write an equation in slope intercept form of the line with the given characteristics: a) passes through (-3,0) and (-5,-3)

Answers

Answer 1

The equation of the line in slope-intercept form is [tex]\bf{y= \frac{3}{2} x + \frac{9}{4}} [/tex].

What is slope-intercept form?y=mx +c, where m is the slope and c is the y-intercept

StepsFind the slopeSubstitute value of the slope into the equationSubstitute a pair of coordinatesSolve for cRewrite equation with value of m and c

Working

The first step is to calculate the slope of the line.

[tex]\boxed{ slope = \frac{y _{1} - y_2 }{x_1 - x_2} }[/tex]

Slope

[tex] = \frac{ - 3 - 0}{ - 5 -( - 3)} [/tex]

[tex] = \frac{ - 3}{ - 5 + 3} [/tex]

[tex] = \frac{ - 3}{ - 2} [/tex]

[tex] = \frac{3}{2} [/tex]

Substitute the value of m into y= mx +c:

[tex]y = \frac{3}{2} x + c[/tex]

Next, substitute a pair of coordinates that the line passes through. Here, I will substitute (-3, 0) into the equation.

When x= -3, y= 0,

[tex]0 = \frac{3}{2} ( - 3) + c[/tex]

Find the value of c:

[tex]0 = - \frac{9}{2} + c[/tex]

[tex]c = \frac{9}{2} [/tex]

Substitute the value of c into the equation:

Thus, the equation of the line is [tex]y = \frac{3}{2} x + \frac{9}{2} [/tex].

To learn more about slope-intercept form, check out: https://brainly.com/question/24436844.

Write An Equation In Slope Intercept Form Of The Line With The Given Characteristics: A) Passes Through

Related Questions

how to graph y = 2|x + 3| - 4

Answers

The x-intercepts and the y-intercepts of the function is that determines the graph is:

x-intercepts = (-5,0) and (-1,0)y-intercepts = (0,2)

How do we graph the function y = f(x) of an absolute equation?

The function of an absolute equation can be graphed by determining the values of x-intercepts and the y-intercepts of the function.

From the given equation:

y = 2|x+3| - 4

To determine the y-intercepts, we need to set the values of x to zero, and vice versa for x-intercepts.

By doing so, the x-intercepts and the y-intercepts of the function is:

x-intercepts = (-5,0) and (-1,0)y-intercepts = (0,2)

Therefore, since we know the x and y-intercepts, the graph of the absolute value can be seen as plotted below.

Learn more about determining the graph of an absolute equation here:

https://brainly.com/question/2166748

#SPJ1

Write the equation of the circle graphed below.

Answers

Step-by-step explanation:

eq of a circle is

(x-h)^2+(y-k)^2=r^2

h is 0

k=3

r is 1.5 this is radius of the circle

x^2+(y-3)^2=1.5^2

please help me with my math

Answers

[tex] \sf{\qquad\qquad\huge\underline{{\sf Answer}}} [/tex]

Let's solve for y and z ~

[tex]\qquad \sf  \dashrightarrow \: z + 61 = 180[/tex]

[ Co- interior angle pair ]

[tex]\qquad \sf  \dashrightarrow \: z = 180 - 61[/tex]

[tex]\qquad \sf  \dashrightarrow \: z = 119 \degree[/tex]

now,

[tex]\qquad \sf  \dashrightarrow \: 5y + 14 = 119[/tex]

[ by Alternate interior angle pair ]

[tex]\qquad \sf  \dashrightarrow \: 5y = 119 - 14[/tex]

[tex]\qquad \sf  \dashrightarrow \: 5y = 105[/tex]

[tex]\qquad \sf  \dashrightarrow \: y = 21 °[/tex]

PLEASE HELP ME I'LL MARK U AS BRAINLIEST IF U GIVE ME THE RIGHT ANSWERS + GOT QUESTION A RIGHT JUST NEED QUESTION B AND C'S ANSWER

Answers

answer for b

catch the 9:10 bus from Beasley.

answer for c

10:06

hope this might help u.

Answer:

Answer for B is 9:10 for Beasley and The answer for C is 10:06

Step-by-step explanation:

Find y.
Help me please:))​

Answers

Answer:

y = 47

Step-by-step explanation:

All of the angles in a triangle must add up to 180. The angle marked 3y can help us find the missing angle of the triangle: 180-3y
Then you can make an equation to help solve for y:
50 + (2y-3) + (180-3y) = 180
Combine like terms:
227-y=180
y = 47

[tex]\quad \huge \quad \quad \boxed{ \tt \:Answer }[/tex]

[tex]\qquad \tt \rightarrow \: y=47 \degree[/tex]

____________________________________

[tex] \large \tt Solution \: : [/tex]

[tex]\qquad \tt \rightarrow \:(2y - 3) + 50 = 3y[/tex]

[tex]\qquad \tt \rightarrow \:2y - 3 + 50 - 3y = 0[/tex]

[tex]\qquad \tt \rightarrow \:2y - 3y + 47 = 0[/tex]

[tex]\qquad \tt \rightarrow \: - y = - 47[/tex]

[tex]\qquad \tt \rightarrow \:y = 47 \degree[/tex]

Answered by : ❝ AǫᴜᴀWɪᴢ ❞

In the diagram below, Θ is measured in radians. Which equation represents the relationship between the radius, r, and arc length, s?

Circle O is shown. Line segments A O and B O are radii with length r. Angle A O B has a measure of theta. Arc A B has a measure of s.

s = Θ · r
r = Θ · s
s = Θ + r
r = Θ + s

Answers

The equation that represents the relationship between the radius, r, and arc length, s is s = Θ * r

How to determine the arc length?

See attachment for the complete question

From the complete question, we have:

Θ represents the central angler represents the circle radius

The angle is given in radians.

So, the arc length is calculated using

Arc length = Angle * Radius

Substitute known values

s = Θ * r

Hence, the equation that represents the relationship between the radius, r, and arc length, s is s = Θ * r

Read more about arc lengths at:

https://brainly.com/question/2005046

#SPJ1

Answer:

A

Step-by-step explanation:

On Edge

HELPPPP PLEASEE DUEE SOONNN

Answers

(A) n=w by the corresponding angles theorem.

(B) This is the correct answer. n=s by the vertical angles theorem and s and x are supplementary by the same-side interior angles theorem. Thus, n and x are supplementary, and are not always equal.

(C) n=z by the alternate exterior angles theorem.

(D) s=w, so (s+w)/2 = (s+s)/2 = s. Since n=s by the vertical angles theorem, n=s.

(E) n and w are equal by the corresponding angles theorem, and w and y are supplementary as they form a linear pair. Thus, n+y=180, and it follows n=180-y.

Step 1: –10 + 8x < 6x – 4
Step 2: –10 < –2x – 4
Step 3: –6 < –2x
Step 4: ________

What is the final step in solving the inequality –2(5 – 4x) < 6x – 4?

x < –3
x > –3
x < 3
x > 3

Answers

Answer:

x < 3

Step-by-step explanation:

The last step is to divide by -2. When you divide by a negative number you must reverse (flip) the inequality symbol.

-6 < -2x

-6/-2 > -2x/-2

3 > x

This is the same as

x < 3 (see the pointy side pointing at the x and the wide open side facing the 3)

Help with math work

Answers

Answers for different section are given below;

What is Function?

The functions are the special types of relations. A function in math is visualized as a rule, which gives a unique output for every input x.

Here, given function;

   f(x) = -x² - 4x + 6

1.    If we take -1 common from the given function, we get

                      f(x) = -1 (x² + 4x - 6)

                      f(x) = -1 (x² + 4x) + 6

      Thus, first block contains -1 and second block contains 4.

     

2.   Then we add half of the coefficient of x², (b/2)², inside the bracket and subtract it outside a times, a(b/2)².

                 f(x) = -1 ( x² + 2. 2x + 2²) +2² + 6

                 f(x) = -1 ( x² + 4x + 2²) +4 + 6

Thus, first block contains -1, second block contains 4, third block contains 4, and fourth block contains 4.

3. Then we factorize the bracket and simplify outside the bracket;

                 f(x) = -1 (x + 2)² + 10

Thus, first block contains -1, second block contains 2 and third block contains 10.

Learn more about Function from:

https://brainly.com/question/12431044

#SPJ1

Which shows an expression to represent the total number of plants in her garden and the total number of plants if p = 3?
3 p minus 2; when p = 3 the number of plants is 7
3 p + 2; when p = 3 the number of plants is 11
p cubed minus 2; when p = 3 the number of plants is 25
p cubed + 2; when p = 3 the number of plants is 29

Answers

The correct answer is option D which is p ³+ 2; when p = 3 the number of plants is 29.

The complete question is given below:-

liana cubed the number of flowering plants in her garden, then added 2 vegetable plants. Let p represent the original number of plants in her garden. Which shows an expression to represent the total number of plants in her garden and the total number of plants if p = 3? 3 p minus 2; when p = 3 the number of plants is 7 3 p + 2; when p = 3 the number of plants is 11 p cubed minus 2; when p = 3 the number of plants is 25 p cubed + 2; when p = 3 the number of plants is 29

What is an expression?

Expression in maths is defined as the collection of the numbers variables and functions by using signs like addition, subtraction, multiplication, and division.

The given expression is liana cubed the number of flowering plants in her garden, then added 2 vegetable plants.

If she cubed the number of the plants will be:-

Now she added two vegetable plants:- 2

Then the equation will be: - p³ + 2. Now we will put the value of p = 3 in the equation.

Total number of the plants = ( 3 )³ + 2 = 27 + 2 = 29

Therefore the correct answer is option D which is p³+ 2; when p = 3 the number of plants is 29.

To know more about Expression follow

https://brainly.com/question/723406

#SPJ1

Mike has 63 toys. 18 of them are new and 12 are his favorites, while 4 are new and favorites. Mike is giving away all the toys that are neither new nor favorites. How many toys does mike have? ASAp

Answers

Answer:34

Step-by-step explanation:

Giving away all that is not new or fav so 12 fav + 18 new + 4 which are new an favorite = 34

Answer:

22

Step-by-step explanation:

63 is the total

14 are new

8 are fav

14+8=22

Find the x-intercept of the rational function.

A (-5,0)
B (0,-5)
C (0, -1)
D (-1, 0)

Answers

Answer:

(-5,0)

Step-by-step explanation:

The x intercept is where it crosses the x axis

It crosses the x axis where x = -5

The y value is 0

(-5,0)

Answer:

A  

Step-by-step explanation:

The x -intercept is 'shorthand' for  x - AXIS intercept

  where the graph crosses the x - axis

      this will always have a   ZERO  value for the 'y'- coordinate

looking at the graph this point is   -5,0

a hyperbola centered at the origin has vertices PLEASE HELP QUICK

Answers

The equation of the hyperbola with a given origin has vertices at (±[tex]\sqrt{61}[/tex], 0) and foci at  (±[tex]\sqrt{98}[/tex], 0) is  [tex]\frac{x^2}{61} -\frac{y^2}{37} =1[/tex].

Given, that a hyperbola centred at the origin has vertices at (±[tex]\sqrt{61}[/tex], 0) and foci at  (±[tex]\sqrt{98}[/tex], 0)

What is hyperbola?

In mathematics, a hyperbola is a type of smooth curve lying in a plane, defined by its geometric properties or by equations for which it is the solution set. A hyperbola has two pieces, called connected components or branches, that are mirror images of each other and resemble two infinite bows.

The formula for a hyperbola centred at the origin is [tex]\frac{x^2}{a^2} -\frac{y^2}{b^2 } =1[/tex]

The vertices are located at (±a, 0), so we have that the value of a is [tex]\sqrt{61}[/tex].

The foci are located at (±c, 0), where [tex]c^2 = a^2 + b^2[/tex].

So if we have that [tex]c = \sqrt{98}[/tex], we can find the value of b:

[tex]98 = 61 + b^2[/tex]

⇒ [tex]b^2 = 37[/tex]

⇒ [tex]b = \sqrt{37}[/tex]

So, the formula for this hyperbola is [tex]\frac{x^2}{61} -\frac{y^2}{37} =1[/tex].

Therefore, the equation of the hyperbola with a given origin has vertices at (±[tex]\sqrt{61}[/tex], 0) and foci at  (±[tex]\sqrt{98}[/tex], 0) is  [tex]\frac{x^2}{61} -\frac{y^2}{37} =1[/tex].

To learn more about hyperbola visit:

https://brainly.com/question/27799190.

#SPJ1

Point p has coordinates (-4,-2) and point q has coordinates (4,3) calculate the shortest distance between P and Q. Give your answer to 1 decimal place

Answers

Answer:

distance = 9.4 units

Step-by-step explanation:

* using the distance formula *

d =

[tex] \sqrt{(x2 - x1 )^{2} + (y2 - y1)^{2} } [/tex]

[tex] \sqrt{( - 4 - 4) ^{2} + ( - 2 - 3) ^{2} } [/tex]

= 9.4 units

If students sit 3 per bench, we are short 3 benches. If they sit 5 per bench,
2 benches are left empty, and one bench only has 4 students. How many
benches are there?

Answers

An expression is defined as a set of numbers, variables, and mathematical operations. There are a total of 10 benches in the class.

What is an Expression?

In mathematics, an expression is defined as a set of numbers, variables, and mathematical operations formed according to rules dependent on the context.

Let the total number of benches be represented by x. If students sit 3 per bench, we are short 3 benches. Therefore, the total number of students can be written as,

Total number of students = 3x + 9

If they sit 5 per bench, 2 benches are left empty, and one bench only has 4 students.

Total number of students = 5(x-1) - 10 +4

Now, the total number of students can be written as,

3x + 9 = 5(x-1) - 10 +4

3x + 9 = 5x - 11

20 = 2x

x = 10

Hence, there are a total of 10 benches in the class.

Learn more about Expression:

https://brainly.com/question/13947055

#SPJ1

What value of k makes the equation true? (5a^2b^3)(6a^kb)=30a^6b^4

Answers

The value of K will be equal to 4 for an expression (5a²b³)(6a[tex].^k[/tex]b)=30a⁶b⁴.

What is an expression?

Expression in maths is defined as the collection of the numbers variables and functions by using signs like addition, subtraction, multiplication and division

We have an expression given as:-

(5a²b³)(6a[tex].^k[/tex]b)=30a⁶b⁴.

The mathematical properties we knew

[tex]x^mx^n = x^{m+n}[/tex]

[tex]x^m[/tex]÷[tex]x^n=x^{m-n}[/tex]

So the expressions will be written as:-

(5. 6 . a². a[tex].^k[/tex] .b³ .b =  30a⁶b⁴.

30 ( [tex]a^{2+k}[/tex])([tex]b^{3+1}[/tex]) =  30a⁶b⁴.

Comparing the terms we will get:-

[tex]a^{2+k}[/tex] = a⁶

2 + k = 6

k = 6 - 4

k = 4

Therefore the value of K will be equal to 4 for an expression (5a²b³)(6a[tex].^k[/tex]b)=30a⁶b⁴.

To know more about Expression follow

https://brainly.com/question/723406

#SPJ1

Plssss help will give brainliest!!!

Answers

2. 3 is not a function

3. 4 is a function

To be a function it has to pass the vertical line test, meaning the x value can not repeat. So for this problem, you need to look at the ordered pair (x,y). For problem 2, answer 3 is not a function because the x value of 1 appears twice. For problem 3, answer 4 is a function because there aren't any x values being repeated.

What is the slope of the line that passes through the points (8,-8) and (5,-1)?

Answers

Hey there!

Answer :

[tex] \sf{ \purple{ \boxed{\bold{m = - \dfrac{7}{3} }}}} [/tex]

[tex] \\ [/tex]

Explanation :

We are given the points [tex] \sf{P_1(\overbrace{ \blue{8}}^{\blue{x_1}} ,\underbrace{\orange{-8}}_{ \orange{y_1}}) \: and \: P_2(\overbrace{ \green{5}}^{\green{x_2}} ,\underbrace{\red{-1}}_{\red{y_2} })} [/tex] . To find the slope [tex] \sf{\purple{m}} [/tex] of such a line, we use the slope formula which is the following:

[tex] \sf{ \purple{m} }= \dfrac{\Delta y}{\Delta x} = \dfrac{ \red{y_2} - \orange{y_1}}{ \green{x_2 }- \blue{x_1}} [/tex]

[tex] \\ [/tex]

⇢Now, by plugging in our values, we get :

[tex] \sf{ \purple{m}} = \dfrac{ \red{ - 1} - \orange{( - 8)}}{ \green{5} \: - \: \blue{8}} = \dfrac{ \: \: 7 \: }{ - 3 \: } \\ \\ \implies \sf{ \purple{ \boxed{m = - \dfrac{7}{3} }}}[/tex]

Therefore, the slope of the line is [tex] \sf{ \purple{ \boxed{m = - \dfrac{7}{3} }}} [/tex]

SOLVING

[tex]\Large\maltese\underline{\textsf{A. What is Asked}}[/tex]

What is the slope of a linear function that goes through (8,-8) and (5,-1)?

[tex]\Large\maltese\underline{\textsf{B. This problem has been solved!}}[/tex]

Formula utilised, here [tex]\bf{\dfrac{y2-y1}{x2-x1}}[/tex].

We utilise that formula because we have two points as our given information.

So, we

put in the values

[tex]\bf{\dfrac{-1-(-8)}{5-8}}[/tex] | subtract on top and bottom

[tex]\bf{\dfrac{-1+8}{-3}}[/tex] | simplify

[tex]\bf{\dfrac{7}{-3}[/tex]

[tex]\cline{1-2}[/tex]

[tex]\bf{Result:}[/tex]

                [tex]\bf{=Slope=-\dfrac{7}{3}}[/tex]

[tex]\LARGE\boxed{\bf{aesthetic\not1\theta l}}[/tex]

Type the correct answer in the box. Use numerals instead of words. If necessary, use / for the fraction bar.
Polygon MNOPQ is dilated by a scale factor of 0.8 with the origin as the center of dilation, resulting in the image M′N′O′P′Q′. The coordinates of point M are (2, 4), and the coordinates of point N are (3, 5).
The slope of is

Answers

The coordinates of point N are (3, 5).2 the answer is 2/1 but just write 2.

We have given that,

Polygon MNOPQ is dilated by a scale factor of 0.8 with the origin as the center of dilation, resulting in the image M′N′O′P′Q′.

What is the coordinate?

A coordinate system is a system that uses one or more numbers, or coordinates, to uniquely determine the position of the points or other geometric elements on a manifold such as Euclidean space.

The coordinates of point M are (2, 4), and the coordinates of point N are (3, 5)

Therefore we get,

2 the answer is 2/1 but just write 2.

To learn more about the co-ordinate visit:

brainly.com/question/17206319

#SPJ1

what is the degree for the polynomial below ?
2x^(2)+3x + 1

Answers

Answer:

The exponent is 2, so the degree is 2

If we can preach that it has 2 pairs of parallel sides, one pair of consecutive sides perpendicular and perpendicular diagonals.(check image)

Answers

Answer:

Prob Online

Step-by-step explanation:

Can't really think of one

The two right-angled triangles below are
similar, which means that they have the
same angles.
a) Write down the value of sin as a
fraction in its simplest form.
b) Work out the length x.
8 cm
3 cm
16 cm
X
Not drawn accurately

Answers

[tex]\quad \huge \quad \quad \boxed{ \tt \:Answer }[/tex]

[tex] \tt{sin(\Theta) = \cfrac{3}{8}} [/tex]

[tex]\qquad \tt \rightarrow \: x = 6\:\: cm[/tex]

____________________________________

[tex] \large \tt Solution \: : [/tex]

[tex]\qquad \tt \rightarrow \: \sin( Theta) = \cfrac{Opposite \:\: side}{Hypotenuse}[/tex]

[tex]\qquad \tt \rightarrow \: \sin( \Theta) = \cfrac{3}{8} [/tex]

since the Triangles are similar, ratio of their corresponding sides are equal :

[tex]\qquad \tt \rightarrow \: \sin( \Theta) = \cfrac{3}{8} = \dfrac{x}{16} [/tex]

[tex]\qquad \tt \rightarrow \:x = 16 \sdot \cfrac{3}{8}[/tex]

[tex]\qquad \tt \rightarrow \: x = 2 \sdot3[/tex]

[tex]\qquad \tt \rightarrow \: x = 6 \: \: cm[/tex]

Answered by : ❝ AǫᴜᴀWɪᴢ ❞

Since  the two right-angled triangles have the same angles, the values are; ai. sin θ= 3/8ii. sin θ= x/16b. x = 6cm

How to determine the value

Using the sine trigonometric identity expressed as;

sin θ = opposite/hypotenuse

Then, we have that for the first triangle;

sin θ= 3/8

For the bigger triangle;

sin θ= x/16b.

Then, since we have that the sine identity is;

sin θ= x/16

But sin θ= 3/8

Divide the values and find the sine inverse in

θ= 0. 375θ = 22. 0 degrees

x = 0. 375 (16)

Multiply

x = 6 cm

Learn about trigonometric identities at:

https://brainly.com/question/22591162

#SPJ2

Which four inequalities can be used to find the solution to this absolute value inequality?

Answers

The four inequalities that can be used to find the solution of 3 ≤ |x + 2| ≤ 6 is x + 2 ≤ 6, x + 2 ≥ -6, x + 2 ≥ 3 and x + 2 ≤ -3

What is an equation?

An equation is an expression that shows the relationship between two or more variables and numbers.

Given the inequality:

3 ≤ |x + 2| ≤ 6

Hence:

x + 2 ≤ 6, -(x + 2) ≤ 6, 3 ≤ x + 2 and 3 ≤ -(x + 2)

This gives:

x + 2 ≤ 6, x + 2 ≥ -6, x + 2 ≥ 3 and x + 2 ≤ -3

The four inequalities that can be used to find the solution of 3 ≤ |x + 2| ≤ 6 is x + 2 ≤ 6, x + 2 ≥ -6, x + 2 ≥ 3 and x + 2 ≤ -3

Find out more on equation at: https://brainly.com/question/2972832

#SPJ1

please help asappp!!!

Answers

Answer:

0

y = 2

Step-by-step explanation:

Since it's a flat line, the slope is 0.

Since all of the points have a y-value of 2, the equation is y = 2.

Answer:

Slope = 0

Equation: y = 2

Step-by-step explanation:

PQ is parallel  to x-axis. Slope of the line parallel to x-axis = 0.

Slope of diagonal PQ = 0

Equation of line parallel to x-axis : y = a

Equation of diagonal PQ: y = 2  or y -2 = 0

What is the measure of angle CED?

There are two triangles labeled ABC and DCE with a common vertex C. In triangle ABC, angle BAC is labeled as y, and angle ABC is labeled as 65 degrees. In triangle DCE, angle CDE is labeled as 65 degrees

y over 2, because Triangle ABC is congruent to triangle DCE
y, because Triangle ABC is similar to triangle EDC
y + 65 degrees, because Triangle ABC is similar to triangle DCE
115 degrees − y, because Triangle ABC is congruent to triangle DCE

Answers

The measure of angle CED is y. The correct option is the second option-   y, because Triangle ABC is similar to triangle EDC

Similar triangles

From the question, we are to determine the measure of angle CED

In the diagram, we can observe that ΔABC is similar to ΔEDC

This is by the Angle-Angle similarity theorem

The theorem states that

If any two angles of a triangle are equal to any two angles of another triangle, then the two triangles are similar to each other

Thus,

Angle CAB = Angle CED

In the diagram,

Angle CAB = y

∴ Angle CED = y

Hence, the measure of angle CED is y. The correct option is the second option-   y, because Triangle ABC is similar to triangle EDC

Learn more on Similar triangles here: https://brainly.com/question/24085502

#SPJ1

What is the volume of the sphere shown below?
O A. π units3
676
3
8788
3
C. 52 units 3
OD. 104 units3
B.
π units³
-13-

Answers

Answer:

B

Step-by-step explanation:

the volume (V) of a sphere is calculated as

V = [tex]\frac{4}{3}[/tex] πr³ ( r is the radius )

here r = 13 , then

V = [tex]\frac{4}{3}[/tex] π × 13³ = [tex]\frac{4}{3}[/tex] π × 2197 = [tex]\frac{4(2197)}{3}[/tex] π = [tex]\frac{8788}{3}[/tex] π units³

The solution is, B.  8788/3 * π units³ is the volume of the sphere shown below.

What is volume?

In mathematics, volume is the space taken by an object. Volume is a measure of three-dimensional space. It is often quantified numerically using SI derived units or by various imperial or US customary units. The definition of length is interrelated with volume.

here, we have,

the volume (V) of a sphere is calculated as

V = 4/3 πr³ ( r is the radius )

now, we have,

from the given figure, we get,

here r = 13 , then

V =  4/3* π × 13³

= 4/3* π × 2197

= 8788/3 * π units³

Hence, The solution is, B.  8788/3 * π units³ is the volume of the sphere shown below.

To learn more on volume click :

brainly.com/question/1578538

#SPJ5

simplify the ratio 42:63 ​

Answers

Answer: 2:3

Step-by-step explanation:

common factor of 42 and 63: 21

42/21= 2

63/21= 3

find the common factor to find the ratio!

therefore the ratio is 2:3

Answer: 2:3

When you divide these two numbers 42 and 63 the smallest possible form they can give is two and three.

Roni wants to write an equation to represent a proportional relationship that has a constant of proportionality equal to StartFraction 7 over 25 EndFraction. She writes the equation y = x + StartFraction 7 over 25 EndFraction. What error is Roni making?
She should have written y = negative x + StartFraction 7 over 25 EndFraction so that x and y have a constant sum.
She should have written x y = StartFraction 7 over 25 EndFraction so that x and y have a constant product.
She should have written y = StartFraction 7 over 25 EndFraction x so that x and y have a constant quotient.
She should have written y = StartFraction 7 over 25 EndFraction so that y has a constant value.

Answers

Answer:

y = 7/25x

Step-by-step explanation:

For a proportional relationship, we have

y ∞ x.

Let k = constant of proportionality = 7/25

Removing the proportionality sign, we have

y = k x

Therefore, the answer is  

y = 7/25x

Instead of y= x + 7/25

So, the error is that x should be multiplied by 7/25 and not added.

Learn more about proportionality from below link:

https://brainly.com/question/9705556

#SPJ10

Select the correct answer from each drop-down menu.
Consider this equation.
- 1-5 = x - 8
The equation has
and
.A valid solution for x is

Answers

Answer:

-1-5=x-8

or, -1-5+8=x

or, x= -1-5+8

or, x= -6+8

or, x=2

therefore, x=2

Which of the following is the correct order of the polynomial
2y5+y+3y7-4y³ +12?

Answers

Answer:

3y⁷ + 2y⁵ - 4y³ + y + 12

Step-by-step explanation:

2y⁵ + y + 3y⁷ - 4y³ + 12

(greatest - least powers)

I hope this helps!

Other Questions
What is the equation of the line perpendicular to 2x - 3y = 13 that passes through the point (-6, 5)?y=x+9y=-3x-4y=-x-13y-x-1 Mary is going to roll a six-sided die. What is the probability that the die lands on the number 3? Input your answer in fraction form Brandon is a running back for his local high school football team. In the last game, he carried the ball 8 times. In the first 5 carries, he gained 6 yards, 12 yards, and 4 yards before losing 2 yards and then losing additional yards. His last 7 carries combined for yards. What was his total net yardage for the game? Kent bought a $1,000, 20-year U.S. Treasury bond that paid six percent annual yield when he was 22. How much would that bond be worth 20 years later when it matured? a drone traveling horizontally at 120m s over a flat ground at an elevation of 4500 meters must drop an emergency package on a target on the ground the trajectory of the package is given by x 120t y 4.9t 2 4500 define peace culture How can technological change create political instability? Which of Cyril's actions does Saki exaggerate in "The Storyteller" to create satire? Select three options.disobeying his auntasking questions about everythingtalking back to his auntencouraging the bachelor to tell a storycommenting on the two stories he is told who was the first president of Lebanon? A study by carnegie mellon university showed that drivers talking on cell phones can miss seeing ......% of their driving environment, including pedestrians and green lights (strayer, d. l. 2007). 20 10 50 At minimum, what initial actions should be performed within 10 minutes of mrs. archers arrival at the emergency department? Active citizenship is a core feature of the democratic process.Please select the best answer from the choices providedTF Simplify the expression by combining liketerms: Algebra 1 What is the oxidation state of Hg in Hg2Cl?O A. +1OB. -1O C. +2OD. -2 All else being equal, if you cut the sample size in half, how does this affect the margin of error when using the sample to make a statistical inference about the mean of the normally distributed population from which it was drawn? m e = startfraction z times s over startroot n endroot endfraction. How do Adams opinions on the french revolution differ from Jefferson according to the letter? Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please What is the measure of \angle xxangle, x?Angles are not necessarily drawn to scale. In the video, a soldier makes an unusual request. what does he want to hear lana turner do? Please help with this.copy according to the instructions below.Houses usually don't just sell themselves. People sell them. And most of the time people doing the selling are real estate agents. For the most part, realty people attract buyers to houses by writing eye-catching advertisement in the classified section of the newspaper.A. Choose a house as the subject of an advertisement. But rather than writing a brief ad for the classified pages, make your ad much longer for a monthly real estate magazine.B. Your advertisement should contain at least three paragraphs with a minimum of 5-7 sentences each. Be certain to use correct capitalization, punctuation and paragraph form.