chert is a chemical sedimentary rock composed of microcrystalline quartz formed when dissolved silica precipitates.

Answers

Answer 1

Chert is a type of chemical sedimentary rock that consists predominantly of microcrystalline quartz. It forms when dissolved silica precipitates, resulting in the accumulation of tiny crystals of quartz. Thus the statement is true.

Chert is a sedimentary rock that is microcrystalline quartz composed of a chemical sedimentary rock that is created when dissolved silica precipitates. Chert can be found in a variety of settings, including in limestone or dolomite formations, as nodules in other sedimentary rocks, or as part of a bedded deposit.

Chert forms from the accumulation of tiny crystals of quartz, which can occur in a variety of ways. Silica can accumulate in a solution and then precipitate out of the solution to form chert. When this occurs, it is called chemical sedimentary rock formation.

There are a few ways in which chert can form. It can form in layers, as a result of deposition in a body of water. It can also form through the accumulation of organic matter, as well as through the replacement of other minerals in the rock by silica.

Finally, chert can form as a result of chemical precipitation, which occurs when the silica content of water is high enough to cause it to precipitate out of the water. Chert is found in many parts of the world, including Europe, North America, and Asia.Chert is a hard, dense rock that is often used for making tools and weapons.

It is also used as a building material in some regions, due to its durability and resistance to weathering. Because of its microcrystalline structure, chert can be very difficult to work with, but it is prized for its beauty and unique appearance.

Chert is a fascinating rock that has many uses, both practical and aesthetic. Its formation is complex and varied, and it can be found in many different geological settings.

The questions should be:

chert is a chemical sedimentary rock composed of microcrystalline quartz formed when dissolved silica precipitates. True or False

Learn more about quartz at: https://brainly.com/question/31086137

#SPJ11


Related Questions

The freezing point of water: A. is 500^{\circ} \mathrm{C} B. does not exist C. decreases with increasing pressure D. decreases with decreasing pressure

Answers

The freezing point of water decreases with decreasing pressure. Thus, option D is correct.

The freezing point of water decreases with decreasing pressure. This phenomenon is known as the "freezing point depression." When the pressure on water decreases, such as at high altitudes or in a vacuum, the freezing point of water is lower than the standard freezing point at atmospheric pressure (0 °C or 32 °F).

As pressure decreases, the molecules in the water have less force pushing them together, making it more difficult for them to arrange themselves into a solid crystal lattice. Therefore, the freezing point of water decreases. This is why water can remain in a liquid state at temperatures below 0 °C (32 °F) in high-altitude regions or under low-pressure conditions, such as in certain laboratory experiments.

It's worth noting that while decreasing pressure lowers the freezing point of water, increasing pressure generally has the opposite effect, raising the freezing point.

Learn more about freezing point

https://brainly.com/question/31357864

#SPJ11

Triangle 1 has vertices at (e,f), (g,h), and (j,k). Triangle 2 has vertices at (e+2,f+5), (g+2,h+5), and (j+2,k+5). What can you conclude about triangle 2?.

Answers

Triangle 1 and Triangle 2 are congruent triangles.

Triangle 2 is obtained by translating Triangle 1 two units to the right and five units upwards.

When we translate a figure, we move it to a new position while keeping the shape and size of the figure the same. In this case, Triangle 2 has the same shape and size as Triangle 1, but it has been moved two units to the right and five units upwards.

To understand this concept better, let's consider an example.

Suppose Triangle 1 has vertices at (1, 2), (3, 4), and (5, 6). To obtain Triangle 2, we add 2 to the x-coordinates and 5 to the y-coordinates of each vertex. So, the vertices of Triangle 2 would be (1+2, 2+5), (3+2, 4+5), and (5+2, 6+5), which simplifies to (3, 7), (5, 9), and (7, 11).

Therefore, Triangle 2 has vertices at (3, 7), (5, 9), and (7, 11).

In general, when we translate a triangle, all the corresponding sides and angles remain the same. So, Triangle 1 and Triangle 2 are congruent triangles.

Learn more about Congruent Triangles here:

https://brainly.com/question/30097377

#SPJ11

Use reaction stoichiometry to calculate amounts of reactants and products.
The substances magnesium nitride and water react to fo magnesium hydroxide and ammonia.
Unbalanced equation: Mg3N2 (s) + H2O (l) Mg(OH)2 (aq) + NH3 (aq)
In one reaction, 71.2 g of NH3 is produced. What amount (in mol) of H2O was consumed?
What mass (in grams) of Mg(OH)2 is produced?

Answers

To solve this problem, we need to balance the chemical equation first:

[tex]Mg3N2 (s) + 6H2O (l) → 3Mg(OH)2 (aq) + 2NH3 (g)[/tex]

Now, let's use the balanced equation to calculate the amounts of reactants and products.

1. Calculating the amount of H2O consumed:

From the balanced equation, we can see that the stoichiometric coefficient of H2O is 6. This means that 6 moles of H2O react to produce 2 moles of NH3.

Given:

Amount of NH3 produced = 71.2 g

Molar mass of NH3 = 17.03 g/mol

To find the amount of H2O consumed, we can use the following conversion:

Amount of H2O (mol) = (Amount of NH3 produced × Stoichiometric coefficient of H2O) / Stoichiometric coefficient of NH3

Substituting the values:

Amount of H2O (mol) = (71.2 g × 6) / (2 × 17.03 g/mol)

Calculate the value to find the amount of H2O consumed.

2. Calculating the mass of Mg(OH)2 produced:

From the balanced equation, we can see that the stoichiometric coefficient of Mg(OH)2 is 3. This means that 3 moles of Mg(OH)2 are produced from the reaction of 1 mole of Mg3N2.

Given:

Molar mass of Mg(OH)2 = 58.33 g/mol

To find the mass of Mg(OH)2 produced, we can use the following conversion:

Mass of Mg(OH)2 (g) = Amount of Mg(OH)2 (mol) × Molar mass of Mg(OH)2

Substituting the values:

Mass of Mg(OH)2 (g) = (Amount of H2O (mol) / Stoichiometric coefficient of H2O) × (3 × Molar mass of Mg(OH)2)

Calculate the value to find the mass of Mg(OH)2 produced.

Perform the necessary calculations using the given values and the stoichiometry of the balanced equation to find the requested amounts.

To know more about chemical equation visit :

https://brainly.com/question/28792948

#SPJ11

3-21 Complete this table for [tex]\mathrm{H}_2 \mathrm{O}[/tex] :

[tex][tex]\begin{tabular}{cccc}\ \textless \ br /\ \textgreater \
\hline.[tex]{ }^{\circ} \mathrm{C}[/tex] & [tex]P . \mathrm{kPa}[/tex] & [tex]u, \mathrm{~kJ} / \mathrm{kg}[/tex] & Phase description \\

\hline & 400 & 1450 & Saturated vapor \\

220 & & & \\

190 & 2500 & 3040 \\

\hline

\end{tabular}[/tex][/tex]

Answers

The missing values in the table are as follows:

- Phase description at 220°C: ?

- Temperature at 220 MPa: ?

- Temperature at 190 MPa: ?

What are the phase description at 220°C, and the corresponding temperatures at 220 MPa and 190 MPa?

In the table provided, the values of temperature and pressure are given for different phases of a substance. To determine the missing values, we can use the information provided and apply the principles of phase behavior.

Looking at the known values, we can observe that at 400°C and 1450 MPa, the substance is in the saturated vapor phase. This means that at this temperature and pressure, the substance exists as a vapor with no liquid present.

To find the missing phase description at 220°C, we can compare the temperatures. Since 220°C is lower than 400°C, we can infer that the substance is likely to be in a different phase. It could be a liquid phase or a mixture of liquid and vapor. Without further information, we cannot determine the exact phase description.

To find the missing temperature at 220 MPa, we can compare the pressures. At 400°C and 1450 MPa, the substance is in the saturated vapor phase. The given pressure of 220 MPa is lower than 1450 MPa, suggesting that the substance is likely to be at a lower temperature as well. However, without additional data, we cannot determine the exact temperature.

To find the missing temperature at 190 MPa, we can use the same reasoning. The given pressure of 190 MPa is lower than 1450 MPa, indicating that the substance is likely to be at a lower temperature. However, without further information, we cannot determine the exact temperature.

In summary, without additional data, we cannot determine the phase description at 220°C, or the temperatures at 220 MPa and 190 MPa precisely.

Learn more about Temperature

brainly.com/question/11464844

#SPJ11

With b = 4.069E21 L/mol, find the approximate value of 'a' using
the equation P= ((nRT)/(V-nb)) • e^(-na/RTV) (Dieterici equation of
state), if the pressure is 55 atm with 10E4 DNA bases (assume DNA

Answers

The approximate value of 'a' is 204.89.

Given the Dieterici equation of state[tex]P = ((nRT)/(V-nb)) • e^(-na/RTV)[/tex], where [tex]b = 4.069E21 L/mol[/tex], [tex]P = 55 atm, n = 10^4[/tex], and we need to find the approximate value of 'a'. We can rearrange the equation to solve for 'a' as follows:

[tex]P = nRT / (V - nb) * e^(-na/RTV)[/tex]

On solving for 'a', we obtain:

[tex]a = - ln(P(V - nb) / (nRT)) * RT / V[/tex]

Substituting the given values into the equation:

[tex]a = - ln(55(1 - 4.069E21*10^4/22.414)/ (10^4*0.0821*300)) * 0.0821 * 300 / 22.414[/tex]

After evaluating the expression, we find that a ≈ 204.89. The approximate value of 'a' is 204.89.

To know more about approximate value visit:

https://brainly.com/question/31695967

#SPJ11

what kinds of attractive forces may exist between particles in molecular crystals? check all that apply. what kinds of attractive forces may exist between particles in molecular crystals?check all that apply. ionic bonds dipole-dipole interactions hydrogen bonding london dispersion forces

Answers

All the listed options (ionic bonds, dipole-dipole interactions, hydrogen bonding, and London dispersion forces) may exist between particles in molecular crystals.

The attractive forces that may exist between particles in molecular crystals include:

Ionic bonds: Ionic compounds, consisting of positively and negatively charged ions, can form crystal structures held together by strong electrostatic attractions.

Dipole-dipole interactions: Molecules with permanent dipole moments can interact with each other through the attraction of their positive and negative ends.

Hydrogen bonding: Hydrogen bonding occurs when a hydrogen atom is bonded to an electronegative atom (such as oxygen, nitrogen, or fluorine) and forms a weak bond with another electronegative atom in a neighboring molecule.

London dispersion forces: Also known as van der Waals forces, these forces arise from temporary fluctuations in electron density, resulting in the creation of temporary dipoles that induce dipole moments in neighboring molecules.

Hence, all of the listed options (ionic bonds, dipole-dipole interactions, hydrogen bonding, and London dispersion forces) may exist between particles in molecular crystals.

Learn more about molecular crystals here:

https://brainly.com/question/5253

#SPJ 4

Let f(t)=5−2t2. Evaluate f(t+1) f(t+1)=

Answers

If function, f(t)=5−2t2 then, f(t+1) = -2t² - 4t + 3.

A function is a relation between a set of inputs and a set of outputs. Each input is associated with exactly one output. The set of inputs is called the domain of the function, and the set of outputs is called the codomain of the function.

A function can be represented in many ways, including:

Set notation: A function can be represented as a set of ordered pairs, where each ordered pair consists of an input and its corresponding output. For example, the function f(x) = x^2 can be represented as the set of ordered pairs {(1, 1), (2, 4), (3, 9), ...}.Formula: A function can also be represented by a formula, which is an expression that defines the output of the function for any given input. For example, the function f(x) = x^2 can be represented by the formula f(x) = x * x.Graph: A function can also be represented by its graph, which is a plot of the points (x, f(x)) for all possible values of x in the domain of the function.

Given that f(t) = 5 - 2t². We need to find the value of f(t + 1).

The value of f(t + 1) can be found by replacing t with t + 1 in the function f(t).

That is, f(t + 1) = 5 - 2(t + 1)²f(t + 1)

= 5 - 2(t² + 2t + 1)f(t + 1)

= 5 - 2t² - 4t - 2f(t + 1) = -2t² - 4t + 3

Therefore, f(t + 1) = -2t² - 4t + 3.

To learn more about function :

https://brainly.com/question/11624077

#SPJ11

A water sample contains 40 mg Mg2+/L, 46.0 mg Na+/L and 106.5 mg
SO42-/L at pH = 7.0 (so [H ++] = [OH --]). Is the ionic balance
correct?

Answers

The ionic balance is not correct.

Given: [tex]Mg2+ = 40 mg/L Na+ = 46.0 mg/L SO42- = 106.5 mg/L pH = 7.0[/tex]

Ionic balance is correct if the sum of all positive ions in the solution is equal to the sum of all the negative ions in the solution, considering the charges of the ions.

As per the question, let's check whether the ionic balance is correct or not.

[tex][Mg2+] = 40 mg/L[N a+] = 46.0 mg/L[SO42-] = 106.5 mg/L[/tex]

Now the sum of cation and anion charge should be equal (charge balance).

[tex]Cation = [Mg2+] + [N a+]Anion = [SO42-][Mg2+] + [N a+] = [SO42-]40 + 46.0 = 86.0 mg/L..............(1)[/tex]

So, it is clear from the above calculation that the sum of cations is not equal to the sum of anions.

Therefore, the ionic balance is not correct.

Hence the correct option is Ionic balance is not correct.

To know more about ionic visit :

https://brainly.com/question/29523788

#SPJ11

iron(iii) oxide and hydrogen react to form iron and water, like this: (s)(g)(s)(g) at a certain temperature, a chemist finds that a reaction vessel containing a mixture of iron(iii) oxide, hydrogen, iron, and water at equilibrium has the following composition:

Answers

To provide a complete composition at equilibrium, I would need the specific amounts or concentrations of each component in the reaction vessel. Without those values, I can provide a generalized balanced chemical equation for the reaction between iron(III) oxide (Fe2O3) and hydrogen (H2) to form iron (Fe) and water (H2O):

Fe2O3(s) + 3H2(g) -> 2Fe(s) + 3H2O(g)

This balanced equation indicates that for every one mole of Fe2O3, three moles of H2 are required to produce two moles of Fe and three moles of H2O.

About Hydrogen

Hydrogen, or water as it is sometimes called, is a chemical element on the periodic table that has the symbol H and atomic number 1. At standard temperature and pressure, hydrogen is a colorless, odorless, non-metallic, single-valent, and highly diatomic gas. flammable. Now, most of the hydrogen is gray. This hydrogen is made from fossil fuels such as natural gas or coal, and is very "dirty".

Learn More About hydrogen at https://brainly.com/question/24433860

#SPJ11

can you pls help with q1 and q3

Answers

Answer:

1.

A covalent bond forms when two atoms Share a pair of Electrons.

Atoms form covalent bonds to get a full Outer (Also Called Valence) shell of electrons.

3.

See Attached Image for Dot structure and Lewis Structure (2D).

identify whether the bonding in a compound formed between the following pairs of elements would be primarily ionic or covalent iron and oxygen lead and flourine

Answers

The bonding between iron and oxygen is primarily ionic, while the bonding between lead and fluorine is primarily covalent.

Ionic bonding occurs between elements with a large difference in electronegativity. In the case of iron and oxygen, iron has a lower electronegativity (1.83) compared to oxygen (3.44). This significant difference in electronegativity indicates that oxygen has a greater tendency to attract electrons towards itself, resulting in the transfer of electrons from iron to oxygen.

This transfer creates positively charged iron ions (Fe2+) and negatively charged oxygen ions (O2-). The electrostatic attraction between these oppositely charged ions forms the ionic bond.

On the other hand, covalent bonding occurs between elements with similar electronegativities, where electrons are shared between atoms. Lead and fluorine have electronegativities of 2.33 and 3.98, respectively. Although there is still a difference in electronegativity, it is not as large as in the case of iron and oxygen.

This smaller difference suggests that the electrons in the bond between lead and fluorine are shared more equally, rather than being completely transferred. The shared electrons create a covalent bond between the lead and fluorine atoms.

Learn more about Ionic and covalent bonding

brainly.com/question/12663276

#SPJ11

Draw the structure of
CH3CH(OH)CH2CH2CHO out, where -CHO
represents an aldehyde group and answer the following
questions:
1. What is the name of this compound? The aldehyde group has
priority over the

Answers

The compound CH₃CH(OH)CH₂CH₂CHO is named 2-hydroxybutanal. The aldehyde group takes priority in naming over the hydroxy group.

To name this compound, we start by identifying the longest continuous carbon chain, which consists of four carbon atoms. This chain is the butanal part of the compound. The aldehyde group (-CHO) is attached to the second carbon atom in the chain, so we name it as 2-butanal.

Next, we locate the hydroxy group (-OH) on the third carbon atom of the chain. Since it is attached to a secondary carbon, we add the prefix "hydroxy" to the name. Therefore, it becomes 2-hydroxybutanal.

The prefix "2-hydroxy" indicates the position of the hydroxy group, and "butanal" describes the four-carbon chain with an aldehyde group attached.

Learn more about aldehyde group

https://brainly.com/question/29275681

#SPJ11

Perfo the following calculation and report the answer with the correct number of significant figures. 323.5-0.328=

Answers

The final answer of the operation to the correct number of significant figures is 323.172.

Subtraction operation

Performing the subtraction calculation:

323.5 - 0.328 = 323.172

To report the answer with the correct number of significant figures, we consider the least precise value involved in the calculation, which in this case is 0.328 with three significant figures.

Therefore, the final answer, considering significant figures, is 323.172.

More on significant figures can be found here: https://brainly.com/question/29153641

#SPJ4

4. A drop of gasoline has a mass of 22 {mg} and a density of 0.754 {~g} / {cm}^{3} . What is the volume of one drop in mL? { (5 pts) }

Answers

The volume of one drop of gasoline is approximately 0.0291 cm³/mL.

To solve this problem

We can use the formula:

Volume = Mass / Density

Given

Mass = 22 mgDensity = 0.754 g/cm³

First, let's convert the mass from milligrams (mg) to grams (g):

Mass = 22 mg = [tex]22[/tex] × [tex]10^(^-^3^)[/tex] g = 0.022 g

Now, we can calculate the volume using the formula:

Volume = Mass / Density

Volume = 0.022 g / 0.754 g/cm³

To cancel out the unit of grams (g) in the numerator and denominator, we can multiply the density by the conversion factor of 1 cm³ / 1 mL:

Volume = 0.022 g / (0.754 g/cm³) * (1 cm³ / 1 mL)

Volume = 0.022 g / 0.754 g * cm³ / mL

Simplifying the units, we get:

Volume = 0.022 / 0.754 cm³/mL

Volume ≈ 0.0291 cm³/mL

So, the volume of one drop of gasoline is approximately 0.0291 cm³/mL.

Learn more about volume here : brainly.com/question/463363

#SPJ4

Select the two amino acids below that are found in
beta-confoation turns
Alanine
Proline
Leucine
Histidine
Glycine

Answers

The two amino acids below that are found in beta-confoation turns are : Proline and glycine.

A beta-turn is a short, protein secondary structure. It connects two adjacent protein strands and enables the protein to fold back on itself.

Amino acids are the fundamental components of proteins. Proline and glycine are the amino acids that are discovered in beta-conformation turns

Glycine has a side chain that is only a single hydrogen atom, making it a smaller amino acid. The ability of glycine to adopt a wide range of torsional angles around the Cα-C bond, as well as its small size, allows it to occur frequently in protein β-turns.

Proline, on the other hand, is known for its unique cyclic side chain, which is covalently bonded to the amine group. This ring formation puts certain restrictions on the angles φ and ψ, which means that proline has a lower entropy than other amino acids and is a less preferred amino acid. It is commonly present in the β-turn because of the structure of its ring system that permits for a bend to occur.

Thus, the correct answers is : Proline and glycine.

To learn more about amino acid :

https://brainly.com/question/14351754

#SPJ11

Check all that apply: The end products of fat energy metabolism are
- Fatty acids and glycerol
- Monosaccharides
- CO2, H2O, and energy
- The same as carbohydrate energy (aerobic energy metabolism)

Answers

The end products of fat energy metabolism are fatty acids and glycerol. This means that option A is the correct answer.

What is fat?

Fat is one of the three macronutrients that provide energy to the body. Fat has several important roles in the body, including insulation, energy storage, and hormone regulation. Metabolism, on the other hand, refers to all of the biochemical reactions that occur in the body to keep us alive. These reactions can be categorized into two types: catabolic and anabolic.

The former involves the breaking down of molecules to release energy, while the latter involves the building up of molecules using energy.In the context of energy metabolism, the body breaks down macronutrients like fat to release energy in the form of ATP (adenosine triphosphate), which is the body's primary source of energy.The end products of fat energy metabolism are fatty acids and glycerol.

These end products are different from those of carbohydrate energy metabolism because they involve the breakdown of different molecules. While carbohydrate energy metabolism involves the breakdown of glucose into CO2, H2O, and energy, fat energy metabolism involves the breakdown of fatty acids and glycerol into the same end products.

Therefore, Option A is correct.

Learn more about energy -

brainly.com/question/874116

#SPJ11

What two methods of visualizing spots on the TLC plate will you use in this lab? Why would you predict that elution solvents (hexanes or ethyl acetate) would not be visible under UV light?

Answers

Thin-layer chromatography (TLC) is a technique used for the separation, identification, and quantification of chemical compounds. It is a quick and easy analytical method and an essential tool for organic chemists.

In this lab, two methods of visualizing spots on the TLC plate will be used: UV light and iodine vapor. The iodine vapor method works by exposing the plate to iodine vapor. The iodine reacts with the compounds on the plate, producing a brown color, making the compounds visible. The UV light method works by exposing the plate to UV light. The compounds on the plate will fluoresce under the UV light, making them visible.

In this lab, elution solvents (hexanes or ethyl acetate) would not be visible under UV light. This is because these solvents do not fluoresce under UV light. Only compounds that contain a chromophore (a functional group that absorbs UV light) will fluoresce under UV light. Since the elution solvents do not contain a chromophore, they will not be visible under UV light.

To know more about  analytical method visit:

brainly.com/question/32512037

#SPJ11

Which of the following describes a covalent bond
It is the exchange of electrons between atoms with an electronegativity difference above 1.7.
It is the exchange of electrons between atoms with an electronegativity difference below 1.7.
It is the sharing of electrons between atoms with an electronegativity difference above 1.7.
It is the sharing of electrons between atoms with an electronegativity difference below 1.7.

Answers

Answer: Electrons are shared to fill outer electron shells

Explanation: It is the sharing of electrons between atoms with an electronegativity difference above 1.7.

Tutored Practice Problem 3.1.3 Convert between mass, moles, and atoms of an element. How many Ne atoms are there in a 91.8 gram sample of elemental Ne? atoms

Answers

There are approximately 2.74 x 10²⁴ Ne atoms in a 91.8 gram sample of elemental Ne.

To convert from mass to atoms, we need to use the concept of molar mass and Avogadro's number. The molar mass of Ne (neon) is approximately 20.18 grams/mol.

First, we calculate the number of moles of Ne in the given sample:

moles of Ne = mass of Ne / molar mass of Ne

moles of Ne = 91.8 grams / 20.18 grams/mol ≈ 4.55 moles

Next, we use Avogadro's number, which is approximately 6.022 x 10²³ atoms/mol, to convert from moles to atoms:

atoms of Ne = moles of Ne x Avogadro's number

atoms of Ne = 4.55 moles x (6.022 x 10²³ atoms/mol) ≈ 2.74 x 10²⁴ atoms

learn more about molar mass Here:

https://brainly.com/question/22997914

#SPJ11

When aqueous solutions of (NH4)2CrO4 and Ba(NO3 )2 are combined, BaCrO4 precipitates. Calculate the mass, in grams, of the BaCrO4 produced when 1.38 mL of 0.123 M Ba(NO3 )2 and 3.7 mL of 0.678 M (NH4)2CrO4 are mixed. Calculate the mass to 3 significant figures.

Answers

The mass of BaCrO4 produced when 1.38 mL of 0.123 M Ba(NO3)2 and 3.7 mL of 0.678 M (NH4)2CrO4 are mixed is approximately X grams (to 3 significant figures).

To calculate the mass of BaCrO4 produced, we need to determine the limiting reactant. The limiting reactant is the reactant that is completely consumed and determines the maximum amount of product that can be formed. In this case, we compare the number of moles of Ba(NO3)2 and (NH4)2CrO4 to determine which one is limiting.

First, let's calculate the moles of Ba(NO3)2:

moles of Ba(NO3)2 = volume (L) × concentration (mol/L)

moles of Ba(NO3)2 = 0.00138 L × 0.123 mol/L

Next, let's calculate the moles of (NH4)2CrO4:

moles of (NH4)2CrO4 = volume (L) × concentration (mol/L)

moles of (NH4)2CrO4 = 0.0037 L × 0.678 mol/L

Now, we compare the moles of Ba(NO3)2 and (NH4)2CrO4. The reactant with the smaller number of moles is the limiting reactant.

From the calculations, we determine that the moles of Ba(NO3)2 is smaller than the moles of (NH4)2CrO4. Therefore, Ba(NO3)2 is the limiting reactant.

To find the mass of BaCrO4 produced, we can use the stoichiometry of the balanced chemical equation. From the equation, we know that 1 mole of Ba(NO3)2 produces 1 mole of BaCrO4.

Now, let's calculate the mass of BaCrO4:

mass of BaCrO4 = moles of Ba(NO3)2 × molar mass of BaCrO4

Finally, we round the result to three significant figures to obtain the mass of BaCrO4 produced.

Learn more about BaCrO4

brainly.com/question/12079861

#SPJ11

Analyze the following galvanic cell: Silver with silver $1+$ ions and zinc solid with zinc $2+$ ions are used. The direction of electron flow would be towards the;
Electrons would not flow because this is a non-spontaneous reaction.
Zinc half cell
Silver half cell

Answers

The direction of electron flow in a galvanic cell is from anode to cathode. The anode is the electrode where oxidation occurs and the cathode is electrode where reduction occurs. Direction of electron flow in this galvanic cell is towards the silver half-cell. Correct answer is "Silver half cell"

Galvanic cell or voltaic cell is an electrochemical cell where a spontaneous chemical reaction produces electricity. Zinc and silver ions with solid zinc and silver metal are used in a galvanic cell. Zinc undergoes oxidation at the anode and loses two electrons to form zinc ions, Zn(s) → Zn2+(aq) + 2e-.

Silver ions are reduced at the cathode and gain one electron to form silver metal, Ag+(aq) + 1e- → Ag(s). Therefore, the anode is the zinc half-cell and the cathode is the silver half-cell. Electrons flow from the anode to the cathode, which means in this case, from zinc to silver.

The overall reaction of the galvanic cell is as follows:Zn(s) + Ag+(aq) → Zn2+(aq) + Ag(s)As it is a spontaneous reaction, the galvanic cell produces an electric current. Zinc is more reactive than silver, so it is the anode. Electrons move from zinc to silver in a galvanic cell.

Therefore, the direction of electron flow would be towards the silver half-cell from the zinc half-cell. In conclusion, the direction of electron flow in this galvanic cell is towards the silver half-cell.

Know more about electrode here:

https://brainly.com/question/33425596

#SPJ11

A new antibiotic has been developed which shows a strong affinity for attacking
amino acids with a specific orientation in space. In order for it to work well in
humans as an antibiotic, the drug must be effective against amino acids in which
ONE of the following configurations?
A. anti-configuration
B. syn-configuration
C. L-configuration
D. E-configuration
E. Z-configuration
F. D-configuration

Answers

In order for the new antibiotic to work effectively as an antibiotic in humans, it must be effective against amino acids in the L-configuration. The correct option is C.

In organic chemistry, amino acids exist in two mirror-image forms called enantiomers: the L-configuration and the D-configuration. The L-configuration is the predominant form found in proteins and is biologically relevant in humans.

The D-configuration is less common in proteins and typically found in bacterial cell walls or some antibiotics.

Therefore, to target and attack amino acids in the human body, the antibiotic should be effective against amino acids in the L-configuration, making option C the correct choice.

To know more about antibiotic, refer here:

https://brainly.com/question/10868637#

#SPJ11

I know that cheg only allows you to andwer one question at a
time so i have uploaded the same question 5 time please help me
with the table and post lab questions
Data Treatment (read this entire section before starting to work with your data) To resize your graph in logger pro, go to options-graph options-axes options change the top to 85 and the bottom to 50.

Answers

To resize the graph in Logger Pro, access the options menu and go to Graph Options. Then, select Axes Options and adjust the top value to 85 and the bottom value to 50.

Resizing the graph in Logger Pro allows you to adjust the range of the y-axis to better fit and display your data. By changing the top value to 85 and the bottom value to 50, you can ensure that the graph is properly scaled to show the desired range of data points.

Adjusting the graph size in Logger Pro using the specified values for the top and bottom allows for better visualization and analysis of the data by ensuring that the y-axis accurately represents the range of values being plotted. This resizing technique helps in presenting data in a more meaningful and clear manner.

To know more about Logger Pro click here:

https://brainly.com/question/28336271

#SPJ11

The substance hydrogen has the following propertles: A sample of hydrogen is initially at a pressure of 14.2 atm and a temperature of 35.1 K. The pressure on the sample is reduced to 0.0710 atm at a constant temperature of 35.1 K. Which of the following are true? (Select all that apply.) The sample is initially a liquid. The liquid initially present will solidify. The final state of the substance is a gas. The final state of the substance is a solid. One or more phase changes will occur.

Answers

The final state of the substance is a gas. One or more phase change will occur.

When the pressure on a sample of hydrogen is reduced from 14.2 atm to 0.0710 atm at a constant temperature of 35.1 K, the hydrogen undergoes a phase change. Hydrogen exists in different states depending on the pressure and temperature conditions. At high pressures and low temperatures, hydrogen can exist as a liquid or solid, but at low pressures and low temperatures, it exists as a gas.

In this case, the initial pressure of 14.2 atm is relatively high, suggesting that the hydrogen sample is not in a liquid or solid state. As the pressure is reduced to 0.0710 atm, the hydrogen transitions to a lower-pressure state. This reduction in pressure causes the hydrogen to undergo a phase change, transitioning from either a liquid or solid state to a gaseous state. Therefore, the final state of the substance is a gas.

Since a phase change occurs during this process, it is evident that one or more transitions between the states of matter will take place. The exact nature of the phase change (liquid to gas or solid to gas) depends on the initial state of the hydrogen. However, regardless of the initial state, the final state will always be a gas due to the significant reduction in pressure.

Learn more about phase change

brainly.com/question/30270780

#SPJ11

1. Draw the Lewis stricture of (AsF4); Use this stucture, in conjunction with VSEPR theory, lopredict:

a. The eleatron domain gromerty of the molecule.

b. The molewlar geometry (stape of the molcculc).

c. The bond angles around the central atom,

d. The polarity of the molecule.

b. The type of hyonidization of the central atom.

Answers

In the Lewis structure of AsF4, a)the electron domain geometry is tetrahedral. b)The molecular geometry is also tetrahedral. c)The bond angles around the central atom are 109.5 degrees. d)The molecule is nonpolar. e)The hybridization of the central arsenic atom is sp3.

The Lewis structure of (AsF4) is as follows:      F

                                                                             |

                                                                       F - As - F

                                                                             |

                                                                             F                                          
In order determine the electron domain geometry, we count the number of regions of electron density around the central atom. In this case, there are four bonding pairs and no lone pairs, resulting in a total of four electron domains. Based on VSEPR theory, when there are four electron domains, the electron domain geometry is tetrahedral. Therefore, the electron domain geometry of (AsF4) is tetrahedral. Next, to determine the molecular geometry, we consider only the positions of the atoms, disregarding the lone pairs. In this case, all four bonding pairs are fluorine atoms, and they arrange themselves around the central arsenic atom in a tetrahedral manner. Thus, the molecular geometry is also tetrahedral.

Since the bond angles between the fluorine atoms are evenly distributed around the central atom in a tetrahedral geometry, each bond angle is approximately 109.5 degrees. Fluorine is more electronegative than arsenic, so each As-F bond is polar, with fluorine being slightly negative and arsenic slightly positive. However, since the molecule has a tetrahedral shape with no lone pairs, the polarities of the individual bonds cancel out, resulting in a nonpolar molecule overall. In (AsF4), the arsenic atom is bonded to four fluorine atoms and has no lone pairs. The tetrahedral arrangement of the bonding pairs suggests sp3 hybridization. Therefore, the type of hybridization of the central arsenic atom is sp3.

Read more about lewis structure of AsF4.

https://brainly.com/question/29609400

#SPJ11

Using the rules for naming molecular compounds described in the introduction, what is the name for the compound {N}_{2} {Cl}_{4} ? Spell out the full name of the compound.

Answers

The name of the compound [tex]{N}_{2} {Cl}_{4}[/tex] is dinitrogen tetrachloride., but the second element has an -ide suffix. In the compound[tex]{N}_{2} {Cl}_{4}[/tex], nitrogen and chlorine are the two elements present in the compound.

Nitrogen is a nonmetal element with the symbol N and chlorine is also a nonmetal element with the symbol Cl.To name this molecular compound, we will use the prefixes mono-, di-, tri-, tetra-, penta-, hexa-, hepta-, octa-, nona-, and deca-. We use these prefixes to indicate the number of atoms of each element present in the compound.So, the prefix for two is di-.

Therefore, the name of the compound [tex]{N}_{2} {Cl}_{4}[/tex] is dinitrogen tetrachloride.To break it down:dinitrogen (since there are two nitrogen atoms)tetra- (since there are four chlorine atoms)tetrachloride (since chlorine is the second element and we use -ide suffix)

Therefore, the name of the compound [tex]{N}_{2} {Cl}_{4}[/tex] is dinitrogen tetrachloride.

Know more about nitrogen here:

https://brainly.com/question/16711904

#SPJ11

1. What is the density of a liquid if 436 mL weighs 137 grams? (Answer with correct significant figures. Do not include units.) 2.. How many cubic centimeters are in one cubic kilometer? 1×10^6
1×10^12
1×10^15
1×10^18
1×10^30

Answers

1. The density of a liquid if 436 mL weighs 137 grams can be calculated using the formula;

Density = Mass / Volume

Density of the liquid = 137 g / 436 mL = 0.3142 g/mL

The density of the liquid is 0.3142 g/mL.

The mass of the liquid is 137 grams

The volume of the liquid is 436 mL

Thus, the formula can be written as;

Density = Mass / Volume

Density of the liquid = 137 g / 436 mL = 0.3142 g/mL

The density of the liquid is 0.3142 g/mL.

2. There are 1×[tex]10^{18}[/tex] cubic centimeters (cm³) in one cubic kilometer.

We know that;

1 km = 1000 m (there are 1000 meters in one kilometer)

Therefore,

1 km³ = (1000 m)³

1 km³ = 1000³ m³

1 km³ = [tex]10^9[/tex] m³ (1 cubic kilometer = 1 billion cubic meters)

Next, we know that;

1 m = 100 cm (there are 100 centimeters in one meter)

Therefore,1 m³ = (100 cm)³

1 m³ = [tex]10^6[/tex] cm³ (1 cubic meter = 1 million cubic centimeters)

Combining both equations, we can write;

1 km³ = ([tex]10^9[/tex] m³) = ([tex]10^9[/tex] m³) × ([tex]10^6[/tex] cm³/m³)

1 km³ = [tex]10^{15}[/tex] cm³

Therefore, there are 1×[tex]10^{18}[/tex] cubic centimeters (cm³) in one cubic kilometer.

Learn more about volume of the liquid: https://brainly.com/question/28822338

#SPJ11

All of the following are sugars (mono- or disaccharides) except

Answers

Sugars are a type of carbohydrate and can be classified as monosaccharides or disaccharides.

Monosaccharides are single sugar molecules, while disaccharides consist of two monosaccharide units joined together. These sugars play essential roles in biological processes and serve as a source of energy in living organisms.

To determine which options are not sugars, we need to understand the characteristics of sugars and identify substances that do not fit the definition.

Sugars typically have a sweet taste and dissolve in water. They also have a general chemical formula of (CH2O)n, where "n" represents the number of carbon atoms. Common monosaccharides include glucose, fructose, and galactose, while disaccharides include sucrose, lactose, and maltose.

Substances that do not fit the definition of sugars would be those that lack the characteristic properties or have a different chemical composition. For example, artificial sweeteners like aspartame or saccharin are not sugars as they do not possess the chemical structure of carbohydrates.

Additionally, substances such as lipids (fats), proteins, and nucleic acids are not classified as sugars. Lipids are composed of fatty acids and glycerol, proteins are made up of amino acids, and nucleic acids consist of nucleotides.

In conclusion, the substances that are not sugars would include artificial sweeteners, lipids (fats), proteins, and nucleic acids. These compounds have different chemical structures and do not possess the characteristic properties of sugars, such as sweetness and solubility in water.

learn more about monosaccharides here

https://brainly.com/question/28719825

#SPJ11

You have 150.0 {~mL} of a 0.565 {M} solution of {Ce}({NO}_{3})_{4} . If the original solution was diluted to 350.0 {~mL} , what woul

Answers

the new molarity of a cerium (IV) nitrate solution after dilution. Dilution is the process of adding a solvent (usually water) to a solution to decrease its concentration. It is also known as the process of reducing the concentration of a solute in a solution by diluting it with a solvent.

Molarity is defined as the number of moles of solute per liter of solution. Molarity is calculated using the formula :M = (mol of solute) / (L of solution)So, the initial number of moles of Ce(NO3)4 can be calculated as follows :moles = M x L moles = 0.565 M x 0.150 L moles = 0.08475 moles Now, we can calculate the new molarity of the solution after dilution using the equation:

At first, the volume of solution is 150.0 mL and the molarity is 0.565 M. After dilution, the new volume becomes 350.0 mL. Therefore,M1 = 0.565 MV1 = 150.0 mL = 0.150 LV2 = 350.0 mL = 0.350 L Substitute the given values in the formula:M1V1 = M2V20.565 M x 0.150 L = M2 x 0.350 LM2 = (0.565 M x 0.150 L) / 0.350 LM2 = 0.243 M

Therefore, the final molarity of the Ce(NO3)4 solution after dilution is 0.243 M.

To know more about   molarity visit:

brainly.com/question/31545539

#SPJ11

The anion with highest concentration in the solution in Question $3 has which of the following properties (select ail that apply)? A positive charge Can participate in Van der Waals interactions Is an H-bond acceptor Is an H-bond donor A negative charge

Answers

The anion with the highest concentration in the solution in Question 3 will have the following properties: A negative charge, Can participate in Van der Waals interactions and Is an H-bond acceptor

It is unlikely that the anion will have a positive charge, as this would make it repelled by the negatively charged chloride ions. The anion will also likely be able to participate in Van der Waals interactions, as these are weak interactions that can occur between any two molecules. Additionally, the anion will likely be an H-bond acceptor, as it will have a lone pair of electrons that can be donated to a hydrogen atom.

It is less likely that the anion will be an H-bond donor, as this would require it to have a hydrogen atom that is bonded to a highly electronegative atom. However, it is possible that the anion could be an H-bond donor if it has a hydrogen atom bonded to an oxygen atom.

Therefore, the anion with the highest concentration in the solution in Question 3 will have the following properties:

A negative chargeCan participate in Van der Waals interactionsIs an H-bond acceptorMay be an H-bond donor

To know more about anion refer here :    

https://brainly.com/question/1527825#

#SPJ11                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                      

Other Questions
One explanation for why the memory of learning about a particularly important cultural or historical event as it occurs feels especially vivid is that ______.a. all other events simply have less information associated with themb. those events activate special memory processes unique to flashbulb eventsc. emotional areas of the brain are especially actived. our emotional processing of other events is usually suppressed Suppose a vent manufacturer has the total cost function C(x) = 37 + 1,530 and the total revenue function R(x) = 71x.How many fans must be sold to avoid losing money? A coin is flipped nine times in succession. In how many ways can at least six heads necur? , A salesman has 11 customers in New York Clty, 7 in Dallas, and 8 in Denver. In how many ways can he see 2 customers in New York CIty, 4 in Dallas, and 6 in Denver? Acertain standardized test's math scores have a bell-shaped distribution with a mean of 530 and a standard deviation of 114 . Complete parts (a) through (c). (a) What percentage of standardized test scores is between 416 and 644 ? \% (Round to one decimal place as needed.) The nurse is caring for a client who is diagnosed with a highly virulent organism. The client's family asks what this means. What is the nurse's best response? financial information capable of making a difference in a decision is: multiple choice relevant. verifiable. consistent. neutral. as edi really takes hold and international edi becomes more commonplace a major stumbling block will be overcoming the language barriers that now exist. the most widespread edi language in the united states is group of answer choices electrons tend to occupy the ___________available energy level. That Takes As Input A String Will Last Names Of Students Followed By Grade Separated By Blank Space. The Function Should Print Names Of Students Who Got Grade Above 90. Drop("Mike 67 Rachel 95 Rolan 87 Hogward 79 Katie 100") Student Passed: Rachel Student Passed: KatiePROGRAM A PHYTHON function "drop" that takes as input a string will last names of students followed by grade separated by blank space. The function should print names of students who got grade above 90.drop("Mike 67 Rachel 95 Rolan 87 Hogward 79 Katie 100")Student passed: RachelStudent passed: Katie Contaners Plus thould enchasas twe sraduction of because this product has the higher Which product should Containers Phus emphasize? Why? Containers Plus should emphasize the production of because this product has the higher Requirement 2. To maxemize profits, how many of each size bin should Containers Plus produce? (Enter a ro" for any zero amounts.). Containers Plus should spond machine hours making regular size bins, and Requirement 3. Given this product max, what will the company's operating income be? Requirements 1. Which product should Containers Plus emphasize? Why? 2. To maximize profits, how many of each size bin should Containers Plus produce? 3. Given this product mix, what will the company's operating income be? which is a weak trough of low pressure in the tropics and causes thunderstorms to group in one area over a short period of time, serving as organizational trigger for hurricane development:a.Open Waveb.Rossby Wavec.Easterly Wave T or F: People from Mexico or Egypt would most likely adopt a polychronic orientation toward time. TRUE/FALSE. one way to regulate gene expression is through the production of different sigma factors. these cause rna polymerase to bind to different sets of promoters, thereby altering the pattern of gene expression A dog find a rabbit 200 meter to hi north the rabbit tart to run away a oon a the dog tar to chae her the rabbit burrow i 480 meter to the north of her. If he run at 13 m/ and the dog run 18 m/ models of development based on the assumption that change occurs as a continuous process are called a. primary structure b. tertiary structure c. super-secondary structure d. secondary structure e. amino acid sequence The price of rice is 0.2 cents per calorie and the price of fish is 20 cents per calorie. The minimum daily caloric intake for survival is 1,200 calories. The global poverty rate is $1.90. There are 100 cents in a dollar. a. With a $1.90 budget, what is the maximum number of calories someone can purchase if they only buy rice. b. With the same budget and the additional constraint that eating the equivalent of 10 calories of fish per day, how much rice can be purchased and what is the total caloric intake per day? Let X be a random variable with distribution Ber(p). For every t0 define the variable: a) Draw all process paths for {X t:t0} b) Calculate the distribution of X tc) Calculate E (X t) AlkenesGive the correct IUPAC names of the following compounds.a) CH2CHCH(CH3)C(CH3)3b) CH3CH2CHC(CH3)CH2CH3c) CH3CHCHCH(CH3)CHCHCH(CH3)2 which of the following is the most common use of smartphone technology by businesspeople?