. Subtract 2 students that might receive a $12000 policy each. Divide by 3000 students to find average payout.

Please help explanation if possible

Answers

Answer:

10% gain

Step-by-step explanation:

[P2-P1]/P1

(33-30)/30=3/30=.1 or 10% gain.

Answer:

10%

Step-by-step explanation:

→ Minus the new share from the old one

33 - 30 = 3

→ Divide the answer by the original price

3 ÷ 30 = 0.1

→ Multiply the answer by 100

0.1 × 100 = 10%

Determine what type of transformation is represented.



A. none of these
B. reflection
C. dilation
D. rotation

Answers

Answer:

The answer is "Option D"

Step-by-step explanation:

In a rotation, an item is rotated around with a known location. Clockwise or anticlockwise spinning is possible. Rotation centers are spherical geometry in space where rotation occurs. The direction of inclination is the indicator of the total rotation made. Rotary point refers to that part point of a figure around which it is revolved.

PLEASE HELP
Write the equation of the line that is perpendicular to the given segment and that passes through the point (-6, -3). A. 1 V=--x-3 2 B. 1 V=--X-6 2 C. y = 2x + 9 D. = 2x-6.​

Answers

Answer:

C

Step-by-step explanation:

The slope of the line will be (2) and the equation will be C

PLS HELP I DONT KNOW THIS ONE

Answers

Answer:

x+3

---------------

(x-3)(x-2)(x-4)

Step-by-step explanation:

x+4             x^2 -16

---------------÷ -------------

x^2 - 5x+6     x+3

Copy dot flip

x+4                x+3

--------------- * -------------

x^2 - 5x+6     x^2 -16

Factor

x+4                x+3

--------------- * -------------

(x-3)(x-2)     (x-4)(x+4)

Cancel like terms

1                   x+3

--------------- * -------------

(x-3)(x-2)     (x-4)1

x+3

---------------   x cannot equal 3,2,4 -4

(x-3)(x-2)(x-4)

Help ! Please and thanks

Answers

The correct answer is that 1 & 8 are alternate exterior angles
they are alterate exterior angles

Which of the following pairs of functions are inverses of each other?
A. f(x) = 5 + x and g(x) = 5 - x
B. f(x) = 2x -9 and g(x)=x+9/2
C. f(x) = 3-6 and g(x)=x+6/2
D. f(x)= x/3+4 and g(x) = 3x - 4​

Answers

The pair of functions that are inverses of each other is B. f(x) = 2x - 9 and g(x) = x + 9/2.

To determine if two functions are inverses of each other, we need to check if the composition of the functions results in the identity function, which is f(g(x)) = x and g(f(x)) = x.

Let's analyze the given options:

A. f(x) = 5 + x and g(x) = 5 - x

To check if they are inverses, we compute f(g(x)) = f(5 - x) = 5 + (5 - x) = 10 - x, which is not equal to x. Similarly, g(f(x)) = g(5 + x) = 5 - (5 + x) = -x, which is also not equal to x. Therefore, these functions are not inverses.

B. f(x) = 2x - 9 and g(x) = x + 9/2

By calculating f(g(x)) and g(f(x)), we find that f(g(x)) = x and g(f(x)) = x, which means these functions are inverses of each other.

C. f(x) = 3 - 6 and g(x) = x + 6/2

Similar to option A, we compute f(g(x)) and g(f(x)), and find that they are not equal to x. Hence, these functions are not inverses.

D. f(x) = x/3 + 4 and g(x) = 3x - 4

After evaluating f(g(x)) and g(f(x)), we see that f(g(x)) = x and g(f(x)) = x. Therefore, these functions are inverses of each other.

In summary, the pair of functions that are inverses of each other is B. f(x) = 2x - 9 and g(x) = x + 9/2.

Learn more about function here:

https://brainly.com/question/782311

#SPJ8

5+(-7)=
A-12
B
-2
с
2
D
12
E
none of these

Answers

Answer:

-2

Step-by-step explanation:

5 + (-7)

Since the 7 is larger than 5, the 7 will overpower the 5 in a way. So, all you do is subtract 7 and 5.

7 - 5 = 2

But the 7 has a negative with it (since it's larger), so you add the negative to the 2.

7 - 5 = -2

The answer will be -2.

Put the following equation of a line into slope-intercept form, simplifying all fractions 2x-2y=14

Answers

Answer:

y = x - 7

Step-by-step explanation:

Answer: y = x - 7

Slope intercept form: y = mx + b

[tex]2x-2y=14\\\\-2y=-2x+14\\\\y=\frac{-2x+14}{-2} =\frac{-2(x-7)}{-2} =x-7[/tex]

Solve x∕3 < 5 Question 5 options: A) x ≥ 15 B) x > 15 C) x < 15 D) x ≤ 15

Answers

Answer:

C

Step-by-step explanation:

Given

[tex]\frac{x}{3}[/tex] < 5 ( multiply both sides by 3 to clear the fraction )

x < 15 → C

A restaurant interest survey of 230 citizens in a town showed that 80 want a new Chili's, 120 want a new Red Lobster, and 20 want both. Determine the probability that:
...​

Answers

Answer:

2/23

6/23

5/23

Step-by-step explanation:

60 only want chilis

20 wants both

100 only want red lobster

50 want neither

The right solution to the given question is "[tex]\frac{2}{23}[/tex]", "[tex]\frac{6}{23}[/tex]" and "[tex]\frac{5}{23}[/tex]".

According to the question,

[tex]a+b+c+d = 230[/tex][tex]b = 20[/tex][tex]a+b = 80[/tex]

By putting the value of "b", we get

[tex]a+20=80[/tex]

                [tex]a = 80-20[/tex]

                [tex]a = 60[/tex]

[tex]b + c=120[/tex]

By putting the value of "b", we get

      [tex]20+c=120[/tex]

              [tex]c = 120-20[/tex]

              [tex]c = 100[/tex]

[tex]d = 230-60-100-20[/tex]

By putting the values of "a", "b", "c" and "d", we get    

       [tex]d = 50[/tex]

(a)

P(both Chili's and Red lobster),

= [tex]\frac{b}{a+b+c+d}[/tex]

= [tex]\frac{2}{23}[/tex]

(b)

P(only chili's),

= [tex]\frac{a}{a+b+c+d}[/tex]

= [tex]\frac{6}{23}[/tex]

(c)

P(neither),

= [tex]\frac{d}{a+b+c+d}[/tex]

= [tex]\frac{5}{23}[/tex]

Learn more about probability here:

https://brainly.com/question/24269622

A =
1
9


4 1 −8
7 4 4
4 −8 1

Answers

I don't know sorry I am weak in math

A supervisor records the repair cost for 22 randomly selected VCRs. A sample mean of $75.50 and standard deviation of $18.07 are subsequently computed. Determine the 99% confidence interval for the mean repair cost for the VCRs. Assume the population is approximately normal. Step 1 of 2 : Find the critical value that should be used in constructing the confidence interval. Round your answer to three decimal places.

Answers

Answer:

The t value for 99% CI for 21 df is 2.831.

The critical value that should be used in constructing the confidence interval is (64.593, 86.407).

Step-by-step explanation:

Now the sample size is less than 30 and also population standard deviation is not known.

Then we will use t distribution to find CI

t value for 99% CI for 21 df is TINV(0.01,21)=2.831

The margin of error is [tex]E=t\times\frac{s}{\sqrt{n}}\\\\=2.831\times\frac{18.07}{\sqrt{22}}\\\\=10.907[/tex]

Hence CI is[tex]CI=\overline{x} \pm E\\\\ =75.50 \pm 10.907\\\\=(64.593,86.407 )[/tex]

plz help and explain this :)

Answers

Answer:

y=3x+6

Step-by-step explanation:

in a line graph, y=mx+c

m refers to gradient, c refers to y-intercept.

since lines are parallel, both lines have the same gradient.

the line intersects (1,9)

x=1,y=9

9=3(1)+c

c=6

so y=3x+6

Answer:

y = 3x+6

Step-by-step explanation:

Parallel lines have the same slope

y = 3x+2 is in slope intercept form (y=mx+b where m is the slope and b is the y intercept)

So the slope is 3

Y = 3x+2

Using the point given substitute into the equation and solve for b

9 = 3(1)+b

9 =3+b

9-3 =b

6=b

y = 3x+6

A certain university has 25,000 registered students. To estimate the percentage who are living at home, a simple random sample of 400 students is drawn. It turns out that 317 of them are living at home. Now, 317 out of 400 is (about) 79%. Indicate whether each quantity is actual or estimated from the data. You'll get partial credit for

Answers

Answer:

Indication of Actual Quantity and Estimated Quantity

Actual Quantity:

Registered students in the university = 25,000

Sample of students = 400

Students living at home = 317

Estimated Quantity:

317 out of 400 students

79%

Step-by-step explanation:

An actual quantity does not require to be estimated.  It is usually given in the question or scenario.  For example, the number of registered students in the university is an actual quantity.  The percentage of students who live at home from the simple random sample of 400 is an estimated quantity.

Aliana is supposed to get back to a customer with an answer about a refund by the end of the day, but she won't have all the approvals she needs to process the refund by that time. What should she do? O a) Call the customer only when she has processed the refund Ob Tell the customer that she should have called about the problem earlier Oc) Explain to the customer that her bosses are the ones that are taking forever O di Apologize to the customer and say that she will call her tomorrow with an update

Answers

Answer:

"ob" is the answer of this long question

Answer:

D

Step-by-step explanation:

reason:

not A cuz the customer has to wait for a long time, and she feel waste of time

not B cus it's the store's responsiblity, not customer. if she said that, the customer would feel be disrespected. and i swear she never comes back that store.

C if she said that, customer also feel waste of time when she has to talk with Aliana who cant solve her problem

and the boss will think Ali couldnt have no problem-solving skills

Please help!
Answers
A,B,C and D
The information is already in the chart
( ignore the charts below question 2.)

Answers

I believe the answer is B!

Hope this helped you! Please follow my account, thanks!

The answer is (B) ur welcome

ZDAC = ZBAD.
What is the length of BD?
Round to one decimal place.

Answers

Answer:

BD = 4.1

Step-by-step explanation:

DA is an angle bisector which also divides the opposite side of the angle it bisects in a way that it is proportional to tye other two sides.

By implication, we would have the following:

AB/BD = AC/DC

AB = 5.3

AC = 5.5

DC = 4.3

BD = ?

Plug in the values

5.3/BD = 5.5/4.3

Cross multiply

BD*5.5 = 4.3*5.3

BD*5.5 = 22.79

Divide both sides by 5.5

BD = 22.79/5.5

BD = 4.1 (to 1 decimal place)

Math geometry worth 30 points

What is the value of x?

Answers

Answer:

x = 3

Step-by-step explanation:

First, use trigonometric function to find RT.

θ = 60°

Opposite = 2√3

Hypotenuse = RT

Apply SOH:

Sin θ = Opp/Hyp

Plug in the values

Sin 60° = 2√3/RT

RT*Sin 60° = 2√3

Divide both sides by Sin 60°

RT = 2√3/sin 60°

RT = 2√3 × √3/2 (sin 60° = √3/2)

RT = (2√3 × √3)/2

RT = (2 × 3)/2

RT = 3

✔️Find x

θ = 45°

Opposite = x

Adjacent = 3

Apply TOA:

Tan θ = Opp/Adj

Substitute

Tan 45° = x/3

3 × Tan 45° = x

3 × 1 = x (tan 45° = 1)

3 = x

x = 3

Find the measure of the incanted angle to the nearest degree

Answers

Answer:

15.4 degrees

Step-by-step explanation:

b= 53

h = 55

cos -¹( 53/53)= 15.4

Other Questions
BOYS AND GIRLS, HELP ME PLEASE!!5,6,7,8 PLEASEfactor this examples Calculate the numerical value of the equilibrium constant, Kc, for the reaction below if the equilibrium concentrations for CO, H2 , CH4 and H2O are 0.989 M, 0.993 M, 1.078 M and 0.878 M, respectively. (calculate your answer to three sig figs)CO(g) + 3 H2(g) CH4(g) + H2O(g) Which of the following statements is False. A. Correlational research can be used to study naturally occurring variables.B. Correlations tell researchers about the strength and direction of relationships between variables C. Correlations can be used to establish cause-and- effect relationships between variables D. Correlational research can be conducted either in the laboratory or in the field Enter the solutions from least to greatest.f(x) = (x 3)(2x 8) How many electrons will one atom of element with 6 protons and 9 neutrons . give an explanation of tundra sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Is velocity ratio of a machine affected by applying oil on it?Explain with reason. rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible Complete the table to investigate dilations ofexponential functions.3.2*23x-2NAN62-12 / 0ab1d.ef241264a =bef=d =DONEIntro What are three things that all 50 state governments have in common? 18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?acuteobtuseequiangularright How do feedback mechanisms help maintain homeostasis? The pre-australopith fossils are especially significant because they challenge some of the long-standing explanations of our evolutionary history. Describe two reasons the pre-australopiths force us to rethink the savanna hypothesis in particular. (Hint: Think about the anatomical traits of the pre-australopiths and the environmental and temporal context in which they lived.) The decomposition of ammonia is: 2 NH3(g) N2(g) + 3 H2(g). If Kp is 1.5 103 at 400C, what is the partial pressure of ammonia at equilibrium when N2 is 0.20 atm and H2 is 0.15 atm? What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid? Many immigrants at the turn of the twentieth century came to the United States to escape religious persecution in their homelands. This is an example of what concept?assimilationpush-pull factorcultural shocknativism Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later How would the following triangle be classified?O scalene acuteO scalene obtuseO isosceles acuteO isosceles obtuse A rock is dropped from a height of 100 feet calculate the time between when the rock was strong and when he landed if we choose down as positive and ignore air friction the function is h(t)=16t^2-100