Alkenes
Give the correct IUPAC names of the following compounds.
a) CH2CHCH(CH3)C(CH3)3
b) CH3CH2CHC(CH3)CH2CH3
c) CH3CHCHCH(CH3)CHCHCH(CH3)2

The molecular shape are (a). The molecular shape of HCN is linear , (b). The molecular shape of [tex]PCl_3[/tex]is trigonal pyramidal.

a. For HCN (hydrogen cyanide), the molecular shape is linear. It consists of a carbon atom bonded to a hydrogen atom and a nitrogen atom with a triple bond.

The arrangement of atoms in a straight line gives it a linear molecular shape.

b. For [tex]PCl_3[/tex](phosphorus trichloride), the molecular shape is trigonal pyramidal. It consists of a central phosphorus atom bonded to three chlorine atoms.

The three chlorine atoms form a pyramid shape around the phosphorus atom, with the lone pair of electrons occupying the fourth position, giving it a trigonal pyramidal molecular shape.

In summary, HCN has a linear shape, while [tex]PCl_3[/tex]has a trigonal pyramidal shape.

These shapes are determined by the arrangement of atoms and the presence of lone pairs, which dictate the molecular geometry of the molecules.

To know more about molecular shape refer here

https://brainly.com/question/31826716#

#SPJ11

The formal charge on C in the Lewis structure of HCO3- is zero.

In the Lewis structure of HCO3-, the central carbon (C) atom is bonded to three oxygen (O) atoms and has one lone pair of electrons. Each oxygen atom is also bonded to a hydrogen (H) atom. By assigning electrons to the atoms and calculating the formal charges, it is determined that the formal charge on C is zero.

To calculate the formal charge on an atom, the formula is:

Formal charge = valence electrons - lone pair electrons - 0.5 * bonding electrons

For the carbon atom in HCO3-, the formal charge is:

Formal charge on C = 4 valence electrons - 0 lone pair electrons - 3 * 2 bonding electrons

                  = 4 - 0 - 6

                  = -2 + 2 (from the overall charge of HCO3-)

                  = 0

The formal charge on the carbon (C) atom in the Lewis structure of HCO3- is zero. This indicates that the carbon atom is neither deficient nor in excess of electrons, making it stable within the molecule.

To know more about Lewis structure click here:

https://brainly.com/question/4144781

#SPJ11

The mass of the cathode after electrolysis is 5.10 g.

To determine the mass of the cathode after electrolysis, we need to apply the principle of mass conservation. According to this principle, the total mass before electrolysis should be equal to the total mass after electrolysis.

Given:

Mass of anode before electrolysis = 14.40 g

Mass of anode after electrolysis = 8.00 g

Mass of cathode before electrolysis = 11.50 g

To find the mass of the cathode after electrolysis, we can subtract the change in mass of the anode from the initial mass of the cathode:

Mass of cathode after electrolysis = Mass of cathode before electrolysis - Change in mass of anode

Change in mass of anode = Mass of anode before electrolysis - Mass of anode after electrolysis

Change in mass of anode = 14.40 g - 8.00 g

Change in mass of anode = 6.40 g

Mass of cathode after electrolysis = 11.50 g - 6.40 g

Mass of cathode after electrolysis = 5.10 g

Therefore, the mass of the cathode after electrolysis is 5.10 g.

learn more abour cathode here

https://brainly.com/question/32063482

#SPJ11

In a solution, when the concentrations of a weak acid and its conjugate base are equal, The correct answer would be c. All of these are true. The solution with the greatest buffering capacity would be option b. 0.543 M NH3 and 0.555 M NH4Cl. Sodium acetate should be added to a solution of acetic acid to prepare a buffer. The correct answer would be c. sodium acetate only.

Part 1: When the concentrations of a weak acid and its conjugate base are equal in a solution, the system is at equilibrium. Therefore, option d. the system is not at equilibrium is incorrect. The correct answer is c. All of these are true. This means that when the concentrations of a weak acid and its conjugate base are equal, the buffering capacity is significantly decreased and the -log of the [H+] (hydrogen ion concentration) and the -log of the Ka (acid dissociation constant) are equal.

Part 2: To determine the solution with the greatest buffering capacity, we need to compare the concentrations of the weak acid and its conjugate base. The buffering capacity is directly related to the concentration of the weak acid and its conjugate base. Therefore, the solution with the highest concentrations of the weak acid and its conjugate base will have the greatest buffering capacity.

Among the given options, the solution with the greatest buffering capacity is option b. 0.543 M NH3 and 0.555 M NH4Cl, as it has the highest concentrations of both NH3 (weak acid) and NH4Cl (conjugate base).

Part 3: To prepare a buffer, we need to add a weak acid and its conjugate base to a solution. Acetic acid is a weak acid, so we need to add its conjugate base. Among the options, the only one that mentions sodium acetate, which is the conjugate base of acetic acid, is option c. sodium acetate only. Therefore, the correct answer is c. sodium acetate only.

In summary:
Part 1: The correct answer is c. All of these are true.
Part 2: The solution with the greatest buffering capacity is option b. 0.543 M NH3 and 0.555 M NH4Cl.
Part 3: Sodium acetate should be added to a solution of acetic acid to prepare a buffer. The correct answer is c. sodium acetate only.

Learn more about buffering capacity at https://brainly.com/question/32474149

#SPJ11

The melting point is the temperature at which a substance turns from a solid to a liquid. It's crucial to learn the melting point of a substance for a variety of reasons, including the identification and purity of the substance. As a result, it is essential to obtain the melting point of the recrystallized product.

If a substance has a lower melting point than it should, it is possible that it is impure. The impurities present in a substance will lower the melting point. The purer the substance, the higher the melting point will be. The melting point of the recrystallized product is essential to determine the purity of the product. If the melting point is close to the expected value, the substance is most likely pure. If the melting point is low, it means that the substance is not pure and that impurities are present. If the melting point is high, it means that the substance is too pure, or in other words, it has no impurities.

Obtaining the melting point of the recrystallized product is beneficial to determine the purity of the substance. It is essential to take the melting point of the recrystallized product since the purer the substance, the higher the melting point will be. If the melting point is low, it means that the substance is not pure and that impurities are present. Therefore, melting point data provides information on the purity of the substance.

To know more about melting point visit

https://brainly.com/question/20551307

#SPJ11

The rate at which dihydrogen is being produced is 3.25 g/s.

Given data are: volume, V = 128 L/s

Pressure, P = 0.94 atm

Temperature, T = 207°C

= 207 + 273

= 480 K

From the given information, it is clear that the chemical engineer studying a new catalyst for the refo reaction finds that 128 litres per second of methane are consumed.

So, the rate of consumption of CH4 = 128 L/s

Now, the balanced chemical equation for the reaction between methane and steam is:

[tex]CH4 + H2O ⟶ CO + 3H2[/tex]

Molar mass of CH4 = 12 + 4 = 16 gm/mol

Let's write the ideal gas equation for the reaction

PV = nRT

n = number of moles of CH4R

= gas constant

= 0.0821 L atm/K mol

Molar mass of CH4 = 16 g/mol

1 atm pressure and 273 K temperature is considered as STP

1 mole of any gas at STP will occupy 22.4 L volume

PV = n

RTPV = (mass/molar mass)

RT Mass of CH4 in 128 L at 0.94 atm and 480 K temperature can be calculated as,

128 x 0.94 = (mass/16) x 0.0821 x 480

Mass of CH4 = 4.73 g

Therefore, the number of moles of CH4

n = (mass/molar mass)

n = (4.73 g)/(16 g/mol)

n = 0.2956 mol

Moles of dihydrogen produced in the reaction, n(H2) = 3 × 0.2956

= 0.8868 mol

From ideal gas equation, PV = nRT

Number of moles of dihydrogen, n(H2) = PV/RT

Volume of hydrogen = V(H2)

= n(H2)RT/PV(H2)

= 0.8868 * 0.0821 * 480 / 0.94

= 36.52 L/s

Molar mass of dihydrogen, H2 = 2 g/mol

Density of H2 gas at STP, D = 0.089 g/L

Mass of H2 produced in 36.52 L/s can be calculated as

Mass = volume * density

= 36.52 L/s * 0.089 g/L

= 3.25 g/s

Hence, the answer is 3.25.

To know more about the dihydrogen, visit:

https://brainly.com/question/30903187

#SPJ11

Infrared spectra are compound-specific and vary based on functional groups. Important peaks in IR spectra include O-H/N-H stretching (3400-2500 cm⁻¹) and C-S stretching (1050-1000 cm⁻¹) for DMSO. CuDMSO and RuDMSO have characteristic peaks related to their complexes. Literature sources like Aldrich FT-IR Spectral Library provide detailed IR peak information.

The important peaks in the infrared (IR) spectra of CuDMSO, DMSO, and RuDMSO, as well as general literature values for common IR peaks.

Infrared spectra are unique for each compound and can vary depending on the specific molecule and its functional groups. Here are some general guidelines for the important peaks in IR spectra:

CuDMSO: The IR spectrum of CuDMSO may show characteristic peaks related to the copper complex and the DMSO ligand. The exact positions of the peaks will depend on the specific coordination environment and bonding interactions.

DMSO (Dimethyl sulfoxide): Common peaks in the IR spectrum of DMSO include a broad peak around 3400-2500 cm⁻¹, which corresponds to the stretching vibrations of O-H and N-H bonds. Another important peak is around 1050-1000 cm⁻¹, which corresponds to the C-S bond stretching vibration.

RuDMSO: Similarly, the IR spectrum of RuDMSO will have characteristic peaks related to the ruthenium complex and DMSO ligand. The specific positions of the peaks will depend on the nature of the coordination and bonding interactions.

Literature values for IR peaks: There are numerous literature sources that provide IR spectral data for various compounds. These references often include tables or databases containing peak positions and assignments for functional groups and specific compounds. Some commonly used references for IR spectra include the Aldrich FT-IR Spectral Library, SDBS (Spectral Database for Organic Compounds), and NIST Chemistry WebBook.

To know more about Infrared spectra refer here :    

https://brainly.com/question/33334268#

#SPJ11                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                      

The hybridization for the [F]^- ion is sp^3.

In the [F]^- ion, the fluorine atom has gained an extra electron, resulting in a negatively charged ion. To determine the hybridization, we look at the electron configuration around the central atom, which is fluorine in this case.

Fluorine has the electron configuration 1s^2 2s^2 2p^5. Since the [F]^- ion has gained one electron, the new electron configuration becomes 1s^2 2s^2 2p^6.

To determine the hybridization, we count the number of electron groups around the central atom. In the case of the [F]^- ion, there is one electron group, consisting of the lone pair of electrons on fluorine. The lone pair occupies one orbital.

Since there is only one electron group, the hybridization is sp^3, which means that the lone pair is located in an sp^3 hybrid orbital.

Learn more about hybridization

brainly.com/question/32752412

#SPJ11

The total volume of the solution is 591.67 mL.

Given values, Mass percentage (m/v) = 5.50%Volume = 225mLNow, we can use the formula given as:m = (mass percentage / 100) × Vwhere,m = Mass in gramsV = Volume in milliliters

We get,m = (5.50 / 100) × 225= 12.375So, 12.375 g of glucose is present in 225 mL of a 5.50% (m/v) glucose solution.

The second question can be answered as follows:

Given values,Volume = 1.44 L = 1440 mL (converting to mL) Volume of Methyl alcohol = 18.5% (v/v)

Now, we can use the formula given as:V1C1 = V2C2where,V1 = Volume of solutionC1 = Concentration of solution (methyl alcohol) before dilutionV2 = Volume of methyl alcoholC2 = Concentration of methyl alcohol

We get,V2 = V1 × (C1 / C2)= 1440 × (18.5 / 100)= 266.4So, the volume of methyl alcohol present is 266.4 mL.

The third question can be answered as follows:Given values,Mass percentage (m/v) = 6.00%Mass of NaCl = 35.5 g

Now, we can use the formula given as:m = (mass percentage / 100) × Vwhere,m = Mass in gramsV = Volume in milliliters

We get,V = m / (mass percentage / 100)= 35.5 / (6.00 / 100)= 591.67

So, the total volume of the solution is 591.67 mL.

Learn more about total volume Here.

https://brainly.com/question/32634963

#SPJ11

Toluene is brominated faster during an electrophilic substitution reaction because it is more reactive towards the bromine water solution compared to nitrobenzene.

The reaction occurs as follows: Toluene reacts with bromine water in the presence of a catalyst such as iron (III) bromide to produce an intermediate, bromotoluene. Bromotoluene then reacts with bromine water to produce the final product, dibromotoluene. The electrophilic substitution reaction proceeds through the formation of a carbocation intermediate in the presence of a catalyst such as FeBr3.

The intermediate then undergoes attack by the electrophile, which in this case is bromine water, to produce the final product. Nitrobenzene, on the other hand, is less reactive towards electrophilic substitution reactions due to the presence of the nitro group which has an electron-withdrawing effect. This makes the carbocation intermediate less stable and hence less reactive toward the electrophile.

Therefore, nitrobenzene is brominated slower compared to toluene.

Learn more about "toluene" :

https://brainly.com/question/31235432

#SPJ11

A β-turn involving the amino acids APGA consists of a tight turn in the polypeptide chain, with two alanine residues forming hydrogen bonds. The diagram represents a simplified schematic of the β-turn structure.

A β-turn is a common secondary structure motif in proteins characterized by a tight turn of the polypeptide chain. One common type of β-turn is a Type I β-turn, which involves four amino acid residues arranged in a specific pattern.

In the case of a β-turn involving the amino acids APGA, the structure can be depicted as follows:

      H                H

      |                |

   N--C--C--N      N--C--C--N

  /           \    /           \

H             O  H             O

|             |  |             |

A -- P -- G -- A  A -- P -- G -- A

In the diagram, the amino acid residues A, P, G, and A are represented by their one-letter codes. The hydrogen bonds between the two alanine (A) residues are indicated by dashed lines, connecting the amide hydrogen (H) of the first alanine residue to the carbonyl oxygen (O) of the second alanine residue.

Note that the N and C represent the nitrogen and carbon atoms of the peptide backbone, respectively.

Please keep in mind that the representation above is a simplified schematic, and the actual β-turn structure may have additional interactions and geometric details.

To know more about polypeptide chain refer here :    

https://brainly.com/question/29793936#

#SPJ11                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                        

Taking into account definition of reaction stoichiometry, 4.14 grams of H₂O are formed when 42.19 of hydrobromic acid is mixed with 9.2 g of sodium hydroxide.

In first place, the balanced reaction is:

HBr + NaOH → NaBr + H₂O

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

The molar mass of the compounds is:

By reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

The limiting reagent is one that is consumed first in its entirety, determining the amount of product in the reaction.

To determine the limiting reagent, it is possible to use a simple rule of three as follows: if by stoichiometry 81 grams of HBr reacts with 40 grams of NaOH, 41.19 grams of HBr reacts with how much mass of NaOH?

mass of NaOH= (41.19 grams of HBr× 40 grams of NaOH)÷ 81 grams of HBr

mass of NaOH= 20.83 grams

But 20.83 grams of NaOH are not available, 9.2 grams are available. Since you have less mass than you need to react with 41.19 grams of HBr, NaOH will be the limiting reagent.

Taking into account the limiting reagent, the following rule of three can be applied: if by reaction stoichiometry 40 grams of NaOH form 18 grams of H₂O, 9.2 grams of NaOH form how much mass of H₂O?

mass of H₂O= (9.2 grams of NaOH×18 grams of H₂O)÷40 grams of NaOH

mass of H₂O= 4.14 grams

Finally, 4.14 grams of H₂O are formed.

Learn more about the reaction stoichiometry:

brainly.com/question/24741074

#SPJ4

Boiling point refers to the temperature at which a liquid turns into vapor, so the greater the boiling point, the more heat is required to turn the substance into a gas.

Here are the five substances in order of increasing boiling point:

1. Methane (CH4) - This is a colorless and odorless gas that is used as a fuel. Its boiling point is -161.6 degrees Celsius.

2. Ethanol (C2H5OH) - This is a colorless, volatile, and flammable liquid that is used as a solvent and fuel. Its boiling point is 78.4 degrees Celsius.

3. Water (H2O) - This is a transparent, odorless, tasteless liquid that is used in many applications, including agriculture, industry, and food preparation. Its boiling point is 100 degrees Celsius.

4. Propylene glycol (C3H8O2) - This is a colorless and odorless liquid that is used as a solvent and antifreeze. Its boiling point is 188.2 degrees Celsius.

5. Glycerin (C3H8O3) - This is a sweet-tasting, colorless, and odorless liquid that is used in many applications, including food, pharmaceuticals, and cosmetics. Its boiling point is 290 degrees Celsius.

To know more about boiling point visit:

https://brainly.com/question/28203474

#SPJ11

P₂Br₈, WS₂, and CH₄ are all molecular compounds, meaning that they are composed of discrete molecules held together by covalent bonds. KI is an ionic compound, meaning that it is composed of ions held together by electrostatic attractions. Therefore,

In general, molecular compounds are formed by sharing electrons between atoms, resulting in discrete molecules. Ionic compounds are formed by the transfer of electrons from one atom to another, resulting in the formation of ions that are held together by electrostatic attractions.

P₂Br₈ and WS₂ are both molecular compounds as they consist of covalent bonds between the atoms within the molecules.

KI is an ionic compound as it is composed of the cation K⁺ and the anion I⁻, which are held together by ionic bonds.

CH₄ is a molecular compound as it consists of covalent bonds between carbon (C) and hydrogen (H) atoms within the molecule.

To know more about electrostatic attractions refer here :    

https://brainly.com/question/19609253#

#SPJ11                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                        

The given monosaccharide can be classified as a ketopentose.

Let's understand how the given monosaccharide can be classified:

It is given that Monosaccharides are classified by the number of carbons it contains and the presence of an aldehyde or ketone. A monosaccharide can contain either an aldehyde functional group or a ketone functional group. The presence of an aldehyde group classifies a monosaccharide as an aldose, whereas the presence of a ketone group classifies it as a ketose. Here, the given monosaccharide does not contain an aldehyde functional group but it contains a ketone functional group. So, it can be classified as a ketose. Also, it contains 5 carbons. Therefore, it is a ketopentose. Therefore, the given monosaccharide can be classified as a ketopentose.

#SPJ11

Learn more about Ketopentose at https://brainly.com/question/23849260

Van der Waals gas and Ideal gas both have unique properties that make them different from each other. Van der Waals gas is a type of real gas while Ideal gas is a type of imaginary gas. They are both governed by different laws, and as a result, they possess different characteristics and properties. In terms of work for compression, a Van der Waals gas requires more work than an Ideal gas.

Here’s why:

Van der Waals gas is a real gas and behaves like a mixture of Ideal gas particles and intermolecular forces that exist between the particles. It consists of particles that occupy a finite volume and attract each other, resulting in an increased pressure that reduces the volume of the gas. As the pressure increases, the particles get closer and closer together, leading to greater intermolecular attractions and resulting in an increase in work for compression.

On the other hand, Ideal gas is an imaginary gas that does not interact with other gas particles or have any intermolecular forces. It only follows the Ideal gas law, which states that pressure, volume, and temperature are directly proportional to each other. Therefore, an Ideal gas requires less work for compression than a Van der Waals gas since Ideal gas particles do not interact with each other.

In conclusion, a Van der Waals gas requires more work for compression than an Ideal gas due to the intermolecular attractions between the gas particles. This results in a higher pressure that reduces the volume of the gas and thus requires more work to compress.

To know more about Van der Waals gas visit:

https://brainly.com/question/29614762

#SPJ11

The strength of the attractive force holding ions in place is directly related to the lattice energy.

Lattice energy refers to the energy released when gaseous ions come together to form a solid ionic compound. It is a measure of the strength of the attractive forces between the ions in the crystal lattice. The lattice energy is influenced by two main factors: the charges of the ions and the distance between them.

The strength of the attractive force holding ions in place is directly proportional to the lattice energy. When ions with opposite charges come together, they form strong electrostatic attractions between them. These attractions, known as ionic bonds, hold the ions in a fixed position within the crystal lattice. The greater the magnitude of the charges on the ions, the stronger the attractive force between them, resulting in higher lattice energy.

Furthermore, the distance between the ions also plays a crucial role in determining the strength of the attractive force. As the distance between ions decreases, the electrostatic attractions between them intensify, leading to an increase in lattice energy. This is because the closer the ions are, the stronger the electrostatic forces of attraction they experience.

In summary, the relationship between lattice energy and the strength of the attractive force holding ions in place is direct. Higher lattice energy corresponds to stronger attractive forces, which in turn result from larger ion charges and shorter distances between the ions.

Learn more about Force

brainly.com/question/30507236

#SPJ11

Copper atoms gain and lose electrons.

Copper atoms gain and lose electrons, which are subatomic particles, when they are oxidized or reduced. Copper is a metal that belongs to the group of transition metals and has the chemical symbol Cu. The atomic number of copper is 29, and it has 29 protons and 29 electrons. Copper has two electrons in its valence shell, which is why it loses them to form Cu+. In addition, it can also gain one electron to form Cu-.When copper is oxidized, it loses one or more electrons, resulting in the formation of copper ions. In contrast, when copper is reduced, it gains one or more electrons, resulting in the formation of copper atoms. The gain and loss of electrons result in the formation of charged particles known as ions. Copper ions are positively charged because they have lost electrons, while copper atoms are neutral because they have an equal number of protons and electrons.

Learn more about Copper atoms

https://brainly.com/question/31604161

#SPJ11

The value of b in the equation [tex]\( f(t) = 85 \cdot b^t \)[/tex] represents the decay factor of the radioactive substance. To determine the value of \( b \), we can use the information that the half-life of the substance is 21 years.

The half-life of a radioactive substance is the time it takes for half of the substance to decay. In this case, the half-life is 21 years, which means that after 21 years, the amount of the substance remaining will be half of the initial amount.

We can use this information to set up an equation:

[tex]\(\frac{1}{2} = b^{21}\)[/tex]

To solve for b, we need to take the 21st root of both sides of the equation:

[tex]\(b = \left(\frac{1}{2}\right)^{\frac{1}{21}}\)[/tex]

Using a calculator, we can evaluate this expression:

[tex]\(b \approx 0.965\)[/tex]

Therefore, the value of b in the equation [tex]\( f(t) = 85 \cdot b^t \)[/tex] is approximately 0.965.

Learn more about radioactive from this link:

https://brainly.com/question/1770619

#SPJ11

Reggie did not add 24 grams of candy to the roof; his statement is incorrect.

According to Reggie, he added 24 grams of candy to the roof. However, we know that each candy has a mass of 3 grams. Therefore, to determine the actual amount of candy added, we can divide the total mass (24 grams) by the mass of each candy (3 grams).

24 grams ÷ 3 grams per candy = 8 candies

The calculation shows that Reggie actually added 8 candies to the roof, not 24 grams of candy. Reggie's statement of adding 24 grams is incorrect and does not align with the given information about the mass of each candy.

learn more about mass here

https://brainly.com/question/14651380

#SPJ11

To determine the average masses of the two molecules from the given data, we need to identify the mass corresponding to the most abundant ion in each isotopic distribution (the bolded value) and calculate the average mass based on those values. Let's calculate the average masses for Peak A and Peak B:

For Peak A:

For Peak B:

Calculating the values:

Therefore, the average masses of the two molecules based on the given data are approximately 1,093.522 and 1,225.286 for Peak A and Peak B, respectively.

Isotopic are atoms that have the same atomic number but different mass numbers. Isobars are atoms that have different atomic numbers but have the same mass number. Isotones are atoms that have different atomic numbers and mass numbers but have the same number of neutrons. Thus, an isotope is an element with the same atomic number and occupying the same place on the periodic table. In other words, isotopes have the same number of protons but a different number of neutrons. For example 2412Mg with 2512Mg and 2612Mg.

Learn More About isotopic at https://brainly.com/question/364529

#SPJ11

1. 0.162 M barium acetate requires 2.025 grams of solid.

2. 0.187 M magnesium nitrate solution: 82.35 mL for 15.4 grams.

3. 22.2 grams of potassium nitrate in 375 mL gives a molarity of 2.66 M.

1. Calculation for barium acetate:

Moles of barium acetate = Molarity × volume of solution (in liters)

Moles of barium acetate = 0.162 M × 0.125 L = 0.02025 moles

Grams of barium acetate = moles of barium acetate × molar mass

Grams of barium acetate = 0.02025 moles × 255.43 g/mol = 2.025 grams

2. Calculation for magnesium nitrate:

Volume of solution (in liters) = moles of solute / Molarity

Volume of solution (in liters) = 15.4 g / (0.187 mol/L) = 82.35 mL (converted to liters by dividing by 1000)

3. Calculation for potassium nitrate:

Molarity = moles of solute / volume of solution (in liters)

Molarity = 22.2 g / (375 mL / 1000) L = 2.66 M

learn more about molarity here:

https://brainly.com/question/8732513

#SPJ11

The empirical formula of a compound is the simplest whole number ratio of the atoms present in the compound. It is calculated by dividing the molecular formula by the greatest common factor of the number of atoms of each element.

A 47.8 mg sample of boron (B) reacts with oxygen (O) to form 154 mg of boron oxide. The mass of oxygen can be determined by subtracting the mass of boron from the mass of the compound:Mass of oxygen = Mass of boron oxide - Mass of boron= 154 mg - 47.8 mg= 106.2 mgNow, we need to determine the empirical formula of boron oxide.

To do this, we need to convert the masses to moles using the molar masses of boron and oxygen Boron: Molar mass = 10.81 g/mol 47.8 mg = 47.8 x 10^-3 g

To know more about empirical formula visit:

brainly.com/question/32125056

#SPJ11

The pH of the solution after adding 12.5 mL of 0.50 M HCl to 1 L of the buffer is 11.57.

To calculate the pH of the given buffer, we need to find the pKa of boric acid, as it will be used to calculate the pH of the buffer. Given, pKa of boric acid is 9.24. Now, let's calculate the pH of this buffer. To calculate the pH of the buffer, we use the following formula: pH = pKa + log([salt]/[acid])Where [salt] is the concentration of sodium borate and [acid] is the concentration of boric acid.

We are given the concentration of boric acid as 0.00721 mol/L and sodium borate as 0.0385 mol/L. Therefore,[acid] = 0.00721 mol/L[salt] = 0.0385 mol/LNow, we can substitute the values of pKa, [salt], and [acid] in the above formula:pH = 9.24 + log(0.0385/0.00721)pH = 9.24 + 0.855pH = 10.10Therefore, the pH of the given buffer is 10.10. Now, we can use this value to calculate the pH after 12.5 mL of 0.50 M HCl is added to 1 L of the buffer.

Given, the volume of the buffer is 1 L, and 12.5 mL of 0.50 M HCl is added to it, so the final volume of the solution is 1.0125 L. Now, let's calculate the moles of HCl added: moles of HCl = M × V moles of HCl = 0.50 M × 0.0125 L moles of HCl = 0.00625 mol Now, we can calculate the new concentration of boric acid and sodium borate: New [acid] = 0.00721 mol/L - 0.00625 mol/L New [salt] = 0.0385 mol/L Therefore, we can use the same formula as before to calculate the new pH: pH = 9.24 + log([salt]/[acid])pH = 9.24 + log(0.0385/0.00096)pH = 9.24 + 2.325pH = 11.57

To know more about substitute visit:

https://brainly.com/question/29383142

#SPJ11

The element with an electron notation that ends with 5s¹ is an unstable metal.

This is because an element with an electron notation that ends with 5s¹ means that the outermost electron of the element is in the 5s orbital. This is a characteristic of metals. Since the outermost electron is only one, the element would be unstable.

Metals have the ability to give away electrons. In order to form a chemical bond with another atom, the electrons must be given up. They have a tendency to give up electrons easily, which is why they are good conductors of heat and electricity. They are usually malleable, ductile and lustrous.

Examples of metals are iron, copper, gold, silver, and aluminum. They are found on the left side of the periodic table. The elements located in the left of the periodic table have electron configurations that end in s¹, s² or s²p¹.

Learn more about metals from the given link:

https://brainly.com/question/29404080

#SPJ11

The concentration of hydroxide ion required to just initiate precipitation is 0.0456 M.

To determine the concentration of hydroxide ion required to initiate precipitation, we need to consider the stoichiometry of the reaction between calcium nitrate and potassium hydroxide. The balanced chemical equation for the reaction is:

Ca(NO3)2 + 2KOH -> Ca(OH)2 + 2KNO3

From the equation, we can see that 1 mole of calcium nitrate reacts with 2 moles of potassium hydroxide to produce 1 mole of calcium hydroxide.

Given that the initial volume of the calcium nitrate solution is 125 ml, and its concentration is 0.0456 M, we can calculate the number of moles of calcium nitrate present in the solution using the formula:

moles = concentration x volume

      = 0.0456 M x 0.125 L

      = 0.0057 moles

Since the stoichiometry of the reaction tells us that 1 mole of calcium nitrate reacts with 2 moles of potassium hydroxide, we need twice the number of moles of calcium nitrate for complete precipitation of calcium hydroxide. Therefore, the moles of hydroxide ions required to initiate precipitation is:

moles of hydroxide ions = 2 x 0.0057 moles

                             = 0.0114 moles

Finally, we can calculate the concentration of hydroxide ions required by dividing the moles by the final volume. The final volume is not given in the question, but assuming it remains the same as the initial volume (125 ml or 0.125 L), we have:

concentration of hydroxide ions = moles of hydroxide ions / final volume

                                         = 0.0114 moles / 0.125 L

                                         = 0.0912 M

Therefore, the concentration of hydroxide ion required to just initiate precipitation is 0.0912 M.

Learn more about precipitation

brainly.com/question/11081618

#SPJ11

The number of mole of phosphorus that reacted, given that 45.2 mg of phosphorus reacts is 0.0015 mole

The number of mole of phosphorus that reacted can be obtained as illustrated below:

Mole of phosphorus that react = mass that reacted / molar mass

= 0.0452 / 31

= 0.0015 mole

Thus, we can conclude from the above calculation that the number of mole of phosphorus that reacted is 0.0015 mole

Learn more about mole:

https://brainly.com/question/13314627

#SPJ4

Complete question:

A 45.2-mg sample of phosphorus reacts with selenium to form 131. 6 mg of the selenide. What is the number of mole of phosphorus that reacted?

The mass of the antifreeze solution added to the glass container is 12.1 g.

To determine the mass of the antifreeze solution, we can subtract the initial weight of the glass container from the combined weight of the container and the antifreeze solution.

Weight of the glass container = 48.462 g

Combined weight of the container and the antifreeze solution = 60.562 g

Mass of the antifreeze solution = Combined weight - Weight of container

Mass of the antifreeze solution = 60.562 g - 48.462 g

Mass of the antifreeze solution = 12.1 g

To learn more about glass container

https://brainly.com/question/4679290

#SPJ11

H2O2 ⟶ H2O + O  Rate = k [H2O2]b) OH + NO2 + N2 ⟶ HNO3 + N2 Rate = k [OH] [NO2] [N2]c) HCO + O2 ⟶ HO2 + CO Rate = k [HCO] [O2]

Reaction molecularity, rate expression, and examples. A reaction's molecularity is the number of molecules involved in the reaction's elementary step. The rate equation is a representation of the reaction's rate in terms of the concentration of reactants.

The reaction rate is influenced by several variables, including concentration, temperature, and pressure. A mechanism is a set of reactions that explain how a reaction happens, and it includes elementary steps. The rate expression for the reaction mechanism is obtained by combining all of the elementary reactions' rate equations. The rate equation can help you figure out what influences the reaction rate.

To know more about molecularity visit:

https://brainly.com/question/32448966

#SPJ11

The major organic product expected from the reaction with KOtBu is the elimination product (alkene).

When a strong base like KOtBu (potassium tert-butoxide) is used, it favors elimination reactions. In this case, the most likely outcome is the elimination of a proton from a beta carbon and the departure of a leaving group, resulting in the formation of an alkene.

During the reaction, the tert-butoxide ion (OtBu-) acts as a strong base, abstracting a proton from a carbon adjacent to the leaving group. This creates a carbon-carbon double bond (alkene) and leaves the leaving group attached to the other carbon. The elimination reaction occurs through an E₂ mechanism, which involves the concerted elimination of the leaving group and a proton.

The selection of KOtBu as the base suggests that a strong, non-nucleophilic base is desired, which is suitable for E₂ eliminations. Other options may include E₁ reactions with a weak base or substitution reactions (SN₁ or SN₂) with a nucleophilic base. However, based on the information provided, the major product expected is the alkene resulting from an E₂ elimination.

Learn more about organic product

brainly.com/question/30328741

#SPJ11