Chemistry College

Which statement is true about cytokinesis?
*
2 points
Chromosomes start to decompress
Chromosomes are pulled towards the poles
A cell plate forms in plant cells
The nuclear envelope breaks down

Answers

Answer 1

The correct statement about cytokinesis is that a cell plate forms in plant cells. Option C is correct.

During cytokinesis, the cytoplasm of the parent cell divides into two daughter cells, each with its own nucleus and organelles. In animal cells, a contractile ring made of actin and myosin filaments forms around the cell's equator and contracts, pinching the cell in two.

In contrast, plant cells build a cell plate, which forms from vesicles produced by the Golgi apparatus, at the cell's equator. These vesicles fuse together and form a new cell wall to separate the two daughter cells. The other three options mentioned in the question are related to mitosis, which is the division of the nucleus, whereas cytokinesis is the division of the cytoplasm. Option C is correct.

To know more about the Cytokinesis, here

https://brainly.com/question/18477575

#SPJ1

Related Questions

need help ASAP. I'll give brainliest to the person who answers CORRECTLY and the fastest.

Answers

We would need to 1.39 L of the stock solution and then make up to the 2.54 L mark.

What is the dilution formula?

The dilution formula is used to calculate the new concentration of a solution after it has been diluted with a solvent. The formula is:

C1V1 = C2V2

where:

C1 = the initial concentration of the solution

V1 = the initial volume of the solution

C2 = the final concentration of the solution

V2 = the final volume of the solution

By the use of the formula;

C1V1 = C2V2

V1 = C2V2/C1

V1 = 2.54 * 6/11

V1 = 1.39 L

Learn more about dilution formula:https://brainly.com/question/30781795

#SPJ1

If I have 20 ml of 0.10 M acetic acid mixed with 15 ml of 0.10 M sodium acetate and 15 ml of water how do I find the pH?

Answers

The buffer solution has a pH of 5.36.

How to find pH?

To find the pH of this buffer solution, use the Henderson-Hasselbalch equation:

pH = pKa + log([A⁻]/[HA])

where pKa = dissociation constant of acetic acid, [A⁻] = concentration of acetate ions, and [HA] = concentration of acetic acid.

Calculate the concentrations of acetate ions and acetic acid in the solution.

The initial moles of acetic acid are:

moles of acetic acid = volume of acetic acid x concentration of acetic acid

moles of acetic acid = 0.020 L x 0.10 mol/L

moles of acetic acid = 0.002 mol

After mixing with sodium acetate, the total volume of the solution is 50 mL, so the concentration of acetic acid and acetate ions are:

[HA] = moles of acetic acid / total volume of solution

[HA] = 0.002 mol / 0.050 L

[HA] = 0.040 M

[A⁻] = concentration of sodium acetate

[A⁻] = 0.10 M

The dissociation constant of acetic acid is pKa = 4.76.

Now, substitute these values into the Henderson-Hasselbalch equation:

pH = pKa + log([A⁻]/[HA])

pH = 4.76 + log(0.10/0.040)

pH = 4.76 + 0.60

pH = 5.36

Therefore, the pH of the buffer solution is 5.36.

Find out more on pH here: https://brainly.com/question/26424076

#SPJ1

(30 pts) Please find the correct answer.

Answers

The answer is 6.0 moles of HCl is required to neutralize 3.0 moles of Mg(OH)2.

The reason is because of the mole to mole ratio between HCl and Mg(OH)2.

Balanced equation: Mg(OH)2 + 2HCl = MgCl2 + 2H2O

If we look at the balanced equation between these two molecules, we can see that for every one mole of Mg(OH)2, two miles of HCl is required.

Therefore the answer is 6.0 moles.

What variable determines which
"R" value you use in your
calculation?
A. moles (n)
B. temperature (T)
C. pressure (P)
D. volume (V)

Answers

The variable that determines which "R" value to use in a calculation is pressure (P). The ideal gas law equation, PV = nRT, includes the universal gas constant (R), which has different values depending on the units used for pressure. If pressure is measured in atmospheres (atm), the value of R is 0.08206 L·atm/mol·K. If pressure is measured in pascals (Pa), the value of R is 8.314 J/mol·K. Similarly, if pressure is measured in other units such as torr, bar, or psi, a different value of R should be used. Therefore, the choice of "R" value to use in a calculation depends on the units of pressure being used in the problem.

Answer:C. pressure (P)

Explanation:

Imagine that you have a 7.00 L
gas tank and a 2.00 L
gas tank. You need to fill one tank with oxygen and the other with acetylene to use in conjunction with your welding torch. If you fill the larger tank with oxygen to a pressure of 155 atm
, to what pressure should you fill the acetylene tank to ensure that you run out of each gas at the same time? Assume ideal behavior for all gases.

Answers

We need to fill the acetylene tank to a pressure of 44.29 atm to ensure that we run out of each gas at the same time.

The acetylene tank pressure

To solve this problem, we need to apply the ideal gas law:

PV = nRT

Applying the ideal gas law for each tank,

PV = NkT

where N is the number of particles, k is Boltzmann's constant, and T is the temperature.

For oxygen:

(155 atm) * (7.00 L)

= N1 * k * T

For acetylene:

(P2) * (2.00 L)

= N2 * k * T

To use up both gases at the same time, we need to use the same number of moles of each gas. So we can set N1 equal to N2:

N1 = N2

Combining the two equations above to solve for P2:

(155 atm) * (7.00 L) = (N1) * k * T

(P2) * (2.00 L) = (N1) * k * T

Dividing the second equation by the first,

P2/P1 = (2.00 L)/(7.00 L)

P2 = (2.00 L)/(7.00 L) * (155 atm)

P2 = 44.29 atm

Learn more on the ideal gas law here https://brainly.com/question/12873752

#SPJ1

Other Questions
a particular task with a 5 day duration in a project cost $32000 for reducing its duration to 3 days. the rate of crashing for this task would then be: What was a visible reminder of religious and political authority in the byzantine empire What agency designated april 22nd as international mother earth day?. In any one-minute interval, the number of requests for a popular Web page is a Poisson random variable with expected value 180 requests.a A Web server has a capacity of C requests per minute. If the number of requests in a one-minute interval is greater than C, the server is overloaded. Use the central limit theorem to estimate the smallest value of C for which the probability of overload is less than 0.055. Note that your answer must be an integer. Also, since this is a discrete random variable, don't forget to use "continuity correction". C= b Now assume that the server's capacity in any one-second interval is C/60, where x is the largest integer x. (This is called the floor function.) For the value of C derived in part (a), what is the probability of overload in a one-second interval? This time, don't approximate via the CLT, but compute the probability exactly. For an n-type semiconductor, where is the fermi level located?. portfolio a is a well-diversified portfolio that is equally-weighted among 12,000 different and diverse stocks. portfolio a has an average amount of systematic risk, so it has exactly the same amount of systematic risk as the market portfolio. portfolio b consists of 2 stocks that operate in the active leisure industry: 3,687 shares of treetop entertainment stock, which has a price of $13.00 per share and a beta of 1.10; and 1,683 shares of garfield recreational stock, which has a price of $4.70 per share and a beta of 1.00. all stocks have some unsystematic risk and all stocks have the same level of unsystematic risk. which one of the following assertions is most likely to be true? portfolio a has more systematic risk than portfolio b, and portfolio a more unsystematic risk than portfolio b portfolio b has more systematic risk than portfolio a, and portfolio b has more unsystematic risk than portfolio a portfolio a has more systematic risk than portfolio b, and portfolio b has more unsystematic risk than portfolio a portfolio b has more systematic risk than portfolio a, and portfolio a has more unsystematic risk than portfolio b portfolio a either has the same amount of systematic risk as portfolio b or portfolio a has the same amount of unsystematic risk as portfolio b, or portfolio a has the same amount of systematic risk and unsystematic risk as portfolio b Help would be much appreciated. Why is reusing ships a great idea for the environment. a clown figurine is located 16.0 cm in front of a thin lens that has a focal length of 11.0 cm. where would the image appear, and would it be real or virtual? bank randomly selected checking account customers and found that of them also had savings accounts at the same bank. a. find the sample proportion of checking account customers also having savings accounts, . b. find the standard error of the sample proportion, . c. find a 95% confidence interval for the population proportion of checking account customers who also have savings accounts A gene is inducible and under negative control. Which of the following pairs will allow expression of this gene?A. Activator + repressorB. Activator + corepressorC. Repressor + inducer D. Repressor + corepressor 2. What is the classification of an enzyme?carbohydrates c. nucleic acids e. peptidoglycans b. proteins d. lipids I need this in 3 minutes Explain Tubulointerstitial nephritis (drug induced interstitial nephritis)! Find the exact length of the curve. Y = x3 3 1 4x , 1 x 2 Noah tried to prove that cos()=sin()cos()=sin()cosine, left parenthesis, theta, right parenthesis, equals, sine, left parenthesis, theta, right parenthesis using the following diagram. His proof is not correct.A right triangle A B C. Angle B A C is a right angle. Angle A C B is theta.A right triangle A B C. Angle B A C is a right angle. Angle A C B is theta.Statement Reason1 =mB=m, angle, B, equals, theta The acute angles in a right triangle are congruent.2 sin()=sin()= BCAB sine, left parenthesis, theta, right parenthesis, equals, start fraction, A, B, divided by, B, C, end fraction Definition of sine.3 cos()=cos(mB)= BCAB cosine, left parenthesis, m, angle, B, right parenthesis, equals, start fraction, A, B, divided by, B, C, end fraction Definition of cosine.4 cos()=cos()= BCAB cosine, left parenthesis, theta, right parenthesis, equals, start fraction, A, B, divided by, B, C, end fraction Substitution.5 cos()=sin()cos()=sin()cosine, left parenthesis, theta, right parenthesis, equals, sine, left parenthesis, theta, right parenthesis Substitution TRUE/FALSE. Objective information in progress notes includes your professional observations A 25-year-old individual states during an interview: "I decided to become an activist in the war on drugs for several reasons. I have witnessed the detrimental effects of drugs on people's lives. My grandfather was an alcoholic and, because my mother was addicted to heroin, I was raised by a foster family. My foster parents taught me to never use drugs, and, additionally they were and are very active in several community organizations that fight against drugs. My foster father also volunteers for a rehab facility and counsels people who have been addicted to heroin."This individual's motivation to become an activist can be attributed primarily to which of the following? (4 points)SocializationLife cycle effectsEffective citizenshipGenerational effects Calculate the acid ionization constant for butanoic acid if a 0.155 M solution is 1.15% ionized. a. 5.1 x 10^-3. b. 1.2 x 10^-2. c. 1.8 x 10^-3. geologists working for the environmental protection agency monitor surface waters at sites across the country to determine the effects of acid rain on aquatic ecosystems. what type of information would the geologists most likely track?(1 point) responses ph levels ph levels climate patterns climate patterns gas emissions gas emissions human activity